From 0469962c5e8b96831b382479cf8210ab756c7794 Mon Sep 17 00:00:00 2001 From: Tom Free <7283497+thfrei@users.noreply.github.com> Date: Thu, 25 Nov 2021 13:45:58 +0100 Subject: [PATCH 01/94] wip: canvas-note patch Conflicts: src/public/app/services/library_loader.js src/public/app/services/tree_context_menu.js src/public/app/widgets/note_actions.js src/services/consistency_checks.js src/services/utils.js --- src/public/app/services/library_loader.js | 12 +- src/public/app/services/tree_context_menu.js | 3 +- .../canvas-note-utils/EraserBrush.js | 128 +++++++ .../app/widgets/type_widgets/canvas_note.js | 356 ++++++++++++++++++ src/routes/api/notes.js | 2 + src/services/backend_script_api.js | 2 +- src/services/export/single.js | 2 +- src/services/notes.js | 4 +- src/services/utils.js | 4 +- 9 files changed, 505 insertions(+), 8 deletions(-) create mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/EraserBrush.js create mode 100644 src/public/app/widgets/type_widgets/canvas_note.js diff --git a/src/public/app/services/library_loader.js b/src/public/app/services/library_loader.js index b6f0dbc8e..b1b6d1911 100644 --- a/src/public/app/services/library_loader.js +++ b/src/public/app/services/library_loader.js @@ -56,6 +56,15 @@ const MERMAID = { js: [ "libraries/mermaid.min.js" ] } +const CANVAS_NOTE = { + js: [ + "libraries/canvas-note/fabric.4.0.0-beta.12.min.js", + ], + // css: [ + // "stylesheets/somestyle.css" + // ] +}; + async function requireLibrary(library) { if (library.css) { library.css.map(cssUrl => requireCss(cssUrl)); @@ -106,5 +115,6 @@ export default { KATEX, WHEEL_ZOOM, FORCE_GRAPH, - MERMAID + MERMAID, + CANVAS_NOTE } diff --git a/src/public/app/services/tree_context_menu.js b/src/public/app/services/tree_context_menu.js index f22de134b..c27266111 100644 --- a/src/public/app/services/tree_context_menu.js +++ b/src/public/app/services/tree_context_menu.js @@ -33,7 +33,8 @@ class TreeContextMenu { { title: "Note Map", command: command, type: "note-map", uiIcon: "map-alt" }, { title: "Render HTML note", command: command, type: "render", uiIcon: "extension" }, { title: "Book", command: command, type: "book", uiIcon: "book" }, - { title: "Mermaid diagram", command: command, type: "mermaid", uiIcon: "selection" } + { title: "Mermaid diagram", command: command, type: "mermaid", uiIcon: "selection" }, + { title: "Canvas Note", command: command, type: "canvas-note", uiIcon: "map-alt" }, ]; } diff --git a/src/public/app/widgets/type_widgets/canvas-note-utils/EraserBrush.js b/src/public/app/widgets/type_widgets/canvas-note-utils/EraserBrush.js new file mode 100644 index 000000000..1e966788f --- /dev/null +++ b/src/public/app/widgets/type_widgets/canvas-note-utils/EraserBrush.js @@ -0,0 +1,128 @@ +const EraserBrushFactory = (fabric) => { + + /** + * ErasedGroup, part of EraserBrush + * + * Made it so that the bound is calculated on the original only + * + * Note: Might not work with versions other than 3.1.0 / 4.0.0 since it uses some + * fabric.js overwriting + * + * Source: https://github.com/fabricjs/fabric.js/issues/1225#issuecomment-499620550 + */ + const ErasedGroup = fabric.util.createClass(fabric.Group, { + original: null, + erasedPath: null, + initialize: function (original, erasedPath, options, isAlreadyGrouped) { + this.original = original; + this.erasedPath = erasedPath; + this.callSuper('initialize', [this.original, this.erasedPath], options, isAlreadyGrouped); + }, + + _calcBounds: function (onlyWidthHeight) { + const aX = [], + aY = [], + props = ['tr', 'br', 'bl', 'tl'], + jLen = props.length, + ignoreZoom = true; + + let o = this.original; + o.setCoords(ignoreZoom); + for (let j = 0; j < jLen; j++) { + const prop = props[j]; + aX.push(o.oCoords[prop].x); + aY.push(o.oCoords[prop].y); + } + + this._getBounds(aX, aY, onlyWidthHeight); + }, + }); + + /** + * EraserBrush, part of EraserBrush + * + * Made it so that the path will be 'merged' with other objects + * into a customized group and has a 'destination-out' composition + * + * Note: Might not work with versions other than 3.1.0 / 4.0.0 since it uses some + * fabric.js overwriting + * + * Source: https://github.com/fabricjs/fabric.js/issues/1225#issuecomment-499620550 + */ + const EraserBrush = fabric.util.createClass(fabric.PencilBrush, { + + /** + * On mouseup after drawing the path on contextTop canvas + * we use the points captured to create an new fabric path object + * and add it to the fabric canvas. + */ + _finalizeAndAddPath: function () { + var ctx = this.canvas.contextTop; + ctx.closePath(); + if (this.decimate) { + this._points = this.decimatePoints(this._points, this.decimate); + } + var pathData = this.convertPointsToSVGPath(this._points).join(''); + if (pathData === 'M 0 0 Q 0 0 0 0 L 0 0') { + // do not create 0 width/height paths, as they are + // rendered inconsistently across browsers + // Firefox 4, for example, renders a dot, + // whereas Chrome 10 renders nothing + this.canvas.requestRenderAll(); + return; + } + + // use globalCompositeOperation to 'fake' eraser + var path = this.createPath(pathData); + path.globalCompositeOperation = 'destination-out'; + path.selectable = false; + path.evented = false; + path.absolutePositioned = true; + + // grab all the objects that intersects with the path + const objects = this.canvas.getObjects().filter((obj) => { + // if (obj instanceof fabric.Textbox) return false; + // if (obj instanceof fabric.IText) return false; + if (!obj.intersectsWithObject(path)) return false; + return true; + }); + + if (objects.length > 0) { + + // merge those objects into a group + const mergedGroup = new fabric.Group(objects); + + // This will perform the actual 'erasing' + // NOTE: you can do this for each object, instead of doing it with a merged group + // however, there will be a visible lag when there's many objects affected by this + const newPath = new ErasedGroup(mergedGroup, path); + + const left = newPath.left; + const top = newPath.top; + + // convert it into a dataURL, then back to a fabric image + const newData = newPath.toDataURL({ + withoutTransform: true + }); + fabric.Image.fromURL(newData, (fabricImage) => { + fabricImage.set({ + left: left, + top: top, + }); + + // remove the old objects then add the new image + this.canvas.remove(...objects); + this.canvas.add(fabricImage); + }); + } + + this.canvas.clearContext(this.canvas.contextTop); + this.canvas.renderAll(); + this._resetShadow(); + }, + }); + + return {EraserBrush, ErasedGroup}; +}; + +export default EraserBrushFactory; diff --git a/src/public/app/widgets/type_widgets/canvas_note.js b/src/public/app/widgets/type_widgets/canvas_note.js new file mode 100644 index 000000000..1d5cfe49b --- /dev/null +++ b/src/public/app/widgets/type_widgets/canvas_note.js @@ -0,0 +1,356 @@ +import libraryLoader from "../../services/library_loader.js"; +import TypeWidget from "./type_widget.js"; +import appContext from "../../services/app_context.js"; +import EraserBrushFactory from './canvas-note-utils/EraserBrush.js'; + + +const TPL = ` +
+ + +
+ +
+ + + 30
+ + +
+ + +
+ + + 0
+ + + 0
+
+
+ + + + + + + +
+
+ +
+
`; + +export default class CanvasNoteTypeWidget extends TypeWidget { + static getType() { + return "canvas-note"; + } + + doRender() { + this.$widget = $(TPL); + + libraryLoader + .requireLibrary(libraryLoader.CANVAS_NOTE) + .then(() => { + console.log("fabric.js-loaded") + this.initFabric(); + }); + + return this.$widget; + } + + async doRefresh(note) { + const noteComplement = await this.tabContext.getNoteComplement(); + if (this.__canvas && noteComplement.content) { + this.__canvas.loadFromJSON(noteComplement.content); + } + console.log('doRefresh', note, noteComplement); + } + + /** + * Function gets data that will be sent via spacedUpdate.scheduleUpdate(); + */ + getContent() { + const content = JSON.stringify(this.__canvas.toJSON()); + console.log('gC', content); + return content; + } + + saveData() { + this.spacedUpdate.scheduleUpdate(); + } + + initFabric() { + const self = this; + const canvas = this.__canvas = new fabric.Canvas('c', { + isDrawingMode: true + }); + fabric.Object.prototype.transparentCorners = false; + + canvas.on('after:render', () => { + self.saveData(); + }); + + window.addEventListener('resize', resizeCanvas, false); + + function resizeCanvas() { + const width = $('.note-detail-canvas-note').width(); + const height = $('.note-detail-canvas-note').height() + console.log(`setting canvas to ${width} x ${height}px`) + canvas.setWidth(width); + canvas.setHeight(height); + canvas.renderAll(); + } + + // resize on init + resizeCanvas(); + + const {EraserBrush} = EraserBrushFactory(fabric); + + var drawingModeEl = $('#drawing-mode'), + drawingOptionsEl = $('#drawing-mode-options'), + drawingColorEl = $('#drawing-color'), + drawingShadowColorEl = $('#drawing-shadow-color'), + drawingLineWidthEl = $('#drawing-line-width'), + drawingShadowWidth = $('#drawing-shadow-width'), + drawingShadowOffset = $('#drawing-shadow-offset'), + saveCanvas = $('#save-canvas'), + refreshCanvas = $('#refresh-canvas'), + clearEl = $('#clear-canvas'), + undo = $('#undo'), + redo = $('#redo') + ; + + const deletedItems = []; + + undo.on('click', function () { + // Source: https://stackoverflow.com/a/28666556 + var lastItemIndex = (canvas.getObjects().length - 1); + var item = canvas.item(lastItemIndex); + + deletedItems.push(item); + // if(item.get('type') === 'path') { + canvas.remove(item); + canvas.renderAll(); + // } + }) + + redo.on('click', function () { + const lastItem = deletedItems.pop(); + if (lastItem) { + canvas.add(lastItem); + canvas.renderAll(); + } + }) + + clearEl.on('click', function () { + console.log('cE-oC'); + canvas.clear() + }); + + saveCanvas.on('click', function () { + console.log('sC-oC'); + const canvasContent = canvas.toJSON(); + console.log('Canvas JSON', canvasContent); + self.saveData(); + }); + refreshCanvas.on('click', function () { + console.log('rC-oC'); + self.doRefresh('no note entity needed for refresh, only noteComplement'); + }); + drawingModeEl.on('click', function () { + canvas.isDrawingMode = !canvas.isDrawingMode; + if (canvas.isDrawingMode) { + drawingModeEl.html('Cancel drawing mode'); + drawingOptionsEl.css('display', ''); + } else { + drawingModeEl.html('Enter drawing mode'); + drawingOptionsEl.css('display', 'none'); + } + }); + // + // if (fabric.PatternBrush) { + // var vLinePatternBrush = new fabric.PatternBrush(canvas); + // vLinePatternBrush.getPatternSrc = function () { + // + // var patternCanvas = fabric.document.createElement('canvas'); + // patternCanvas.width = patternCanvas.height = 10; + // var ctx = patternCanvas.getContext('2d'); + // + // ctx.strokeStyle = this.color; + // ctx.lineWidth = 5; + // ctx.beginPath(); + // ctx.moveTo(0, 5); + // ctx.lineTo(10, 5); + // ctx.closePath(); + // ctx.stroke(); + // + // return patternCanvas; + // }; + // + // var hLinePatternBrush = new fabric.PatternBrush(canvas); + // hLinePatternBrush.getPatternSrc = function () { + // + // var patternCanvas = fabric.document.createElement('canvas'); + // patternCanvas.width = patternCanvas.height = 10; + // var ctx = patternCanvas.getContext('2d'); + // + // ctx.strokeStyle = this.color; + // ctx.lineWidth = 5; + // ctx.beginPath(); + // ctx.moveTo(5, 0); + // ctx.lineTo(5, 10); + // ctx.closePath(); + // ctx.stroke(); + // + // return patternCanvas; + // }; + // + // var squarePatternBrush = new fabric.PatternBrush(canvas); + // squarePatternBrush.getPatternSrc = function () { + // + // var squareWidth = 10, squareDistance = 2; + // + // var patternCanvas = fabric.document.createElement('canvas'); + // patternCanvas.width = patternCanvas.height = squareWidth + squareDistance; + // var ctx = patternCanvas.getContext('2d'); + // + // ctx.fillStyle = this.color; + // ctx.fillRect(0, 0, squareWidth, squareWidth); + // + // return patternCanvas; + // }; + // + // var diamondPatternBrush = new fabric.PatternBrush(canvas); + // diamondPatternBrush.getPatternSrc = function () { + // + // var squareWidth = 10, squareDistance = 5; + // var patternCanvas = fabric.document.createElement('canvas'); + // var rect = new fabric.Rect({ + // width: squareWidth, + // height: squareWidth, + // angle: 45, + // fill: this.color + // }); + // + // var canvasWidth = rect.getBoundingRect().width; + // + // patternCanvas.width = patternCanvas.height = canvasWidth + squareDistance; + // rect.set({left: canvasWidth / 2, top: canvasWidth / 2}); + // + // var ctx = patternCanvas.getContext('2d'); + // rect.render(ctx); + // + // return patternCanvas; + // }; + // + // // var img = new Image(); + // // img.src = './libraries/canvas-note/honey_im_subtle.png'; + // + // // var texturePatternBrush = new fabric.PatternBrush(canvas); + // // texturePatternBrush.source = img; + // } + + $('#drawing-mode-selector').change(function () { + if (false) { + } + // else if (this.value === 'hline') { + // canvas.freeDrawingBrush = vLinePatternBrush; + // } else if (this.value === 'vline') { + // canvas.freeDrawingBrush = hLinePatternBrush; + // } else if (this.value === 'square') { + // canvas.freeDrawingBrush = squarePatternBrush; + // } else if (this.value === 'diamond') { + // canvas.freeDrawingBrush = diamondPatternBrush; + // } + // else if (this.value === 'texture') { + // canvas.freeDrawingBrush = texturePatternBrush; + // } + else if (this.value === "Eraser") { + // to use it, just set the brush + const eraserBrush = new EraserBrush(canvas); + eraserBrush.width = parseInt(drawingLineWidthEl.val(), 10) || 1; + eraserBrush.color = 'rgb(236,195,195)'; // erser works with opacity! + canvas.freeDrawingBrush = eraserBrush; + canvas.isDrawingMode = true; + } else { + canvas.freeDrawingBrush = new fabric[this.value + 'Brush'](canvas); + canvas.freeDrawingBrush.color = drawingColorEl.val(); + canvas.freeDrawingBrush.width = parseInt(drawingLineWidthEl.val(), 10) || 1; + canvas.freeDrawingBrush.shadow = new fabric.Shadow({ + blur: parseInt(drawingShadowWidth.val(), 10) || 0, + offsetX: 0, + offsetY: 0, + affectStroke: true, + color: drawingShadowColorEl.val(), + }); + } + + + }); + + drawingColorEl.change(function () { + canvas.freeDrawingBrush.color = this.value; + }); + drawingShadowColorEl.change(function () { + canvas.freeDrawingBrush.shadow.color = this.value; + }) + drawingLineWidthEl.change(function () { + canvas.freeDrawingBrush.width = parseInt(this.value, 10) || 1; + drawingLineWidthEl.prev().html(this.value); + }); + drawingShadowWidth.change(function () { + canvas.freeDrawingBrush.shadow.blur = parseInt(this.value, 10) || 0; + drawingShadowWidth.prev().html(this.value); + }); + drawingShadowOffset.change(function () { + canvas.freeDrawingBrush.shadow.offsetX = parseInt(this.value, 10) || 0; + canvas.freeDrawingBrush.shadow.offsetY = parseInt(this.value, 10) || 0; + drawingShadowOffset.prev().html(this.value); + }) + + if (canvas.freeDrawingBrush) { + canvas.freeDrawingBrush.color = drawingColorEl.value; + canvas.freeDrawingBrush.width = parseInt(drawingLineWidthEl.value, 10) || 1; + canvas.freeDrawingBrush.shadow = new fabric.Shadow({ + blur: parseInt(drawingShadowWidth.value, 10) || 0, + offsetX: 0, + offsetY: 0, + affectStroke: true, + color: drawingShadowColorEl.value, + }); + } + } +} + diff --git a/src/routes/api/notes.js b/src/routes/api/notes.js index f602189e2..29f0e3508 100644 --- a/src/routes/api/notes.js +++ b/src/routes/api/notes.js @@ -217,6 +217,8 @@ function changeTitle(req) { noteService.triggerNoteTitleChanged(note); } + console.log(note, await note.getContent()); + return note; } diff --git a/src/services/backend_script_api.js b/src/services/backend_script_api.js index 757c067bb..305a39c94 100644 --- a/src/services/backend_script_api.js +++ b/src/services/backend_script_api.js @@ -210,7 +210,7 @@ function BackendScriptApi(currentNote, apiParams) { * @property {string} parentNoteId - MANDATORY * @property {string} title - MANDATORY * @property {string|buffer} content - MANDATORY - * @property {string} type - text, code, file, image, search, book, relation-map - MANDATORY + * @property {string} type - text, code, file, image, search, book, relation-map, canvas-note - MANDATORY * @property {string} mime - value is derived from default mimes for type * @property {boolean} isProtected - default is false * @property {boolean} isExpanded - default is false diff --git a/src/services/export/single.js b/src/services/export/single.js index 2937b40d7..f7ab87dc4 100644 --- a/src/services/export/single.js +++ b/src/services/export/single.js @@ -41,7 +41,7 @@ function exportSingleNote(taskContext, branch, format, res) { extension = mimeTypes.extension(note.mime) || 'code'; mime = note.mime; } - else if (note.type === 'relation-map' || note.type === 'search') { + else if (note.type === 'relation-map' || note.type === 'canas-note' || note.type === 'search') { payload = content; extension = 'json'; mime = 'application/json'; diff --git a/src/services/notes.js b/src/services/notes.js index 5609e0582..4d62ae274 100644 --- a/src/services/notes.js +++ b/src/services/notes.js @@ -52,7 +52,7 @@ function deriveMime(type, mime) { mime = 'text/html'; } else if (type === 'code' || type === 'mermaid') { mime = 'text/plain'; - } else if (['relation-map', 'search'].includes(type)) { + } else if (['relation-map', 'search', 'canvas-note'].includes(type)) { mime = 'application/json'; } else if (['render', 'book'].includes(type)) { mime = ''; @@ -83,7 +83,7 @@ function copyChildAttributes(parentNote, childNote) { * - {string} parentNoteId * - {string} title * - {*} content - * - {string} type - text, code, file, image, search, book, relation-map, render + * - {string} type - text, code, file, image, search, book, relation-map, canvas-note, render * * Following are optional (have defaults) * - {string} mime - value is derived from default mimes for type diff --git a/src/services/utils.js b/src/services/utils.js index f4f31c69e..d50716381 100644 --- a/src/services/utils.js +++ b/src/services/utils.js @@ -168,7 +168,7 @@ const STRING_MIME_TYPES = [ function isStringNote(type, mime) { // render and book are string note in the sense that they are expected to contain empty string - return ["text", "code", "relation-map", "search", "render", "book", "mermaid"].includes(type) + return ["text", "code", "relation-map", "search", "render", "book", "mermaid", "canvas-note"].includes(type) || mime.startsWith('text/') || STRING_MIME_TYPES.includes(mime); } @@ -192,7 +192,7 @@ function formatDownloadTitle(filename, type, mime) { if (type === 'text') { return filename + '.html'; - } else if (['relation-map', 'search'].includes(type)) { + } else if (['relation-map', 'canvas-note', 'search'].includes(type)) { return filename + '.json'; } else { if (!mime) { From a894c19c2b6c7bbfd411c295e58cda4b3da60b46 Mon Sep 17 00:00:00 2001 From: Tom Free <7283497+thfrei@users.noreply.github.com> Date: Thu, 25 Nov 2021 13:47:56 +0100 Subject: [PATCH 02/94] add missing canvas-note entries in helper functions Conflicts: src/public/app/entities/note_short.js src/public/app/services/tree_context_menu.js --- src/public/app/entities/note_short.js | 3 ++- src/public/app/widgets/note_detail.js | 2 ++ src/public/app/widgets/note_type.js | 1 + src/routes/api/notes.js | 2 -- 4 files changed, 5 insertions(+), 3 deletions(-) diff --git a/src/public/app/entities/note_short.js b/src/public/app/entities/note_short.js index 836755566..e8bb1de42 100644 --- a/src/public/app/entities/note_short.js +++ b/src/public/app/entities/note_short.js @@ -16,7 +16,8 @@ const NOTE_TYPE_ICONS = { "relation-map": "bx bx-map-alt", "book": "bx bx-book", "note-map": "bx bx-map-alt", - "mermaid": "bx bx-selection" + "mermaid": "bx bx-selection", + "canvas-note": "bx bx-pen" }; /** diff --git a/src/public/app/widgets/note_detail.js b/src/public/app/widgets/note_detail.js index dea666515..be61f6bc3 100644 --- a/src/public/app/widgets/note_detail.js +++ b/src/public/app/widgets/note_detail.js @@ -10,6 +10,7 @@ import FileTypeWidget from "./type_widgets/file.js"; import ImageTypeWidget from "./type_widgets/image.js"; import RenderTypeWidget from "./type_widgets/render.js"; import RelationMapTypeWidget from "./type_widgets/relation_map.js"; +import CanvasNoteTypeWidget from "./type_widgets/canvas_note.js"; import ProtectedSessionTypeWidget from "./type_widgets/protected_session.js"; import BookTypeWidget from "./type_widgets/book.js"; import appContext from "../services/app_context.js"; @@ -50,6 +51,7 @@ const typeWidgetClasses = { 'search': NoneTypeWidget, 'render': RenderTypeWidget, 'relation-map': RelationMapTypeWidget, + 'canvas-note': CanvasNoteTypeWidget, 'protected-session': ProtectedSessionTypeWidget, 'book': BookTypeWidget, 'note-map': NoteMapTypeWidget diff --git a/src/public/app/widgets/note_type.js b/src/public/app/widgets/note_type.js index a81e446e3..111b96e6a 100644 --- a/src/public/app/widgets/note_type.js +++ b/src/public/app/widgets/note_type.js @@ -11,6 +11,7 @@ const NOTE_TYPES = [ { type: "text", mime: "text/html", title: "Text", selectable: true }, { type: "relation-map", mime: "application/json", title: "Relation Map", selectable: true }, { type: "render", mime: '', title: "Render Note", selectable: true }, + { type: "canvas-note", mime: 'application/json', title: "Canvas Note", selectable: true }, { type: "book", mime: '', title: "Book", selectable: true }, { type: "mermaid", mime: 'text/mermaid', title: "Mermaid Diagram", selectable: true }, { type: "code", mime: 'text/plain', title: "Code", selectable: true } diff --git a/src/routes/api/notes.js b/src/routes/api/notes.js index 29f0e3508..f602189e2 100644 --- a/src/routes/api/notes.js +++ b/src/routes/api/notes.js @@ -217,8 +217,6 @@ function changeTitle(req) { noteService.triggerNoteTitleChanged(note); } - console.log(note, await note.getContent()); - return note; } From 2f2d8327e4a38af5d4c2ad53811600a4e4264a42 Mon Sep 17 00:00:00 2001 From: thfrei <7283497+thfrei@users.noreply.github.com> Date: Sat, 7 Nov 2020 22:46:08 +0100 Subject: [PATCH 03/94] update libraries --- libraries/canvas-note/fabric.4.1.0.custom.js | 32279 +++++++++++++++++ libraries/canvas-note/hammer.2.0.8.min.js | 7 + libraries/canvas-note/jquery.hammer.js | 33 + src/public/app/services/library_loader.js | 4 +- 4 files changed, 32322 insertions(+), 1 deletion(-) create mode 100644 libraries/canvas-note/fabric.4.1.0.custom.js create mode 100644 libraries/canvas-note/hammer.2.0.8.min.js create mode 100644 libraries/canvas-note/jquery.hammer.js diff --git a/libraries/canvas-note/fabric.4.1.0.custom.js b/libraries/canvas-note/fabric.4.1.0.custom.js new file mode 100644 index 000000000..3599aa07e --- /dev/null +++ b/libraries/canvas-note/fabric.4.1.0.custom.js @@ -0,0 +1,32279 @@ +/*! Fabric.js Copyright 2008-2015, Printio (Juriy Zaytsev, Maxim Chernyak) */ + +var fabric = fabric || { version: '4.2.0' }; +if (typeof exports !== 'undefined') { + exports.fabric = fabric; +} +/* _AMD_START_ */ +else if (typeof define === 'function' && define.amd) { + define([], function() { return fabric; }); +} +/* _AMD_END_ */ +if (typeof document !== 'undefined' && typeof window !== 'undefined') { + if (document instanceof (typeof HTMLDocument !== 'undefined' ? HTMLDocument : Document)) { + fabric.document = document; + } + else { + fabric.document = document.implementation.createHTMLDocument(''); + } + fabric.window = window; +} +else { + // assume we're running under node.js when document/window are not present + var jsdom = require('jsdom'); + var virtualWindow = new jsdom.JSDOM( + decodeURIComponent('%3C!DOCTYPE%20html%3E%3Chtml%3E%3Chead%3E%3C%2Fhead%3E%3Cbody%3E%3C%2Fbody%3E%3C%2Fhtml%3E'), + { + features: { + FetchExternalResources: ['img'] + }, + resources: 'usable' + }).window; + fabric.document = virtualWindow.document; + fabric.jsdomImplForWrapper = require('jsdom/lib/jsdom/living/generated/utils').implForWrapper; + fabric.nodeCanvas = require('jsdom/lib/jsdom/utils').Canvas; + fabric.window = virtualWindow; + DOMParser = fabric.window.DOMParser; +} + +/** + * True when in environment that supports touch events + * @type boolean + */ +fabric.isTouchSupported = 'ontouchstart' in fabric.window || 'ontouchstart' in fabric.document || + (fabric.window && fabric.window.navigator && fabric.window.navigator.maxTouchPoints > 0); + +/** + * True when in environment that's probably Node.js + * @type boolean + */ +fabric.isLikelyNode = typeof Buffer !== 'undefined' && + typeof window === 'undefined'; + +/* _FROM_SVG_START_ */ +/** + * Attributes parsed from all SVG elements + * @type array + */ +fabric.SHARED_ATTRIBUTES = [ + 'display', + 'transform', + 'fill', 'fill-opacity', 'fill-rule', + 'opacity', + 'stroke', 'stroke-dasharray', 'stroke-linecap', 'stroke-dashoffset', + 'stroke-linejoin', 'stroke-miterlimit', + 'stroke-opacity', 'stroke-width', + 'id', 'paint-order', 'vector-effect', + 'instantiated_by_use', 'clip-path', +]; +/* _FROM_SVG_END_ */ + +/** + * Pixel per Inch as a default value set to 96. Can be changed for more realistic conversion. + */ +fabric.DPI = 96; +fabric.reNum = '(?:[-+]?(?:\\d+|\\d*\\.\\d+)(?:[eE][-+]?\\d+)?)'; +fabric.commaWsp = '(?:\\s+,?\\s*|,\\s*)' +fabric.rePathCommand = /([-+]?((\d+\.\d+)|((\d+)|(\.\d+)))(?:[eE][-+]?\d+)?)/ig; +fabric.reNonWord = /[ \n\.,;!\?\-]/; +fabric.fontPaths = { }; +fabric.iMatrix = [1, 0, 0, 1, 0, 0]; +fabric.svgNS = 'http://www.w3.org/2000/svg'; + +/** + * Pixel limit for cache canvases. 1Mpx , 4Mpx should be fine. + * @since 1.7.14 + * @type Number + * @default + */ +fabric.perfLimitSizeTotal = 2097152; + +/** + * Pixel limit for cache canvases width or height. IE fixes the maximum at 5000 + * @since 1.7.14 + * @type Number + * @default + */ +fabric.maxCacheSideLimit = 4096; + +/** + * Lowest pixel limit for cache canvases, set at 256PX + * @since 1.7.14 + * @type Number + * @default + */ +fabric.minCacheSideLimit = 256; + +/** + * Cache Object for widths of chars in text rendering. + */ +fabric.charWidthsCache = { }; + +/** + * if webgl is enabled and available, textureSize will determine the size + * of the canvas backend + * @since 2.0.0 + * @type Number + * @default + */ +fabric.textureSize = 2048; + +/** + * When 'true', style information is not retained when copy/pasting text, making + * pasted text use destination style. + * Defaults to 'false'. + * @type Boolean + * @default + */ +fabric.disableStyleCopyPaste = false; + +/** + * Enable webgl for filtering picture is available + * A filtering backend will be initialized, this will both take memory and + * time since a default 2048x2048 canvas will be created for the gl context + * @since 2.0.0 + * @type Boolean + * @default + */ +fabric.enableGLFiltering = true; + +/** + * Device Pixel Ratio + * @see https://developer.apple.com/library/safari/documentation/AudioVideo/Conceptual/HTML-canvas-guide/SettingUptheCanvas/SettingUptheCanvas.html + */ +fabric.devicePixelRatio = fabric.window.devicePixelRatio || + fabric.window.webkitDevicePixelRatio || + fabric.window.mozDevicePixelRatio || + 1; +/** + * Browser-specific constant to adjust CanvasRenderingContext2D.shadowBlur value, + * which is unitless and not rendered equally across browsers. + * + * Values that work quite well (as of October 2017) are: + * - Chrome: 1.5 + * - Edge: 1.75 + * - Firefox: 0.9 + * - Safari: 0.95 + * + * @since 2.0.0 + * @type Number + * @default 1 + */ +fabric.browserShadowBlurConstant = 1; + +/** + * This object contains the result of arc to beizer conversion for faster retrieving if the same arc needs to be converted again. + * It was an internal variable, is accessible since version 2.3.4 + */ +fabric.arcToSegmentsCache = { }; + +/** + * This object keeps the results of the boundsOfCurve calculation mapped by the joined arguments necessary to calculate it. + * It does speed up calculation, if you parse and add always the same paths, but in case of heavy usage of freedrawing + * you do not get any speed benefit and you get a big object in memory. + * The object was a private variable before, while now is appended to the lib so that you have access to it and you + * can eventually clear it. + * It was an internal variable, is accessible since version 2.3.4 + */ +fabric.boundsOfCurveCache = { }; + +/** + * If disabled boundsOfCurveCache is not used. For apps that make heavy usage of pencil drawing probably disabling it is better + * @default true + */ +fabric.cachesBoundsOfCurve = true; + +/** + * Skip performance testing of setupGLContext and force the use of putImageData that seems to be the one that works best on + * Chrome + old hardware. if your users are experiencing empty images after filtering you may try to force this to true + * this has to be set before instantiating the filtering backend ( before filtering the first image ) + * @type Boolean + * @default false + */ +fabric.forceGLPutImageData = false; + +fabric.initFilterBackend = function() { + if (fabric.enableGLFiltering && fabric.isWebglSupported && fabric.isWebglSupported(fabric.textureSize)) { + console.log('max texture size: ' + fabric.maxTextureSize); + return (new fabric.WebglFilterBackend({ tileSize: fabric.textureSize })); + } + else if (fabric.Canvas2dFilterBackend) { + return (new fabric.Canvas2dFilterBackend()); + } +}; +if (typeof document !== 'undefined' && typeof window !== 'undefined') { + // ensure globality even if entire library were function wrapped (as in Meteor.js packaging system) + window.fabric = fabric; +} +/*: + ---------------------------------------------------- + event.js : 1.1.5 : 2014/02/12 : MIT License + ---------------------------------------------------- + https://github.com/mudcube/Event.js + ---------------------------------------------------- + 1 : click, dblclick, dbltap + 1+ : tap, longpress, drag, swipe + 2+ : pinch, rotate + : mousewheel, devicemotion, shake + ---------------------------------------------------- + Ideas for the future + ---------------------------------------------------- + * GamePad, and other input abstractions. + * Event batching - i.e. for every x fingers down a new gesture is created. + ---------------------------------------------------- + http://www.w3.org/TR/2011/WD-touch-events-20110505/ + ---------------------------------------------------- +*/ + +if (typeof(eventjs) === "undefined") var eventjs = {}; + +(function(root) { "use strict"; + +// Add custom *EventListener commands to HTMLElements (set false to prevent funkiness). +root.modifyEventListener = false; + +// Add bulk *EventListener commands on NodeLists from querySelectorAll and others (set false to prevent funkiness). +root.modifySelectors = false; + +root.configure = function(conf) { + if (isFinite(conf.modifyEventListener)) root.modifyEventListener = conf.modifyEventListener; + if (isFinite(conf.modifySelectors)) root.modifySelectors = conf.modifySelectors; + /// Augment event listeners + if (eventListenersAgumented === false && root.modifyEventListener) { + augmentEventListeners(); + } + if (selectorsAugmented === false && root.modifySelectors) { + augmentSelectors(); + } +}; + +// Event maintenance. +root.add = function(target, type, listener, configure) { + return eventManager(target, type, listener, configure, "add"); +}; + +root.remove = function(target, type, listener, configure) { + return eventManager(target, type, listener, configure, "remove"); +}; + +root.returnFalse = function(event) { + return false; +}; + +root.stop = function(event) { + if (!event) return; + if (event.stopPropagation) event.stopPropagation(); + event.cancelBubble = true; // <= IE8 + event.cancelBubbleCount = 0; +}; + +root.prevent = function(event) { + if (!event) return; + if (event.preventDefault) { + event.preventDefault(); + } else if (event.preventManipulation) { + event.preventManipulation(); // MS + } else { + event.returnValue = false; // <= IE8 + } +}; + +root.cancel = function(event) { + root.stop(event); + root.prevent(event); +}; + +root.blur = function() { // Blurs the focused element. Useful when using eventjs.cancel as canceling will prevent focused elements from being blurred. + var node = document.activeElement; + if (!node) return; + var nodeName = document.activeElement.nodeName; + if (nodeName === "INPUT" || nodeName === "TEXTAREA" || node.contentEditable === "true") { + if (node.blur) node.blur(); + } +}; + +// Check whether event is natively supported (via @kangax) +root.getEventSupport = function (target, type) { + if (typeof(target) === "string") { + type = target; + target = window; + } + type = "on" + type; + if (type in target) return true; + if (!target.setAttribute) target = document.createElement("div"); + if (target.setAttribute && target.removeAttribute) { + target.setAttribute(type, ""); + var isSupported = typeof target[type] === "function"; + if (typeof target[type] !== "undefined") target[type] = null; + target.removeAttribute(type); + return isSupported; + } +}; + +var clone = function (obj) { + if (!obj || typeof (obj) !== 'object') return obj; + var temp = new obj.constructor(); + for (var key in obj) { + if (!obj[key] || typeof (obj[key]) !== 'object') { + temp[key] = obj[key]; + } else { // clone sub-object + temp[key] = clone(obj[key]); + } + } + return temp; +}; + +/// Handle custom *EventListener commands. +var eventManager = function(target, type, listener, configure, trigger, fromOverwrite) { + configure = configure || {}; + // Check whether target is a configuration variable; + if (String(target) === "[object Object]") { + var data = target; + target = data.target; delete data.target; + /// + if (data.type && data.listener) { + type = data.type; delete data.type; + listener = data.listener; delete data.listener; + for (var key in data) { + configure[key] = data[key]; + } + } else { // specialness + for (var param in data) { + var value = data[param]; + if (typeof(value) === "function") continue; + configure[param] = value; + } + /// + var ret = {}; + for (var key in data) { + var param = key.split(","); + var o = data[key]; + var conf = {}; + for (var k in configure) { // clone base configuration + conf[k] = configure[k]; + } + /// + if (typeof(o) === "function") { // without configuration + var listener = o; + } else if (typeof(o.listener) === "function") { // with configuration + var listener = o.listener; + for (var k in o) { // merge configure into base configuration + if (typeof(o[k]) === "function") continue; + conf[k] = o[k]; + } + } else { // not a listener + continue; + } + /// + for (var n = 0; n < param.length; n ++) { + ret[key] = eventjs.add(target, param[n], listener, conf, trigger); + } + } + return ret; + } + } + /// + if (!target || !type || !listener) return; + // Check for element to load on interval (before onload). + if (typeof(target) === "string" && type === "ready") { + if (window.eventjs_stallOnReady) { /// force stall for scripts to load + type = "load"; + target = window; + } else { // + var time = (new Date()).getTime(); + var timeout = configure.timeout; + var ms = configure.interval || 1000 / 60; + var interval = window.setInterval(function() { + if ((new Date()).getTime() - time > timeout) { + window.clearInterval(interval); + } + if (document.querySelector(target)) { + window.clearInterval(interval); + setTimeout(listener, 1); + } + }, ms); + return; + } + } + // Get DOM element from Query Selector. + if (typeof(target) === "string") { + target = document.querySelectorAll(target); + if (target.length === 0) return createError("Missing target on listener!", arguments); // No results. + if (target.length === 1) { // Single target. + target = target[0]; + } + } + + /// Handle multiple targets. + var event; + var events = {}; + if (target.length > 0 && target !== window) { + for (var n0 = 0, length0 = target.length; n0 < length0; n0 ++) { + event = eventManager(target[n0], type, listener, clone(configure), trigger); + if (event) events[n0] = event; + } + return createBatchCommands(events); + } + + /// Check for multiple events in one string. + if (typeof(type) === "string") { + type = type.toLowerCase(); + if (type.indexOf(" ") !== -1) { + type = type.split(" "); + } else if (type.indexOf(",") !== -1) { + type = type.split(","); + } + } + + /// Attach or remove multiple events associated with a target. + if (typeof(type) !== "string") { // Has multiple events. + if (typeof(type.length) === "number") { // Handle multiple listeners glued together. + for (var n1 = 0, length1 = type.length; n1 < length1; n1 ++) { // Array [type] + event = eventManager(target, type[n1], listener, clone(configure), trigger); + if (event) events[type[n1]] = event; + } + } else { // Handle multiple listeners. + for (var key in type) { // Object {type} + if (typeof(type[key]) === "function") { // without configuration. + event = eventManager(target, key, type[key], clone(configure), trigger); + } else { // with configuration. + event = eventManager(target, key, type[key].listener, clone(type[key]), trigger); + } + if (event) events[key] = event; + } + } + return createBatchCommands(events); + } else if (type.indexOf("on") === 0) { // to support things like "onclick" instead of "click" + type = type.substr(2); + } + + // Ensure listener is a function. + if (typeof(target) !== "object") return createError("Target is not defined!", arguments); + if (typeof(listener) !== "function") return createError("Listener is not a function!", arguments); + + // Generate a unique wrapper identifier. + var useCapture = configure.useCapture || false; + var id = getID(target) + "." + getID(listener) + "." + (useCapture ? 1 : 0); + // Handle the event. + if (root.Gesture && root.Gesture._gestureHandlers[type]) { // Fire custom event. + id = type + id; + if (trigger === "remove") { // Remove event listener. + if (!wrappers[id]) return; // Already removed. + wrappers[id].remove(); + delete wrappers[id]; + } else if (trigger === "add") { // Attach event listener. + if (wrappers[id]) { + wrappers[id].add(); + return wrappers[id]; // Already attached. + } + // Retains "this" orientation. + if (configure.useCall && !root.modifyEventListener) { + var tmp = listener; + listener = function(event, self) { + for (var key in self) event[key] = self[key]; + return tmp.call(target, event); + }; + } + // Create listener proxy. + configure.gesture = type; + configure.target = target; + configure.listener = listener; + configure.fromOverwrite = fromOverwrite; + // Record wrapper. + wrappers[id] = root.proxy[type](configure); + } + return wrappers[id]; + } else { // Fire native event. + var eventList = getEventList(type); + for (var n = 0, eventId; n < eventList.length; n ++) { + type = eventList[n]; + eventId = type + "." + id; + if (trigger === "remove") { // Remove event listener. + if (!wrappers[eventId]) continue; // Already removed. + target[remove](type, listener, useCapture); + delete wrappers[eventId]; + } else if (trigger === "add") { // Attach event listener. + if (wrappers[eventId]) return wrappers[eventId]; // Already attached. + target[add](type, listener, useCapture); + // Record wrapper. + wrappers[eventId] = { + id: eventId, + type: type, + target: target, + listener: listener, + remove: function() { + for (var n = 0; n < eventList.length; n ++) { + root.remove(target, eventList[n], listener, configure); + } + } + }; + } + } + return wrappers[eventId]; + } +}; + +/// Perform batch actions on multiple events. +var createBatchCommands = function(events) { + return { + remove: function() { // Remove multiple events. + for (var key in events) { + events[key].remove(); + } + }, + add: function() { // Add multiple events. + for (var key in events) { + events[key].add(); + } + } + }; +}; + +/// Display error message in console. +var createError = function(message, data) { + if (typeof(console) === "undefined") return; + if (typeof(console.error) === "undefined") return; + console.error(message, data); +}; + +/// Handle naming discrepancies between platforms. +var pointerDefs = { + "msPointer": [ "MSPointerDown", "MSPointerMove", "MSPointerUp" ], + "touch": [ "touchstart", "touchmove", "touchend" ], + "mouse": [ "mousedown", "mousemove", "mouseup" ] +}; + +var pointerDetect = { + // MSPointer + "MSPointerDown": 0, + "MSPointerMove": 1, + "MSPointerUp": 2, + // Touch + "touchstart": 0, + "touchmove": 1, + "touchend": 2, + // Mouse + "mousedown": 0, + "mousemove": 1, + "mouseup": 2 +}; + +var getEventSupport = (function() { + root.supports = {}; + if (window.navigator.msPointerEnabled) { + root.supports.msPointer = true; + } + if (root.getEventSupport("touchstart")) { + root.supports.touch = true; + } + if (root.getEventSupport("mousedown")) { + root.supports.mouse = true; + } +})(); + +var getEventList = (function() { + return function(type) { + var prefix = document.addEventListener ? "" : "on"; // IE + var idx = pointerDetect[type]; + if (isFinite(idx)) { + var types = []; + for (var key in root.supports) { + types.push(prefix + pointerDefs[key][idx]); + } + return types; + } else { + return [ prefix + type ]; + } + }; +})(); + +/// Event wrappers to keep track of all events placed in the window. +var wrappers = {}; +var counter = 0; +var getID = function(object) { + if (object === window) return "#window"; + if (object === document) return "#document"; + if (!object.uniqueID) object.uniqueID = "e" + counter ++; + return object.uniqueID; +}; + +/// Detect platforms native *EventListener command. +var add = document.addEventListener ? "addEventListener" : "attachEvent"; +var remove = document.removeEventListener ? "removeEventListener" : "detachEvent"; + +/* + Pointer.js + ---------------------------------------- + Modified from; https://github.com/borismus/pointer.js +*/ + +root.createPointerEvent = function (event, self, preventRecord) { + var eventName = self.gesture; + var target = self.target; + var pts = event.changedTouches || root.proxy.getCoords(event); + if (pts.length) { + var pt = pts[0]; + self.pointers = preventRecord ? [] : pts; + self.pageX = pt.pageX; + self.pageY = pt.pageY; + self.x = self.pageX; + self.y = self.pageY; + } + /// + var newEvent = document.createEvent("Event"); + newEvent.initEvent(eventName, true, true); + newEvent.originalEvent = event; + for (var k in self) { + if (k === "target") continue; + newEvent[k] = self[k]; + } + /// + var type = newEvent.type; + if (root.Gesture && root.Gesture._gestureHandlers[type]) { // capture custom events. +// target.dispatchEvent(newEvent); + self.oldListener.call(target, newEvent, self, false); + } +}; + +var eventListenersAgumented = false; +var augmentEventListeners = function() { + /// Allows *EventListener to use custom event proxies. + if (!window.HTMLElement) return; + var augmentEventListener = function(proto) { + var recall = function(trigger) { // overwrite native *EventListener's + var handle = trigger + "EventListener"; + var handler = proto[handle]; + proto[handle] = function (type, listener, useCapture) { + if (root.Gesture && root.Gesture._gestureHandlers[type]) { // capture custom events. + var configure = useCapture; + if (typeof(useCapture) === "object") { + configure.useCall = true; + } else { // convert to configuration object. + configure = { + useCall: true, + useCapture: useCapture + }; + } + eventManager(this, type, listener, configure, trigger, true); +// handler.call(this, type, listener, useCapture); + } else { // use native function. + var types = getEventList(type); + for (var n = 0; n < types.length; n ++) { + handler.call(this, types[n], listener, useCapture); + } + } + }; + }; + recall("add"); + recall("remove"); + }; + // NOTE: overwriting HTMLElement doesn't do anything in Firefox. + if (navigator.userAgent.match(/Firefox/)) { + // TODO: fix Firefox for the general case. + augmentEventListener(HTMLDivElement.prototype); + augmentEventListener(HTMLCanvasElement.prototype); + } else { + augmentEventListener(HTMLElement.prototype); + } + augmentEventListener(document); + augmentEventListener(window); +}; + +var selectorsAugmented = false; +var augmentSelectors = function() { +/// Allows querySelectorAll and other NodeLists to perform *EventListener commands in bulk. + var proto = NodeList.prototype; + proto.removeEventListener = function(type, listener, useCapture) { + for (var n = 0, length = this.length; n < length; n ++) { + this[n].removeEventListener(type, listener, useCapture); + } + }; + proto.addEventListener = function(type, listener, useCapture) { + for (var n = 0, length = this.length; n < length; n ++) { + this[n].addEventListener(type, listener, useCapture); + } + }; +}; + +return root; + +})(eventjs); + +/*: + ---------------------------------------------------- + eventjs.proxy : 0.4.2 : 2013/07/17 : MIT License + ---------------------------------------------------- + https://github.com/mudcube/eventjs.js + ---------------------------------------------------- +*/ + +if (typeof(eventjs) === "undefined") var eventjs = {}; +if (typeof(eventjs.proxy) === "undefined") eventjs.proxy = {}; + +eventjs.proxy = (function(root) { "use strict"; + +/* + Create a new pointer gesture instance. +*/ + +root.pointerSetup = function(conf, self) { + /// Configure. + conf.target = conf.target || window; + conf.doc = conf.target.ownerDocument || conf.target; // Associated document. + conf.minFingers = conf.minFingers || conf.fingers || 1; // Minimum required fingers. + conf.maxFingers = conf.maxFingers || conf.fingers || Infinity; // Maximum allowed fingers. + conf.position = conf.position || "relative"; // Determines what coordinate system points are returned. + delete conf.fingers; //- + /// Convenience data. + self = self || {}; + self.enabled = true; + self.gesture = conf.gesture; + self.target = conf.target; + self.env = conf.env; + /// + if (eventjs.modifyEventListener && conf.fromOverwrite) { + conf.oldListener = conf.listener; + conf.listener = eventjs.createPointerEvent; + } + /// Convenience commands. + var fingers = 0; + var type = self.gesture.indexOf("pointer") === 0 && eventjs.modifyEventListener ? "pointer" : "mouse"; + if (conf.oldListener) self.oldListener = conf.oldListener; + /// + self.listener = conf.listener; + self.proxy = function(listener) { + self.defaultListener = conf.listener; + conf.listener = listener; + listener(conf.event, self); + }; + self.add = function() { + if (self.enabled === true) return; + if (conf.onPointerDown) eventjs.add(conf.target, type + "down", conf.onPointerDown); + if (conf.onPointerMove) eventjs.add(conf.doc, type + "move", conf.onPointerMove); + if (conf.onPointerUp) eventjs.add(conf.doc, type + "up", conf.onPointerUp); + self.enabled = true; + }; + self.remove = function() { + if (self.enabled === false) return; + if (conf.onPointerDown) eventjs.remove(conf.target, type + "down", conf.onPointerDown); + if (conf.onPointerMove) eventjs.remove(conf.doc, type + "move", conf.onPointerMove); + if (conf.onPointerUp) eventjs.remove(conf.doc, type + "up", conf.onPointerUp); + self.reset(); + self.enabled = false; + }; + self.pause = function(opt) { + if (conf.onPointerMove && (!opt || opt.move)) eventjs.remove(conf.doc, type + "move", conf.onPointerMove); + if (conf.onPointerUp && (!opt || opt.up)) eventjs.remove(conf.doc, type + "up", conf.onPointerUp); + fingers = conf.fingers; + conf.fingers = 0; + }; + self.resume = function(opt) { + if (conf.onPointerMove && (!opt || opt.move)) eventjs.add(conf.doc, type + "move", conf.onPointerMove); + if (conf.onPointerUp && (!opt || opt.up)) eventjs.add(conf.doc, type + "up", conf.onPointerUp); + conf.fingers = fingers; + }; + self.reset = function() { + conf.tracker = {}; + conf.fingers = 0; + }; + /// + return self; +}; + +/* + Begin proxied pointer command. +*/ + +var sp = eventjs.supports; // Default pointerType +/// +eventjs.isMouse = !!sp.mouse; +eventjs.isMSPointer = !!sp.touch; +eventjs.isTouch = !!sp.msPointer; +/// +root.pointerStart = function(event, self, conf) { + /// tracks multiple inputs + var type = (event.type || "mousedown").toUpperCase(); + if (type.indexOf("MOUSE") === 0) { + eventjs.isMouse = true; + eventjs.isTouch = false; + eventjs.isMSPointer = false; + } else if (type.indexOf("TOUCH") === 0) { + eventjs.isMouse = false; + eventjs.isTouch = true; + eventjs.isMSPointer = false; + } else if (type.indexOf("MSPOINTER") === 0) { + eventjs.isMouse = false; + eventjs.isTouch = false; + eventjs.isMSPointer = true; + } + /// + var addTouchStart = function(touch, sid) { + var bbox = conf.bbox; + var pt = track[sid] = {}; + /// + switch(conf.position) { + case "absolute": // Absolute from within window. + pt.offsetX = 0; + pt.offsetY = 0; + break; + case "differenceFromLast": // Since last coordinate recorded. + pt.offsetX = touch.pageX; + pt.offsetY = touch.pageY; + break; + case "difference": // Relative from origin. + pt.offsetX = touch.pageX; + pt.offsetY = touch.pageY; + break; + case "move": // Move target element. + pt.offsetX = touch.pageX - bbox.x1; + pt.offsetY = touch.pageY - bbox.y1; + break; + default: // Relative from within target. + pt.offsetX = bbox.x1 - bbox.scrollLeft; + pt.offsetY = bbox.y1 - bbox.scrollTop; + break; + } + /// + var x = touch.pageX - pt.offsetX; + var y = touch.pageY - pt.offsetY; + /// + pt.rotation = 0; + pt.scale = 1; + pt.startTime = pt.moveTime = (new Date()).getTime(); + pt.move = { x: x, y: y }; + pt.start = { x: x, y: y }; + /// + conf.fingers ++; + }; + /// + conf.event = event; + if (self.defaultListener) { + conf.listener = self.defaultListener; + delete self.defaultListener; + } + /// + var isTouchStart = !conf.fingers; + var track = conf.tracker; + var touches = event.changedTouches || root.getCoords(event); + var length = touches.length; + // Adding touch events to tracking. + for (var i = 0; i < length; i ++) { + var touch = touches[i]; + var sid = touch.identifier || Infinity; // Touch ID. + // Track the current state of the touches. + if (conf.fingers) { + if (conf.fingers >= conf.maxFingers) { + var ids = []; + for (var sid in conf.tracker) ids.push(sid); + self.identifier = ids.join(","); + return isTouchStart; + } + var fingers = 0; // Finger ID. + for (var rid in track) { + // Replace removed finger. + if (track[rid].up) { + delete track[rid]; + addTouchStart(touch, sid); + conf.cancel = true; + break; + } + fingers ++; + } + // Add additional finger. + if (track[sid]) continue; + addTouchStart(touch, sid); + } else { // Start tracking fingers. + track = conf.tracker = {}; + self.bbox = conf.bbox = root.getBoundingBox(conf.target); + conf.fingers = 0; + conf.cancel = false; + addTouchStart(touch, sid); + } + } + /// + var ids = []; + for (var sid in conf.tracker) ids.push(sid); + self.identifier = ids.join(","); + /// + return isTouchStart; +}; + +/* + End proxied pointer command. +*/ + +root.pointerEnd = function(event, self, conf, onPointerUp) { + // Record changed touches have ended (iOS changedTouches is not reliable). + var touches = event.touches || []; + var length = touches.length; + var exists = {}; + for (var i = 0; i < length; i ++) { + var touch = touches[i]; + var sid = touch.identifier; + exists[sid || Infinity] = true; + } + for (var sid in conf.tracker) { + var track = conf.tracker[sid]; + if (exists[sid] || track.up) continue; + if (onPointerUp) { // add changedTouches to mouse. + onPointerUp({ + pageX: track.pageX, + pageY: track.pageY, + changedTouches: [{ + pageX: track.pageX, + pageY: track.pageY, + identifier: sid === "Infinity" ? Infinity : sid + }] + }, "up"); + } + track.up = true; + conf.fingers --; + } +/* // This should work but fails in Safari on iOS4 so not using it. + var touches = event.changedTouches || root.getCoords(event); + var length = touches.length; + // Record changed touches have ended (this should work). + for (var i = 0; i < length; i ++) { + var touch = touches[i]; + var sid = touch.identifier || Infinity; + var track = conf.tracker[sid]; + if (track && !track.up) { + if (onPointerUp) { // add changedTouches to mouse. + onPointerUp({ + changedTouches: [{ + pageX: track.pageX, + pageY: track.pageY, + identifier: sid === "Infinity" ? Infinity : sid + }] + }, "up"); + } + track.up = true; + conf.fingers --; + } + } */ + // Wait for all fingers to be released. + if (conf.fingers !== 0) return false; + // Record total number of fingers gesture used. + var ids = []; + conf.gestureFingers = 0; + for (var sid in conf.tracker) { + conf.gestureFingers ++; + ids.push(sid); + } + self.identifier = ids.join(","); + // Our pointer gesture has ended. + return true; +}; + +/* + Returns mouse coords in an array to match event.*Touches + ------------------------------------------------------------ + var touch = event.changedTouches || root.getCoords(event); +*/ + +root.getCoords = function(event) { + if (typeof(event.pageX) !== "undefined") { // Desktop browsers. + root.getCoords = function(event) { + return Array({ + type: "mouse", + x: event.pageX, + y: event.pageY, + pageX: event.pageX, + pageY: event.pageY, + identifier: event.pointerId || Infinity // pointerId is MS + }); + }; + } else { // Internet Explorer <= 8.0 + root.getCoords = function(event) { + var doc = document.documentElement; + event = event || window.event; + return Array({ + type: "mouse", + x: event.clientX + doc.scrollLeft, + y: event.clientY + doc.scrollTop, + pageX: event.clientX + doc.scrollLeft, + pageY: event.clientY + doc.scrollTop, + identifier: Infinity + }); + }; + } + return root.getCoords(event); +}; + +/* + Returns single coords in an object. + ------------------------------------------------------------ + var mouse = root.getCoord(event); +*/ + +root.getCoord = function(event) { + if ("ontouchstart" in window) { // Mobile browsers. + var pX = 0; + var pY = 0; + root.getCoord = function(event) { + var touches = event.changedTouches; + if (touches && touches.length) { // ontouchstart + ontouchmove + return { + x: pX = touches[0].pageX, + y: pY = touches[0].pageY + }; + } else { // ontouchend + return { + x: pX, + y: pY + }; + } + }; + } else if(typeof(event.pageX) !== "undefined" && typeof(event.pageY) !== "undefined") { // Desktop browsers. + root.getCoord = function(event) { + return { + x: event.pageX, + y: event.pageY + }; + }; + } else { // Internet Explorer <=8.0 + root.getCoord = function(event) { + var doc = document.documentElement; + event = event || window.event; + return { + x: event.clientX + doc.scrollLeft, + y: event.clientY + doc.scrollTop + }; + }; + } + return root.getCoord(event); +}; + +/* + Get target scale and position in space. +*/ + +var getPropertyAsFloat = function(o, type) { + var n = parseFloat(o.getPropertyValue(type), 10); + return isFinite(n) ? n : 0; +}; + +root.getBoundingBox = function(o) { + if (o === window || o === document) o = document.body; + /// + var bbox = {}; + var bcr = o.getBoundingClientRect(); + bbox.width = bcr.width; + bbox.height = bcr.height; + bbox.x1 = bcr.left; + bbox.y1 = bcr.top; + bbox.scaleX = bcr.width / o.offsetWidth || 1; + bbox.scaleY = bcr.height / o.offsetHeight || 1; + bbox.scrollLeft = 0; + bbox.scrollTop = 0; + /// + var style = window.getComputedStyle(o); + var borderBox = style.getPropertyValue("box-sizing") === "border-box"; + /// + if (borderBox === false) { + var left = getPropertyAsFloat(style, "border-left-width"); + var right = getPropertyAsFloat(style, "border-right-width"); + var bottom = getPropertyAsFloat(style, "border-bottom-width"); + var top = getPropertyAsFloat(style, "border-top-width"); + bbox.border = [ left, right, top, bottom ]; + bbox.x1 += left; + bbox.y1 += top; + bbox.width -= right + left; + bbox.height -= bottom + top; + } + +/* var left = getPropertyAsFloat(style, "padding-left"); + var right = getPropertyAsFloat(style, "padding-right"); + var bottom = getPropertyAsFloat(style, "padding-bottom"); + var top = getPropertyAsFloat(style, "padding-top"); + bbox.padding = [ left, right, top, bottom ];*/ + /// + bbox.x2 = bbox.x1 + bbox.width; + bbox.y2 = bbox.y1 + bbox.height; + + /// Get the scroll of container element. + var position = style.getPropertyValue("position"); + var tmp = position === "fixed" ? o : o.parentNode; + while (tmp !== null) { + if (tmp === document.body) break; + if (tmp.scrollTop === undefined) break; + var style = window.getComputedStyle(tmp); + var position = style.getPropertyValue("position"); + if (position === "absolute") { + + } else if (position === "fixed") { +// bbox.scrollTop += document.body.scrollTop; +// bbox.scrollLeft += document.body.scrollLeft; + bbox.scrollTop -= tmp.parentNode.scrollTop; + bbox.scrollLeft -= tmp.parentNode.scrollLeft; + break; + } else { + bbox.scrollLeft += tmp.scrollLeft; + bbox.scrollTop += tmp.scrollTop; + } + /// + tmp = tmp.parentNode; + }; + /// + bbox.scrollBodyLeft = (window.pageXOffset !== undefined) ? window.pageXOffset : (document.documentElement || document.body.parentNode || document.body).scrollLeft; + bbox.scrollBodyTop = (window.pageYOffset !== undefined) ? window.pageYOffset : (document.documentElement || document.body.parentNode || document.body).scrollTop; + /// + bbox.scrollLeft -= bbox.scrollBodyLeft; + bbox.scrollTop -= bbox.scrollBodyTop; + /// + return bbox; +}; + +/* + Keep track of metaKey, the proper ctrlKey for users platform. + ---------------------------------------------------- + http://www.quirksmode.org/js/keys.html + ----------------------------------- + http://unixpapa.com/js/key.html +*/ + +(function() { + var agent = navigator.userAgent.toLowerCase(); + var mac = agent.indexOf("macintosh") !== -1; + var metaKeys; + if (mac && agent.indexOf("khtml") !== -1) { // chrome, safari. + metaKeys = { 91: true, 93: true }; + } else if (mac && agent.indexOf("firefox") !== -1) { // mac firefox. + metaKeys = { 224: true }; + } else { // windows, linux, or mac opera. + metaKeys = { 17: true }; + } + (root.metaTrackerReset = function() { + eventjs.fnKey = root.fnKey = false; + eventjs.metaKey = root.metaKey = false; + eventjs.escKey = root.escKey = false; + eventjs.ctrlKey = root.ctrlKey = false; + eventjs.shiftKey = root.shiftKey = false; + eventjs.altKey = root.altKey = false; + })(); + root.metaTracker = function(event) { + var isKeyDown = event.type === "keydown"; + if (event.keyCode === 27) eventjs.escKey = root.escKey = isKeyDown; + if (metaKeys[event.keyCode]) eventjs.metaKey = root.metaKey = isKeyDown; + eventjs.ctrlKey = root.ctrlKey = event.ctrlKey; + eventjs.shiftKey = root.shiftKey = event.shiftKey; + eventjs.altKey = root.altKey = event.altKey; + }; +})(); + +return root; + +})(eventjs.proxy); +/*: + ---------------------------------------------------- + "MutationObserver" event proxy. + ---------------------------------------------------- + author: Selvakumar Arumugam - MIT LICENSE + src: http://stackoverflow.com/questions/10868104/can-you-have-a-javascript-hook-trigger-after-a-dom-elements-style-object-change + ---------------------------------------------------- +*/ +if (typeof(eventjs) === "undefined") var eventjs = {}; + +eventjs.MutationObserver = (function() { + var MutationObserver = window.MutationObserver || window.WebKitMutationObserver || window.MozMutationObserver; + var DOMAttrModifiedSupported = !MutationObserver && (function() { + var p = document.createElement("p"); + var flag = false; + var fn = function() { flag = true }; + if (p.addEventListener) { + p.addEventListener("DOMAttrModified", fn, false); + } else if (p.attachEvent) { + p.attachEvent("onDOMAttrModified", fn); + } else { + return false; + } + /// + p.setAttribute("id", "target"); + /// + return flag; + })(); + /// + return function(container, callback) { + if (MutationObserver) { + var options = { + subtree: false, + attributes: true + }; + var observer = new MutationObserver(function(mutations) { + mutations.forEach(function(e) { + callback.call(e.target, e.attributeName); + }); + }); + observer.observe(container, options) + } else if (DOMAttrModifiedSupported) { + eventjs.add(container, "DOMAttrModified", function(e) { + callback.call(container, e.attrName); + }); + } else if ("onpropertychange" in document.body) { + eventjs.add(container, "propertychange", function(e) { + callback.call(container, window.event.propertyName); + }); + } + } +})(); +/*: + "Click" event proxy. + ---------------------------------------------------- + eventjs.add(window, "click", function(event, self) {}); +*/ + +if (typeof(eventjs) === "undefined") var eventjs = {}; +if (typeof(eventjs.proxy) === "undefined") eventjs.proxy = {}; + +eventjs.proxy = (function(root) { "use strict"; + +root.click = function(conf) { + conf.gesture = conf.gesture || "click"; + conf.maxFingers = conf.maxFingers || conf.fingers || 1; + /// Tracking the events. + conf.onPointerDown = function (event) { + if (root.pointerStart(event, self, conf)) { + eventjs.add(conf.target, "mouseup", conf.onPointerUp); + } + }; + conf.onPointerUp = function(event) { + if (root.pointerEnd(event, self, conf)) { + eventjs.remove(conf.target, "mouseup", conf.onPointerUp); + var pointers = event.changedTouches || root.getCoords(event); + var pointer = pointers[0]; + var bbox = conf.bbox; + var newbbox = root.getBoundingBox(conf.target); + var y = pointer.pageY - newbbox.scrollBodyTop; + var x = pointer.pageX - newbbox.scrollBodyLeft; + //// + if (x > bbox.x1 && y > bbox.y1 && + x < bbox.x2 && y < bbox.y2 && + bbox.scrollTop === newbbox.scrollTop) { // has not been scrolled + /// + for (var key in conf.tracker) break; //- should be modularized? in dblclick too + var point = conf.tracker[key]; + self.x = point.start.x; + self.y = point.start.y; + /// + conf.listener(event, self); + } + } + }; + // Generate maintenance commands, and other configurations. + var self = root.pointerSetup(conf); + self.state = "click"; + // Attach events. + eventjs.add(conf.target, "mousedown", conf.onPointerDown); + // Return this object. + return self; +}; + +eventjs.Gesture = eventjs.Gesture || {}; +eventjs.Gesture._gestureHandlers = eventjs.Gesture._gestureHandlers || {}; +eventjs.Gesture._gestureHandlers.click = root.click; + +return root; + +})(eventjs.proxy); +/*: + "Double-Click" aka "Double-Tap" event proxy. + ---------------------------------------------------- + eventjs.add(window, "dblclick", function(event, self) {}); + ---------------------------------------------------- + Touch an target twice for <= 700ms, with less than 25 pixel drift. +*/ + +if (typeof(eventjs) === "undefined") var eventjs = {}; +if (typeof(eventjs.proxy) === "undefined") eventjs.proxy = {}; + +eventjs.proxy = (function(root) { "use strict"; + +root.dbltap = +root.dblclick = function(conf) { + conf.gesture = conf.gesture || "dbltap"; + conf.maxFingers = conf.maxFingers || conf.fingers || 1; + // Setting up local variables. + var delay = 700; // in milliseconds + var time0, time1, timeout; + var pointer0, pointer1; + // Tracking the events. + conf.onPointerDown = function (event) { + var pointers = event.changedTouches || root.getCoords(event); + if (time0 && !time1) { // Click #2 + pointer1 = pointers[0]; + time1 = (new Date()).getTime() - time0; + } else { // Click #1 + pointer0 = pointers[0]; + time0 = (new Date()).getTime(); + time1 = 0; + clearTimeout(timeout); + timeout = setTimeout(function() { + time0 = 0; + }, delay); + } + if (root.pointerStart(event, self, conf)) { + eventjs.add(conf.target, "mousemove", conf.onPointerMove).listener(event); + eventjs.add(conf.target, "mouseup", conf.onPointerUp); + } + }; + conf.onPointerMove = function (event) { + if (time0 && !time1) { + var pointers = event.changedTouches || root.getCoords(event); + pointer1 = pointers[0]; + } + var bbox = conf.bbox; + var ax = (pointer1.pageX - bbox.x1); + var ay = (pointer1.pageY - bbox.y1); + if (!(ax > 0 && ax < bbox.width && // Within target coordinates.. + ay > 0 && ay < bbox.height && + Math.abs(pointer1.pageX - pointer0.pageX) <= 25 && // Within drift deviance. + Math.abs(pointer1.pageY - pointer0.pageY) <= 25)) { + // Cancel out this listener. + eventjs.remove(conf.target, "mousemove", conf.onPointerMove); + clearTimeout(timeout); + time0 = time1 = 0; + } + }; + conf.onPointerUp = function(event) { + if (root.pointerEnd(event, self, conf)) { + eventjs.remove(conf.target, "mousemove", conf.onPointerMove); + eventjs.remove(conf.target, "mouseup", conf.onPointerUp); + } + if (time0 && time1) { + if (time1 <= delay) { // && !(event.cancelBubble && ++event.cancelBubbleCount > 1)) { + self.state = conf.gesture; + for (var key in conf.tracker) break; + var point = conf.tracker[key]; + self.x = point.start.x; + self.y = point.start.y; + conf.listener(event, self); + } + clearTimeout(timeout); + time0 = time1 = 0; + } + }; + // Generate maintenance commands, and other configurations. + var self = root.pointerSetup(conf); + self.state = "dblclick"; + // Attach events. + eventjs.add(conf.target, "mousedown", conf.onPointerDown); + // Return this object. + return self; +}; + +eventjs.Gesture = eventjs.Gesture || {}; +eventjs.Gesture._gestureHandlers = eventjs.Gesture._gestureHandlers || {}; +eventjs.Gesture._gestureHandlers.dbltap = root.dbltap; +eventjs.Gesture._gestureHandlers.dblclick = root.dblclick; + +return root; + +})(eventjs.proxy); +/*: + "Drag" event proxy (1+ fingers). + ---------------------------------------------------- + CONFIGURE: maxFingers, position. + ---------------------------------------------------- + eventjs.add(window, "drag", function(event, self) { + console.log(self.gesture, self.state, self.start, self.x, self.y, self.bbox); + }); +*/ + +if (typeof(eventjs) === "undefined") var eventjs = {}; +if (typeof(eventjs.proxy) === "undefined") eventjs.proxy = {}; + +eventjs.proxy = (function(root) { "use strict"; + +root.dragElement = function(that, event) { + root.drag({ + event: event, + target: that, + position: "move", + listener: function(event, self) { + that.style.left = self.x + "px"; + that.style.top = self.y + "px"; + eventjs.prevent(event); + } + }); +}; + +root.drag = function(conf) { + conf.gesture = "drag"; + conf.onPointerDown = function (event) { + if (root.pointerStart(event, self, conf)) { + if (!conf.monitor) { + eventjs.add(conf.doc, "mousemove", conf.onPointerMove); + eventjs.add(conf.doc, "mouseup", conf.onPointerUp); + } + } + // Process event listener. + conf.onPointerMove(event, "down"); + }; + conf.onPointerMove = function (event, state) { + if (!conf.tracker) return conf.onPointerDown(event); + var bbox = conf.bbox; + var touches = event.changedTouches || root.getCoords(event); + var length = touches.length; + for (var i = 0; i < length; i ++) { + var touch = touches[i]; + var identifier = touch.identifier || Infinity; + var pt = conf.tracker[identifier]; + // Identifier defined outside of listener. + if (!pt) continue; + pt.pageX = touch.pageX; + pt.pageY = touch.pageY; + // Record data. + self.state = state || "move"; + self.identifier = identifier; + self.start = pt.start; + self.fingers = conf.fingers; + if (conf.position === "differenceFromLast") { + self.x = (pt.pageX - pt.offsetX); + self.y = (pt.pageY - pt.offsetY); + pt.offsetX = pt.pageX; + pt.offsetY = pt.pageY; + } else { + self.x = (pt.pageX - pt.offsetX); + self.y = (pt.pageY - pt.offsetY); + } + /// + conf.listener(event, self); + } + }; + conf.onPointerUp = function(event) { + // Remove tracking for touch. + if (root.pointerEnd(event, self, conf, conf.onPointerMove)) { + if (!conf.monitor) { + eventjs.remove(conf.doc, "mousemove", conf.onPointerMove); + eventjs.remove(conf.doc, "mouseup", conf.onPointerUp); + } + } + }; + // Generate maintenance commands, and other configurations. + var self = root.pointerSetup(conf); + // Attach events. + if (conf.event) { + conf.onPointerDown(conf.event); + } else { // + eventjs.add(conf.target, "mousedown", conf.onPointerDown); + if (conf.monitor) { + eventjs.add(conf.doc, "mousemove", conf.onPointerMove); + eventjs.add(conf.doc, "mouseup", conf.onPointerUp); + } + } + // Return this object. + return self; +}; + +eventjs.Gesture = eventjs.Gesture || {}; +eventjs.Gesture._gestureHandlers = eventjs.Gesture._gestureHandlers || {}; +eventjs.Gesture._gestureHandlers.drag = root.drag; + +return root; + +})(eventjs.proxy); +/*: + "Gesture" event proxy (2+ fingers). + ---------------------------------------------------- + CONFIGURE: minFingers, maxFingers. + ---------------------------------------------------- + eventjs.add(window, "gesture", function(event, self) { + console.log( + self.x, // centroid + self.y, + self.rotation, + self.scale, + self.fingers, + self.state + ); + }); +*/ + +if (typeof(eventjs) === "undefined") var eventjs = {}; +if (typeof(eventjs.proxy) === "undefined") eventjs.proxy = {}; + +eventjs.proxy = (function(root) { "use strict"; + +var RAD_DEG = Math.PI / 180; +var getCentroid = function(self, points) { + var centroidx = 0; + var centroidy = 0; + var length = 0; + for (var sid in points) { + var touch = points[sid]; + if (touch.up) continue; + centroidx += touch.move.x; + centroidy += touch.move.y; + length ++; + } + self.x = centroidx /= length; + self.y = centroidy /= length; + return self; +}; + +root.gesture = function(conf) { + conf.gesture = conf.gesture || "gesture"; + conf.minFingers = conf.minFingers || conf.fingers || 2; + // Tracking the events. + conf.onPointerDown = function (event) { + var fingers = conf.fingers; + if (root.pointerStart(event, self, conf)) { + eventjs.add(conf.doc, "mousemove", conf.onPointerMove); + eventjs.add(conf.doc, "mouseup", conf.onPointerUp); + } + // Record gesture start. + if (conf.fingers === conf.minFingers && fingers !== conf.fingers) { + self.fingers = conf.minFingers; + self.scale = 1; + self.rotation = 0; + self.state = "start"; + var sids = ""; //- FIXME(mud): can generate duplicate IDs. + for (var key in conf.tracker) sids += key; + self.identifier = parseInt(sids); + getCentroid(self, conf.tracker); + conf.listener(event, self); + } + }; + /// + conf.onPointerMove = function (event, state) { + var bbox = conf.bbox; + var points = conf.tracker; + var touches = event.changedTouches || root.getCoords(event); + var length = touches.length; + // Update tracker coordinates. + for (var i = 0; i < length; i ++) { + var touch = touches[i]; + var sid = touch.identifier || Infinity; + var pt = points[sid]; + // Check whether "pt" is used by another gesture. + if (!pt) continue; + // Find the actual coordinates. + pt.move.x = (touch.pageX - bbox.x1); + pt.move.y = (touch.pageY - bbox.y1); + } + /// + if (conf.fingers < conf.minFingers) return; + /// + var touches = []; + var scale = 0; + var rotation = 0; + + /// Calculate centroid of gesture. + getCentroid(self, points); + /// + for (var sid in points) { + var touch = points[sid]; + if (touch.up) continue; + var start = touch.start; + if (!start.distance) { + var dx = start.x - self.x; + var dy = start.y - self.y; + start.distance = Math.sqrt(dx * dx + dy * dy); + start.angle = Math.atan2(dx, dy) / RAD_DEG; + } + // Calculate scale. + var dx = touch.move.x - self.x; + var dy = touch.move.y - self.y; + var distance = Math.sqrt(dx * dx + dy * dy); + scale += distance / start.distance; + // Calculate rotation. + var angle = Math.atan2(dx, dy) / RAD_DEG; + var rotate = (start.angle - angle + 360) % 360 - 180; + touch.DEG2 = touch.DEG1; // Previous degree. + touch.DEG1 = rotate > 0 ? rotate : -rotate; // Current degree. + if (typeof(touch.DEG2) !== "undefined") { + if (rotate > 0) { + touch.rotation += touch.DEG1 - touch.DEG2; + } else { + touch.rotation -= touch.DEG1 - touch.DEG2; + } + rotation += touch.rotation; + } + // Attach current points to self. + touches.push(touch.move); + } + /// + self.touches = touches; + self.fingers = conf.fingers; + self.scale = scale / conf.fingers; + self.rotation = rotation / conf.fingers; + self.state = "change"; + conf.listener(event, self); + }; + conf.onPointerUp = function(event) { + // Remove tracking for touch. + var fingers = conf.fingers; + if (root.pointerEnd(event, self, conf)) { + eventjs.remove(conf.doc, "mousemove", conf.onPointerMove); + eventjs.remove(conf.doc, "mouseup", conf.onPointerUp); + } + // Check whether fingers has dropped below minFingers. + if (fingers === conf.minFingers && conf.fingers < conf.minFingers) { + self.fingers = conf.fingers; + self.state = "end"; + conf.listener(event, self); + } + }; + // Generate maintenance commands, and other configurations. + var self = root.pointerSetup(conf); + // Attach events. + eventjs.add(conf.target, "mousedown", conf.onPointerDown); + // Return this object. + return self; +}; + +eventjs.Gesture = eventjs.Gesture || {}; +eventjs.Gesture._gestureHandlers = eventjs.Gesture._gestureHandlers || {}; +eventjs.Gesture._gestureHandlers.gesture = root.gesture; + +return root; + +})(eventjs.proxy); +/*: + "Pointer" event proxy (1+ fingers). + ---------------------------------------------------- + CONFIGURE: minFingers, maxFingers. + ---------------------------------------------------- + eventjs.add(window, "gesture", function(event, self) { + console.log(self.rotation, self.scale, self.fingers, self.state); + }); +*/ + +if (typeof(eventjs) === "undefined") var eventjs = {}; +if (typeof(eventjs.proxy) === "undefined") eventjs.proxy = {}; + +eventjs.proxy = (function(root) { "use strict"; + +root.pointerdown = +root.pointermove = +root.pointerup = function(conf) { + conf.gesture = conf.gesture || "pointer"; + if (conf.target.isPointerEmitter) return; + // Tracking the events. + var isDown = true; + conf.onPointerDown = function (event) { + isDown = false; + self.gesture = "pointerdown"; + conf.listener(event, self); + }; + conf.onPointerMove = function (event) { + self.gesture = "pointermove"; + conf.listener(event, self, isDown); + }; + conf.onPointerUp = function (event) { + isDown = true; + self.gesture = "pointerup"; + conf.listener(event, self, true); + }; + // Generate maintenance commands, and other configurations. + var self = root.pointerSetup(conf); + // Attach events. + eventjs.add(conf.target, "mousedown", conf.onPointerDown); + eventjs.add(conf.target, "mousemove", conf.onPointerMove); + eventjs.add(conf.doc, "mouseup", conf.onPointerUp); + // Return this object. + conf.target.isPointerEmitter = true; + return self; +}; + +eventjs.Gesture = eventjs.Gesture || {}; +eventjs.Gesture._gestureHandlers = eventjs.Gesture._gestureHandlers || {}; +eventjs.Gesture._gestureHandlers.pointerdown = root.pointerdown; +eventjs.Gesture._gestureHandlers.pointermove = root.pointermove; +eventjs.Gesture._gestureHandlers.pointerup = root.pointerup; + +return root; + +})(eventjs.proxy); +/*: + "Device Motion" and "Shake" event proxy. + ---------------------------------------------------- + http://developer.android.com/reference/android/hardware/Sensoreventjs.html#values + ---------------------------------------------------- + eventjs.add(window, "shake", function(event, self) {}); + eventjs.add(window, "devicemotion", function(event, self) { + console.log(self.acceleration, self.accelerationIncludingGravity); + }); +*/ + +if (typeof(eventjs) === "undefined") var eventjs = {}; +if (typeof(eventjs.proxy) === "undefined") eventjs.proxy = {}; + +eventjs.proxy = (function(root) { "use strict"; + +root.shake = function(conf) { + // Externally accessible data. + var self = { + gesture: "devicemotion", + acceleration: {}, + accelerationIncludingGravity: {}, + target: conf.target, + listener: conf.listener, + remove: function() { + window.removeEventListener('devicemotion', onDeviceMotion, false); + } + }; + // Setting up local variables. + var threshold = 4; // Gravitational threshold. + var timeout = 1000; // Timeout between shake events. + var timeframe = 200; // Time between shakes. + var shakes = 3; // Minimum shakes to trigger event. + var lastShake = (new Date()).getTime(); + var gravity = { x: 0, y: 0, z: 0 }; + var delta = { + x: { count: 0, value: 0 }, + y: { count: 0, value: 0 }, + z: { count: 0, value: 0 } + }; + // Tracking the events. + var onDeviceMotion = function(e) { + var alpha = 0.8; // Low pass filter. + var o = e.accelerationIncludingGravity; + gravity.x = alpha * gravity.x + (1 - alpha) * o.x; + gravity.y = alpha * gravity.y + (1 - alpha) * o.y; + gravity.z = alpha * gravity.z + (1 - alpha) * o.z; + self.accelerationIncludingGravity = gravity; + self.acceleration.x = o.x - gravity.x; + self.acceleration.y = o.y - gravity.y; + self.acceleration.z = o.z - gravity.z; + /// + if (conf.gesture === "devicemotion") { + conf.listener(e, self); + return; + } + var data = "xyz"; + var now = (new Date()).getTime(); + for (var n = 0, length = data.length; n < length; n ++) { + var letter = data[n]; + var ACCELERATION = self.acceleration[letter]; + var DELTA = delta[letter]; + var abs = Math.abs(ACCELERATION); + /// Check whether another shake event was recently registered. + if (now - lastShake < timeout) continue; + /// Check whether delta surpasses threshold. + if (abs > threshold) { + var idx = now * ACCELERATION / abs; + var span = Math.abs(idx + DELTA.value); + // Check whether last delta was registered within timeframe. + if (DELTA.value && span < timeframe) { + DELTA.value = idx; + DELTA.count ++; + // Check whether delta count has enough shakes. + if (DELTA.count === shakes) { + conf.listener(e, self); + // Reset tracking. + lastShake = now; + DELTA.value = 0; + DELTA.count = 0; + } + } else { + // Track first shake. + DELTA.value = idx; + DELTA.count = 1; + } + } + } + }; + // Attach events. + if (!window.addEventListener) return; + window.addEventListener('devicemotion', onDeviceMotion, false); + // Return this object. + return self; +}; + +eventjs.Gesture = eventjs.Gesture || {}; +eventjs.Gesture._gestureHandlers = eventjs.Gesture._gestureHandlers || {}; +eventjs.Gesture._gestureHandlers.shake = root.shake; + +return root; + +})(eventjs.proxy); +/*: + "Swipe" event proxy (1+ fingers). + ---------------------------------------------------- + CONFIGURE: snap, threshold, maxFingers. + ---------------------------------------------------- + eventjs.add(window, "swipe", function(event, self) { + console.log(self.velocity, self.angle); + }); +*/ + +if (typeof(eventjs) === "undefined") var eventjs = {}; +if (typeof(eventjs.proxy) === "undefined") eventjs.proxy = {}; + +eventjs.proxy = (function(root) { "use strict"; + +var RAD_DEG = Math.PI / 180; + +root.swipe = function(conf) { + conf.snap = conf.snap || 90; // angle snap. + conf.threshold = conf.threshold || 1; // velocity threshold. + conf.gesture = conf.gesture || "swipe"; + // Tracking the events. + conf.onPointerDown = function (event) { + if (root.pointerStart(event, self, conf)) { + eventjs.add(conf.doc, "mousemove", conf.onPointerMove).listener(event); + eventjs.add(conf.doc, "mouseup", conf.onPointerUp); + } + }; + conf.onPointerMove = function (event) { + var touches = event.changedTouches || root.getCoords(event); + var length = touches.length; + for (var i = 0; i < length; i ++) { + var touch = touches[i]; + var sid = touch.identifier || Infinity; + var o = conf.tracker[sid]; + // Identifier defined outside of listener. + if (!o) continue; + o.move.x = touch.pageX; + o.move.y = touch.pageY; + o.moveTime = (new Date()).getTime(); + } + }; + conf.onPointerUp = function(event) { + if (root.pointerEnd(event, self, conf)) { + eventjs.remove(conf.doc, "mousemove", conf.onPointerMove); + eventjs.remove(conf.doc, "mouseup", conf.onPointerUp); + /// + var velocity1; + var velocity2 + var degree1; + var degree2; + /// Calculate centroid of gesture. + var start = { x: 0, y: 0 }; + var endx = 0; + var endy = 0; + var length = 0; + /// + for (var sid in conf.tracker) { + var touch = conf.tracker[sid]; + var xdist = touch.move.x - touch.start.x; + var ydist = touch.move.y - touch.start.y; + /// + endx += touch.move.x; + endy += touch.move.y; + start.x += touch.start.x; + start.y += touch.start.y; + length ++; + /// + var distance = Math.sqrt(xdist * xdist + ydist * ydist); + var ms = touch.moveTime - touch.startTime; + var degree2 = Math.atan2(xdist, ydist) / RAD_DEG + 180; + var velocity2 = ms ? distance / ms : 0; + if (typeof(degree1) === "undefined") { + degree1 = degree2; + velocity1 = velocity2; + } else if (Math.abs(degree2 - degree1) <= 20) { + degree1 = (degree1 + degree2) / 2; + velocity1 = (velocity1 + velocity2) / 2; + } else { + return; + } + } + /// + var fingers = conf.gestureFingers; + if (conf.minFingers <= fingers && conf.maxFingers >= fingers) { + if (velocity1 > conf.threshold) { + start.x /= length; + start.y /= length; + self.start = start; + self.x = endx / length; + self.y = endy / length; + self.angle = -((((degree1 / conf.snap + 0.5) >> 0) * conf.snap || 360) - 360); + self.velocity = velocity1; + self.fingers = fingers; + self.state = "swipe"; + conf.listener(event, self); + } + } + } + }; + // Generate maintenance commands, and other configurations. + var self = root.pointerSetup(conf); + // Attach events. + eventjs.add(conf.target, "mousedown", conf.onPointerDown); + // Return this object. + return self; +}; + +eventjs.Gesture = eventjs.Gesture || {}; +eventjs.Gesture._gestureHandlers = eventjs.Gesture._gestureHandlers || {}; +eventjs.Gesture._gestureHandlers.swipe = root.swipe; + +return root; + +})(eventjs.proxy); +/*: + "Tap" and "Longpress" event proxy. + ---------------------------------------------------- + CONFIGURE: delay (longpress), timeout (tap). + ---------------------------------------------------- + eventjs.add(window, "tap", function(event, self) { + console.log(self.fingers); + }); + ---------------------------------------------------- + multi-finger tap // touch an target for <= 250ms. + multi-finger longpress // touch an target for >= 500ms +*/ + +if (typeof(eventjs) === "undefined") var eventjs = {}; +if (typeof(eventjs.proxy) === "undefined") eventjs.proxy = {}; + +eventjs.proxy = (function(root) { "use strict"; + +root.longpress = function(conf) { + conf.gesture = "longpress"; + return root.tap(conf); +}; + +root.tap = function(conf) { + conf.delay = conf.delay || 500; + conf.timeout = conf.timeout || 250; + conf.driftDeviance = conf.driftDeviance || 10; + conf.gesture = conf.gesture || "tap"; + // Setting up local variables. + var timestamp, timeout; + // Tracking the events. + conf.onPointerDown = function (event) { + if (root.pointerStart(event, self, conf)) { + timestamp = (new Date()).getTime(); + // Initialize event listeners. + eventjs.add(conf.doc, "mousemove", conf.onPointerMove).listener(event); + eventjs.add(conf.doc, "mouseup", conf.onPointerUp); + // Make sure this is a "longpress" event. + if (conf.gesture !== "longpress") return; + timeout = setTimeout(function() { + if (event.cancelBubble && ++event.cancelBubbleCount > 1) return; + // Make sure no fingers have been changed. + var fingers = 0; + for (var key in conf.tracker) { + var point = conf.tracker[key]; + if (point.end === true) return; + if (conf.cancel) return; + fingers ++; + } + // Send callback. + if (conf.minFingers <= fingers && conf.maxFingers >= fingers) { + self.state = "start"; + self.fingers = fingers; + self.x = point.start.x; + self.y = point.start.y; + conf.listener(event, self); + } + }, conf.delay); + } + }; + conf.onPointerMove = function (event) { + var bbox = conf.bbox; + var touches = event.changedTouches || root.getCoords(event); + var length = touches.length; + for (var i = 0; i < length; i ++) { + var touch = touches[i]; + var identifier = touch.identifier || Infinity; + var pt = conf.tracker[identifier]; + if (!pt) continue; + var x = (touch.pageX - bbox.x1); + var y = (touch.pageY - bbox.y1); + /// + var dx = x - pt.start.x; + var dy = y - pt.start.y; + var distance = Math.sqrt(dx * dx + dy * dy); + if (!(x > 0 && x < bbox.width && // Within target coordinates.. + y > 0 && y < bbox.height && + distance <= conf.driftDeviance)) { // Within drift deviance. + // Cancel out this listener. + eventjs.remove(conf.doc, "mousemove", conf.onPointerMove); + conf.cancel = true; + return; + } + } + }; + conf.onPointerUp = function(event) { + if (root.pointerEnd(event, self, conf)) { + clearTimeout(timeout); + eventjs.remove(conf.doc, "mousemove", conf.onPointerMove); + eventjs.remove(conf.doc, "mouseup", conf.onPointerUp); + if (event.cancelBubble && ++event.cancelBubbleCount > 1) return; + // Callback release on longpress. + if (conf.gesture === "longpress") { + if (self.state === "start") { + self.state = "end"; + conf.listener(event, self); + } + return; + } + // Cancel event due to movement. + if (conf.cancel) return; + // Ensure delay is within margins. + if ((new Date()).getTime() - timestamp > conf.timeout) return; + // Send callback. + var fingers = conf.gestureFingers; + if (conf.minFingers <= fingers && conf.maxFingers >= fingers) { + self.state = "tap"; + self.fingers = conf.gestureFingers; + conf.listener(event, self); + } + } + }; + // Generate maintenance commands, and other configurations. + var self = root.pointerSetup(conf); + // Attach events. + eventjs.add(conf.target, "mousedown", conf.onPointerDown); + // Return this object. + return self; +}; + +eventjs.Gesture = eventjs.Gesture || {}; +eventjs.Gesture._gestureHandlers = eventjs.Gesture._gestureHandlers || {}; +eventjs.Gesture._gestureHandlers.tap = root.tap; +eventjs.Gesture._gestureHandlers.longpress = root.longpress; + +return root; + +})(eventjs.proxy); +/*: + "Mouse Wheel" event proxy. + ---------------------------------------------------- + eventjs.add(window, "wheel", function(event, self) { + console.log(self.state, self.wheelDelta); + }); +*/ + +if (typeof(eventjs) === "undefined") var eventjs = {}; +if (typeof(eventjs.proxy) === "undefined") eventjs.proxy = {}; + +eventjs.proxy = (function(root) { "use strict"; + +root.wheelPreventElasticBounce = function(el) { + if (!el) return; + if (typeof(el) === "string") el = document.querySelector(el); + eventjs.add(el, "wheel", function(event, self) { + self.preventElasticBounce(); + eventjs.stop(event); + }); +}; + +root.wheel = function(conf) { + // Configure event listener. + var interval; + var timeout = conf.timeout || 150; + var count = 0; + // Externally accessible data. + var self = { + gesture: "wheel", + state: "start", + wheelDelta: 0, + target: conf.target, + listener: conf.listener, + preventElasticBounce: function(event) { + var target = this.target; + var scrollTop = target.scrollTop; + var top = scrollTop + target.offsetHeight; + var height = target.scrollHeight; + if (top === height && this.wheelDelta <= 0) eventjs.cancel(event); + else if (scrollTop === 0 && this.wheelDelta >= 0) eventjs.cancel(event); + eventjs.stop(event); + }, + add: function() { + conf.target[add](type, onMouseWheel, false); + }, + remove: function() { + conf.target[remove](type, onMouseWheel, false); + } + }; + // Tracking the events. + var onMouseWheel = function(event) { + event = event || window.event; + self.state = count++ ? "change" : "start"; + self.wheelDelta = event.detail ? event.detail * -20 : event.wheelDelta; + conf.listener(event, self); + clearTimeout(interval); + interval = setTimeout(function() { + count = 0; + self.state = "end"; + self.wheelDelta = 0; + conf.listener(event, self); + }, timeout); + }; + // Attach events. + var add = document.addEventListener ? "addEventListener" : "attachEvent"; + var remove = document.removeEventListener ? "removeEventListener" : "detachEvent"; + var type = eventjs.getEventSupport("mousewheel") ? "mousewheel" : "DOMMouseScroll"; + conf.target[add](type, onMouseWheel, false); + // Return this object. + return self; +}; + +eventjs.Gesture = eventjs.Gesture || {}; +eventjs.Gesture._gestureHandlers = eventjs.Gesture._gestureHandlers || {}; +eventjs.Gesture._gestureHandlers.wheel = root.wheel; + +return root; + +})(eventjs.proxy); +/* + "Orientation Change" + ---------------------------------------------------- + https://developer.apple.com/library/safari/documentation/SafariDOMAdditions/Reference/DeviceOrientationEventClassRef/DeviceOrientationEvent/DeviceOrientationEvent.html#//apple_ref/doc/uid/TP40010526 + ---------------------------------------------------- + Event.add(window, "deviceorientation", function(event, self) {}); +*/ + +if (typeof(Event) === "undefined") var Event = {}; +if (typeof(Event.proxy) === "undefined") Event.proxy = {}; + +Event.proxy = (function(root) { "use strict"; + +root.orientation = function(conf) { + // Externally accessible data. + var self = { + gesture: "orientationchange", + previous: null, /* Report the previous orientation */ + current: window.orientation, + target: conf.target, + listener: conf.listener, + remove: function() { + window.removeEventListener('orientationchange', onOrientationChange, false); + } + }; + + // Tracking the events. + var onOrientationChange = function(e) { + + self.previous = self.current; + self.current = window.orientation; + if(self.previous !== null && self.previous != self.current) { + conf.listener(e, self); + return; + } + + + }; + // Attach events. + if (window.DeviceOrientationEvent) { + window.addEventListener("orientationchange", onOrientationChange, false); + } + // Return this object. + return self; +}; + +Event.Gesture = Event.Gesture || {}; +Event.Gesture._gestureHandlers = Event.Gesture._gestureHandlers || {}; +Event.Gesture._gestureHandlers.orientation = root.orientation; + +return root; + +})(Event.proxy); +(function() { + + /** + * @private + * @param {String} eventName + * @param {Function} handler + */ + function _removeEventListener(eventName, handler) { + if (!this.__eventListeners[eventName]) { + return; + } + var eventListener = this.__eventListeners[eventName]; + if (handler) { + eventListener[eventListener.indexOf(handler)] = false; + } + else { + fabric.util.array.fill(eventListener, false); + } + } + + /** + * Observes specified event + * @memberOf fabric.Observable + * @alias on + * @param {String|Object} eventName Event name (eg. 'after:render') or object with key/value pairs (eg. {'after:render': handler, 'selection:cleared': handler}) + * @param {Function} handler Function that receives a notification when an event of the specified type occurs + * @return {Self} thisArg + * @chainable + */ + function on(eventName, handler) { + if (!this.__eventListeners) { + this.__eventListeners = { }; + } + // one object with key/value pairs was passed + if (arguments.length === 1) { + for (var prop in eventName) { + this.on(prop, eventName[prop]); + } + } + else { + if (!this.__eventListeners[eventName]) { + this.__eventListeners[eventName] = []; + } + this.__eventListeners[eventName].push(handler); + } + return this; + } + + /** + * Stops event observing for a particular event handler. Calling this method + * without arguments removes all handlers for all events + * @memberOf fabric.Observable + * @alias off + * @param {String|Object} eventName Event name (eg. 'after:render') or object with key/value pairs (eg. {'after:render': handler, 'selection:cleared': handler}) + * @param {Function} handler Function to be deleted from EventListeners + * @return {Self} thisArg + * @chainable + */ + function off(eventName, handler) { + if (!this.__eventListeners) { + return this; + } + + // remove all key/value pairs (event name -> event handler) + if (arguments.length === 0) { + for (eventName in this.__eventListeners) { + _removeEventListener.call(this, eventName); + } + } + // one object with key/value pairs was passed + else if (arguments.length === 1 && typeof arguments[0] === 'object') { + for (var prop in eventName) { + _removeEventListener.call(this, prop, eventName[prop]); + } + } + else { + _removeEventListener.call(this, eventName, handler); + } + return this; + } + + /** + * Fires event with an optional options object + * @memberOf fabric.Observable + * @param {String} eventName Event name to fire + * @param {Object} [options] Options object + * @return {Self} thisArg + * @chainable + */ + function fire(eventName, options) { + if (!this.__eventListeners) { + return this; + } + + var listenersForEvent = this.__eventListeners[eventName]; + if (!listenersForEvent) { + return this; + } + + for (var i = 0, len = listenersForEvent.length; i < len; i++) { + listenersForEvent[i] && listenersForEvent[i].call(this, options || { }); + } + this.__eventListeners[eventName] = listenersForEvent.filter(function(value) { + return value !== false; + }); + return this; + } + + /** + * @namespace fabric.Observable + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2#events} + * @see {@link http://fabricjs.com/events|Events demo} + */ + fabric.Observable = { + fire: fire, + on: on, + off: off, + }; +})(); +/** + * @namespace fabric.Collection + */ +fabric.Collection = { + + _objects: [], + + /** + * Adds objects to collection, Canvas or Group, then renders canvas + * (if `renderOnAddRemove` is not `false`). + * in case of Group no changes to bounding box are made. + * Objects should be instances of (or inherit from) fabric.Object + * Use of this function is highly discouraged for groups. + * you can add a bunch of objects with the add method but then you NEED + * to run a addWithUpdate call for the Group class or position/bbox will be wrong. + * @param {...fabric.Object} object Zero or more fabric instances + * @return {Self} thisArg + * @chainable + */ + add: function () { + this._objects.push.apply(this._objects, arguments); + if (this._onObjectAdded) { + for (var i = 0, length = arguments.length; i < length; i++) { + this._onObjectAdded(arguments[i]); + } + } + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * Inserts an object into collection at specified index, then renders canvas (if `renderOnAddRemove` is not `false`) + * An object should be an instance of (or inherit from) fabric.Object + * Use of this function is highly discouraged for groups. + * you can add a bunch of objects with the insertAt method but then you NEED + * to run a addWithUpdate call for the Group class or position/bbox will be wrong. + * @param {Object} object Object to insert + * @param {Number} index Index to insert object at + * @param {Boolean} nonSplicing When `true`, no splicing (shifting) of objects occurs + * @return {Self} thisArg + * @chainable + */ + insertAt: function (object, index, nonSplicing) { + var objects = this._objects; + if (nonSplicing) { + objects[index] = object; + } + else { + objects.splice(index, 0, object); + } + this._onObjectAdded && this._onObjectAdded(object); + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * Removes objects from a collection, then renders canvas (if `renderOnAddRemove` is not `false`) + * @param {...fabric.Object} object Zero or more fabric instances + * @return {Self} thisArg + * @chainable + */ + remove: function() { + var objects = this._objects, + index, somethingRemoved = false; + + for (var i = 0, length = arguments.length; i < length; i++) { + index = objects.indexOf(arguments[i]); + + // only call onObjectRemoved if an object was actually removed + if (index !== -1) { + somethingRemoved = true; + objects.splice(index, 1); + this._onObjectRemoved && this._onObjectRemoved(arguments[i]); + } + } + + this.renderOnAddRemove && somethingRemoved && this.requestRenderAll(); + return this; + }, + + /** + * Executes given function for each object in this group + * @param {Function} callback + * Callback invoked with current object as first argument, + * index - as second and an array of all objects - as third. + * Callback is invoked in a context of Global Object (e.g. `window`) + * when no `context` argument is given + * + * @param {Object} context Context (aka thisObject) + * @return {Self} thisArg + * @chainable + */ + forEachObject: function(callback, context) { + var objects = this.getObjects(); + for (var i = 0, len = objects.length; i < len; i++) { + callback.call(context, objects[i], i, objects); + } + return this; + }, + + /** + * Returns an array of children objects of this instance + * Type parameter introduced in 1.3.10 + * since 2.3.5 this method return always a COPY of the array; + * @param {String} [type] When specified, only objects of this type are returned + * @return {Array} + */ + getObjects: function(type) { + if (typeof type === 'undefined') { + return this._objects.concat(); + } + return this._objects.filter(function(o) { + return o.type === type; + }); + }, + + /** + * Returns object at specified index + * @param {Number} index + * @return {Self} thisArg + */ + item: function (index) { + return this._objects[index]; + }, + + /** + * Returns true if collection contains no objects + * @return {Boolean} true if collection is empty + */ + isEmpty: function () { + return this._objects.length === 0; + }, + + /** + * Returns a size of a collection (i.e: length of an array containing its objects) + * @return {Number} Collection size + */ + size: function() { + return this._objects.length; + }, + + /** + * Returns true if collection contains an object + * @param {Object} object Object to check against + * @return {Boolean} `true` if collection contains an object + */ + contains: function(object) { + return this._objects.indexOf(object) > -1; + }, + + /** + * Returns number representation of a collection complexity + * @return {Number} complexity + */ + complexity: function () { + return this._objects.reduce(function (memo, current) { + memo += current.complexity ? current.complexity() : 0; + return memo; + }, 0); + } +}; +/** + * @namespace fabric.CommonMethods + */ +fabric.CommonMethods = { + + /** + * Sets object's properties from options + * @param {Object} [options] Options object + */ + _setOptions: function(options) { + for (var prop in options) { + this.set(prop, options[prop]); + } + }, + + /** + * @private + * @param {Object} [filler] Options object + * @param {String} [property] property to set the Gradient to + */ + _initGradient: function(filler, property) { + if (filler && filler.colorStops && !(filler instanceof fabric.Gradient)) { + this.set(property, new fabric.Gradient(filler)); + } + }, + + /** + * @private + * @param {Object} [filler] Options object + * @param {String} [property] property to set the Pattern to + * @param {Function} [callback] callback to invoke after pattern load + */ + _initPattern: function(filler, property, callback) { + if (filler && filler.source && !(filler instanceof fabric.Pattern)) { + this.set(property, new fabric.Pattern(filler, callback)); + } + else { + callback && callback(); + } + }, + + /** + * @private + */ + _setObject: function(obj) { + for (var prop in obj) { + this._set(prop, obj[prop]); + } + }, + + /** + * Sets property to a given value. When changing position/dimension -related properties (left, top, scale, angle, etc.) `set` does not update position of object's borders/controls. If you need to update those, call `setCoords()`. + * @param {String|Object} key Property name or object (if object, iterate over the object properties) + * @param {Object|Function} value Property value (if function, the value is passed into it and its return value is used as a new one) + * @return {fabric.Object} thisArg + * @chainable + */ + set: function(key, value) { + if (typeof key === 'object') { + this._setObject(key); + } + else { + this._set(key, value); + } + return this; + }, + + _set: function(key, value) { + this[key] = value; + }, + + /** + * Toggles specified property from `true` to `false` or from `false` to `true` + * @param {String} property Property to toggle + * @return {fabric.Object} thisArg + * @chainable + */ + toggle: function(property) { + var value = this.get(property); + if (typeof value === 'boolean') { + this.set(property, !value); + } + return this; + }, + + /** + * Basic getter + * @param {String} property Property name + * @return {*} value of a property + */ + get: function(property) { + return this[property]; + } +}; +(function(global) { + + var sqrt = Math.sqrt, + atan2 = Math.atan2, + pow = Math.pow, + PiBy180 = Math.PI / 180, + PiBy2 = Math.PI / 2; + + /** + * @namespace fabric.util + */ + fabric.util = { + + /** + * Calculate the cos of an angle, avoiding returning floats for known results + * @static + * @memberOf fabric.util + * @param {Number} angle the angle in radians or in degree + * @return {Number} + */ + cos: function(angle) { + if (angle === 0) { return 1; } + if (angle < 0) { + // cos(a) = cos(-a) + angle = -angle; + } + var angleSlice = angle / PiBy2; + switch (angleSlice) { + case 1: case 3: return 0; + case 2: return -1; + } + return Math.cos(angle); + }, + + /** + * Calculate the sin of an angle, avoiding returning floats for known results + * @static + * @memberOf fabric.util + * @param {Number} angle the angle in radians or in degree + * @return {Number} + */ + sin: function(angle) { + if (angle === 0) { return 0; } + var angleSlice = angle / PiBy2, sign = 1; + if (angle < 0) { + // sin(-a) = -sin(a) + sign = -1; + } + switch (angleSlice) { + case 1: return sign; + case 2: return 0; + case 3: return -sign; + } + return Math.sin(angle); + }, + + /** + * Removes value from an array. + * Presence of value (and its position in an array) is determined via `Array.prototype.indexOf` + * @static + * @memberOf fabric.util + * @param {Array} array + * @param {*} value + * @return {Array} original array + */ + removeFromArray: function(array, value) { + var idx = array.indexOf(value); + if (idx !== -1) { + array.splice(idx, 1); + } + return array; + }, + + /** + * Returns random number between 2 specified ones. + * @static + * @memberOf fabric.util + * @param {Number} min lower limit + * @param {Number} max upper limit + * @return {Number} random value (between min and max) + */ + getRandomInt: function(min, max) { + return Math.floor(Math.random() * (max - min + 1)) + min; + }, + + /** + * Transforms degrees to radians. + * @static + * @memberOf fabric.util + * @param {Number} degrees value in degrees + * @return {Number} value in radians + */ + degreesToRadians: function(degrees) { + return degrees * PiBy180; + }, + + /** + * Transforms radians to degrees. + * @static + * @memberOf fabric.util + * @param {Number} radians value in radians + * @return {Number} value in degrees + */ + radiansToDegrees: function(radians) { + return radians / PiBy180; + }, + + /** + * Rotates `point` around `origin` with `radians` + * @static + * @memberOf fabric.util + * @param {fabric.Point} point The point to rotate + * @param {fabric.Point} origin The origin of the rotation + * @param {Number} radians The radians of the angle for the rotation + * @return {fabric.Point} The new rotated point + */ + rotatePoint: function(point, origin, radians) { + point.subtractEquals(origin); + var v = fabric.util.rotateVector(point, radians); + return new fabric.Point(v.x, v.y).addEquals(origin); + }, + + /** + * Rotates `vector` with `radians` + * @static + * @memberOf fabric.util + * @param {Object} vector The vector to rotate (x and y) + * @param {Number} radians The radians of the angle for the rotation + * @return {Object} The new rotated point + */ + rotateVector: function(vector, radians) { + var sin = fabric.util.sin(radians), + cos = fabric.util.cos(radians), + rx = vector.x * cos - vector.y * sin, + ry = vector.x * sin + vector.y * cos; + return { + x: rx, + y: ry + }; + }, + + /** + * Apply transform t to point p + * @static + * @memberOf fabric.util + * @param {fabric.Point} p The point to transform + * @param {Array} t The transform + * @param {Boolean} [ignoreOffset] Indicates that the offset should not be applied + * @return {fabric.Point} The transformed point + */ + transformPoint: function(p, t, ignoreOffset) { + if (ignoreOffset) { + return new fabric.Point( + t[0] * p.x + t[2] * p.y, + t[1] * p.x + t[3] * p.y + ); + } + return new fabric.Point( + t[0] * p.x + t[2] * p.y + t[4], + t[1] * p.x + t[3] * p.y + t[5] + ); + }, + + /** + * Returns coordinates of points's bounding rectangle (left, top, width, height) + * @param {Array} points 4 points array + * @param {Array} [transform] an array of 6 numbers representing a 2x3 transform matrix + * @return {Object} Object with left, top, width, height properties + */ + makeBoundingBoxFromPoints: function(points, transform) { + if (transform) { + for (var i = 0; i < points.length; i++) { + points[i] = fabric.util.transformPoint(points[i], transform); + } + } + var xPoints = [points[0].x, points[1].x, points[2].x, points[3].x], + minX = fabric.util.array.min(xPoints), + maxX = fabric.util.array.max(xPoints), + width = maxX - minX, + yPoints = [points[0].y, points[1].y, points[2].y, points[3].y], + minY = fabric.util.array.min(yPoints), + maxY = fabric.util.array.max(yPoints), + height = maxY - minY; + + return { + left: minX, + top: minY, + width: width, + height: height + }; + }, + + /** + * Invert transformation t + * @static + * @memberOf fabric.util + * @param {Array} t The transform + * @return {Array} The inverted transform + */ + invertTransform: function(t) { + var a = 1 / (t[0] * t[3] - t[1] * t[2]), + r = [a * t[3], -a * t[1], -a * t[2], a * t[0]], + o = fabric.util.transformPoint({ x: t[4], y: t[5] }, r, true); + r[4] = -o.x; + r[5] = -o.y; + return r; + }, + + /** + * A wrapper around Number#toFixed, which contrary to native method returns number, not string. + * @static + * @memberOf fabric.util + * @param {Number|String} number number to operate on + * @param {Number} fractionDigits number of fraction digits to "leave" + * @return {Number} + */ + toFixed: function(number, fractionDigits) { + return parseFloat(Number(number).toFixed(fractionDigits)); + }, + + /** + * Converts from attribute value to pixel value if applicable. + * Returns converted pixels or original value not converted. + * @param {Number|String} value number to operate on + * @param {Number} fontSize + * @return {Number|String} + */ + parseUnit: function(value, fontSize) { + var unit = /\D{0,2}$/.exec(value), + number = parseFloat(value); + if (!fontSize) { + fontSize = fabric.Text.DEFAULT_SVG_FONT_SIZE; + } + switch (unit[0]) { + case 'mm': + return number * fabric.DPI / 25.4; + + case 'cm': + return number * fabric.DPI / 2.54; + + case 'in': + return number * fabric.DPI; + + case 'pt': + return number * fabric.DPI / 72; // or * 4 / 3 + + case 'pc': + return number * fabric.DPI / 72 * 12; // or * 16 + + case 'em': + return number * fontSize; + + default: + return number; + } + }, + + /** + * Function which always returns `false`. + * @static + * @memberOf fabric.util + * @return {Boolean} + */ + falseFunction: function() { + return false; + }, + + /** + * Returns klass "Class" object of given namespace + * @memberOf fabric.util + * @param {String} type Type of object (eg. 'circle') + * @param {String} namespace Namespace to get klass "Class" object from + * @return {Object} klass "Class" + */ + getKlass: function(type, namespace) { + // capitalize first letter only + type = fabric.util.string.camelize(type.charAt(0).toUpperCase() + type.slice(1)); + return fabric.util.resolveNamespace(namespace)[type]; + }, + + /** + * Returns array of attributes for given svg that fabric parses + * @memberOf fabric.util + * @param {String} type Type of svg element (eg. 'circle') + * @return {Array} string names of supported attributes + */ + getSvgAttributes: function(type) { + var attributes = [ + 'instantiated_by_use', + 'style', + 'id', + 'class' + ]; + switch (type) { + case 'linearGradient': + attributes = attributes.concat(['x1', 'y1', 'x2', 'y2', 'gradientUnits', 'gradientTransform']); + break; + case 'radialGradient': + attributes = attributes.concat(['gradientUnits', 'gradientTransform', 'cx', 'cy', 'r', 'fx', 'fy', 'fr']); + break; + case 'stop': + attributes = attributes.concat(['offset', 'stop-color', 'stop-opacity']); + break; + } + return attributes; + }, + + /** + * Returns object of given namespace + * @memberOf fabric.util + * @param {String} namespace Namespace string e.g. 'fabric.Image.filter' or 'fabric' + * @return {Object} Object for given namespace (default fabric) + */ + resolveNamespace: function(namespace) { + if (!namespace) { + return fabric; + } + + var parts = namespace.split('.'), + len = parts.length, i, + obj = global || fabric.window; + + for (i = 0; i < len; ++i) { + obj = obj[parts[i]]; + } + + return obj; + }, + + /** + * Loads image element from given url and passes it to a callback + * @memberOf fabric.util + * @param {String} url URL representing an image + * @param {Function} callback Callback; invoked with loaded image + * @param {*} [context] Context to invoke callback in + * @param {Object} [crossOrigin] crossOrigin value to set image element to + */ + loadImage: function(url, callback, context, crossOrigin) { + if (!url) { + callback && callback.call(context, url); + return; + } + + var img = fabric.util.createImage(); + + /** @ignore */ + var onLoadCallback = function () { + callback && callback.call(context, img, false); + img = img.onload = img.onerror = null; + }; + + img.onload = onLoadCallback; + /** @ignore */ + img.onerror = function() { + fabric.log('Error loading ' + img.src); + callback && callback.call(context, null, true); + img = img.onload = img.onerror = null; + }; + + // data-urls appear to be buggy with crossOrigin + // https://github.com/kangax/fabric.js/commit/d0abb90f1cd5c5ef9d2a94d3fb21a22330da3e0a#commitcomment-4513767 + // see https://code.google.com/p/chromium/issues/detail?id=315152 + // https://bugzilla.mozilla.org/show_bug.cgi?id=935069 + // crossOrigin null is the same as not set. + if (url.indexOf('data') !== 0 && + crossOrigin !== undefined && + crossOrigin !== null) { + img.crossOrigin = crossOrigin; + } + + // IE10 / IE11-Fix: SVG contents from data: URI + // will only be available if the IMG is present + // in the DOM (and visible) + if (url.substring(0,14) === 'data:image/svg') { + img.onload = null; + fabric.util.loadImageInDom(img, onLoadCallback); + } + + img.src = url; + }, + + /** + * Attaches SVG image with data: URL to the dom + * @memberOf fabric.util + * @param {Object} img Image object with data:image/svg src + * @param {Function} callback Callback; invoked with loaded image + * @return {Object} DOM element (div containing the SVG image) + */ + loadImageInDom: function(img, onLoadCallback) { + var div = fabric.document.createElement('div'); + div.style.width = div.style.height = '1px'; + div.style.left = div.style.top = '-100%'; + div.style.position = 'absolute'; + div.appendChild(img); + fabric.document.querySelector('body').appendChild(div); + /** + * Wrap in function to: + * 1. Call existing callback + * 2. Cleanup DOM + */ + img.onload = function () { + onLoadCallback(); + div.parentNode.removeChild(div); + div = null; + }; + }, + + /** + * Creates corresponding fabric instances from their object representations + * @static + * @memberOf fabric.util + * @param {Array} objects Objects to enliven + * @param {Function} callback Callback to invoke when all objects are created + * @param {String} namespace Namespace to get klass "Class" object from + * @param {Function} reviver Method for further parsing of object elements, + * called after each fabric object created. + */ + enlivenObjects: function(objects, callback, namespace, reviver) { + objects = objects || []; + + var enlivenedObjects = [], + numLoadedObjects = 0, + numTotalObjects = objects.length; + + function onLoaded() { + if (++numLoadedObjects === numTotalObjects) { + callback && callback(enlivenedObjects.filter(function(obj) { + // filter out undefined objects (objects that gave error) + return obj; + })); + } + } + + if (!numTotalObjects) { + callback && callback(enlivenedObjects); + return; + } + + objects.forEach(function (o, index) { + // if sparse array + if (!o || !o.type) { + onLoaded(); + return; + } + var klass = fabric.util.getKlass(o.type, namespace); + klass.fromObject(o, function (obj, error) { + error || (enlivenedObjects[index] = obj); + reviver && reviver(o, obj, error); + onLoaded(); + }); + }); + }, + + /** + * Create and wait for loading of patterns + * @static + * @memberOf fabric.util + * @param {Array} patterns Objects to enliven + * @param {Function} callback Callback to invoke when all objects are created + * called after each fabric object created. + */ + enlivenPatterns: function(patterns, callback) { + patterns = patterns || []; + + function onLoaded() { + if (++numLoadedPatterns === numPatterns) { + callback && callback(enlivenedPatterns); + } + } + + var enlivenedPatterns = [], + numLoadedPatterns = 0, + numPatterns = patterns.length; + + if (!numPatterns) { + callback && callback(enlivenedPatterns); + return; + } + + patterns.forEach(function (p, index) { + if (p && p.source) { + new fabric.Pattern(p, function(pattern) { + enlivenedPatterns[index] = pattern; + onLoaded(); + }); + } + else { + enlivenedPatterns[index] = p; + onLoaded(); + } + }); + }, + + /** + * Groups SVG elements (usually those retrieved from SVG document) + * @static + * @memberOf fabric.util + * @param {Array} elements SVG elements to group + * @param {Object} [options] Options object + * @param {String} path Value to set sourcePath to + * @return {fabric.Object|fabric.Group} + */ + groupSVGElements: function(elements, options, path) { + var object; + if (elements && elements.length === 1) { + return elements[0]; + } + if (options) { + if (options.width && options.height) { + options.centerPoint = { + x: options.width / 2, + y: options.height / 2 + }; + } + else { + delete options.width; + delete options.height; + } + } + object = new fabric.Group(elements, options); + if (typeof path !== 'undefined') { + object.sourcePath = path; + } + return object; + }, + + /** + * Populates an object with properties of another object + * @static + * @memberOf fabric.util + * @param {Object} source Source object + * @param {Object} destination Destination object + * @return {Array} properties Properties names to include + */ + populateWithProperties: function(source, destination, properties) { + if (properties && Object.prototype.toString.call(properties) === '[object Array]') { + for (var i = 0, len = properties.length; i < len; i++) { + if (properties[i] in source) { + destination[properties[i]] = source[properties[i]]; + } + } + } + }, + + /** + * Draws a dashed line between two points + * + * This method is used to draw dashed line around selection area. + * See dotted stroke in canvas + * + * @param {CanvasRenderingContext2D} ctx context + * @param {Number} x start x coordinate + * @param {Number} y start y coordinate + * @param {Number} x2 end x coordinate + * @param {Number} y2 end y coordinate + * @param {Array} da dash array pattern + */ + drawDashedLine: function(ctx, x, y, x2, y2, da) { + var dx = x2 - x, + dy = y2 - y, + len = sqrt(dx * dx + dy * dy), + rot = atan2(dy, dx), + dc = da.length, + di = 0, + draw = true; + + ctx.save(); + ctx.translate(x, y); + ctx.moveTo(0, 0); + ctx.rotate(rot); + + x = 0; + while (len > x) { + x += da[di++ % dc]; + if (x > len) { + x = len; + } + ctx[draw ? 'lineTo' : 'moveTo'](x, 0); + draw = !draw; + } + + ctx.restore(); + }, + + /** + * Creates canvas element + * @static + * @memberOf fabric.util + * @return {CanvasElement} initialized canvas element + */ + createCanvasElement: function() { + return fabric.document.createElement('canvas'); + }, + + /** + * Creates a canvas element that is a copy of another and is also painted + * @param {CanvasElement} canvas to copy size and content of + * @static + * @memberOf fabric.util + * @return {CanvasElement} initialized canvas element + */ + copyCanvasElement: function(canvas) { + var newCanvas = fabric.util.createCanvasElement(); + newCanvas.width = canvas.width; + newCanvas.height = canvas.height; + newCanvas.getContext('2d').drawImage(canvas, 0, 0); + return newCanvas; + }, + + /** + * since 2.6.0 moved from canvas instance to utility. + * @param {CanvasElement} canvasEl to copy size and content of + * @param {String} format 'jpeg' or 'png', in some browsers 'webp' is ok too + * @param {Number} quality <= 1 and > 0 + * @static + * @memberOf fabric.util + * @return {String} data url + */ + toDataURL: function(canvasEl, format, quality) { + return canvasEl.toDataURL('image/' + format, quality); + }, + + /** + * Creates image element (works on client and node) + * @static + * @memberOf fabric.util + * @return {HTMLImageElement} HTML image element + */ + createImage: function() { + return fabric.document.createElement('img'); + }, + + /** + * Multiply matrix A by matrix B to nest transformations + * @static + * @memberOf fabric.util + * @param {Array} a First transformMatrix + * @param {Array} b Second transformMatrix + * @param {Boolean} is2x2 flag to multiply matrices as 2x2 matrices + * @return {Array} The product of the two transform matrices + */ + multiplyTransformMatrices: function(a, b, is2x2) { + // Matrix multiply a * b + return [ + a[0] * b[0] + a[2] * b[1], + a[1] * b[0] + a[3] * b[1], + a[0] * b[2] + a[2] * b[3], + a[1] * b[2] + a[3] * b[3], + is2x2 ? 0 : a[0] * b[4] + a[2] * b[5] + a[4], + is2x2 ? 0 : a[1] * b[4] + a[3] * b[5] + a[5] + ]; + }, + + /** + * Decomposes standard 2x3 matrix into transform components + * @static + * @memberOf fabric.util + * @param {Array} a transformMatrix + * @return {Object} Components of transform + */ + qrDecompose: function(a) { + var angle = atan2(a[1], a[0]), + denom = pow(a[0], 2) + pow(a[1], 2), + scaleX = sqrt(denom), + scaleY = (a[0] * a[3] - a[2] * a[1]) / scaleX, + skewX = atan2(a[0] * a[2] + a[1] * a [3], denom); + return { + angle: angle / PiBy180, + scaleX: scaleX, + scaleY: scaleY, + skewX: skewX / PiBy180, + skewY: 0, + translateX: a[4], + translateY: a[5] + }; + }, + + /** + * Returns a transform matrix starting from an object of the same kind of + * the one returned from qrDecompose, useful also if you want to calculate some + * transformations from an object that is not enlived yet + * @static + * @memberOf fabric.util + * @param {Object} options + * @param {Number} [options.angle] angle in degrees + * @return {Number[]} transform matrix + */ + calcRotateMatrix: function(options) { + if (!options.angle) { + return fabric.iMatrix.concat(); + } + var theta = fabric.util.degreesToRadians(options.angle), + cos = fabric.util.cos(theta), + sin = fabric.util.sin(theta); + return [cos, sin, -sin, cos, 0, 0]; + }, + + /** + * Returns a transform matrix starting from an object of the same kind of + * the one returned from qrDecompose, useful also if you want to calculate some + * transformations from an object that is not enlived yet. + * is called DimensionsTransformMatrix because those properties are the one that influence + * the size of the resulting box of the object. + * @static + * @memberOf fabric.util + * @param {Object} options + * @param {Number} [options.scaleX] + * @param {Number} [options.scaleY] + * @param {Boolean} [options.flipX] + * @param {Boolean} [options.flipY] + * @param {Number} [options.skewX] + * @param {Number} [options.skewX] + * @return {Number[]} transform matrix + */ + calcDimensionsMatrix: function(options) { + var scaleX = typeof options.scaleX === 'undefined' ? 1 : options.scaleX, + scaleY = typeof options.scaleY === 'undefined' ? 1 : options.scaleY, + scaleMatrix = [ + options.flipX ? -scaleX : scaleX, + 0, + 0, + options.flipY ? -scaleY : scaleY, + 0, + 0], + multiply = fabric.util.multiplyTransformMatrices, + degreesToRadians = fabric.util.degreesToRadians; + if (options.skewX) { + scaleMatrix = multiply( + scaleMatrix, + [1, 0, Math.tan(degreesToRadians(options.skewX)), 1], + true); + } + if (options.skewY) { + scaleMatrix = multiply( + scaleMatrix, + [1, Math.tan(degreesToRadians(options.skewY)), 0, 1], + true); + } + return scaleMatrix; + }, + + /** + * Returns a transform matrix starting from an object of the same kind of + * the one returned from qrDecompose, useful also if you want to calculate some + * transformations from an object that is not enlived yet + * @static + * @memberOf fabric.util + * @param {Object} options + * @param {Number} [options.angle] + * @param {Number} [options.scaleX] + * @param {Number} [options.scaleY] + * @param {Boolean} [options.flipX] + * @param {Boolean} [options.flipY] + * @param {Number} [options.skewX] + * @param {Number} [options.skewX] + * @param {Number} [options.translateX] + * @param {Number} [options.translateY] + * @return {Number[]} transform matrix + */ + composeMatrix: function(options) { + var matrix = [1, 0, 0, 1, options.translateX || 0, options.translateY || 0], + multiply = fabric.util.multiplyTransformMatrices; + if (options.angle) { + matrix = multiply(matrix, fabric.util.calcRotateMatrix(options)); + } + if (options.scaleX !== 1 || options.scaleY !== 1 || + options.skewX || options.skewY || options.flipX || options.flipY) { + matrix = multiply(matrix, fabric.util.calcDimensionsMatrix(options)); + } + return matrix; + }, + + /** + * reset an object transform state to neutral. Top and left are not accounted for + * @static + * @memberOf fabric.util + * @param {fabric.Object} target object to transform + */ + resetObjectTransform: function (target) { + target.scaleX = 1; + target.scaleY = 1; + target.skewX = 0; + target.skewY = 0; + target.flipX = false; + target.flipY = false; + target.rotate(0); + }, + + /** + * Extract Object transform values + * @static + * @memberOf fabric.util + * @param {fabric.Object} target object to read from + * @return {Object} Components of transform + */ + saveObjectTransform: function (target) { + return { + scaleX: target.scaleX, + scaleY: target.scaleY, + skewX: target.skewX, + skewY: target.skewY, + angle: target.angle, + left: target.left, + flipX: target.flipX, + flipY: target.flipY, + top: target.top + }; + }, + + /** + * Returns true if context has transparent pixel + * at specified location (taking tolerance into account) + * @param {CanvasRenderingContext2D} ctx context + * @param {Number} x x coordinate + * @param {Number} y y coordinate + * @param {Number} tolerance Tolerance + */ + isTransparent: function(ctx, x, y, tolerance) { + + // If tolerance is > 0 adjust start coords to take into account. + // If moves off Canvas fix to 0 + if (tolerance > 0) { + if (x > tolerance) { + x -= tolerance; + } + else { + x = 0; + } + if (y > tolerance) { + y -= tolerance; + } + else { + y = 0; + } + } + + var _isTransparent = true, i, temp, + imageData = ctx.getImageData(x, y, (tolerance * 2) || 1, (tolerance * 2) || 1), + l = imageData.data.length; + + // Split image data - for tolerance > 1, pixelDataSize = 4; + for (i = 3; i < l; i += 4) { + temp = imageData.data[i]; + _isTransparent = temp <= 0; + if (_isTransparent === false) { + break; // Stop if colour found + } + } + + imageData = null; + + return _isTransparent; + }, + + /** + * Parse preserveAspectRatio attribute from element + * @param {string} attribute to be parsed + * @return {Object} an object containing align and meetOrSlice attribute + */ + parsePreserveAspectRatioAttribute: function(attribute) { + var meetOrSlice = 'meet', alignX = 'Mid', alignY = 'Mid', + aspectRatioAttrs = attribute.split(' '), align; + + if (aspectRatioAttrs && aspectRatioAttrs.length) { + meetOrSlice = aspectRatioAttrs.pop(); + if (meetOrSlice !== 'meet' && meetOrSlice !== 'slice') { + align = meetOrSlice; + meetOrSlice = 'meet'; + } + else if (aspectRatioAttrs.length) { + align = aspectRatioAttrs.pop(); + } + } + //divide align in alignX and alignY + alignX = align !== 'none' ? align.slice(1, 4) : 'none'; + alignY = align !== 'none' ? align.slice(5, 8) : 'none'; + return { + meetOrSlice: meetOrSlice, + alignX: alignX, + alignY: alignY + }; + }, + + /** + * Clear char widths cache for the given font family or all the cache if no + * fontFamily is specified. + * Use it if you know you are loading fonts in a lazy way and you are not waiting + * for custom fonts to load properly when adding text objects to the canvas. + * If a text object is added when its own font is not loaded yet, you will get wrong + * measurement and so wrong bounding boxes. + * After the font cache is cleared, either change the textObject text content or call + * initDimensions() to trigger a recalculation + * @memberOf fabric.util + * @param {String} [fontFamily] font family to clear + */ + clearFabricFontCache: function(fontFamily) { + fontFamily = (fontFamily || '').toLowerCase(); + if (!fontFamily) { + fabric.charWidthsCache = { }; + } + else if (fabric.charWidthsCache[fontFamily]) { + delete fabric.charWidthsCache[fontFamily]; + } + }, + + /** + * Given current aspect ratio, determines the max width and height that can + * respect the total allowed area for the cache. + * @memberOf fabric.util + * @param {Number} ar aspect ratio + * @param {Number} maximumArea Maximum area you want to achieve + * @return {Object.x} Limited dimensions by X + * @return {Object.y} Limited dimensions by Y + */ + limitDimsByArea: function(ar, maximumArea) { + var roughWidth = Math.sqrt(maximumArea * ar), + perfLimitSizeY = Math.floor(maximumArea / roughWidth); + return { x: Math.floor(roughWidth), y: perfLimitSizeY }; + }, + + capValue: function(min, value, max) { + return Math.max(min, Math.min(value, max)); + }, + + /** + * Finds the scale for the object source to fit inside the object destination, + * keeping aspect ratio intact. + * respect the total allowed area for the cache. + * @memberOf fabric.util + * @param {Object | fabric.Object} source + * @param {Number} source.height natural unscaled height of the object + * @param {Number} source.width natural unscaled width of the object + * @param {Object | fabric.Object} destination + * @param {Number} destination.height natural unscaled height of the object + * @param {Number} destination.width natural unscaled width of the object + * @return {Number} scale factor to apply to source to fit into destination + */ + findScaleToFit: function(source, destination) { + return Math.min(destination.width / source.width, destination.height / source.height); + }, + + /** + * Finds the scale for the object source to cover entirely the object destination, + * keeping aspect ratio intact. + * respect the total allowed area for the cache. + * @memberOf fabric.util + * @param {Object | fabric.Object} source + * @param {Number} source.height natural unscaled height of the object + * @param {Number} source.width natural unscaled width of the object + * @param {Object | fabric.Object} destination + * @param {Number} destination.height natural unscaled height of the object + * @param {Number} destination.width natural unscaled width of the object + * @return {Number} scale factor to apply to source to cover destination + */ + findScaleToCover: function(source, destination) { + return Math.max(destination.width / source.width, destination.height / source.height); + }, + + /** + * given an array of 6 number returns something like `"matrix(...numbers)"` + * @memberOf fabric.util + * @param {Array} trasnform an array with 6 numbers + * @return {String} transform matrix for svg + * @return {Object.y} Limited dimensions by Y + */ + matrixToSVG: function(transform) { + return 'matrix(' + transform.map(function(value) { + return fabric.util.toFixed(value, fabric.Object.NUM_FRACTION_DIGITS); + }).join(' ') + ')'; + }, + + /** + * given a width and height, return the size of the bounding box + * that can contains the box with width/height with applied transform + * described in options. + * Use to calculate the boxes around objects for controls. + * @memberOf fabric.util + * @param {Number} width + * @param {Number} height + * @param {Object} options + * @param {Number} options.scaleX + * @param {Number} options.scaleY + * @param {Number} options.skewX + * @param {Number} options.skewY + * @return {Object.x} width of containing + * @return {Object.y} height of containing + */ + sizeAfterTransform: function(width, height, options) { + var dimX = width / 2, dimY = height / 2, + points = [ + { + x: -dimX, + y: -dimY + }, + { + x: dimX, + y: -dimY + }, + { + x: -dimX, + y: dimY + }, + { + x: dimX, + y: dimY + }], + transformMatrix = fabric.util.calcDimensionsMatrix(options), + bbox = fabric.util.makeBoundingBoxFromPoints(points, transformMatrix); + return { + x: bbox.width, + y: bbox.height, + }; + } + }; +})(typeof exports !== 'undefined' ? exports : this); +(function() { + + /** + * Creates accessors (getXXX, setXXX) for a "class", based on "stateProperties" array + * @static + * @memberOf fabric.util + * @param {Object} klass "Class" to create accessors for + */ + fabric.util.createAccessors = function(klass) { + var proto = klass.prototype, i, propName, + capitalizedPropName, setterName, getterName; + + for (i = proto.stateProperties.length; i--; ) { + + propName = proto.stateProperties[i]; + capitalizedPropName = propName.charAt(0).toUpperCase() + propName.slice(1); + setterName = 'set' + capitalizedPropName; + getterName = 'get' + capitalizedPropName; + + // using `new Function` for better introspection + if (!proto[getterName]) { + proto[getterName] = (function(property) { + return new Function('return this.get("' + property + '")'); + })(propName); + } + if (!proto[setterName]) { + proto[setterName] = (function(property) { + return new Function('value', 'return this.set("' + property + '", value)'); + })(propName); + } + } + }; + + /** @lends fabric.Text.Prototype */ + /** + * Retrieves object's fontSize + * @method getFontSize + * @memberOf fabric.Text.prototype + * @return {String} Font size (in pixels) + */ + + /** + * Sets object's fontSize + * Does not update the object .width and .height, + * call .initDimensions() to update the values. + * @method setFontSize + * @memberOf fabric.Text.prototype + * @param {Number} fontSize Font size (in pixels) + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's fontWeight + * @method getFontWeight + * @memberOf fabric.Text.prototype + * @return {(String|Number)} Font weight + */ + + /** + * Sets object's fontWeight + * Does not update the object .width and .height, + * call .initDimensions() to update the values. + * @method setFontWeight + * @memberOf fabric.Text.prototype + * @param {(Number|String)} fontWeight Font weight + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's fontFamily + * @method getFontFamily + * @memberOf fabric.Text.prototype + * @return {String} Font family + */ + + /** + * Sets object's fontFamily + * Does not update the object .width and .height, + * call .initDimensions() to update the values. + * @method setFontFamily + * @memberOf fabric.Text.prototype + * @param {String} fontFamily Font family + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's text + * @method getText + * @memberOf fabric.Text.prototype + * @return {String} text + */ + + /** + * Sets object's text + * Does not update the object .width and .height, + * call .initDimensions() to update the values. + * @method setText + * @memberOf fabric.Text.prototype + * @param {String} text Text + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's underline + * @method getUnderline + * @memberOf fabric.Text.prototype + * @return {Boolean} underline enabled or disabled + */ + + /** + * Sets object's underline + * @method setUnderline + * @memberOf fabric.Text.prototype + * @param {Boolean} underline Text decoration + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's fontStyle + * @method getFontStyle + * @memberOf fabric.Text.prototype + * @return {String} Font style + */ + + /** + * Sets object's fontStyle + * Does not update the object .width and .height, + * call .initDimensions() to update the values. + * @method setFontStyle + * @memberOf fabric.Text.prototype + * @param {String} fontStyle Font style + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's lineHeight + * @method getLineHeight + * @memberOf fabric.Text.prototype + * @return {Number} Line height + */ + + /** + * Sets object's lineHeight + * @method setLineHeight + * @memberOf fabric.Text.prototype + * @param {Number} lineHeight Line height + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's textAlign + * @method getTextAlign + * @memberOf fabric.Text.prototype + * @return {String} Text alignment + */ + + /** + * Sets object's textAlign + * @method setTextAlign + * @memberOf fabric.Text.prototype + * @param {String} textAlign Text alignment + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's textBackgroundColor + * @method getTextBackgroundColor + * @memberOf fabric.Text.prototype + * @return {String} Text background color + */ + + /** + * Sets object's textBackgroundColor + * @method setTextBackgroundColor + * @memberOf fabric.Text.prototype + * @param {String} textBackgroundColor Text background color + * @return {fabric.Text} + * @chainable + */ + + /** @lends fabric.Object.Prototype */ + /** + * Retrieves object's {@link fabric.Object#transformMatrix|transformMatrix} + * @method getTransformMatrix + * @memberOf fabric.Object.prototype + * @return {Array} transformMatrix + */ + + /** + * Sets object's {@link fabric.Object#transformMatrix|transformMatrix} + * @method setTransformMatrix + * @memberOf fabric.Object.prototype + * @param {Array} transformMatrix + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#visible|visible} state + * @method getVisible + * @memberOf fabric.Object.prototype + * @return {Boolean} True if visible + */ + + /** + * Sets object's {@link fabric.Object#visible|visible} state + * @method setVisible + * @memberOf fabric.Object.prototype + * @param {Boolean} value visible value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#shadow|shadow} + * @method getShadow + * @memberOf fabric.Object.prototype + * @return {Object} Shadow instance + */ + + /** + * Retrieves object's {@link fabric.Object#stroke|stroke} + * @method getStroke + * @memberOf fabric.Object.prototype + * @return {String} stroke value + */ + + /** + * Sets object's {@link fabric.Object#stroke|stroke} + * @method setStroke + * @memberOf fabric.Object.prototype + * @param {String} value stroke value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#strokeWidth|strokeWidth} + * @method getStrokeWidth + * @memberOf fabric.Object.prototype + * @return {Number} strokeWidth value + */ + + /** + * Sets object's {@link fabric.Object#strokeWidth|strokeWidth} + * @method setStrokeWidth + * @memberOf fabric.Object.prototype + * @param {Number} value strokeWidth value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#originX|originX} + * @method getOriginX + * @memberOf fabric.Object.prototype + * @return {String} originX value + */ + + /** + * Sets object's {@link fabric.Object#originX|originX} + * @method setOriginX + * @memberOf fabric.Object.prototype + * @param {String} value originX value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#originY|originY} + * @method getOriginY + * @memberOf fabric.Object.prototype + * @return {String} originY value + */ + + /** + * Sets object's {@link fabric.Object#originY|originY} + * @method setOriginY + * @memberOf fabric.Object.prototype + * @param {String} value originY value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#fill|fill} + * @method getFill + * @memberOf fabric.Object.prototype + * @return {String} Fill value + */ + + /** + * Sets object's {@link fabric.Object#fill|fill} + * @method setFill + * @memberOf fabric.Object.prototype + * @param {String} value Fill value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#opacity|opacity} + * @method getOpacity + * @memberOf fabric.Object.prototype + * @return {Number} Opacity value (0-1) + */ + + /** + * Sets object's {@link fabric.Object#opacity|opacity} + * @method setOpacity + * @memberOf fabric.Object.prototype + * @param {Number} value Opacity value (0-1) + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#angle|angle} (in degrees) + * @method getAngle + * @memberOf fabric.Object.prototype + * @return {Number} + */ + + /** + * Retrieves object's {@link fabric.Object#top|top position} + * @method getTop + * @memberOf fabric.Object.prototype + * @return {Number} Top value (in pixels) + */ + + /** + * Sets object's {@link fabric.Object#top|top position} + * @method setTop + * @memberOf fabric.Object.prototype + * @param {Number} value Top value (in pixels) + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#left|left position} + * @method getLeft + * @memberOf fabric.Object.prototype + * @return {Number} Left value (in pixels) + */ + + /** + * Sets object's {@link fabric.Object#left|left position} + * @method setLeft + * @memberOf fabric.Object.prototype + * @param {Number} value Left value (in pixels) + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#scaleX|scaleX} value + * @method getScaleX + * @memberOf fabric.Object.prototype + * @return {Number} scaleX value + */ + + /** + * Sets object's {@link fabric.Object#scaleX|scaleX} value + * @method setScaleX + * @memberOf fabric.Object.prototype + * @param {Number} value scaleX value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#scaleY|scaleY} value + * @method getScaleY + * @memberOf fabric.Object.prototype + * @return {Number} scaleY value + */ + + /** + * Sets object's {@link fabric.Object#scaleY|scaleY} value + * @method setScaleY + * @memberOf fabric.Object.prototype + * @param {Number} value scaleY value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#flipX|flipX} value + * @method getFlipX + * @memberOf fabric.Object.prototype + * @return {Boolean} flipX value + */ + + /** + * Sets object's {@link fabric.Object#flipX|flipX} value + * @method setFlipX + * @memberOf fabric.Object.prototype + * @param {Boolean} value flipX value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#flipY|flipY} value + * @method getFlipY + * @memberOf fabric.Object.prototype + * @return {Boolean} flipY value + */ + + /** + * Sets object's {@link fabric.Object#flipY|flipY} value + * @method setFlipY + * @memberOf fabric.Object.prototype + * @param {Boolean} value flipY value + * @return {fabric.Object} thisArg + * @chainable + */ + +})(typeof exports !== 'undefined' ? exports : this); +(function() { + var _join = Array.prototype.join, + commandLengths = { + m: 2, + l: 2, + h: 1, + v: 1, + c: 6, + s: 4, + q: 4, + t: 2, + a: 7 + }, + repeatedCommands = { + m: 'l', + M: 'L' + }; + function segmentToBezier(th2, th3, cosTh, sinTh, rx, ry, cx1, cy1, mT, fromX, fromY) { + var costh2 = fabric.util.cos(th2), + sinth2 = fabric.util.sin(th2), + costh3 = fabric.util.cos(th3), + sinth3 = fabric.util.sin(th3), + toX = cosTh * rx * costh3 - sinTh * ry * sinth3 + cx1, + toY = sinTh * rx * costh3 + cosTh * ry * sinth3 + cy1, + cp1X = fromX + mT * ( -cosTh * rx * sinth2 - sinTh * ry * costh2), + cp1Y = fromY + mT * ( -sinTh * rx * sinth2 + cosTh * ry * costh2), + cp2X = toX + mT * ( cosTh * rx * sinth3 + sinTh * ry * costh3), + cp2Y = toY + mT * ( sinTh * rx * sinth3 - cosTh * ry * costh3); + + return ['C', + cp1X, cp1Y, + cp2X, cp2Y, + toX, toY + ]; + } + + /* Adapted from http://dxr.mozilla.org/mozilla-central/source/content/svg/content/src/nsSVGPathDataParser.cpp + * by Andrea Bogazzi code is under MPL. if you don't have a copy of the license you can take it here + * http://mozilla.org/MPL/2.0/ + */ + function arcToSegments(toX, toY, rx, ry, large, sweep, rotateX) { + var PI = Math.PI, th = rotateX * PI / 180, + sinTh = fabric.util.sin(th), + cosTh = fabric.util.cos(th), + fromX = 0, fromY = 0; + + rx = Math.abs(rx); + ry = Math.abs(ry); + + var px = -cosTh * toX * 0.5 - sinTh * toY * 0.5, + py = -cosTh * toY * 0.5 + sinTh * toX * 0.5, + rx2 = rx * rx, ry2 = ry * ry, py2 = py * py, px2 = px * px, + pl = rx2 * ry2 - rx2 * py2 - ry2 * px2, + root = 0; + + if (pl < 0) { + var s = Math.sqrt(1 - pl / (rx2 * ry2)); + rx *= s; + ry *= s; + } + else { + root = (large === sweep ? -1.0 : 1.0) * + Math.sqrt( pl / (rx2 * py2 + ry2 * px2)); + } + + var cx = root * rx * py / ry, + cy = -root * ry * px / rx, + cx1 = cosTh * cx - sinTh * cy + toX * 0.5, + cy1 = sinTh * cx + cosTh * cy + toY * 0.5, + mTheta = calcVectorAngle(1, 0, (px - cx) / rx, (py - cy) / ry), + dtheta = calcVectorAngle((px - cx) / rx, (py - cy) / ry, (-px - cx) / rx, (-py - cy) / ry); + + if (sweep === 0 && dtheta > 0) { + dtheta -= 2 * PI; + } + else if (sweep === 1 && dtheta < 0) { + dtheta += 2 * PI; + } + + // Convert into cubic bezier segments <= 90deg + var segments = Math.ceil(Math.abs(dtheta / PI * 2)), + result = [], mDelta = dtheta / segments, + mT = 8 / 3 * Math.sin(mDelta / 4) * Math.sin(mDelta / 4) / Math.sin(mDelta / 2), + th3 = mTheta + mDelta; + + for (var i = 0; i < segments; i++) { + result[i] = segmentToBezier(mTheta, th3, cosTh, sinTh, rx, ry, cx1, cy1, mT, fromX, fromY); + fromX = result[i][5]; + fromY = result[i][6]; + mTheta = th3; + th3 += mDelta; + } + return result; + } + + /* + * Private + */ + function calcVectorAngle(ux, uy, vx, vy) { + var ta = Math.atan2(uy, ux), + tb = Math.atan2(vy, vx); + if (tb >= ta) { + return tb - ta; + } + else { + return 2 * Math.PI - (ta - tb); + } + } + + /** + * Calculate bounding box of a beziercurve + * @param {Number} x0 starting point + * @param {Number} y0 + * @param {Number} x1 first control point + * @param {Number} y1 + * @param {Number} x2 secondo control point + * @param {Number} y2 + * @param {Number} x3 end of beizer + * @param {Number} y3 + */ + // taken from http://jsbin.com/ivomiq/56/edit no credits available for that. + // TODO: can we normalize this with the starting points set at 0 and then translated the bbox? + function getBoundsOfCurve(x0, y0, x1, y1, x2, y2, x3, y3) { + var argsString; + if (fabric.cachesBoundsOfCurve) { + argsString = _join.call(arguments); + if (fabric.boundsOfCurveCache[argsString]) { + return fabric.boundsOfCurveCache[argsString]; + } + } + + var sqrt = Math.sqrt, + min = Math.min, max = Math.max, + abs = Math.abs, tvalues = [], + bounds = [[], []], + a, b, c, t, t1, t2, b2ac, sqrtb2ac; + + b = 6 * x0 - 12 * x1 + 6 * x2; + a = -3 * x0 + 9 * x1 - 9 * x2 + 3 * x3; + c = 3 * x1 - 3 * x0; + + for (var i = 0; i < 2; ++i) { + if (i > 0) { + b = 6 * y0 - 12 * y1 + 6 * y2; + a = -3 * y0 + 9 * y1 - 9 * y2 + 3 * y3; + c = 3 * y1 - 3 * y0; + } + + if (abs(a) < 1e-12) { + if (abs(b) < 1e-12) { + continue; + } + t = -c / b; + if (0 < t && t < 1) { + tvalues.push(t); + } + continue; + } + b2ac = b * b - 4 * c * a; + if (b2ac < 0) { + continue; + } + sqrtb2ac = sqrt(b2ac); + t1 = (-b + sqrtb2ac) / (2 * a); + if (0 < t1 && t1 < 1) { + tvalues.push(t1); + } + t2 = (-b - sqrtb2ac) / (2 * a); + if (0 < t2 && t2 < 1) { + tvalues.push(t2); + } + } + + var x, y, j = tvalues.length, jlen = j, mt; + while (j--) { + t = tvalues[j]; + mt = 1 - t; + x = (mt * mt * mt * x0) + (3 * mt * mt * t * x1) + (3 * mt * t * t * x2) + (t * t * t * x3); + bounds[0][j] = x; + + y = (mt * mt * mt * y0) + (3 * mt * mt * t * y1) + (3 * mt * t * t * y2) + (t * t * t * y3); + bounds[1][j] = y; + } + + bounds[0][jlen] = x0; + bounds[1][jlen] = y0; + bounds[0][jlen + 1] = x3; + bounds[1][jlen + 1] = y3; + var result = [ + { + x: min.apply(null, bounds[0]), + y: min.apply(null, bounds[1]) + }, + { + x: max.apply(null, bounds[0]), + y: max.apply(null, bounds[1]) + } + ]; + if (fabric.cachesBoundsOfCurve) { + fabric.boundsOfCurveCache[argsString] = result; + } + return result; + } + + /** + * Converts arc to a bunch of beizer curves + * @param {Number} fx starting point x + * @param {Number} fy starting point y + * @param {Array} coords Arc command + */ + function fromArcToBeizers(fx, fy, coords) { + var rx = coords[1], + ry = coords[2], + rot = coords[3], + large = coords[4], + sweep = coords[5], + tx = coords[6], + ty = coords[7], + segsNorm = arcToSegments(tx - fx, ty - fy, rx, ry, large, sweep, rot); + + for (var i = 0, len = segsNorm.length; i < len; i++) { + segsNorm[i][1] += fx; + segsNorm[i][2] += fy; + segsNorm[i][3] += fx; + segsNorm[i][4] += fy; + segsNorm[i][5] += fx; + segsNorm[i][6] += fy; + } + return segsNorm; + }; + + + function makePathSimpler(path) { + // x and y represent the last point of the path. the previous command point. + // we add them to each relative command to make it an absolute comment. + // we also swap the v V h H with L, because are easier to transform. + var x = 0, y = 0, len = path.length, + // x1 and y1 represent the last point of the subpath. the subpath is started with + // m or M command. When a z or Z command is drawn, x and y need to be resetted to + // the last x1 and y1. + x1 = 0, y1 = 0, current, i, converted, + // previous will host the letter of the previous command, to handle S and T. + // controlX and controlY will host the previous reflected control point + destinationPath = [], previous, controlX, controlY; + for (i = 0; i < len; ++i) { + converted = false; + current = path[i].slice(0); + switch (current[0]) { // first letter + case 'l': // lineto, relative + current[0] = 'L'; + current[1] += x; + current[2] += y; + // falls through + case 'L': + x = current[1]; + y = current[2]; + break; + case 'h': // horizontal lineto, relative + current[1] += x; + // falls through + case 'H': + current[0] = 'L'; + current[2] = y; + x = current[1]; + break; + case 'v': // vertical lineto, relative + current[1] += y; + // falls through + case 'V': + current[0] = 'L'; + y = current[1]; + current[1] = x; + current[2] = y; + break; + case 'm': // moveTo, relative + current[0] = 'M'; + current[1] += x; + current[2] += y; + // falls through + case 'M': + x = current[1]; + y = current[2]; + x1 = current[1]; + y1 = current[2]; + break; + case 'c': // bezierCurveTo, relative + current[0] = 'C'; + current[1] += x; + current[2] += y; + current[3] += x; + current[4] += y; + current[5] += x; + current[6] += y; + // falls through + case 'C': + controlX = current[3]; + controlY = current[4]; + x = current[5]; + y = current[6]; + break; + case 's': // shorthand cubic bezierCurveTo, relative + current[0] = 'S'; + current[1] += x; + current[2] += y; + current[3] += x; + current[4] += y; + // falls through + case 'S': + // would be sScC but since we are swapping sSc for C, we check just that. + if (previous === 'C') { + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + else { + // If there is no previous command or if the previous command was not a C, c, S, or s, + // the control point is coincident with the current point + controlX = x; + controlY = y; + } + x = current[3]; + y = current[4]; + current[0] = 'C'; + current[5] = current[3]; + current[6] = current[4]; + current[3] = current[1]; + current[4] = current[2]; + current[1] = controlX; + current[2] = controlY; + // current[3] and current[4] are NOW the second control point. + // we keep it for the next reflection. + controlX = current[3]; + controlY = current[4]; + break; + case 'q': // quadraticCurveTo, relative + current[0] = 'Q'; + current[1] += x; + current[2] += y; + current[3] += x; + current[4] += y; + // falls through + case 'Q': + controlX = current[1]; + controlY = current[2]; + x = current[3]; + y = current[4]; + break; + case 't': // shorthand quadraticCurveTo, relative + current[0] = 'T'; + current[1] += x; + current[2] += y; + // falls through + case 'T': + if (previous === 'Q') { + // calculate reflection of previous control point + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + else { + // If there is no previous command or if the previous command was not a Q, q, T or t, + // assume the control point is coincident with the current point + controlX = x; + controlY = y; + } + current[0] = 'Q'; + x = current[1]; + y = current[2]; + current[1] = controlX; + current[2] = controlY; + current[3] = x; + current[4] = y; + break; + case 'a': + current[0] = 'A'; + current[6] += x; + current[7] += y; + // falls through + case 'A': + converted = true; + destinationPath = destinationPath.concat(fromArcToBeizers(x, y, current)); + x = current[6]; + y = current[7]; + break; + case 'z': + case 'Z': + x = x1; + y = y1; + break; + default: + } + if (!converted) { + destinationPath.push(current); + } + previous = current[0]; + } + return destinationPath; + }; + + /** + * Calc length from point x1,y1 to x2,y2 + * @param {Number} x1 starting point x + * @param {Number} y1 starting point y + * @param {Number} x2 starting point x + * @param {Number} y2 starting point y + * @return {Number} length of segment + */ + function calcLineLength(x1, y1, x2, y2) { + return Math.sqrt((x2 - x1) * (x2 - x1) + (y2 - y1) * (y2 - y1)); + } + + // functions for the Cubic beizer + // taken from: https://github.com/konvajs/konva/blob/7.0.5/src/shapes/Path.ts#L350 + function CB1(t) { + return t * t * t; + } + function CB2(t) { + return 3 * t * t * (1 - t); + } + function CB3(t) { + return 3 * t * (1 - t) * (1 - t); + } + function CB4(t) { + return (1 - t) * (1 - t) * (1 - t); + } + + function getPointOnCubicBezierIterator(p1x, p1y, p2x, p2y, p3x, p3y, p4x, p4y) { + return function(pct) { + var c1 = CB1(pct), c2 = CB2(pct), c3 = CB3(pct), c4 = CB4(pct); + return { + x: p4x * c1 + p3x * c2 + p2x * c3 + p1x * c4, + y: p4y * c1 + p3y * c2 + p2y * c3 + p1y * c4 + }; + }; + } + + function QB1(t) { + return t * t; + } + + function QB2(t) { + return 2 * t * (1 - t); + } + + function QB3(t) { + return (1 - t) * (1 - t); + } + + function getPointOnQuadraticBezierIterator(p1x, p1y, p2x, p2y, p3x, p3y) { + return function(pct) { + var c1 = QB1(pct), c2 = QB2(pct), c3 = QB3(pct); + return { + x: p3x * c1 + p2x * c2 + p1x * c3, + y: p3y * c1 + p2y * c2 + p1y * c3 + }; + }; + } + + function pathIterator(iterator, x1, y1) { + var tempP = { x: x1, y: y1 }, p, tmpLen = 0, perc; + for (perc = 0.01; perc <= 1; perc += 0.01) { + p = iterator(perc); + tmpLen += calcLineLength(tempP.x, tempP.y, p.x, p.y); + tempP = p; + } + return tmpLen; + } + + //measures the length of a pre-simplified path + function getPathSegmentsInfo(path) { + var totalLength = 0, len = path.length, current, + //x2 and y2 are the coords of segment start + //x1 and y1 are the coords of the current point + x1 = 0, y1 = 0, x2 = 0, y2 = 0, info = [], iterator, tempInfo; + for (var i = 0; i < len; i++) { + current = path[i]; + tempInfo = { + x: x1, + y: y1, + command: current[0], + }; + switch (current[0]) { //first letter + case 'M': + tempInfo.length = 0; + x2 = x1 = current[1]; + y2 = y1 = current[2]; + break; + case 'L': + tempInfo.length = calcLineLength(x1, y1, current[1], current[2]); + x1 = current[1]; + y1 = current[2]; + break; + case 'C': + iterator = getPointOnCubicBezierIterator( + x1, + y1, + current[1], + current[2], + current[3], + current[4], + current[5], + current[6] + ); + tempInfo.length = pathIterator(iterator, x1, y1); + x1 = current[5]; + y1 = current[6]; + break; + case 'Q': + iterator = getPointOnQuadraticBezierIterator( + x1, + y1, + current[1], + current[2], + current[3], + current[4] + ); + tempInfo.length = pathIterator(iterator, x1, y1); + x1 = current[3]; + y1 = current[4]; + break; + case 'Z': + case 'z': + // we add those in order to ease calculations later + tempInfo.destX = x2; + tempInfo.destY = y2; + tempInfo.length = calcLineLength(x1, y1, x2, y2); + x1 = x2; + y1 = y2; + break; + } + totalLength += tempInfo.length; + info.push(tempInfo); + } + info.push({ length: totalLength, x: x1, y: y1 }); + return info; + } + + function getPointOnPath(path, perc, infos) { + if (!infos) { + infos = getPathSegmentsInfo(path); + } + var distance = infos[infos.length - 1] * perc, i = 0; + while ((distance - infos[i] > 0) && i < infos.length) { + distance -= infos[i]; + i++; + } + var segInfo = infos[i], segPercent = distance / segInfo.length, + command = segInfo.length, segment = path[i]; + switch (command) { + case 'Z': + case 'z': + return new fabric.Point(segInfo.x, segInfo.y).lerp( + new fabric.Point(segInfo.destX, segInfo.destY), + segPercent + ); + break; + case 'L': + return new fabric.Point(segInfo.x, segInfo.y).lerp( + new fabric.Point(segment[1], segment[2]), + segPercent + ); + break; + case 'C': + return getPointOnCubicBezierIterator( + segInfo.x, + segInfo.y, + segment[1], + segment[2], + segment[3], + segment[4], + segment[5], + segment[6] + )(segPercent); + break; + case 'Q': + return getPointOnQuadraticBezierIterator( + segInfo.x, + segInfo.y, + segment[1], + segment[2], + segment[3], + segment[4] + )(segPercent); + break; + } + } + + function parsePath(pathString) { + var result = [], + coords = [], + currentPath, + parsed, + re = fabric.rePathCommand, + rNumber = '[-+]?(?:\\d*\\.\\d+|\\d+\\.?)(?:[eE][-+]?\\d+)?\\s*', + rNumberCommaWsp = '(' + rNumber + ')' + fabric.commaWsp, + rFlagCommaWsp = '([01])' + fabric.commaWsp + '?', + rArcSeq = rNumberCommaWsp + '?' + rNumberCommaWsp + '?' + rNumberCommaWsp + rFlagCommaWsp + rFlagCommaWsp + + rNumberCommaWsp + '?(' + rNumber + ')', + regArcArgumentSequence = new RegExp(rArcSeq, 'g'), + match, + coordsStr, + // one of commands (m,M,l,L,q,Q,c,C,etc.) followed by non-command characters (i.e. command values) + path; + if (!pathString || !pathString.match) { + return result; + } + path = pathString.match(/[mzlhvcsqta][^mzlhvcsqta]*/gi); + + for (var i = 0, coordsParsed, len = path.length; i < len; i++) { + currentPath = path[i]; + + coordsStr = currentPath.slice(1).trim(); + coords.length = 0; + + var command = currentPath.charAt(0); + coordsParsed = [command]; + + if (command.toLowerCase() === 'a') { + // arcs have special flags that apparently don't require spaces so handle special + for (var args; (args = regArcArgumentSequence.exec(coordsStr));) { + for (var j = 1; j < args.length; j++) { + coords.push(args[j]); + } + } + } + else { + while ((match = re.exec(coordsStr))) { + coords.push(match[0]); + } + } + + for (var j = 0, jlen = coords.length; j < jlen; j++) { + parsed = parseFloat(coords[j]); + if (!isNaN(parsed)) { + coordsParsed.push(parsed); + } + } + + var commandLength = commandLengths[command.toLowerCase()], + repeatedCommand = repeatedCommands[command] || command; + + if (coordsParsed.length - 1 > commandLength) { + for (var k = 1, klen = coordsParsed.length; k < klen; k += commandLength) { + result.push([command].concat(coordsParsed.slice(k, k + commandLength))); + command = repeatedCommand; + } + } + else { + result.push(coordsParsed); + } + } + + return result; + }; + + /** + * Calculate bounding box of a elliptic-arc + * @deprecated + * @param {Number} fx start point of arc + * @param {Number} fy + * @param {Number} rx horizontal radius + * @param {Number} ry vertical radius + * @param {Number} rot angle of horizontal axis + * @param {Number} large 1 or 0, whatever the arc is the big or the small on the 2 points + * @param {Number} sweep 1 or 0, 1 clockwise or counterclockwise direction + * @param {Number} tx end point of arc + * @param {Number} ty + */ + function getBoundsOfArc(fx, fy, rx, ry, rot, large, sweep, tx, ty) { + + var fromX = 0, fromY = 0, bound, bounds = [], + segs = arcToSegments(tx - fx, ty - fy, rx, ry, large, sweep, rot); + + for (var i = 0, len = segs.length; i < len; i++) { + bound = getBoundsOfCurve(fromX, fromY, segs[i][1], segs[i][2], segs[i][3], segs[i][4], segs[i][5], segs[i][6]); + bounds.push({ x: bound[0].x + fx, y: bound[0].y + fy }); + bounds.push({ x: bound[1].x + fx, y: bound[1].y + fy }); + fromX = segs[i][5]; + fromY = segs[i][6]; + } + return bounds; + }; + + /** + * Draws arc + * @param {CanvasRenderingContext2D} ctx + * @param {Number} fx + * @param {Number} fy + * @param {Array} coords coords of the arc, without the front 'A/a' + */ + function drawArc(ctx, fx, fy, coords) { + coords = coords.slice(0).unshift('X'); // command A or a does not matter + var beizers = fromArcToBeizers(fx, fy, coords); + beizers.forEach(function(beizer) { + ctx.bezierCurveTo.apply(ctx, beizer.slice(1)); + }); + }; + + fabric.util.parsePath = parsePath; + fabric.util.makePathSimpler = makePathSimpler; + fabric.util.getPathSegmentsInfo = getPathSegmentsInfo; + fabric.util.fromArcToBeizers = fromArcToBeizers; + fabric.util.getBoundsOfCurve = getBoundsOfCurve; + fabric.util.getPointOnPath = getPointOnPath; + // kept because we do not want to make breaking changes. + // but useless and deprecated. + fabric.util.getBoundsOfArc = getBoundsOfArc; + fabric.util.drawArc = drawArc; +})(); +(function() { + + var slice = Array.prototype.slice; + + /** + * Invokes method on all items in a given array + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} method Name of a method to invoke + * @return {Array} + */ + function invoke(array, method) { + var args = slice.call(arguments, 2), result = []; + for (var i = 0, len = array.length; i < len; i++) { + result[i] = args.length ? array[i][method].apply(array[i], args) : array[i][method].call(array[i]); + } + return result; + } + + /** + * Finds maximum value in array (not necessarily "first" one) + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} byProperty + * @return {*} + */ + function max(array, byProperty) { + return find(array, byProperty, function(value1, value2) { + return value1 >= value2; + }); + } + + /** + * Finds minimum value in array (not necessarily "first" one) + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} byProperty + * @return {*} + */ + function min(array, byProperty) { + return find(array, byProperty, function(value1, value2) { + return value1 < value2; + }); + } + + /** + * @private + */ + function fill(array, value) { + var k = array.length; + while (k--) { + array[k] = value; + } + return array; + } + + /** + * @private + */ + function find(array, byProperty, condition) { + if (!array || array.length === 0) { + return; + } + + var i = array.length - 1, + result = byProperty ? array[i][byProperty] : array[i]; + if (byProperty) { + while (i--) { + if (condition(array[i][byProperty], result)) { + result = array[i][byProperty]; + } + } + } + else { + while (i--) { + if (condition(array[i], result)) { + result = array[i]; + } + } + } + return result; + } + + /** + * @namespace fabric.util.array + */ + fabric.util.array = { + fill: fill, + invoke: invoke, + min: min, + max: max + }; + +})(); +(function() { + /** + * Copies all enumerable properties of one js object to another + * this does not and cannot compete with generic utils. + * Does not clone or extend fabric.Object subclasses. + * This is mostly for internal use and has extra handling for fabricJS objects + * it skips the canvas and group properties in deep cloning. + * @memberOf fabric.util.object + * @param {Object} destination Where to copy to + * @param {Object} source Where to copy from + * @return {Object} + */ + + function extend(destination, source, deep) { + // JScript DontEnum bug is not taken care of + // the deep clone is for internal use, is not meant to avoid + // javascript traps or cloning html element or self referenced objects. + if (deep) { + if (!fabric.isLikelyNode && source instanceof Element) { + // avoid cloning deep images, canvases, + destination = source; + } + else if (source instanceof Array) { + destination = []; + for (var i = 0, len = source.length; i < len; i++) { + destination[i] = extend({ }, source[i], deep); + } + } + else if (source && typeof source === 'object') { + for (var property in source) { + if (property === 'canvas' || property === 'group') { + // we do not want to clone this props at all. + // we want to keep the keys in the copy + destination[property] = null; + } + else if (source.hasOwnProperty(property)) { + destination[property] = extend({ }, source[property], deep); + } + } + } + else { + // this sounds odd for an extend but is ok for recursive use + destination = source; + } + } + else { + for (var property in source) { + destination[property] = source[property]; + } + } + return destination; + } + + /** + * Creates an empty object and copies all enumerable properties of another object to it + * @memberOf fabric.util.object + * TODO: this function return an empty object if you try to clone null + * @param {Object} object Object to clone + * @return {Object} + */ + function clone(object, deep) { + return extend({ }, object, deep); + } + + /** @namespace fabric.util.object */ + fabric.util.object = { + extend: extend, + clone: clone + }; + fabric.util.object.extend(fabric.util, fabric.Observable); +})(); +(function() { + + /** + * Camelizes a string + * @memberOf fabric.util.string + * @param {String} string String to camelize + * @return {String} Camelized version of a string + */ + function camelize(string) { + return string.replace(/-+(.)?/g, function(match, character) { + return character ? character.toUpperCase() : ''; + }); + } + + /** + * Capitalizes a string + * @memberOf fabric.util.string + * @param {String} string String to capitalize + * @param {Boolean} [firstLetterOnly] If true only first letter is capitalized + * and other letters stay untouched, if false first letter is capitalized + * and other letters are converted to lowercase. + * @return {String} Capitalized version of a string + */ + function capitalize(string, firstLetterOnly) { + return string.charAt(0).toUpperCase() + + (firstLetterOnly ? string.slice(1) : string.slice(1).toLowerCase()); + } + + /** + * Escapes XML in a string + * @memberOf fabric.util.string + * @param {String} string String to escape + * @return {String} Escaped version of a string + */ + function escapeXml(string) { + return string.replace(/&/g, '&') + .replace(/"/g, '"') + .replace(/'/g, ''') + .replace(//g, '>'); + } + + /** + * Divide a string in the user perceived single units + * @memberOf fabric.util.string + * @param {String} textstring String to escape + * @return {Array} array containing the graphemes + */ + function graphemeSplit(textstring) { + var i = 0, chr, graphemes = []; + for (i = 0, chr; i < textstring.length; i++) { + if ((chr = getWholeChar(textstring, i)) === false) { + continue; + } + graphemes.push(chr); + } + return graphemes; + } + + // taken from mdn in the charAt doc page. + function getWholeChar(str, i) { + var code = str.charCodeAt(i); + + if (isNaN(code)) { + return ''; // Position not found + } + if (code < 0xD800 || code > 0xDFFF) { + return str.charAt(i); + } + + // High surrogate (could change last hex to 0xDB7F to treat high private + // surrogates as single characters) + if (0xD800 <= code && code <= 0xDBFF) { + if (str.length <= (i + 1)) { + throw 'High surrogate without following low surrogate'; + } + var next = str.charCodeAt(i + 1); + if (0xDC00 > next || next > 0xDFFF) { + throw 'High surrogate without following low surrogate'; + } + return str.charAt(i) + str.charAt(i + 1); + } + // Low surrogate (0xDC00 <= code && code <= 0xDFFF) + if (i === 0) { + throw 'Low surrogate without preceding high surrogate'; + } + var prev = str.charCodeAt(i - 1); + + // (could change last hex to 0xDB7F to treat high private + // surrogates as single characters) + if (0xD800 > prev || prev > 0xDBFF) { + throw 'Low surrogate without preceding high surrogate'; + } + // We can pass over low surrogates now as the second component + // in a pair which we have already processed + return false; + } + + + /** + * String utilities + * @namespace fabric.util.string + */ + fabric.util.string = { + camelize: camelize, + capitalize: capitalize, + escapeXml: escapeXml, + graphemeSplit: graphemeSplit + }; +})(); +(function() { + + var slice = Array.prototype.slice, emptyFunction = function() { }, + + IS_DONTENUM_BUGGY = (function() { + for (var p in { toString: 1 }) { + if (p === 'toString') { + return false; + } + } + return true; + })(), + + /** @ignore */ + addMethods = function(klass, source, parent) { + for (var property in source) { + + if (property in klass.prototype && + typeof klass.prototype[property] === 'function' && + (source[property] + '').indexOf('callSuper') > -1) { + + klass.prototype[property] = (function(property) { + return function() { + + var superclass = this.constructor.superclass; + this.constructor.superclass = parent; + var returnValue = source[property].apply(this, arguments); + this.constructor.superclass = superclass; + + if (property !== 'initialize') { + return returnValue; + } + }; + })(property); + } + else { + klass.prototype[property] = source[property]; + } + + if (IS_DONTENUM_BUGGY) { + if (source.toString !== Object.prototype.toString) { + klass.prototype.toString = source.toString; + } + if (source.valueOf !== Object.prototype.valueOf) { + klass.prototype.valueOf = source.valueOf; + } + } + } + }; + + function Subclass() { } + + function callSuper(methodName) { + var parentMethod = null, + _this = this; + + // climb prototype chain to find method not equal to callee's method + while (_this.constructor.superclass) { + var superClassMethod = _this.constructor.superclass.prototype[methodName]; + if (_this[methodName] !== superClassMethod) { + parentMethod = superClassMethod; + break; + } + // eslint-disable-next-line + _this = _this.constructor.superclass.prototype; + } + + if (!parentMethod) { + return console.log('tried to callSuper ' + methodName + ', method not found in prototype chain', this); + } + + return (arguments.length > 1) + ? parentMethod.apply(this, slice.call(arguments, 1)) + : parentMethod.call(this); + } + + /** + * Helper for creation of "classes". + * @memberOf fabric.util + * @param {Function} [parent] optional "Class" to inherit from + * @param {Object} [properties] Properties shared by all instances of this class + * (be careful modifying objects defined here as this would affect all instances) + */ + function createClass() { + var parent = null, + properties = slice.call(arguments, 0); + + if (typeof properties[0] === 'function') { + parent = properties.shift(); + } + function klass() { + this.initialize.apply(this, arguments); + } + + klass.superclass = parent; + klass.subclasses = []; + + if (parent) { + Subclass.prototype = parent.prototype; + klass.prototype = new Subclass(); + parent.subclasses.push(klass); + } + for (var i = 0, length = properties.length; i < length; i++) { + addMethods(klass, properties[i], parent); + } + if (!klass.prototype.initialize) { + klass.prototype.initialize = emptyFunction; + } + klass.prototype.constructor = klass; + klass.prototype.callSuper = callSuper; + return klass; + } + + fabric.util.createClass = createClass; +})(); +(function () { + // since ie11 can use addEventListener but they do not support options, i need to check + var couldUseAttachEvent = !!fabric.document.createElement('div').attachEvent, + touchEvents = ['touchstart', 'touchmove', 'touchend']; + /** + * Adds an event listener to an element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {String} eventName + * @param {Function} handler + */ + fabric.util.addListener = function(element, eventName, handler, options) { + element && element.addEventListener(eventName, handler, couldUseAttachEvent ? false : options); + }; + + /** + * Removes an event listener from an element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {String} eventName + * @param {Function} handler + */ + fabric.util.removeListener = function(element, eventName, handler, options) { + element && element.removeEventListener(eventName, handler, couldUseAttachEvent ? false : options); + }; + + function getTouchInfo(event) { + var touchProp = event.changedTouches; + if (touchProp && touchProp[0]) { + return touchProp[0]; + } + return event; + } + + fabric.util.getPointer = function(event) { + var element = event.target, + scroll = fabric.util.getScrollLeftTop(element), + _evt = getTouchInfo(event); + return { + x: _evt.clientX + scroll.left, + y: _evt.clientY + scroll.top + }; + }; + + fabric.util.isTouchEvent = function(event) { + return touchEvents.indexOf(event.type) > -1 || event.pointerType === 'touch'; + }; +})(); +(function () { + + /** + * Cross-browser wrapper for setting element's style + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {Object} styles + * @return {HTMLElement} Element that was passed as a first argument + */ + function setStyle(element, styles) { + var elementStyle = element.style; + if (!elementStyle) { + return element; + } + if (typeof styles === 'string') { + element.style.cssText += ';' + styles; + return styles.indexOf('opacity') > -1 + ? setOpacity(element, styles.match(/opacity:\s*(\d?\.?\d*)/)[1]) + : element; + } + for (var property in styles) { + if (property === 'opacity') { + setOpacity(element, styles[property]); + } + else { + var normalizedProperty = (property === 'float' || property === 'cssFloat') + ? (typeof elementStyle.styleFloat === 'undefined' ? 'cssFloat' : 'styleFloat') + : property; + elementStyle[normalizedProperty] = styles[property]; + } + } + return element; + } + + var parseEl = fabric.document.createElement('div'), + supportsOpacity = typeof parseEl.style.opacity === 'string', + supportsFilters = typeof parseEl.style.filter === 'string', + reOpacity = /alpha\s*\(\s*opacity\s*=\s*([^\)]+)\)/, + + /** @ignore */ + setOpacity = function (element) { return element; }; + + if (supportsOpacity) { + /** @ignore */ + setOpacity = function(element, value) { + element.style.opacity = value; + return element; + }; + } + else if (supportsFilters) { + /** @ignore */ + setOpacity = function(element, value) { + var es = element.style; + if (element.currentStyle && !element.currentStyle.hasLayout) { + es.zoom = 1; + } + if (reOpacity.test(es.filter)) { + value = value >= 0.9999 ? '' : ('alpha(opacity=' + (value * 100) + ')'); + es.filter = es.filter.replace(reOpacity, value); + } + else { + es.filter += ' alpha(opacity=' + (value * 100) + ')'; + } + return element; + }; + } + + fabric.util.setStyle = setStyle; + +})(); +(function() { + + var _slice = Array.prototype.slice; + + /** + * Takes id and returns an element with that id (if one exists in a document) + * @memberOf fabric.util + * @param {String|HTMLElement} id + * @return {HTMLElement|null} + */ + function getById(id) { + return typeof id === 'string' ? fabric.document.getElementById(id) : id; + } + + var sliceCanConvertNodelists, + /** + * Converts an array-like object (e.g. arguments or NodeList) to an array + * @memberOf fabric.util + * @param {Object} arrayLike + * @return {Array} + */ + toArray = function(arrayLike) { + return _slice.call(arrayLike, 0); + }; + + try { + sliceCanConvertNodelists = toArray(fabric.document.childNodes) instanceof Array; + } + catch (err) { } + + if (!sliceCanConvertNodelists) { + toArray = function(arrayLike) { + var arr = new Array(arrayLike.length), i = arrayLike.length; + while (i--) { + arr[i] = arrayLike[i]; + } + return arr; + }; + } + + /** + * Creates specified element with specified attributes + * @memberOf fabric.util + * @param {String} tagName Type of an element to create + * @param {Object} [attributes] Attributes to set on an element + * @return {HTMLElement} Newly created element + */ + function makeElement(tagName, attributes) { + var el = fabric.document.createElement(tagName); + for (var prop in attributes) { + if (prop === 'class') { + el.className = attributes[prop]; + } + else if (prop === 'for') { + el.htmlFor = attributes[prop]; + } + else { + el.setAttribute(prop, attributes[prop]); + } + } + return el; + } + + /** + * Adds class to an element + * @memberOf fabric.util + * @param {HTMLElement} element Element to add class to + * @param {String} className Class to add to an element + */ + function addClass(element, className) { + if (element && (' ' + element.className + ' ').indexOf(' ' + className + ' ') === -1) { + element.className += (element.className ? ' ' : '') + className; + } + } + + /** + * Wraps element with another element + * @memberOf fabric.util + * @param {HTMLElement} element Element to wrap + * @param {HTMLElement|String} wrapper Element to wrap with + * @param {Object} [attributes] Attributes to set on a wrapper + * @return {HTMLElement} wrapper + */ + function wrapElement(element, wrapper, attributes) { + if (typeof wrapper === 'string') { + wrapper = makeElement(wrapper, attributes); + } + if (element.parentNode) { + element.parentNode.replaceChild(wrapper, element); + } + wrapper.appendChild(element); + return wrapper; + } + + /** + * Returns element scroll offsets + * @memberOf fabric.util + * @param {HTMLElement} element Element to operate on + * @return {Object} Object with left/top values + */ + function getScrollLeftTop(element) { + + var left = 0, + top = 0, + docElement = fabric.document.documentElement, + body = fabric.document.body || { + scrollLeft: 0, scrollTop: 0 + }; + + // While loop checks (and then sets element to) .parentNode OR .host + // to account for ShadowDOM. We still want to traverse up out of ShadowDOM, + // but the .parentNode of a root ShadowDOM node will always be null, instead + // it should be accessed through .host. See http://stackoverflow.com/a/24765528/4383938 + while (element && (element.parentNode || element.host)) { + + // Set element to element parent, or 'host' in case of ShadowDOM + element = element.parentNode || element.host; + + if (element === fabric.document) { + left = body.scrollLeft || docElement.scrollLeft || 0; + top = body.scrollTop || docElement.scrollTop || 0; + } + else { + left += element.scrollLeft || 0; + top += element.scrollTop || 0; + } + + if (element.nodeType === 1 && element.style.position === 'fixed') { + break; + } + } + + return { left: left, top: top }; + } + + /** + * Returns offset for a given element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element Element to get offset for + * @return {Object} Object with "left" and "top" properties + */ + function getElementOffset(element) { + var docElem, + doc = element && element.ownerDocument, + box = { left: 0, top: 0 }, + offset = { left: 0, top: 0 }, + scrollLeftTop, + offsetAttributes = { + borderLeftWidth: 'left', + borderTopWidth: 'top', + paddingLeft: 'left', + paddingTop: 'top' + }; + + if (!doc) { + return offset; + } + + for (var attr in offsetAttributes) { + offset[offsetAttributes[attr]] += parseInt(getElementStyle(element, attr), 10) || 0; + } + + docElem = doc.documentElement; + if ( typeof element.getBoundingClientRect !== 'undefined' ) { + box = element.getBoundingClientRect(); + } + + scrollLeftTop = getScrollLeftTop(element); + + return { + left: box.left + scrollLeftTop.left - (docElem.clientLeft || 0) + offset.left, + top: box.top + scrollLeftTop.top - (docElem.clientTop || 0) + offset.top + }; + } + + /** + * Returns style attribute value of a given element + * @memberOf fabric.util + * @param {HTMLElement} element Element to get style attribute for + * @param {String} attr Style attribute to get for element + * @return {String} Style attribute value of the given element. + */ + var getElementStyle; + if (fabric.document.defaultView && fabric.document.defaultView.getComputedStyle) { + getElementStyle = function(element, attr) { + var style = fabric.document.defaultView.getComputedStyle(element, null); + return style ? style[attr] : undefined; + }; + } + else { + getElementStyle = function(element, attr) { + var value = element.style[attr]; + if (!value && element.currentStyle) { + value = element.currentStyle[attr]; + } + return value; + }; + } + + (function () { + var style = fabric.document.documentElement.style, + selectProp = 'userSelect' in style + ? 'userSelect' + : 'MozUserSelect' in style + ? 'MozUserSelect' + : 'WebkitUserSelect' in style + ? 'WebkitUserSelect' + : 'KhtmlUserSelect' in style + ? 'KhtmlUserSelect' + : ''; + + /** + * Makes element unselectable + * @memberOf fabric.util + * @param {HTMLElement} element Element to make unselectable + * @return {HTMLElement} Element that was passed in + */ + function makeElementUnselectable(element) { + if (typeof element.onselectstart !== 'undefined') { + element.onselectstart = fabric.util.falseFunction; + } + if (selectProp) { + element.style[selectProp] = 'none'; + } + else if (typeof element.unselectable === 'string') { + element.unselectable = 'on'; + } + return element; + } + + /** + * Makes element selectable + * @memberOf fabric.util + * @param {HTMLElement} element Element to make selectable + * @return {HTMLElement} Element that was passed in + */ + function makeElementSelectable(element) { + if (typeof element.onselectstart !== 'undefined') { + element.onselectstart = null; + } + if (selectProp) { + element.style[selectProp] = ''; + } + else if (typeof element.unselectable === 'string') { + element.unselectable = ''; + } + return element; + } + + fabric.util.makeElementUnselectable = makeElementUnselectable; + fabric.util.makeElementSelectable = makeElementSelectable; + })(); + + function getNodeCanvas(element) { + var impl = fabric.jsdomImplForWrapper(element); + return impl._canvas || impl._image; + }; + + function cleanUpJsdomNode(element) { + if (!fabric.isLikelyNode) { + return; + } + var impl = fabric.jsdomImplForWrapper(element); + if (impl) { + impl._image = null; + impl._canvas = null; + // unsure if necessary + impl._currentSrc = null; + impl._attributes = null; + impl._classList = null; + } + } + + function setImageSmoothing(ctx, value) { + ctx.imageSmoothingEnabled = ctx.imageSmoothingEnabled || ctx.webkitImageSmoothingEnabled + || ctx.mozImageSmoothingEnabled || ctx.msImageSmoothingEnabled || ctx.oImageSmoothingEnabled; + ctx.imageSmoothingEnabled = value; + } + + /** + * setImageSmoothing sets the context imageSmoothingEnabled property. + * Used by canvas and by ImageObject. + * @memberOf fabric.util + * @since 4.0.0 + * @param {HTMLRenderingContext2D} ctx to set on + * @param {Boolean} value true or false + */ + fabric.util.setImageSmoothing = setImageSmoothing; + fabric.util.getById = getById; + fabric.util.toArray = toArray; + fabric.util.addClass = addClass; + fabric.util.makeElement = makeElement; + fabric.util.wrapElement = wrapElement; + fabric.util.getScrollLeftTop = getScrollLeftTop; + fabric.util.getElementOffset = getElementOffset; + fabric.util.getNodeCanvas = getNodeCanvas; + fabric.util.cleanUpJsdomNode = cleanUpJsdomNode; + +})(); +(function() { + + function addParamToUrl(url, param) { + return url + (/\?/.test(url) ? '&' : '?') + param; + } + + function emptyFn() { } + + /** + * Cross-browser abstraction for sending XMLHttpRequest + * @memberOf fabric.util + * @param {String} url URL to send XMLHttpRequest to + * @param {Object} [options] Options object + * @param {String} [options.method="GET"] + * @param {String} [options.parameters] parameters to append to url in GET or in body + * @param {String} [options.body] body to send with POST or PUT request + * @param {Function} options.onComplete Callback to invoke when request is completed + * @return {XMLHttpRequest} request + */ + function request(url, options) { + options || (options = { }); + + var method = options.method ? options.method.toUpperCase() : 'GET', + onComplete = options.onComplete || function() { }, + xhr = new fabric.window.XMLHttpRequest(), + body = options.body || options.parameters; + + /** @ignore */ + xhr.onreadystatechange = function() { + if (xhr.readyState === 4) { + onComplete(xhr); + xhr.onreadystatechange = emptyFn; + } + }; + + if (method === 'GET') { + body = null; + if (typeof options.parameters === 'string') { + url = addParamToUrl(url, options.parameters); + } + } + + xhr.open(method, url, true); + + if (method === 'POST' || method === 'PUT') { + xhr.setRequestHeader('Content-Type', 'application/x-www-form-urlencoded'); + } + + xhr.send(body); + return xhr; + } + + fabric.util.request = request; +})(); +/** + * Wrapper around `console.log` (when available) + * @param {*} [values] Values to log + */ +fabric.log = console.log; + +/** + * Wrapper around `console.warn` (when available) + * @param {*} [values] Values to log as a warning + */ +fabric.warn = console.warn; +(function() { + + function noop() { + return false; + } + + function defaultEasing(t, b, c, d) { + return -c * Math.cos(t / d * (Math.PI / 2)) + c + b; + } + + /** + * Changes value from one to another within certain period of time, invoking callbacks as value is being changed. + * @memberOf fabric.util + * @param {Object} [options] Animation options + * @param {Function} [options.onChange] Callback; invoked on every value change + * @param {Function} [options.onComplete] Callback; invoked when value change is completed + * @param {Number} [options.startValue=0] Starting value + * @param {Number} [options.endValue=100] Ending value + * @param {Number} [options.byValue=100] Value to modify the property by + * @param {Function} [options.easing] Easing function + * @param {Number} [options.duration=500] Duration of change (in ms) + * @param {Function} [options.abort] Additional function with logic. If returns true, onComplete is called. + */ + function animate(options) { + + requestAnimFrame(function(timestamp) { + options || (options = { }); + + var start = timestamp || +new Date(), + duration = options.duration || 500, + finish = start + duration, time, + onChange = options.onChange || noop, + abort = options.abort || noop, + onComplete = options.onComplete || noop, + easing = options.easing || defaultEasing, + startValue = 'startValue' in options ? options.startValue : 0, + endValue = 'endValue' in options ? options.endValue : 100, + byValue = options.byValue || endValue - startValue; + + options.onStart && options.onStart(); + + (function tick(ticktime) { + // TODO: move abort call after calculation + // and pass (current,valuePerc, timePerc) as arguments + time = ticktime || +new Date(); + var currentTime = time > finish ? duration : (time - start), + timePerc = currentTime / duration, + current = easing(currentTime, startValue, byValue, duration), + valuePerc = Math.abs((current - startValue) / byValue); + if (abort()) { + onComplete(endValue, 1, 1); + return; + } + if (time > finish) { + onChange(endValue, 1, 1); + onComplete(endValue, 1, 1); + return; + } + else { + onChange(current, valuePerc, timePerc); + requestAnimFrame(tick); + } + })(start); + }); + } + + var _requestAnimFrame = fabric.window.requestAnimationFrame || + fabric.window.webkitRequestAnimationFrame || + fabric.window.mozRequestAnimationFrame || + fabric.window.oRequestAnimationFrame || + fabric.window.msRequestAnimationFrame || + function(callback) { + return fabric.window.setTimeout(callback, 1000 / 60); + }; + + var _cancelAnimFrame = fabric.window.cancelAnimationFrame || fabric.window.clearTimeout; + + /** + * requestAnimationFrame polyfill based on http://paulirish.com/2011/requestanimationframe-for-smart-animating/ + * In order to get a precise start time, `requestAnimFrame` should be called as an entry into the method + * @memberOf fabric.util + * @param {Function} callback Callback to invoke + * @param {DOMElement} element optional Element to associate with animation + */ + function requestAnimFrame() { + return _requestAnimFrame.apply(fabric.window, arguments); + } + + function cancelAnimFrame() { + return _cancelAnimFrame.apply(fabric.window, arguments); + } + + fabric.util.animate = animate; + fabric.util.requestAnimFrame = requestAnimFrame; + fabric.util.cancelAnimFrame = cancelAnimFrame; +})(); +(function() { + // Calculate an in-between color. Returns a "rgba()" string. + // Credit: Edwin Martin + // http://www.bitstorm.org/jquery/color-animation/jquery.animate-colors.js + function calculateColor(begin, end, pos) { + var color = 'rgba(' + + parseInt((begin[0] + pos * (end[0] - begin[0])), 10) + ',' + + parseInt((begin[1] + pos * (end[1] - begin[1])), 10) + ',' + + parseInt((begin[2] + pos * (end[2] - begin[2])), 10); + + color += ',' + (begin && end ? parseFloat(begin[3] + pos * (end[3] - begin[3])) : 1); + color += ')'; + return color; + } + + /** + * Changes the color from one to another within certain period of time, invoking callbacks as value is being changed. + * @memberOf fabric.util + * @param {String} fromColor The starting color in hex or rgb(a) format. + * @param {String} toColor The starting color in hex or rgb(a) format. + * @param {Number} [duration] Duration of change (in ms). + * @param {Object} [options] Animation options + * @param {Function} [options.onChange] Callback; invoked on every value change + * @param {Function} [options.onComplete] Callback; invoked when value change is completed + * @param {Function} [options.colorEasing] Easing function. Note that this function only take two arguments (currentTime, duration). Thus the regular animation easing functions cannot be used. + * @param {Function} [options.abort] Additional function with logic. If returns true, onComplete is called. + */ + function animateColor(fromColor, toColor, duration, options) { + var startColor = new fabric.Color(fromColor).getSource(), + endColor = new fabric.Color(toColor).getSource(), + originalOnComplete = options.onComplete, + originalOnChange = options.onChange; + options = options || {}; + + fabric.util.animate(fabric.util.object.extend(options, { + duration: duration || 500, + startValue: startColor, + endValue: endColor, + byValue: endColor, + easing: function (currentTime, startValue, byValue, duration) { + var posValue = options.colorEasing + ? options.colorEasing(currentTime, duration) + : 1 - Math.cos(currentTime / duration * (Math.PI / 2)); + return calculateColor(startValue, byValue, posValue); + }, + // has to take in account for color restoring; + onComplete: function(current, valuePerc, timePerc) { + if (originalOnComplete) { + return originalOnComplete( + calculateColor(endColor, endColor, 0), + valuePerc, + timePerc + ); + } + }, + onChange: function(current, valuePerc, timePerc) { + if (originalOnChange) { + if (Array.isArray(current)) { + return originalOnChange( + calculateColor(current, current, 0), + valuePerc, + timePerc + ); + } + originalOnChange(current, valuePerc, timePerc); + } + } + })); + } + + fabric.util.animateColor = animateColor; + +})(); +(function() { + + function normalize(a, c, p, s) { + if (a < Math.abs(c)) { + a = c; + s = p / 4; + } + else { + //handle the 0/0 case: + if (c === 0 && a === 0) { + s = p / (2 * Math.PI) * Math.asin(1); + } + else { + s = p / (2 * Math.PI) * Math.asin(c / a); + } + } + return { a: a, c: c, p: p, s: s }; + } + + function elastic(opts, t, d) { + return opts.a * + Math.pow(2, 10 * (t -= 1)) * + Math.sin( (t * d - opts.s) * (2 * Math.PI) / opts.p ); + } + + /** + * Cubic easing out + * @memberOf fabric.util.ease + */ + function easeOutCubic(t, b, c, d) { + return c * ((t = t / d - 1) * t * t + 1) + b; + } + + /** + * Cubic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutCubic(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t * t + b; + } + return c / 2 * ((t -= 2) * t * t + 2) + b; + } + + /** + * Quartic easing in + * @memberOf fabric.util.ease + */ + function easeInQuart(t, b, c, d) { + return c * (t /= d) * t * t * t + b; + } + + /** + * Quartic easing out + * @memberOf fabric.util.ease + */ + function easeOutQuart(t, b, c, d) { + return -c * ((t = t / d - 1) * t * t * t - 1) + b; + } + + /** + * Quartic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutQuart(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t * t * t + b; + } + return -c / 2 * ((t -= 2) * t * t * t - 2) + b; + } + + /** + * Quintic easing in + * @memberOf fabric.util.ease + */ + function easeInQuint(t, b, c, d) { + return c * (t /= d) * t * t * t * t + b; + } + + /** + * Quintic easing out + * @memberOf fabric.util.ease + */ + function easeOutQuint(t, b, c, d) { + return c * ((t = t / d - 1) * t * t * t * t + 1) + b; + } + + /** + * Quintic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutQuint(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t * t * t * t + b; + } + return c / 2 * ((t -= 2) * t * t * t * t + 2) + b; + } + + /** + * Sinusoidal easing in + * @memberOf fabric.util.ease + */ + function easeInSine(t, b, c, d) { + return -c * Math.cos(t / d * (Math.PI / 2)) + c + b; + } + + /** + * Sinusoidal easing out + * @memberOf fabric.util.ease + */ + function easeOutSine(t, b, c, d) { + return c * Math.sin(t / d * (Math.PI / 2)) + b; + } + + /** + * Sinusoidal easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutSine(t, b, c, d) { + return -c / 2 * (Math.cos(Math.PI * t / d) - 1) + b; + } + + /** + * Exponential easing in + * @memberOf fabric.util.ease + */ + function easeInExpo(t, b, c, d) { + return (t === 0) ? b : c * Math.pow(2, 10 * (t / d - 1)) + b; + } + + /** + * Exponential easing out + * @memberOf fabric.util.ease + */ + function easeOutExpo(t, b, c, d) { + return (t === d) ? b + c : c * (-Math.pow(2, -10 * t / d) + 1) + b; + } + + /** + * Exponential easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutExpo(t, b, c, d) { + if (t === 0) { + return b; + } + if (t === d) { + return b + c; + } + t /= d / 2; + if (t < 1) { + return c / 2 * Math.pow(2, 10 * (t - 1)) + b; + } + return c / 2 * (-Math.pow(2, -10 * --t) + 2) + b; + } + + /** + * Circular easing in + * @memberOf fabric.util.ease + */ + function easeInCirc(t, b, c, d) { + return -c * (Math.sqrt(1 - (t /= d) * t) - 1) + b; + } + + /** + * Circular easing out + * @memberOf fabric.util.ease + */ + function easeOutCirc(t, b, c, d) { + return c * Math.sqrt(1 - (t = t / d - 1) * t) + b; + } + + /** + * Circular easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutCirc(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return -c / 2 * (Math.sqrt(1 - t * t) - 1) + b; + } + return c / 2 * (Math.sqrt(1 - (t -= 2) * t) + 1) + b; + } + + /** + * Elastic easing in + * @memberOf fabric.util.ease + */ + function easeInElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d; + if (t === 1) { + return b + c; + } + if (!p) { + p = d * 0.3; + } + var opts = normalize(a, c, p, s); + return -elastic(opts, t, d) + b; + } + + /** + * Elastic easing out + * @memberOf fabric.util.ease + */ + function easeOutElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d; + if (t === 1) { + return b + c; + } + if (!p) { + p = d * 0.3; + } + var opts = normalize(a, c, p, s); + return opts.a * Math.pow(2, -10 * t) * Math.sin((t * d - opts.s) * (2 * Math.PI) / opts.p ) + opts.c + b; + } + + /** + * Elastic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d / 2; + if (t === 2) { + return b + c; + } + if (!p) { + p = d * (0.3 * 1.5); + } + var opts = normalize(a, c, p, s); + if (t < 1) { + return -0.5 * elastic(opts, t, d) + b; + } + return opts.a * Math.pow(2, -10 * (t -= 1)) * + Math.sin((t * d - opts.s) * (2 * Math.PI) / opts.p ) * 0.5 + opts.c + b; + } + + /** + * Backwards easing in + * @memberOf fabric.util.ease + */ + function easeInBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + return c * (t /= d) * t * ((s + 1) * t - s) + b; + } + + /** + * Backwards easing out + * @memberOf fabric.util.ease + */ + function easeOutBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + return c * ((t = t / d - 1) * t * ((s + 1) * t + s) + 1) + b; + } + + /** + * Backwards easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + t /= d / 2; + if (t < 1) { + return c / 2 * (t * t * (((s *= (1.525)) + 1) * t - s)) + b; + } + return c / 2 * ((t -= 2) * t * (((s *= (1.525)) + 1) * t + s) + 2) + b; + } + + /** + * Bouncing easing in + * @memberOf fabric.util.ease + */ + function easeInBounce(t, b, c, d) { + return c - easeOutBounce (d - t, 0, c, d) + b; + } + + /** + * Bouncing easing out + * @memberOf fabric.util.ease + */ + function easeOutBounce(t, b, c, d) { + if ((t /= d) < (1 / 2.75)) { + return c * (7.5625 * t * t) + b; + } + else if (t < (2 / 2.75)) { + return c * (7.5625 * (t -= (1.5 / 2.75)) * t + 0.75) + b; + } + else if (t < (2.5 / 2.75)) { + return c * (7.5625 * (t -= (2.25 / 2.75)) * t + 0.9375) + b; + } + else { + return c * (7.5625 * (t -= (2.625 / 2.75)) * t + 0.984375) + b; + } + } + + /** + * Bouncing easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutBounce(t, b, c, d) { + if (t < d / 2) { + return easeInBounce (t * 2, 0, c, d) * 0.5 + b; + } + return easeOutBounce(t * 2 - d, 0, c, d) * 0.5 + c * 0.5 + b; + } + + /** + * Easing functions + * See Easing Equations by Robert Penner + * @namespace fabric.util.ease + */ + fabric.util.ease = { + + /** + * Quadratic easing in + * @memberOf fabric.util.ease + */ + easeInQuad: function(t, b, c, d) { + return c * (t /= d) * t + b; + }, + + /** + * Quadratic easing out + * @memberOf fabric.util.ease + */ + easeOutQuad: function(t, b, c, d) { + return -c * (t /= d) * (t - 2) + b; + }, + + /** + * Quadratic easing in and out + * @memberOf fabric.util.ease + */ + easeInOutQuad: function(t, b, c, d) { + t /= (d / 2); + if (t < 1) { + return c / 2 * t * t + b; + } + return -c / 2 * ((--t) * (t - 2) - 1) + b; + }, + + /** + * Cubic easing in + * @memberOf fabric.util.ease + */ + easeInCubic: function(t, b, c, d) { + return c * (t /= d) * t * t + b; + }, + + easeOutCubic: easeOutCubic, + easeInOutCubic: easeInOutCubic, + easeInQuart: easeInQuart, + easeOutQuart: easeOutQuart, + easeInOutQuart: easeInOutQuart, + easeInQuint: easeInQuint, + easeOutQuint: easeOutQuint, + easeInOutQuint: easeInOutQuint, + easeInSine: easeInSine, + easeOutSine: easeOutSine, + easeInOutSine: easeInOutSine, + easeInExpo: easeInExpo, + easeOutExpo: easeOutExpo, + easeInOutExpo: easeInOutExpo, + easeInCirc: easeInCirc, + easeOutCirc: easeOutCirc, + easeInOutCirc: easeInOutCirc, + easeInElastic: easeInElastic, + easeOutElastic: easeOutElastic, + easeInOutElastic: easeInOutElastic, + easeInBack: easeInBack, + easeOutBack: easeOutBack, + easeInOutBack: easeInOutBack, + easeInBounce: easeInBounce, + easeOutBounce: easeOutBounce, + easeInOutBounce: easeInOutBounce + }; + +})(); +(function(global) { + + 'use strict'; + + /** + * @name fabric + * @namespace + */ + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + clone = fabric.util.object.clone, + toFixed = fabric.util.toFixed, + parseUnit = fabric.util.parseUnit, + multiplyTransformMatrices = fabric.util.multiplyTransformMatrices, + + svgValidTagNames = ['path', 'circle', 'polygon', 'polyline', 'ellipse', 'rect', 'line', + 'image', 'text'], + svgViewBoxElements = ['symbol', 'image', 'marker', 'pattern', 'view', 'svg'], + svgInvalidAncestors = ['pattern', 'defs', 'symbol', 'metadata', 'clipPath', 'mask', 'desc'], + svgValidParents = ['symbol', 'g', 'a', 'svg', 'clipPath', 'defs'], + + attributesMap = { + cx: 'left', + x: 'left', + r: 'radius', + cy: 'top', + y: 'top', + display: 'visible', + visibility: 'visible', + transform: 'transformMatrix', + 'fill-opacity': 'fillOpacity', + 'fill-rule': 'fillRule', + 'font-family': 'fontFamily', + 'font-size': 'fontSize', + 'font-style': 'fontStyle', + 'font-weight': 'fontWeight', + 'letter-spacing': 'charSpacing', + 'paint-order': 'paintFirst', + 'stroke-dasharray': 'strokeDashArray', + 'stroke-dashoffset': 'strokeDashOffset', + 'stroke-linecap': 'strokeLineCap', + 'stroke-linejoin': 'strokeLineJoin', + 'stroke-miterlimit': 'strokeMiterLimit', + 'stroke-opacity': 'strokeOpacity', + 'stroke-width': 'strokeWidth', + 'text-decoration': 'textDecoration', + 'text-anchor': 'textAnchor', + opacity: 'opacity', + 'clip-path': 'clipPath', + 'clip-rule': 'clipRule', + 'vector-effect': 'strokeUniform', + 'image-rendering': 'imageSmoothing', + }, + + colorAttributes = { + stroke: 'strokeOpacity', + fill: 'fillOpacity' + }, + + fSize = 'font-size', cPath = 'clip-path'; + + fabric.svgValidTagNamesRegEx = getSvgRegex(svgValidTagNames); + fabric.svgViewBoxElementsRegEx = getSvgRegex(svgViewBoxElements); + fabric.svgInvalidAncestorsRegEx = getSvgRegex(svgInvalidAncestors); + fabric.svgValidParentsRegEx = getSvgRegex(svgValidParents); + + fabric.cssRules = { }; + fabric.gradientDefs = { }; + fabric.clipPaths = { }; + + function normalizeAttr(attr) { + // transform attribute names + if (attr in attributesMap) { + return attributesMap[attr]; + } + return attr; + } + + function normalizeValue(attr, value, parentAttributes, fontSize) { + var isArray = Object.prototype.toString.call(value) === '[object Array]', + parsed; + + if ((attr === 'fill' || attr === 'stroke') && value === 'none') { + value = ''; + } + else if (attr === 'strokeUniform') { + return (value === 'non-scaling-stroke'); + } + else if (attr === 'strokeDashArray') { + if (value === 'none') { + value = null; + } + else { + value = value.replace(/,/g, ' ').split(/\s+/).map(parseFloat); + } + } + else if (attr === 'transformMatrix') { + if (parentAttributes && parentAttributes.transformMatrix) { + value = multiplyTransformMatrices( + parentAttributes.transformMatrix, fabric.parseTransformAttribute(value)); + } + else { + value = fabric.parseTransformAttribute(value); + } + } + else if (attr === 'visible') { + value = value !== 'none' && value !== 'hidden'; + // display=none on parent element always takes precedence over child element + if (parentAttributes && parentAttributes.visible === false) { + value = false; + } + } + else if (attr === 'opacity') { + value = parseFloat(value); + if (parentAttributes && typeof parentAttributes.opacity !== 'undefined') { + value *= parentAttributes.opacity; + } + } + else if (attr === 'textAnchor' /* text-anchor */) { + value = value === 'start' ? 'left' : value === 'end' ? 'right' : 'center'; + } + else if (attr === 'charSpacing') { + // parseUnit returns px and we convert it to em + parsed = parseUnit(value, fontSize) / fontSize * 1000; + } + else if (attr === 'paintFirst') { + var fillIndex = value.indexOf('fill'); + var strokeIndex = value.indexOf('stroke'); + var value = 'fill'; + if (fillIndex > -1 && strokeIndex > -1 && strokeIndex < fillIndex) { + value = 'stroke'; + } + else if (fillIndex === -1 && strokeIndex > -1) { + value = 'stroke'; + } + } + else if (attr === 'href' || attr === 'xlink:href' || attr === 'font') { + return value; + } + else if (attr === 'imageSmoothing') { + return (value === 'optimizeQuality' ? true : false); + } + else { + parsed = isArray ? value.map(parseUnit) : parseUnit(value, fontSize); + } + + return (!isArray && isNaN(parsed) ? value : parsed); + } + + /** + * @private + */ + function getSvgRegex(arr) { + return new RegExp('^(' + arr.join('|') + ')\\b', 'i'); + } + + /** + * @private + * @param {Object} attributes Array of attributes to parse + */ + function _setStrokeFillOpacity(attributes) { + for (var attr in colorAttributes) { + + if (typeof attributes[colorAttributes[attr]] === 'undefined' || attributes[attr] === '') { + continue; + } + + if (typeof attributes[attr] === 'undefined') { + if (!fabric.Object.prototype[attr]) { + continue; + } + attributes[attr] = fabric.Object.prototype[attr]; + } + + if (attributes[attr].indexOf('url(') === 0) { + continue; + } + + var color = new fabric.Color(attributes[attr]); + attributes[attr] = color.setAlpha(toFixed(color.getAlpha() * attributes[colorAttributes[attr]], 2)).toRgba(); + } + return attributes; + } + + /** + * @private + */ + function _getMultipleNodes(doc, nodeNames) { + var nodeName, nodeArray = [], nodeList, i, len; + for (i = 0, len = nodeNames.length; i < len; i++) { + nodeName = nodeNames[i]; + nodeList = doc.getElementsByTagName(nodeName); + nodeArray = nodeArray.concat(Array.prototype.slice.call(nodeList)); + } + return nodeArray; + } + + /** + * Parses "transform" attribute, returning an array of values + * @static + * @function + * @memberOf fabric + * @param {String} attributeValue String containing attribute value + * @return {Array} Array of 6 elements representing transformation matrix + */ + fabric.parseTransformAttribute = (function() { + function rotateMatrix(matrix, args) { + var cos = fabric.util.cos(args[0]), sin = fabric.util.sin(args[0]), + x = 0, y = 0; + if (args.length === 3) { + x = args[1]; + y = args[2]; + } + + matrix[0] = cos; + matrix[1] = sin; + matrix[2] = -sin; + matrix[3] = cos; + matrix[4] = x - (cos * x - sin * y); + matrix[5] = y - (sin * x + cos * y); + } + + function scaleMatrix(matrix, args) { + var multiplierX = args[0], + multiplierY = (args.length === 2) ? args[1] : args[0]; + + matrix[0] = multiplierX; + matrix[3] = multiplierY; + } + + function skewMatrix(matrix, args, pos) { + matrix[pos] = Math.tan(fabric.util.degreesToRadians(args[0])); + } + + function translateMatrix(matrix, args) { + matrix[4] = args[0]; + if (args.length === 2) { + matrix[5] = args[1]; + } + } + + // identity matrix + var iMatrix = fabric.iMatrix, + + // == begin transform regexp + number = fabric.reNum, + + commaWsp = fabric.commaWsp, + + skewX = '(?:(skewX)\\s*\\(\\s*(' + number + ')\\s*\\))', + + skewY = '(?:(skewY)\\s*\\(\\s*(' + number + ')\\s*\\))', + + rotate = '(?:(rotate)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + ')' + + commaWsp + '(' + number + '))?\\s*\\))', + + scale = '(?:(scale)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + '))?\\s*\\))', + + translate = '(?:(translate)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + '))?\\s*\\))', + + matrix = '(?:(matrix)\\s*\\(\\s*' + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + + '\\s*\\))', + + transform = '(?:' + + matrix + '|' + + translate + '|' + + scale + '|' + + rotate + '|' + + skewX + '|' + + skewY + + ')', + + transforms = '(?:' + transform + '(?:' + commaWsp + '*' + transform + ')*' + ')', + + transformList = '^\\s*(?:' + transforms + '?)\\s*$', + + // http://www.w3.org/TR/SVG/coords.html#TransformAttribute + reTransformList = new RegExp(transformList), + // == end transform regexp + + reTransform = new RegExp(transform, 'g'); + + return function(attributeValue) { + + // start with identity matrix + var matrix = iMatrix.concat(), + matrices = []; + + // return if no argument was given or + // an argument does not match transform attribute regexp + if (!attributeValue || (attributeValue && !reTransformList.test(attributeValue))) { + return matrix; + } + + attributeValue.replace(reTransform, function(match) { + + var m = new RegExp(transform).exec(match).filter(function (match) { + // match !== '' && match != null + return (!!match); + }), + operation = m[1], + args = m.slice(2).map(parseFloat); + + switch (operation) { + case 'translate': + translateMatrix(matrix, args); + break; + case 'rotate': + args[0] = fabric.util.degreesToRadians(args[0]); + rotateMatrix(matrix, args); + break; + case 'scale': + scaleMatrix(matrix, args); + break; + case 'skewX': + skewMatrix(matrix, args, 2); + break; + case 'skewY': + skewMatrix(matrix, args, 1); + break; + case 'matrix': + matrix = args; + break; + } + + // snapshot current matrix into matrices array + matrices.push(matrix.concat()); + // reset + matrix = iMatrix.concat(); + }); + + var combinedMatrix = matrices[0]; + while (matrices.length > 1) { + matrices.shift(); + combinedMatrix = fabric.util.multiplyTransformMatrices(combinedMatrix, matrices[0]); + } + return combinedMatrix; + }; + })(); + + /** + * @private + */ + function parseStyleString(style, oStyle) { + var attr, value; + style.replace(/;\s*$/, '').split(';').forEach(function (chunk) { + var pair = chunk.split(':'); + + attr = pair[0].trim().toLowerCase(); + value = pair[1].trim(); + + oStyle[attr] = value; + }); + } + + /** + * @private + */ + function parseStyleObject(style, oStyle) { + var attr, value; + for (var prop in style) { + if (typeof style[prop] === 'undefined') { + continue; + } + + attr = prop.toLowerCase(); + value = style[prop]; + + oStyle[attr] = value; + } + } + + /** + * @private + */ + function getGlobalStylesForElement(element, svgUid) { + var styles = { }; + for (var rule in fabric.cssRules[svgUid]) { + if (elementMatchesRule(element, rule.split(' '))) { + for (var property in fabric.cssRules[svgUid][rule]) { + styles[property] = fabric.cssRules[svgUid][rule][property]; + } + } + } + return styles; + } + + /** + * @private + */ + function elementMatchesRule(element, selectors) { + var firstMatching, parentMatching = true; + //start from rightmost selector. + firstMatching = selectorMatches(element, selectors.pop()); + if (firstMatching && selectors.length) { + parentMatching = doesSomeParentMatch(element, selectors); + } + return firstMatching && parentMatching && (selectors.length === 0); + } + + function doesSomeParentMatch(element, selectors) { + var selector, parentMatching = true; + while (element.parentNode && element.parentNode.nodeType === 1 && selectors.length) { + if (parentMatching) { + selector = selectors.pop(); + } + element = element.parentNode; + parentMatching = selectorMatches(element, selector); + } + return selectors.length === 0; + } + + /** + * @private + */ + function selectorMatches(element, selector) { + var nodeName = element.nodeName, + classNames = element.getAttribute('class'), + id = element.getAttribute('id'), matcher, i; + // i check if a selector matches slicing away part from it. + // if i get empty string i should match + matcher = new RegExp('^' + nodeName, 'i'); + selector = selector.replace(matcher, ''); + if (id && selector.length) { + matcher = new RegExp('#' + id + '(?![a-zA-Z\\-]+)', 'i'); + selector = selector.replace(matcher, ''); + } + if (classNames && selector.length) { + classNames = classNames.split(' '); + for (i = classNames.length; i--;) { + matcher = new RegExp('\\.' + classNames[i] + '(?![a-zA-Z\\-]+)', 'i'); + selector = selector.replace(matcher, ''); + } + } + return selector.length === 0; + } + + /** + * @private + * to support IE8 missing getElementById on SVGdocument and on node xmlDOM + */ + function elementById(doc, id) { + var el; + doc.getElementById && (el = doc.getElementById(id)); + if (el) { + return el; + } + var node, i, len, nodelist = doc.getElementsByTagName('*'); + for (i = 0, len = nodelist.length; i < len; i++) { + node = nodelist[i]; + if (id === node.getAttribute('id')) { + return node; + } + } + } + + /** + * @private + */ + function parseUseDirectives(doc) { + var nodelist = _getMultipleNodes(doc, ['use', 'svg:use']), i = 0; + while (nodelist.length && i < nodelist.length) { + var el = nodelist[i], + xlink = (el.getAttribute('xlink:href') || el.getAttribute('href')).substr(1), + x = el.getAttribute('x') || 0, + y = el.getAttribute('y') || 0, + el2 = elementById(doc, xlink).cloneNode(true), + currentTrans = (el2.getAttribute('transform') || '') + ' translate(' + x + ', ' + y + ')', + parentNode, oldLength = nodelist.length, attr, j, attrs, len, namespace = fabric.svgNS; + + applyViewboxTransform(el2); + if (/^svg$/i.test(el2.nodeName)) { + var el3 = el2.ownerDocument.createElementNS(namespace, 'g'); + for (j = 0, attrs = el2.attributes, len = attrs.length; j < len; j++) { + attr = attrs.item(j); + el3.setAttributeNS(namespace, attr.nodeName, attr.nodeValue); + } + // el2.firstChild != null + while (el2.firstChild) { + el3.appendChild(el2.firstChild); + } + el2 = el3; + } + + for (j = 0, attrs = el.attributes, len = attrs.length; j < len; j++) { + attr = attrs.item(j); + if (attr.nodeName === 'x' || attr.nodeName === 'y' || + attr.nodeName === 'xlink:href' || attr.nodeName === 'href') { + continue; + } + + if (attr.nodeName === 'transform') { + currentTrans = attr.nodeValue + ' ' + currentTrans; + } + else { + el2.setAttribute(attr.nodeName, attr.nodeValue); + } + } + + el2.setAttribute('transform', currentTrans); + el2.setAttribute('instantiated_by_use', '1'); + el2.removeAttribute('id'); + parentNode = el.parentNode; + parentNode.replaceChild(el2, el); + // some browsers do not shorten nodelist after replaceChild (IE8) + if (nodelist.length === oldLength) { + i++; + } + } + } + + // http://www.w3.org/TR/SVG/coords.html#ViewBoxAttribute + // matches, e.g.: +14.56e-12, etc. + var reViewBoxAttrValue = new RegExp( + '^' + + '\\s*(' + fabric.reNum + '+)\\s*,?' + + '\\s*(' + fabric.reNum + '+)\\s*,?' + + '\\s*(' + fabric.reNum + '+)\\s*,?' + + '\\s*(' + fabric.reNum + '+)\\s*' + + '$' + ); + + /** + * Add a element that envelop all child elements and makes the viewbox transformMatrix descend on all elements + */ + function applyViewboxTransform(element) { + if (!fabric.svgViewBoxElementsRegEx.test(element.nodeName)) { + return; + } + var viewBoxAttr = element.getAttribute('viewBox'), + scaleX = 1, + scaleY = 1, + minX = 0, + minY = 0, + viewBoxWidth, viewBoxHeight, matrix, el, + widthAttr = element.getAttribute('width'), + heightAttr = element.getAttribute('height'), + x = element.getAttribute('x') || 0, + y = element.getAttribute('y') || 0, + preserveAspectRatio = element.getAttribute('preserveAspectRatio') || '', + missingViewBox = (!viewBoxAttr || !(viewBoxAttr = viewBoxAttr.match(reViewBoxAttrValue))), + missingDimAttr = (!widthAttr || !heightAttr || widthAttr === '100%' || heightAttr === '100%'), + toBeParsed = missingViewBox && missingDimAttr, + parsedDim = { }, translateMatrix = '', widthDiff = 0, heightDiff = 0; + + parsedDim.width = 0; + parsedDim.height = 0; + parsedDim.toBeParsed = toBeParsed; + + if (missingViewBox) { + if (((x || y) && element.parentNode.nodeName !== '#document')) { + translateMatrix = ' translate(' + parseUnit(x) + ' ' + parseUnit(y) + ') '; + matrix = (element.getAttribute('transform') || '') + translateMatrix; + element.setAttribute('transform', matrix); + element.removeAttribute('x'); + element.removeAttribute('y'); + } + } + + if (toBeParsed) { + return parsedDim; + } + + if (missingViewBox) { + parsedDim.width = parseUnit(widthAttr); + parsedDim.height = parseUnit(heightAttr); + // set a transform for elements that have x y and are inner(only) SVGs + return parsedDim; + } + minX = -parseFloat(viewBoxAttr[1]); + minY = -parseFloat(viewBoxAttr[2]); + viewBoxWidth = parseFloat(viewBoxAttr[3]); + viewBoxHeight = parseFloat(viewBoxAttr[4]); + parsedDim.minX = minX; + parsedDim.minY = minY; + parsedDim.viewBoxWidth = viewBoxWidth; + parsedDim.viewBoxHeight = viewBoxHeight; + if (!missingDimAttr) { + parsedDim.width = parseUnit(widthAttr); + parsedDim.height = parseUnit(heightAttr); + scaleX = parsedDim.width / viewBoxWidth; + scaleY = parsedDim.height / viewBoxHeight; + } + else { + parsedDim.width = viewBoxWidth; + parsedDim.height = viewBoxHeight; + } + + // default is to preserve aspect ratio + preserveAspectRatio = fabric.util.parsePreserveAspectRatioAttribute(preserveAspectRatio); + if (preserveAspectRatio.alignX !== 'none') { + //translate all container for the effect of Mid, Min, Max + if (preserveAspectRatio.meetOrSlice === 'meet') { + scaleY = scaleX = (scaleX > scaleY ? scaleY : scaleX); + // calculate additional translation to move the viewbox + } + if (preserveAspectRatio.meetOrSlice === 'slice') { + scaleY = scaleX = (scaleX > scaleY ? scaleX : scaleY); + // calculate additional translation to move the viewbox + } + widthDiff = parsedDim.width - viewBoxWidth * scaleX; + heightDiff = parsedDim.height - viewBoxHeight * scaleX; + if (preserveAspectRatio.alignX === 'Mid') { + widthDiff /= 2; + } + if (preserveAspectRatio.alignY === 'Mid') { + heightDiff /= 2; + } + if (preserveAspectRatio.alignX === 'Min') { + widthDiff = 0; + } + if (preserveAspectRatio.alignY === 'Min') { + heightDiff = 0; + } + } + + if (scaleX === 1 && scaleY === 1 && minX === 0 && minY === 0 && x === 0 && y === 0) { + return parsedDim; + } + if ((x || y) && element.parentNode.nodeName !== '#document') { + translateMatrix = ' translate(' + parseUnit(x) + ' ' + parseUnit(y) + ') '; + } + + matrix = translateMatrix + ' matrix(' + scaleX + + ' 0' + + ' 0 ' + + scaleY + ' ' + + (minX * scaleX + widthDiff) + ' ' + + (minY * scaleY + heightDiff) + ') '; + // seems unused. + // parsedDim.viewboxTransform = fabric.parseTransformAttribute(matrix); + if (element.nodeName === 'svg') { + el = element.ownerDocument.createElementNS(fabric.svgNS, 'g'); + // element.firstChild != null + while (element.firstChild) { + el.appendChild(element.firstChild); + } + element.appendChild(el); + } + else { + el = element; + el.removeAttribute('x'); + el.removeAttribute('y'); + matrix = el.getAttribute('transform') + matrix; + } + el.setAttribute('transform', matrix); + return parsedDim; + } + + function hasAncestorWithNodeName(element, nodeName) { + while (element && (element = element.parentNode)) { + if (element.nodeName && nodeName.test(element.nodeName.replace('svg:', '')) + && !element.getAttribute('instantiated_by_use')) { + return true; + } + } + return false; + } + + /** + * Parses an SVG document, converts it to an array of corresponding fabric.* instances and passes them to a callback + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @param {Function} callback Callback to call when parsing is finished; + * It's being passed an array of elements (parsed from a document). + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + * @param {Object} [parsingOptions] options for parsing document + * @param {String} [parsingOptions.crossOrigin] crossOrigin settings + */ + fabric.parseSVGDocument = function(doc, callback, reviver, parsingOptions) { + if (!doc) { + return; + } + + parseUseDirectives(doc); + + var svgUid = fabric.Object.__uid++, i, len, + options = applyViewboxTransform(doc), + descendants = fabric.util.toArray(doc.getElementsByTagName('*')); + options.crossOrigin = parsingOptions && parsingOptions.crossOrigin; + options.svgUid = svgUid; + + if (descendants.length === 0 && fabric.isLikelyNode) { + // we're likely in node, where "o3-xml" library fails to gEBTN("*") + // https://github.com/ajaxorg/node-o3-xml/issues/21 + descendants = doc.selectNodes('//*[name(.)!="svg"]'); + var arr = []; + for (i = 0, len = descendants.length; i < len; i++) { + arr[i] = descendants[i]; + } + descendants = arr; + } + + var elements = descendants.filter(function(el) { + applyViewboxTransform(el); + return fabric.svgValidTagNamesRegEx.test(el.nodeName.replace('svg:', '')) && + !hasAncestorWithNodeName(el, fabric.svgInvalidAncestorsRegEx); // http://www.w3.org/TR/SVG/struct.html#DefsElement + }); + if (!elements || (elements && !elements.length)) { + callback && callback([], {}); + return; + } + var clipPaths = { }; + descendants.filter(function(el) { + return el.nodeName.replace('svg:', '') === 'clipPath'; + }).forEach(function(el) { + var id = el.getAttribute('id'); + clipPaths[id] = fabric.util.toArray(el.getElementsByTagName('*')).filter(function(el) { + return fabric.svgValidTagNamesRegEx.test(el.nodeName.replace('svg:', '')); + }); + }); + fabric.gradientDefs[svgUid] = fabric.getGradientDefs(doc); + fabric.cssRules[svgUid] = fabric.getCSSRules(doc); + fabric.clipPaths[svgUid] = clipPaths; + // Precedence of rules: style > class > attribute + fabric.parseElements(elements, function(instances, elements) { + if (callback) { + callback(instances, options, elements, descendants); + delete fabric.gradientDefs[svgUid]; + delete fabric.cssRules[svgUid]; + delete fabric.clipPaths[svgUid]; + } + }, clone(options), reviver, parsingOptions); + }; + + function recursivelyParseGradientsXlink(doc, gradient) { + var gradientsAttrs = ['gradientTransform', 'x1', 'x2', 'y1', 'y2', 'gradientUnits', 'cx', 'cy', 'r', 'fx', 'fy'], + xlinkAttr = 'xlink:href', + xLink = gradient.getAttribute(xlinkAttr).substr(1), + referencedGradient = elementById(doc, xLink); + if (referencedGradient && referencedGradient.getAttribute(xlinkAttr)) { + recursivelyParseGradientsXlink(doc, referencedGradient); + } + gradientsAttrs.forEach(function(attr) { + if (referencedGradient && !gradient.hasAttribute(attr) && referencedGradient.hasAttribute(attr)) { + gradient.setAttribute(attr, referencedGradient.getAttribute(attr)); + } + }); + if (!gradient.children.length) { + var referenceClone = referencedGradient.cloneNode(true); + while (referenceClone.firstChild) { + gradient.appendChild(referenceClone.firstChild); + } + } + gradient.removeAttribute(xlinkAttr); + } + + var reFontDeclaration = new RegExp( + '(normal|italic)?\\s*(normal|small-caps)?\\s*' + + '(normal|bold|bolder|lighter|100|200|300|400|500|600|700|800|900)?\\s*(' + + fabric.reNum + + '(?:px|cm|mm|em|pt|pc|in)*)(?:\\/(normal|' + fabric.reNum + '))?\\s+(.*)'); + + extend(fabric, { + /** + * Parses a short font declaration, building adding its properties to a style object + * @static + * @function + * @memberOf fabric + * @param {String} value font declaration + * @param {Object} oStyle definition + */ + parseFontDeclaration: function(value, oStyle) { + var match = value.match(reFontDeclaration); + + if (!match) { + return; + } + var fontStyle = match[1], + // font variant is not used + // fontVariant = match[2], + fontWeight = match[3], + fontSize = match[4], + lineHeight = match[5], + fontFamily = match[6]; + + if (fontStyle) { + oStyle.fontStyle = fontStyle; + } + if (fontWeight) { + oStyle.fontWeight = isNaN(parseFloat(fontWeight)) ? fontWeight : parseFloat(fontWeight); + } + if (fontSize) { + oStyle.fontSize = parseUnit(fontSize); + } + if (fontFamily) { + oStyle.fontFamily = fontFamily; + } + if (lineHeight) { + oStyle.lineHeight = lineHeight === 'normal' ? 1 : lineHeight; + } + }, + + /** + * Parses an SVG document, returning all of the gradient declarations found in it + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @return {Object} Gradient definitions; key corresponds to element id, value -- to gradient definition element + */ + getGradientDefs: function(doc) { + var tagArray = [ + 'linearGradient', + 'radialGradient', + 'svg:linearGradient', + 'svg:radialGradient'], + elList = _getMultipleNodes(doc, tagArray), + el, j = 0, gradientDefs = { }; + j = elList.length; + while (j--) { + el = elList[j]; + if (el.getAttribute('xlink:href')) { + recursivelyParseGradientsXlink(doc, el); + } + gradientDefs[el.getAttribute('id')] = el; + } + return gradientDefs; + }, + + /** + * Returns an object of attributes' name/value, given element and an array of attribute names; + * Parses parent "g" nodes recursively upwards. + * @static + * @memberOf fabric + * @param {DOMElement} element Element to parse + * @param {Array} attributes Array of attributes to parse + * @return {Object} object containing parsed attributes' names/values + */ + parseAttributes: function(element, attributes, svgUid) { + + if (!element) { + return; + } + + var value, + parentAttributes = { }, + fontSize, parentFontSize; + + if (typeof svgUid === 'undefined') { + svgUid = element.getAttribute('svgUid'); + } + // if there's a parent container (`g` or `a` or `symbol` node), parse its attributes recursively upwards + if (element.parentNode && fabric.svgValidParentsRegEx.test(element.parentNode.nodeName)) { + parentAttributes = fabric.parseAttributes(element.parentNode, attributes, svgUid); + } + + var ownAttributes = attributes.reduce(function(memo, attr) { + value = element.getAttribute(attr); + if (value) { // eslint-disable-line + memo[attr] = value; + } + return memo; + }, { }); + // add values parsed from style, which take precedence over attributes + // (see: http://www.w3.org/TR/SVG/styling.html#UsingPresentationAttributes) + var cssAttrs = extend( + getGlobalStylesForElement(element, svgUid), + fabric.parseStyleAttribute(element) + ); + ownAttributes = extend( + ownAttributes, + cssAttrs + ); + if (cssAttrs[cPath]) { + element.setAttribute(cPath, cssAttrs[cPath]); + } + fontSize = parentFontSize = parentAttributes.fontSize || fabric.Text.DEFAULT_SVG_FONT_SIZE; + if (ownAttributes[fSize]) { + // looks like the minimum should be 9px when dealing with ems. this is what looks like in browsers. + ownAttributes[fSize] = fontSize = parseUnit(ownAttributes[fSize], parentFontSize); + } + + var normalizedAttr, normalizedValue, normalizedStyle = {}; + for (var attr in ownAttributes) { + normalizedAttr = normalizeAttr(attr); + normalizedValue = normalizeValue(normalizedAttr, ownAttributes[attr], parentAttributes, fontSize); + normalizedStyle[normalizedAttr] = normalizedValue; + } + if (normalizedStyle && normalizedStyle.font) { + fabric.parseFontDeclaration(normalizedStyle.font, normalizedStyle); + } + var mergedAttrs = extend(parentAttributes, normalizedStyle); + return fabric.svgValidParentsRegEx.test(element.nodeName) ? mergedAttrs : _setStrokeFillOpacity(mergedAttrs); + }, + + /** + * Transforms an array of svg elements to corresponding fabric.* instances + * @static + * @memberOf fabric + * @param {Array} elements Array of elements to parse + * @param {Function} callback Being passed an array of fabric instances (transformed from SVG elements) + * @param {Object} [options] Options object + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + */ + parseElements: function(elements, callback, options, reviver, parsingOptions) { + new fabric.ElementsParser(elements, callback, options, reviver, parsingOptions).parse(); + }, + + /** + * Parses "style" attribute, retuning an object with values + * @static + * @memberOf fabric + * @param {SVGElement} element Element to parse + * @return {Object} Objects with values parsed from style attribute of an element + */ + parseStyleAttribute: function(element) { + var oStyle = { }, + style = element.getAttribute('style'); + + if (!style) { + return oStyle; + } + + if (typeof style === 'string') { + parseStyleString(style, oStyle); + } + else { + parseStyleObject(style, oStyle); + } + + return oStyle; + }, + + /** + * Parses "points" attribute, returning an array of values + * @static + * @memberOf fabric + * @param {String} points points attribute string + * @return {Array} array of points + */ + parsePointsAttribute: function(points) { + + // points attribute is required and must not be empty + if (!points) { + return null; + } + + // replace commas with whitespace and remove bookending whitespace + points = points.replace(/,/g, ' ').trim(); + + points = points.split(/\s+/); + var parsedPoints = [], i, len; + + for (i = 0, len = points.length; i < len; i += 2) { + parsedPoints.push({ + x: parseFloat(points[i]), + y: parseFloat(points[i + 1]) + }); + } + + // odd number of points is an error + // if (parsedPoints.length % 2 !== 0) { + // return null; + // } + + return parsedPoints; + }, + + /** + * Returns CSS rules for a given SVG document + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @return {Object} CSS rules of this document + */ + getCSSRules: function(doc) { + var styles = doc.getElementsByTagName('style'), i, len, + allRules = { }, rules; + + // very crude parsing of style contents + for (i = 0, len = styles.length; i < len; i++) { + // \n' + ].join(''); + } + + return markup; + }, + + /** + * @private + */ + _setSVGObjects: function(markup, reviver) { + var instance, i, len, objects = this._objects; + for (i = 0, len = objects.length; i < len; i++) { + instance = objects[i]; + if (instance.excludeFromExport) { + continue; + } + this._setSVGObject(markup, instance, reviver); + } + }, + + /** + * @private + */ + _setSVGObject: function(markup, instance, reviver) { + markup.push(instance.toSVG(reviver)); + }, + + /** + * @private + */ + _setSVGBgOverlayImage: function(markup, property, reviver) { + if (this[property] && !this[property].excludeFromExport && this[property].toSVG) { + markup.push(this[property].toSVG(reviver)); + } + }, + + /** + * @private + */ + _setSVGBgOverlayColor: function(markup, property) { + var filler = this[property + 'Color'], vpt = this.viewportTransform, finalWidth = this.width, + finalHeight = this.height; + if (!filler) { + return; + } + if (filler.toLive) { + var repeat = filler.repeat, iVpt = fabric.util.invertTransform(vpt), shouldInvert = this[property + 'Vpt'], + additionalTransform = shouldInvert ? fabric.util.matrixToSVG(iVpt) : ''; + markup.push( + '\n' + ); + } + else { + markup.push( + '\n' + ); + } + }, + /* _TO_SVG_END_ */ + + /** + * Moves an object or the objects of a multiple selection + * to the bottom of the stack of drawn objects + * @param {fabric.Object} object Object to send to back + * @return {fabric.Canvas} thisArg + * @chainable + */ + sendToBack: function (object) { + if (!object) { + return this; + } + var activeSelection = this._activeObject, + i, obj, objs; + if (object === activeSelection && object.type === 'activeSelection') { + objs = activeSelection._objects; + for (i = objs.length; i--;) { + obj = objs[i]; + removeFromArray(this._objects, obj); + this._objects.unshift(obj); + } + } + else { + removeFromArray(this._objects, object); + this._objects.unshift(object); + } + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * Moves an object or the objects of a multiple selection + * to the top of the stack of drawn objects + * @param {fabric.Object} object Object to send + * @return {fabric.Canvas} thisArg + * @chainable + */ + bringToFront: function (object) { + if (!object) { + return this; + } + var activeSelection = this._activeObject, + i, obj, objs; + if (object === activeSelection && object.type === 'activeSelection') { + objs = activeSelection._objects; + for (i = 0; i < objs.length; i++) { + obj = objs[i]; + removeFromArray(this._objects, obj); + this._objects.push(obj); + } + } + else { + removeFromArray(this._objects, object); + this._objects.push(object); + } + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * Moves an object or a selection down in stack of drawn objects + * An optional paramter, intersecting allowes to move the object in behind + * the first intersecting object. Where intersection is calculated with + * bounding box. If no intersection is found, there will not be change in the + * stack. + * @param {fabric.Object} object Object to send + * @param {Boolean} [intersecting] If `true`, send object behind next lower intersecting object + * @return {fabric.Canvas} thisArg + * @chainable + */ + sendBackwards: function (object, intersecting) { + if (!object) { + return this; + } + var activeSelection = this._activeObject, + i, obj, idx, newIdx, objs, objsMoved = 0; + + if (object === activeSelection && object.type === 'activeSelection') { + objs = activeSelection._objects; + for (i = 0; i < objs.length; i++) { + obj = objs[i]; + idx = this._objects.indexOf(obj); + if (idx > 0 + objsMoved) { + newIdx = idx - 1; + removeFromArray(this._objects, obj); + this._objects.splice(newIdx, 0, obj); + } + objsMoved++; + } + } + else { + idx = this._objects.indexOf(object); + if (idx !== 0) { + // if object is not on the bottom of stack + newIdx = this._findNewLowerIndex(object, idx, intersecting); + removeFromArray(this._objects, object); + this._objects.splice(newIdx, 0, object); + } + } + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * @private + */ + _findNewLowerIndex: function(object, idx, intersecting) { + var newIdx, i; + + if (intersecting) { + newIdx = idx; + + // traverse down the stack looking for the nearest intersecting object + for (i = idx - 1; i >= 0; --i) { + + var isIntersecting = object.intersectsWithObject(this._objects[i]) || + object.isContainedWithinObject(this._objects[i]) || + this._objects[i].isContainedWithinObject(object); + + if (isIntersecting) { + newIdx = i; + break; + } + } + } + else { + newIdx = idx - 1; + } + + return newIdx; + }, + + /** + * Moves an object or a selection up in stack of drawn objects + * An optional paramter, intersecting allowes to move the object in front + * of the first intersecting object. Where intersection is calculated with + * bounding box. If no intersection is found, there will not be change in the + * stack. + * @param {fabric.Object} object Object to send + * @param {Boolean} [intersecting] If `true`, send object in front of next upper intersecting object + * @return {fabric.Canvas} thisArg + * @chainable + */ + bringForward: function (object, intersecting) { + if (!object) { + return this; + } + var activeSelection = this._activeObject, + i, obj, idx, newIdx, objs, objsMoved = 0; + + if (object === activeSelection && object.type === 'activeSelection') { + objs = activeSelection._objects; + for (i = objs.length; i--;) { + obj = objs[i]; + idx = this._objects.indexOf(obj); + if (idx < this._objects.length - 1 - objsMoved) { + newIdx = idx + 1; + removeFromArray(this._objects, obj); + this._objects.splice(newIdx, 0, obj); + } + objsMoved++; + } + } + else { + idx = this._objects.indexOf(object); + if (idx !== this._objects.length - 1) { + // if object is not on top of stack (last item in an array) + newIdx = this._findNewUpperIndex(object, idx, intersecting); + removeFromArray(this._objects, object); + this._objects.splice(newIdx, 0, object); + } + } + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * @private + */ + _findNewUpperIndex: function(object, idx, intersecting) { + var newIdx, i, len; + + if (intersecting) { + newIdx = idx; + + // traverse up the stack looking for the nearest intersecting object + for (i = idx + 1, len = this._objects.length; i < len; ++i) { + + var isIntersecting = object.intersectsWithObject(this._objects[i]) || + object.isContainedWithinObject(this._objects[i]) || + this._objects[i].isContainedWithinObject(object); + + if (isIntersecting) { + newIdx = i; + break; + } + } + } + else { + newIdx = idx + 1; + } + + return newIdx; + }, + + /** + * Moves an object to specified level in stack of drawn objects + * @param {fabric.Object} object Object to send + * @param {Number} index Position to move to + * @return {fabric.Canvas} thisArg + * @chainable + */ + moveTo: function (object, index) { + removeFromArray(this._objects, object); + this._objects.splice(index, 0, object); + return this.renderOnAddRemove && this.requestRenderAll(); + }, + + /** + * Clears a canvas element and dispose objects + * @return {fabric.Canvas} thisArg + * @chainable + */ + dispose: function () { + // cancel eventually ongoing renders + if (this.isRendering) { + fabric.util.cancelAnimFrame(this.isRendering); + this.isRendering = 0; + } + this.forEachObject(function(object) { + object.dispose && object.dispose(); + }); + this._objects = []; + if (this.backgroundImage && this.backgroundImage.dispose) { + this.backgroundImage.dispose(); + } + this.backgroundImage = null; + if (this.overlayImage && this.overlayImage.dispose) { + this.overlayImage.dispose(); + } + this.overlayImage = null; + this._iTextInstances = null; + this.contextContainer = null; + fabric.util.cleanUpJsdomNode(this.lowerCanvasEl); + this.lowerCanvasEl = undefined; + return this; + }, + + /** + * Returns a string representation of an instance + * @return {String} string representation of an instance + */ + toString: function () { + return '#'; + } + }); + + extend(fabric.StaticCanvas.prototype, fabric.Observable); + extend(fabric.StaticCanvas.prototype, fabric.Collection); + extend(fabric.StaticCanvas.prototype, fabric.DataURLExporter); + + extend(fabric.StaticCanvas, /** @lends fabric.StaticCanvas */ { + + /** + * @static + * @type String + * @default + */ + EMPTY_JSON: '{"objects": [], "background": "white"}', + + /** + * Provides a way to check support of some of the canvas methods + * (either those of HTMLCanvasElement itself, or rendering context) + * + * @param {String} methodName Method to check support for; + * Could be one of "setLineDash" + * @return {Boolean | null} `true` if method is supported (or at least exists), + * `null` if canvas element or context can not be initialized + */ + supports: function (methodName) { + var el = createCanvasElement(); + + if (!el || !el.getContext) { + return null; + } + + var ctx = el.getContext('2d'); + if (!ctx) { + return null; + } + + switch (methodName) { + + case 'setLineDash': + return typeof ctx.setLineDash !== 'undefined'; + + default: + return null; + } + } + }); + + /** + * Returns JSON representation of canvas + * @function + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {String} JSON string + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#serialization} + * @see {@link http://jsfiddle.net/fabricjs/pec86/|jsFiddle demo} + * @example JSON without additional properties + * var json = canvas.toJSON(); + * @example JSON with additional properties included + * var json = canvas.toJSON(['lockMovementX', 'lockMovementY', 'lockRotation', 'lockScalingX', 'lockScalingY']); + * @example JSON without default values + * canvas.includeDefaultValues = false; + * var json = canvas.toJSON(); + */ + fabric.StaticCanvas.prototype.toJSON = fabric.StaticCanvas.prototype.toObject; + + if (fabric.isLikelyNode) { + fabric.StaticCanvas.prototype.createPNGStream = function() { + var impl = getNodeCanvas(this.lowerCanvasEl); + return impl && impl.createPNGStream(); + }; + fabric.StaticCanvas.prototype.createJPEGStream = function(opts) { + var impl = getNodeCanvas(this.lowerCanvasEl); + return impl && impl.createJPEGStream(opts); + }; + } +})(); +/** + * BaseBrush class + * @class fabric.BaseBrush + * @see {@link http://fabricjs.com/freedrawing|Freedrawing demo} + */ +fabric.BaseBrush = fabric.util.createClass(/** @lends fabric.BaseBrush.prototype */ { + + /** + * Color of a brush + * @type String + * @default + */ + color: 'rgb(0, 0, 0)', + + /** + * Width of a brush, has to be a Number, no string literals + * @type Number + * @default + */ + width: 1, + + /** + * Shadow object representing shadow of this shape. + * Backwards incompatibility note: This property replaces "shadowColor" (String), "shadowOffsetX" (Number), + * "shadowOffsetY" (Number) and "shadowBlur" (Number) since v1.2.12 + * @type fabric.Shadow + * @default + */ + shadow: null, + + /** + * Line endings style of a brush (one of "butt", "round", "square") + * @type String + * @default + */ + strokeLineCap: 'round', + + /** + * Corner style of a brush (one of "bevel", "round", "miter") + * @type String + * @default + */ + strokeLineJoin: 'round', + + /** + * Maximum miter length (used for strokeLineJoin = "miter") of a brush's + * @type Number + * @default + */ + strokeMiterLimit: 10, + + /** + * Stroke Dash Array. + * @type Array + * @default + */ + strokeDashArray: null, + + /** + * Sets brush styles + * @private + */ + _setBrushStyles: function() { + var ctx = this.canvas.contextTop; + ctx.strokeStyle = this.color; + ctx.lineWidth = this.width; + ctx.lineCap = this.strokeLineCap; + ctx.miterLimit = this.strokeMiterLimit; + ctx.lineJoin = this.strokeLineJoin; + if (fabric.StaticCanvas.supports('setLineDash')) { + ctx.setLineDash(this.strokeDashArray || []); + } + }, + + /** + * Sets the transformation on given context + * @param {RenderingContext2d} ctx context to render on + * @private + */ + _saveAndTransform: function(ctx) { + var v = this.canvas.viewportTransform; + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + }, + + /** + * Sets brush shadow styles + * @private + */ + _setShadow: function() { + if (!this.shadow) { + return; + } + + var canvas = this.canvas, + shadow = this.shadow, + ctx = canvas.contextTop, + zoom = canvas.getZoom(); + if (canvas && canvas._isRetinaScaling()) { + zoom *= fabric.devicePixelRatio; + } + + ctx.shadowColor = shadow.color; + ctx.shadowBlur = shadow.blur * zoom; + ctx.shadowOffsetX = shadow.offsetX * zoom; + ctx.shadowOffsetY = shadow.offsetY * zoom; + }, + + needsFullRender: function() { + var color = new fabric.Color(this.color); + return color.getAlpha() < 1 || !!this.shadow; + }, + + /** + * Removes brush shadow styles + * @private + */ + _resetShadow: function() { + var ctx = this.canvas.contextTop; + + ctx.shadowColor = ''; + ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0; + } +}); +(function() { + /** + * PencilBrush class + * @class fabric.PencilBrush + * @extends fabric.BaseBrush + */ + fabric.PencilBrush = fabric.util.createClass(fabric.BaseBrush, /** @lends fabric.PencilBrush.prototype */ { + + /** + * Discard points that are less than `decimate` pixel distant from each other + * @type Number + * @default 0.4 + */ + decimate: 0.4, + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.PencilBrush} Instance of a pencil brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this._points = []; + }, + + /** + * Invoked inside on mouse down and mouse move + * @param {Object} pointer + */ + _drawSegment: function (ctx, p1, p2) { + var midPoint = p1.midPointFrom(p2); + ctx.quadraticCurveTo(p1.x, p1.y, midPoint.x, midPoint.y); + return midPoint; + }, + + /** + * Inovoked on mouse down + * @param {Object} pointer + */ + onMouseDown: function(pointer, options) { + if (!this.canvas._isMainEvent(options.e)) { + return; + } + this._prepareForDrawing(pointer); + // capture coordinates immediately + // this allows to draw dots (when movement never occurs) + this._captureDrawingPath(pointer); + this._render(); + }, + + /** + * Inovoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer, options) { + if (!this.canvas._isMainEvent(options.e)) { + return; + } + if (this._captureDrawingPath(pointer) && this._points.length > 1) { + if (this.needsFullRender()) { + // redraw curve + // clear top canvas + this.canvas.clearContext(this.canvas.contextTop); + this._render(); + } + else { + var points = this._points, length = points.length, ctx = this.canvas.contextTop; + // draw the curve update + this._saveAndTransform(ctx); + if (this.oldEnd) { + ctx.beginPath(); + ctx.moveTo(this.oldEnd.x, this.oldEnd.y); + } + this.oldEnd = this._drawSegment(ctx, points[length - 2], points[length - 1], true); + ctx.stroke(); + ctx.restore(); + } + } + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function(options) { + if (!this.canvas._isMainEvent(options.e)) { + return true; + } + this.oldEnd = undefined; + this._finalizeAndAddPath(); + return false; + }, + + /** + * @private + * @param {Object} pointer Actual mouse position related to the canvas. + */ + _prepareForDrawing: function(pointer) { + + var p = new fabric.Point(pointer.x, pointer.y); + + this._reset(); + this._addPoint(p); + this.canvas.contextTop.moveTo(p.x, p.y); + }, + + /** + * @private + * @param {fabric.Point} point Point to be added to points array + */ + _addPoint: function(point) { + if (this._points.length > 1 && point.eq(this._points[this._points.length - 1])) { + return false; + } + this._points.push(point); + return true; + }, + + /** + * Clear points array and set contextTop canvas style. + * @private + */ + _reset: function() { + this._points = []; + this._setBrushStyles(); + this._setShadow(); + }, + + /** + * @private + * @param {Object} pointer Actual mouse position related to the canvas. + */ + _captureDrawingPath: function(pointer) { + var pointerPoint = new fabric.Point(pointer.x, pointer.y); + return this._addPoint(pointerPoint); + }, + + /** + * Draw a smooth path on the topCanvas using quadraticCurveTo + * @private + */ + _render: function() { + var ctx = this.canvas.contextTop, i, len, + p1 = this._points[0], + p2 = this._points[1]; + + this._saveAndTransform(ctx); + ctx.beginPath(); + //if we only have 2 points in the path and they are the same + //it means that the user only clicked the canvas without moving the mouse + //then we should be drawing a dot. A path isn't drawn between two identical dots + //that's why we set them apart a bit + if (this._points.length === 2 && p1.x === p2.x && p1.y === p2.y) { + var width = this.width / 1000; + p1 = new fabric.Point(p1.x, p1.y); + p2 = new fabric.Point(p2.x, p2.y); + p1.x -= width; + p2.x += width; + } + ctx.moveTo(p1.x, p1.y); + + for (i = 1, len = this._points.length; i < len; i++) { + // we pick the point between pi + 1 & pi + 2 as the + // end point and p1 as our control point. + this._drawSegment(ctx, p1, p2); + p1 = this._points[i]; + p2 = this._points[i + 1]; + } + // Draw last line as a straight line while + // we wait for the next point to be able to calculate + // the bezier control point + ctx.lineTo(p1.x, p1.y); + ctx.stroke(); + ctx.restore(); + }, + + /** + * Converts points to SVG path + * @param {Array} points Array of points + * @return {String} SVG path + */ + convertPointsToSVGPath: function(points) { + var path = [], i, width = this.width / 1000, + p1 = new fabric.Point(points[0].x, points[0].y), + p2 = new fabric.Point(points[1].x, points[1].y), + len = points.length, multSignX = 1, multSignY = 0, manyPoints = len > 2; + + if (manyPoints) { + multSignX = points[2].x < p2.x ? -1 : points[2].x === p2.x ? 0 : 1; + multSignY = points[2].y < p2.y ? -1 : points[2].y === p2.y ? 0 : 1; + } + path.push('M ', p1.x - multSignX * width, ' ', p1.y - multSignY * width, ' '); + for (i = 1; i < len; i++) { + if (!p1.eq(p2)) { + var midPoint = p1.midPointFrom(p2); + // p1 is our bezier control point + // midpoint is our endpoint + // start point is p(i-1) value. + path.push('Q ', p1.x, ' ', p1.y, ' ', midPoint.x, ' ', midPoint.y, ' '); + } + p1 = points[i]; + if ((i + 1) < points.length) { + p2 = points[i + 1]; + } + } + if (manyPoints) { + multSignX = p1.x > points[i - 2].x ? 1 : p1.x === points[i - 2].x ? 0 : -1; + multSignY = p1.y > points[i - 2].y ? 1 : p1.y === points[i - 2].y ? 0 : -1; + } + path.push('L ', p1.x + multSignX * width, ' ', p1.y + multSignY * width); + return path; + }, + + /** + * Creates fabric.Path object to add on canvas + * @param {String} pathData Path data + * @return {fabric.Path} Path to add on canvas + */ + createPath: function(pathData) { + var path = new fabric.Path(pathData, { + fill: null, + stroke: this.color, + strokeWidth: this.width, + strokeLineCap: this.strokeLineCap, + strokeMiterLimit: this.strokeMiterLimit, + strokeLineJoin: this.strokeLineJoin, + strokeDashArray: this.strokeDashArray, + }); + if (this.shadow) { + this.shadow.affectStroke = true; + path.shadow = new fabric.Shadow(this.shadow); + } + + return path; + }, + + /** + * Decimate poins array with the decimate value + */ + decimatePoints: function(points, distance) { + if (points.length <= 2) { + return points; + } + var zoom = this.canvas.getZoom(), adjustedDistance = Math.pow(distance / zoom, 2), + i, l = points.length - 1, lastPoint = points[0], newPoints = [lastPoint], + cDistance; + for (i = 1; i < l; i++) { + cDistance = Math.pow(lastPoint.x - points[i].x, 2) + Math.pow(lastPoint.y - points[i].y, 2); + if (cDistance >= adjustedDistance) { + lastPoint = points[i]; + newPoints.push(lastPoint); + } + } + if (newPoints.length === 1) { + newPoints.push(new fabric.Point(newPoints[0].x, newPoints[0].y)); + } + return newPoints; + }, + + /** + * On mouseup after drawing the path on contextTop canvas + * we use the points captured to create an new fabric path object + * and add it to the fabric canvas. + */ + _finalizeAndAddPath: function() { + var ctx = this.canvas.contextTop; + ctx.closePath(); + if (this.decimate) { + this._points = this.decimatePoints(this._points, this.decimate); + } + var pathData = this.convertPointsToSVGPath(this._points).join(''); + if (pathData === 'M 0 0 Q 0 0 0 0 L 0 0') { + // do not create 0 width/height paths, as they are + // rendered inconsistently across browsers + // Firefox 4, for example, renders a dot, + // whereas Chrome 10 renders nothing + this.canvas.requestRenderAll(); + return; + } + + var path = this.createPath(pathData); + this.canvas.clearContext(this.canvas.contextTop); + this.canvas.fire('before:path:created', { path: path }); + this.canvas.add(path); + this.canvas.requestRenderAll(); + path.setCoords(); + this._resetShadow(); + + + // fire event 'path' created + this.canvas.fire('path:created', { path: path }); + } + }); +})(); +/** + * CircleBrush class + * @class fabric.CircleBrush + */ +fabric.CircleBrush = fabric.util.createClass(fabric.BaseBrush, /** @lends fabric.CircleBrush.prototype */ { + + /** + * Width of a brush + * @type Number + * @default + */ + width: 10, + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.CircleBrush} Instance of a circle brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this.points = []; + }, + + /** + * Invoked inside on mouse down and mouse move + * @param {Object} pointer + */ + drawDot: function(pointer) { + var point = this.addPoint(pointer), + ctx = this.canvas.contextTop; + this._saveAndTransform(ctx); + this.dot(ctx, point); + ctx.restore(); + }, + + dot: function(ctx, point) { + ctx.fillStyle = point.fill; + ctx.beginPath(); + ctx.arc(point.x, point.y, point.radius, 0, Math.PI * 2, false); + ctx.closePath(); + ctx.fill(); + }, + + /** + * Invoked on mouse down + */ + onMouseDown: function(pointer) { + this.points.length = 0; + this.canvas.clearContext(this.canvas.contextTop); + this._setShadow(); + this.drawDot(pointer); + }, + + /** + * Render the full state of the brush + * @private + */ + _render: function() { + var ctx = this.canvas.contextTop, i, len, + points = this.points; + this._saveAndTransform(ctx); + for (i = 0, len = points.length; i < len; i++) { + this.dot(ctx, points[i]); + } + ctx.restore(); + }, + + /** + * Invoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer) { + if (this.needsFullRender()) { + this.canvas.clearContext(this.canvas.contextTop); + this.addPoint(pointer); + this._render(); + } + else { + this.drawDot(pointer); + } + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function() { + var originalRenderOnAddRemove = this.canvas.renderOnAddRemove, i, len; + this.canvas.renderOnAddRemove = false; + + var circles = []; + + for (i = 0, len = this.points.length; i < len; i++) { + var point = this.points[i], + circle = new fabric.Circle({ + radius: point.radius, + left: point.x, + top: point.y, + originX: 'center', + originY: 'center', + fill: point.fill + }); + + this.shadow && (circle.shadow = new fabric.Shadow(this.shadow)); + + circles.push(circle); + } + var group = new fabric.Group(circles); + group.canvas = this.canvas; + + this.canvas.fire('before:path:created', { path: group }); + this.canvas.add(group); + this.canvas.fire('path:created', { path: group }); + + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderOnAddRemove = originalRenderOnAddRemove; + this.canvas.requestRenderAll(); + }, + + /** + * @param {Object} pointer + * @return {fabric.Point} Just added pointer point + */ + addPoint: function(pointer) { + var pointerPoint = new fabric.Point(pointer.x, pointer.y), + + circleRadius = fabric.util.getRandomInt( + Math.max(0, this.width - 20), this.width + 20) / 2, + + circleColor = new fabric.Color(this.color) + .setAlpha(fabric.util.getRandomInt(0, 100) / 100) + .toRgba(); + + pointerPoint.radius = circleRadius; + pointerPoint.fill = circleColor; + + this.points.push(pointerPoint); + + return pointerPoint; + } +}); +/** + * SprayBrush class + * @class fabric.SprayBrush + */ +fabric.SprayBrush = fabric.util.createClass( fabric.BaseBrush, /** @lends fabric.SprayBrush.prototype */ { + + /** + * Width of a spray + * @type Number + * @default + */ + width: 10, + + /** + * Density of a spray (number of dots per chunk) + * @type Number + * @default + */ + density: 20, + + /** + * Width of spray dots + * @type Number + * @default + */ + dotWidth: 1, + + /** + * Width variance of spray dots + * @type Number + * @default + */ + dotWidthVariance: 1, + + /** + * Whether opacity of a dot should be random + * @type Boolean + * @default + */ + randomOpacity: false, + + /** + * Whether overlapping dots (rectangles) should be removed (for performance reasons) + * @type Boolean + * @default + */ + optimizeOverlapping: true, + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.SprayBrush} Instance of a spray brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this.sprayChunks = []; + }, + + /** + * Invoked on mouse down + * @param {Object} pointer + */ + onMouseDown: function(pointer) { + this.sprayChunks.length = 0; + this.canvas.clearContext(this.canvas.contextTop); + this._setShadow(); + + this.addSprayChunk(pointer); + this.render(this.sprayChunkPoints); + }, + + /** + * Invoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer) { + this.addSprayChunk(pointer); + this.render(this.sprayChunkPoints); + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function() { + var originalRenderOnAddRemove = this.canvas.renderOnAddRemove; + this.canvas.renderOnAddRemove = false; + + var rects = []; + + for (var i = 0, ilen = this.sprayChunks.length; i < ilen; i++) { + var sprayChunk = this.sprayChunks[i]; + + for (var j = 0, jlen = sprayChunk.length; j < jlen; j++) { + + var rect = new fabric.Rect({ + width: sprayChunk[j].width, + height: sprayChunk[j].width, + left: sprayChunk[j].x + 1, + top: sprayChunk[j].y + 1, + originX: 'center', + originY: 'center', + fill: this.color + }); + rects.push(rect); + } + } + + if (this.optimizeOverlapping) { + rects = this._getOptimizedRects(rects); + } + + var group = new fabric.Group(rects); + this.shadow && group.set('shadow', new fabric.Shadow(this.shadow)); + this.canvas.fire('before:path:created', { path: group }); + this.canvas.add(group); + this.canvas.fire('path:created', { path: group }); + + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderOnAddRemove = originalRenderOnAddRemove; + this.canvas.requestRenderAll(); + }, + + /** + * @private + * @param {Array} rects + */ + _getOptimizedRects: function(rects) { + + // avoid creating duplicate rects at the same coordinates + var uniqueRects = { }, key, i, len; + + for (i = 0, len = rects.length; i < len; i++) { + key = rects[i].left + '' + rects[i].top; + if (!uniqueRects[key]) { + uniqueRects[key] = rects[i]; + } + } + var uniqueRectsArray = []; + for (key in uniqueRects) { + uniqueRectsArray.push(uniqueRects[key]); + } + + return uniqueRectsArray; + }, + + /** + * Render new chunk of spray brush + */ + render: function(sprayChunk) { + var ctx = this.canvas.contextTop, i, len; + ctx.fillStyle = this.color; + + this._saveAndTransform(ctx); + + for (i = 0, len = sprayChunk.length; i < len; i++) { + var point = sprayChunk[i]; + if (typeof point.opacity !== 'undefined') { + ctx.globalAlpha = point.opacity; + } + ctx.fillRect(point.x, point.y, point.width, point.width); + } + ctx.restore(); + }, + + /** + * Render all spray chunks + */ + _render: function() { + var ctx = this.canvas.contextTop, i, ilen; + ctx.fillStyle = this.color; + + this._saveAndTransform(ctx); + + for (i = 0, ilen = this.sprayChunks.length; i < ilen; i++) { + this.render(this.sprayChunks[i]); + } + ctx.restore(); + }, + + /** + * @param {Object} pointer + */ + addSprayChunk: function(pointer) { + this.sprayChunkPoints = []; + + var x, y, width, radius = this.width / 2, i; + + for (i = 0; i < this.density; i++) { + + x = fabric.util.getRandomInt(pointer.x - radius, pointer.x + radius); + y = fabric.util.getRandomInt(pointer.y - radius, pointer.y + radius); + + if (this.dotWidthVariance) { + width = fabric.util.getRandomInt( + // bottom clamp width to 1 + Math.max(1, this.dotWidth - this.dotWidthVariance), + this.dotWidth + this.dotWidthVariance); + } + else { + width = this.dotWidth; + } + + var point = new fabric.Point(x, y); + point.width = width; + + if (this.randomOpacity) { + point.opacity = fabric.util.getRandomInt(0, 100) / 100; + } + + this.sprayChunkPoints.push(point); + } + + this.sprayChunks.push(this.sprayChunkPoints); + } +}); +/** + * PatternBrush class + * @class fabric.PatternBrush + * @extends fabric.BaseBrush + */ +fabric.PatternBrush = fabric.util.createClass(fabric.PencilBrush, /** @lends fabric.PatternBrush.prototype */ { + + getPatternSrc: function() { + + var dotWidth = 20, + dotDistance = 5, + patternCanvas = fabric.util.createCanvasElement(), + patternCtx = patternCanvas.getContext('2d'); + + patternCanvas.width = patternCanvas.height = dotWidth + dotDistance; + + patternCtx.fillStyle = this.color; + patternCtx.beginPath(); + patternCtx.arc(dotWidth / 2, dotWidth / 2, dotWidth / 2, 0, Math.PI * 2, false); + patternCtx.closePath(); + patternCtx.fill(); + + return patternCanvas; + }, + + getPatternSrcFunction: function() { + return String(this.getPatternSrc).replace('this.color', '"' + this.color + '"'); + }, + + /** + * Creates "pattern" instance property + */ + getPattern: function() { + return this.canvas.contextTop.createPattern(this.source || this.getPatternSrc(), 'repeat'); + }, + + /** + * Sets brush styles + */ + _setBrushStyles: function() { + this.callSuper('_setBrushStyles'); + this.canvas.contextTop.strokeStyle = this.getPattern(); + }, + + /** + * Creates path + */ + createPath: function(pathData) { + var path = this.callSuper('createPath', pathData), + topLeft = path._getLeftTopCoords().scalarAdd(path.strokeWidth / 2); + + path.stroke = new fabric.Pattern({ + source: this.source || this.getPatternSrcFunction(), + offsetX: -topLeft.x, + offsetY: -topLeft.y + }); + return path; + } +}); +(function() { + + var getPointer = fabric.util.getPointer, + degreesToRadians = fabric.util.degreesToRadians, + abs = Math.abs, + supportLineDash = fabric.StaticCanvas.supports('setLineDash'), + isTouchEvent = fabric.util.isTouchEvent, + STROKE_OFFSET = 0.5; + + /** + * Canvas class + * @class fabric.Canvas + * @extends fabric.StaticCanvas + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1#canvas} + * @see {@link fabric.Canvas#initialize} for constructor definition + * + * @fires object:modified at the end of a transform or any change when statefull is true + * @fires object:rotating while an object is being rotated from the control + * @fires object:scaling while an object is being scaled by controls + * @fires object:moving while an object is being dragged + * @fires object:skewing while an object is being skewed from the controls + * + * @fires before:transform before a transform is is started + * @fires before:selection:cleared + * @fires selection:cleared + * @fires selection:updated + * @fires selection:created + * + * @fires path:created after a drawing operation ends and the path is added + * @fires mouse:down + * @fires mouse:move + * @fires mouse:up + * @fires mouse:down:before on mouse down, before the inner fabric logic runs + * @fires mouse:move:before on mouse move, before the inner fabric logic runs + * @fires mouse:up:before on mouse up, before the inner fabric logic runs + * @fires mouse:over + * @fires mouse:out + * @fires mouse:dblclick whenever a native dbl click event fires on the canvas. + * + * @fires dragover + * @fires dragenter + * @fires dragleave + * @fires drop + * @fires after:render at the end of the render process, receives the context in the callback + * @fires before:render at start the render process, receives the context in the callback + * + * the following events are deprecated: + * @fires object:rotated at the end of a rotation transform + * @fires object:scaled at the end of a scale transform + * @fires object:moved at the end of translation transform + * @fires object:skewed at the end of a skew transform + */ + fabric.Canvas = fabric.util.createClass(fabric.StaticCanvas, /** @lends fabric.Canvas.prototype */ { + + /** + * Constructor + * @param {HTMLElement | String} el <canvas> element to initialize instance on + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(el, options) { + options || (options = { }); + this.renderAndResetBound = this.renderAndReset.bind(this); + this.requestRenderAllBound = this.requestRenderAll.bind(this); + this._initStatic(el, options); + this._initInteractive(); + this._createCacheCanvas(); + }, + + /** + * When true, objects can be transformed by one side (unproportionally) + * when dragged on the corners that normally would not do that. + * @type Boolean + * @default + * @since fabric 4.0 // changed name and default value + */ + uniformScaling: true, + + /** + * Indicates which key switches uniform scaling. + * values: 'altKey', 'shiftKey', 'ctrlKey'. + * If `null` or 'none' or any other string that is not a modifier key + * feature is disabled. + * totally wrong named. this sounds like `uniform scaling` + * if Canvas.uniformScaling is true, pressing this will set it to false + * and viceversa. + * @since 1.6.2 + * @type String + * @default + */ + uniScaleKey: 'shiftKey', + + /** + * When true, objects use center point as the origin of scale transformation. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredScaling: false, + + /** + * When true, objects use center point as the origin of rotate transformation. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredRotation: false, + + /** + * Indicates which key enable centered Transform + * values: 'altKey', 'shiftKey', 'ctrlKey'. + * If `null` or 'none' or any other string that is not a modifier key + * feature is disabled feature disabled. + * @since 1.6.2 + * @type String + * @default + */ + centeredKey: 'altKey', + + /** + * Indicates which key enable alternate action on corner + * values: 'altKey', 'shiftKey', 'ctrlKey'. + * If `null` or 'none' or any other string that is not a modifier key + * feature is disabled feature disabled. + * @since 1.6.2 + * @type String + * @default + */ + altActionKey: 'shiftKey', + + /** + * Indicates that canvas is interactive. This property should not be changed. + * @type Boolean + * @default + */ + interactive: true, + + /** + * Indicates whether group selection should be enabled + * @type Boolean + * @default + */ + selection: true, + + /** + * Indicates which key or keys enable multiple click selection + * Pass value as a string or array of strings + * values: 'altKey', 'shiftKey', 'ctrlKey'. + * If `null` or empty or containing any other string that is not a modifier key + * feature is disabled. + * @since 1.6.2 + * @type String|Array + * @default + */ + selectionKey: 'shiftKey', + + /** + * Indicates which key enable alternative selection + * in case of target overlapping with active object + * values: 'altKey', 'shiftKey', 'ctrlKey'. + * For a series of reason that come from the general expectations on how + * things should work, this feature works only for preserveObjectStacking true. + * If `null` or 'none' or any other string that is not a modifier key + * feature is disabled. + * @since 1.6.5 + * @type null|String + * @default + */ + altSelectionKey: null, + + /** + * Color of selection + * @type String + * @default + */ + selectionColor: 'rgba(100, 100, 255, 0.3)', // blue + + /** + * Default dash array pattern + * If not empty the selection border is dashed + * @type Array + */ + selectionDashArray: [], + + /** + * Color of the border of selection (usually slightly darker than color of selection itself) + * @type String + * @default + */ + selectionBorderColor: 'rgba(255, 255, 255, 0.3)', + + /** + * Width of a line used in object/group selection + * @type Number + * @default + */ + selectionLineWidth: 1, + + /** + * Select only shapes that are fully contained in the dragged selection rectangle. + * @type Boolean + * @default + */ + selectionFullyContained: false, + + /** + * Default cursor value used when hovering over an object on canvas + * @type String + * @default + */ + hoverCursor: 'move', + + /** + * Default cursor value used when moving an object on canvas + * @type String + * @default + */ + moveCursor: 'move', + + /** + * Default cursor value used for the entire canvas + * @type String + * @default + */ + defaultCursor: 'default', + + /** + * Cursor value used during free drawing + * @type String + * @default + */ + freeDrawingCursor: 'crosshair', + + /** + * Cursor value used for rotation point + * @type String + * @default + */ + rotationCursor: 'crosshair', + + /** + * Cursor value used for disabled elements ( corners with disabled action ) + * @type String + * @since 2.0.0 + * @default + */ + notAllowedCursor: 'not-allowed', + + /** + * Default element class that's given to wrapper (div) element of canvas + * @type String + * @default + */ + containerClass: 'canvas-container', + + /** + * When true, object detection happens on per-pixel basis rather than on per-bounding-box + * @type Boolean + * @default + */ + perPixelTargetFind: false, + + /** + * Number of pixels around target pixel to tolerate (consider active) during object detection + * @type Number + * @default + */ + targetFindTolerance: 0, + + /** + * When true, target detection is skipped. Target detection will return always undefined. + * click selection won't work anymore, events will fire with no targets. + * if something is selected before setting it to true, it will be deselected at the first click. + * area selection will still work. check the `selection` property too. + * if you deactivate both, you should look into staticCanvas. + * @type Boolean + * @default + */ + skipTargetFind: false, + + /** + * When true, mouse events on canvas (mousedown/mousemove/mouseup) result in free drawing. + * After mousedown, mousemove creates a shape, + * and then mouseup finalizes it and adds an instance of `fabric.Path` onto canvas. + * @tutorial {@link http://fabricjs.com/fabric-intro-part-4#free_drawing} + * @type Boolean + * @default + */ + isDrawingMode: false, + + /** + * Indicates whether objects should remain in current stack position when selected. + * When false objects are brought to top and rendered as part of the selection group + * @type Boolean + * @default + */ + preserveObjectStacking: false, + + /** + * Indicates the angle that an object will lock to while rotating. + * @type Number + * @since 1.6.7 + * @default + */ + snapAngle: 0, + + /** + * Indicates the distance from the snapAngle the rotation will lock to the snapAngle. + * When `null`, the snapThreshold will default to the snapAngle. + * @type null|Number + * @since 1.6.7 + * @default + */ + snapThreshold: null, + + /** + * Indicates if the right click on canvas can output the context menu or not + * @type Boolean + * @since 1.6.5 + * @default + */ + stopContextMenu: false, + + /** + * Indicates if the canvas can fire right click events + * @type Boolean + * @since 1.6.5 + * @default + */ + fireRightClick: false, + + /** + * Indicates if the canvas can fire middle click events + * @type Boolean + * @since 1.7.8 + * @default + */ + fireMiddleClick: false, + + /** + * Keep track of the subTargets for Mouse Events + * @type fabric.Object[] + */ + targets: [], + + /** + * Keep track of the hovered target + * @type fabric.Object + * @private + */ + _hoveredTarget: null, + + /** + * hold the list of nested targets hovered + * @type fabric.Object[] + * @private + */ + _hoveredTargets: [], + + /** + * @private + */ + _initInteractive: function() { + this._currentTransform = null; + this._groupSelector = null; + this._initWrapperElement(); + this._createUpperCanvas(); + this._initEventListeners(); + + this._initRetinaScaling(); + + this.freeDrawingBrush = fabric.PencilBrush && new fabric.PencilBrush(this); + + this.calcOffset(); + }, + + /** + * Divides objects in two groups, one to render immediately + * and one to render as activeGroup. + * @return {Array} objects to render immediately and pushes the other in the activeGroup. + */ + _chooseObjectsToRender: function() { + var activeObjects = this.getActiveObjects(), + object, objsToRender, activeGroupObjects; + + if (activeObjects.length > 0 && !this.preserveObjectStacking) { + objsToRender = []; + activeGroupObjects = []; + for (var i = 0, length = this._objects.length; i < length; i++) { + object = this._objects[i]; + if (activeObjects.indexOf(object) === -1 ) { + objsToRender.push(object); + } + else { + activeGroupObjects.push(object); + } + } + if (activeObjects.length > 1) { + this._activeObject._objects = activeGroupObjects; + } + objsToRender.push.apply(objsToRender, activeGroupObjects); + } + else { + objsToRender = this._objects; + } + return objsToRender; + }, + + /** + * Renders both the top canvas and the secondary container canvas. + * @return {fabric.Canvas} instance + * @chainable + */ + renderAll: function () { + if (this.contextTopDirty && !this._groupSelector && !this.isDrawingMode) { + this.clearContext(this.contextTop); + this.contextTopDirty = false; + } + if (this.hasLostContext) { + this.renderTopLayer(this.contextTop); + } + var canvasToDrawOn = this.contextContainer; + this.renderCanvas(canvasToDrawOn, this._chooseObjectsToRender()); + return this; + }, + + renderTopLayer: function(ctx) { + ctx.save(); + if (this.isDrawingMode && this._isCurrentlyDrawing) { + this.freeDrawingBrush && this.freeDrawingBrush._render(); + this.contextTopDirty = true; + } + // we render the top context - last object + if (this.selection && this._groupSelector) { + this._drawSelection(ctx); + this.contextTopDirty = true; + } + ctx.restore(); + }, + + /** + * Method to render only the top canvas. + * Also used to render the group selection box. + * @return {fabric.Canvas} thisArg + * @chainable + */ + renderTop: function () { + var ctx = this.contextTop; + this.clearContext(ctx); + this.renderTopLayer(ctx); + this.fire('after:render'); + return this; + }, + + /** + * @private + */ + _normalizePointer: function (object, pointer) { + var m = object.calcTransformMatrix(), + invertedM = fabric.util.invertTransform(m), + vptPointer = this.restorePointerVpt(pointer); + return fabric.util.transformPoint(vptPointer, invertedM); + }, + + /** + * Returns true if object is transparent at a certain location + * @param {fabric.Object} target Object to check + * @param {Number} x Left coordinate + * @param {Number} y Top coordinate + * @return {Boolean} + */ + isTargetTransparent: function (target, x, y) { + // in case the target is the activeObject, we cannot execute this optimization + // because we need to draw controls too. + if (target.shouldCache() && target._cacheCanvas && target !== this._activeObject) { + var normalizedPointer = this._normalizePointer(target, {x: x, y: y}), + targetRelativeX = Math.max(target.cacheTranslationX + (normalizedPointer.x * target.zoomX), 0), + targetRelativeY = Math.max(target.cacheTranslationY + (normalizedPointer.y * target.zoomY), 0); + + var isTransparent = fabric.util.isTransparent( + target._cacheContext, Math.round(targetRelativeX), Math.round(targetRelativeY), this.targetFindTolerance); + + return isTransparent; + } + + var ctx = this.contextCache, + originalColor = target.selectionBackgroundColor, v = this.viewportTransform; + + target.selectionBackgroundColor = ''; + + this.clearContext(ctx); + + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + target.render(ctx); + ctx.restore(); + + target === this._activeObject && target._renderControls(ctx, { + hasBorders: false, + transparentCorners: false + }, { + hasBorders: false, + }); + + target.selectionBackgroundColor = originalColor; + + var isTransparent = fabric.util.isTransparent( + ctx, x, y, this.targetFindTolerance); + + return isTransparent; + }, + + /** + * takes an event and determins if selection key has been pressed + * @private + * @param {Event} e Event object + */ + _isSelectionKeyPressed: function(e) { + var selectionKeyPressed = false; + + if (Object.prototype.toString.call(this.selectionKey) === '[object Array]') { + selectionKeyPressed = !!this.selectionKey.find(function(key) { return e[key] === true; }); + } + else { + selectionKeyPressed = e[this.selectionKey]; + } + + return selectionKeyPressed; + }, + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + */ + _shouldClearSelection: function (e, target) { + var activeObjects = this.getActiveObjects(), + activeObject = this._activeObject; + + return ( + !target + || + (target && + activeObject && + activeObjects.length > 1 && + activeObjects.indexOf(target) === -1 && + activeObject !== target && + !this._isSelectionKeyPressed(e)) + || + (target && !target.evented) + || + (target && + !target.selectable && + activeObject && + activeObject !== target) + ); + }, + + /** + * centeredScaling from object can't override centeredScaling from canvas. + * this should be fixed, since object setting should take precedence over canvas. + * also this should be something that will be migrated in the control properties. + * as ability to define the origin of the transformation that the control provide. + * @private + * @param {fabric.Object} target + * @param {String} action + * @param {Boolean} altKey + */ + _shouldCenterTransform: function (target, action, altKey) { + if (!target) { + return; + } + + var centerTransform; + + if (action === 'scale' || action === 'scaleX' || action === 'scaleY' || action === 'resizing') { + centerTransform = this.centeredScaling || target.centeredScaling; + } + else if (action === 'rotate') { + centerTransform = this.centeredRotation || target.centeredRotation; + } + + return centerTransform ? !altKey : altKey; + }, + + /** + * should disappear before release 4.0 + * @private + */ + _getOriginFromCorner: function(target, corner) { + var origin = { + x: target.originX, + y: target.originY + }; + + if (corner === 'ml' || corner === 'tl' || corner === 'bl') { + origin.x = 'right'; + } + else if (corner === 'mr' || corner === 'tr' || corner === 'br') { + origin.x = 'left'; + } + + if (corner === 'tl' || corner === 'mt' || corner === 'tr') { + origin.y = 'bottom'; + } + else if (corner === 'bl' || corner === 'mb' || corner === 'br') { + origin.y = 'top'; + } + else if (corner === 'mtr') { + origin.x = 'center'; + origin.y = 'center'; + } + return origin; + }, + + /** + * @private + * @param {Boolean} alreadySelected true if target is already selected + * @param {String} corner a string representing the corner ml, mr, tl ... + * @param {Event} e Event object + * @param {fabric.Object} [target] inserted back to help overriding. Unused + */ + _getActionFromCorner: function(alreadySelected, corner, e, target) { + if (!corner || !alreadySelected) { + return 'drag'; + } + var control = target.controls[corner]; + return control.getActionName(e, control, target); + }, + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + */ + _setupCurrentTransform: function (e, target, alreadySelected) { + if (!target) { + return; + } + + var pointer = this.getPointer(e), corner = target.__corner, + actionHandler = (alreadySelected && corner) ? + target.controls[corner].getActionHandler() : fabric.controlsUtils.dragHandler, + action = this._getActionFromCorner(alreadySelected, corner, e, target), + origin = this._getOriginFromCorner(target, corner), + altKey = e[this.centeredKey], + transform = { + target: target, + action: action, + actionHandler: actionHandler, + corner: corner, + scaleX: target.scaleX, + scaleY: target.scaleY, + skewX: target.skewX, + skewY: target.skewY, + // used by transation + offsetX: pointer.x - target.left, + offsetY: pointer.y - target.top, + originX: origin.x, + originY: origin.y, + ex: pointer.x, + ey: pointer.y, + lastX: pointer.x, + lastY: pointer.y, + // unsure they are useful anymore. + // left: target.left, + // top: target.top, + theta: degreesToRadians(target.angle), + // end of unsure + width: target.width * target.scaleX, + shiftKey: e.shiftKey, + altKey: altKey, + original: fabric.util.saveObjectTransform(target), + }; + + if (this._shouldCenterTransform(target, action, altKey)) { + transform.originX = 'center'; + transform.originY = 'center'; + } + transform.original.originX = origin.x; + transform.original.originY = origin.y; + this._currentTransform = transform; + this._beforeTransform(e); + }, + + /** + * Set the cursor type of the canvas element + * @param {String} value Cursor type of the canvas element. + * @see http://www.w3.org/TR/css3-ui/#cursor + */ + setCursor: function (value) { + this.upperCanvasEl.style.cursor = value; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx to draw the selection on + */ + _drawSelection: function (ctx) { + var groupSelector = this._groupSelector, + left = groupSelector.left, + top = groupSelector.top, + aleft = abs(left), + atop = abs(top); + + if (this.selectionColor) { + ctx.fillStyle = this.selectionColor; + + ctx.fillRect( + groupSelector.ex - ((left > 0) ? 0 : -left), + groupSelector.ey - ((top > 0) ? 0 : -top), + aleft, + atop + ); + } + + if (!this.selectionLineWidth || !this.selectionBorderColor) { + return; + } + ctx.lineWidth = this.selectionLineWidth; + ctx.strokeStyle = this.selectionBorderColor; + + // selection border + if (this.selectionDashArray.length > 1 && !supportLineDash) { + + var px = groupSelector.ex + STROKE_OFFSET - ((left > 0) ? 0 : aleft), + py = groupSelector.ey + STROKE_OFFSET - ((top > 0) ? 0 : atop); + + ctx.beginPath(); + + fabric.util.drawDashedLine(ctx, px, py, px + aleft, py, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px, py + atop - 1, px + aleft, py + atop - 1, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px, py, px, py + atop, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px + aleft - 1, py, px + aleft - 1, py + atop, this.selectionDashArray); + + ctx.closePath(); + ctx.stroke(); + } + else { + fabric.Object.prototype._setLineDash.call(this, ctx, this.selectionDashArray); + ctx.strokeRect( + groupSelector.ex + STROKE_OFFSET - ((left > 0) ? 0 : aleft), + groupSelector.ey + STROKE_OFFSET - ((top > 0) ? 0 : atop), + aleft, + atop + ); + } + }, + + /** + * Method that determines what object we are clicking on + * the skipGroup parameter is for internal use, is needed for shift+click action + * 11/09/2018 TODO: would be cool if findTarget could discern between being a full target + * or the outside part of the corner. + * @param {Event} e mouse event + * @param {Boolean} skipGroup when true, activeGroup is skipped and only objects are traversed through + * @return {fabric.Object} the target found + */ + findTarget: function (e, skipGroup) { + if (this.skipTargetFind) { + return; + } + + var ignoreZoom = true, + pointer = this.getPointer(e, ignoreZoom), + activeObject = this._activeObject, + aObjects = this.getActiveObjects(), + activeTarget, activeTargetSubs, + isTouch = isTouchEvent(e); + + // first check current group (if one exists) + // active group does not check sub targets like normal groups. + // if active group just exits. + this.targets = []; + + if (aObjects.length > 1 && !skipGroup && activeObject === this._searchPossibleTargets([activeObject], pointer)) { + return activeObject; + } + // if we hit the corner of an activeObject, let's return that. + if (aObjects.length === 1 && activeObject._findTargetCorner(pointer, isTouch)) { + return activeObject; + } + if (aObjects.length === 1 && + activeObject === this._searchPossibleTargets([activeObject], pointer)) { + if (!this.preserveObjectStacking) { + return activeObject; + } + else { + activeTarget = activeObject; + activeTargetSubs = this.targets; + this.targets = []; + } + } + var target = this._searchPossibleTargets(this._objects, pointer); + if (e[this.altSelectionKey] && target && activeTarget && target !== activeTarget) { + target = activeTarget; + this.targets = activeTargetSubs; + } + return target; + }, + + /** + * Checks point is inside the object. + * @param {Object} [pointer] x,y object of point coordinates we want to check. + * @param {fabric.Object} obj Object to test against + * @param {Object} [globalPointer] x,y object of point coordinates relative to canvas used to search per pixel target. + * @return {Boolean} true if point is contained within an area of given object + * @private + */ + _checkTarget: function(pointer, obj, globalPointer) { + if (obj && + obj.visible && + obj.evented && + // http://www.geog.ubc.ca/courses/klink/gis.notes/ncgia/u32.html + // http://idav.ucdavis.edu/~okreylos/TAship/Spring2000/PointInPolygon.html + (obj.containsPoint(pointer) || !!obj._findTargetCorner(pointer)) + ) { + if ((this.perPixelTargetFind || obj.perPixelTargetFind) && !obj.isEditing) { + var isTransparent = this.isTargetTransparent(obj, globalPointer.x, globalPointer.y); + if (!isTransparent) { + return true; + } + } + else { + return true; + } + } + }, + + /** + * Function used to search inside objects an object that contains pointer in bounding box or that contains pointerOnCanvas when painted + * @param {Array} [objects] objects array to look into + * @param {Object} [pointer] x,y object of point coordinates we want to check. + * @return {fabric.Object} object that contains pointer + * @private + */ + _searchPossibleTargets: function(objects, pointer) { + // Cache all targets where their bounding box contains point. + var target, i = objects.length, subTarget; + // Do not check for currently grouped objects, since we check the parent group itself. + // until we call this function specifically to search inside the activeGroup + while (i--) { + var objToCheck = objects[i]; + var pointerToUse = objToCheck.group ? + this._normalizePointer(objToCheck.group, pointer) : pointer; + if (this._checkTarget(pointerToUse, objToCheck, pointer)) { + target = objects[i]; + if (target.subTargetCheck && target instanceof fabric.Group) { + subTarget = this._searchPossibleTargets(target._objects, pointer); + subTarget && this.targets.push(subTarget); + } + break; + } + } + return target; + }, + + /** + * Returns pointer coordinates without the effect of the viewport + * @param {Object} pointer with "x" and "y" number values + * @return {Object} object with "x" and "y" number values + */ + restorePointerVpt: function(pointer) { + return fabric.util.transformPoint( + pointer, + fabric.util.invertTransform(this.viewportTransform) + ); + }, + + /** + * Returns pointer coordinates relative to canvas. + * Can return coordinates with or without viewportTransform. + * ignoreZoom false gives back coordinates that represent + * the point clicked on canvas element. + * ignoreZoom true gives back coordinates after being processed + * by the viewportTransform ( sort of coordinates of what is displayed + * on the canvas where you are clicking. + * ignoreZoom true = HTMLElement coordinates relative to top,left + * ignoreZoom false, default = fabric space coordinates, the same used for shape position + * To interact with your shapes top and left you want to use ignoreZoom true + * most of the time, while ignoreZoom false will give you coordinates + * compatible with the object.oCoords system. + * of the time. + * @param {Event} e + * @param {Boolean} ignoreZoom + * @return {Object} object with "x" and "y" number values + */ + getPointer: function (e, ignoreZoom) { + // return cached values if we are in the event processing chain + if (this._absolutePointer && !ignoreZoom) { + return this._absolutePointer; + } + if (this._pointer && ignoreZoom) { + return this._pointer; + } + + var pointer = getPointer(e), + upperCanvasEl = this.upperCanvasEl, + bounds = upperCanvasEl.getBoundingClientRect(), + boundsWidth = bounds.width || 0, + boundsHeight = bounds.height || 0, + cssScale; + + if (!boundsWidth || !boundsHeight ) { + if ('top' in bounds && 'bottom' in bounds) { + boundsHeight = Math.abs( bounds.top - bounds.bottom ); + } + if ('right' in bounds && 'left' in bounds) { + boundsWidth = Math.abs( bounds.right - bounds.left ); + } + } + + this.calcOffset(); + pointer.x = pointer.x - this._offset.left; + pointer.y = pointer.y - this._offset.top; + if (!ignoreZoom) { + pointer = this.restorePointerVpt(pointer); + } + + var retinaScaling = this.getRetinaScaling(); + if (retinaScaling !== 1) { + pointer.x /= retinaScaling; + pointer.y /= retinaScaling; + } + + if (boundsWidth === 0 || boundsHeight === 0) { + // If bounds are not available (i.e. not visible), do not apply scale. + cssScale = { width: 1, height: 1 }; + } + else { + cssScale = { + width: upperCanvasEl.width / boundsWidth, + height: upperCanvasEl.height / boundsHeight + }; + } + + return { + x: pointer.x * cssScale.width, + y: pointer.y * cssScale.height + }; + }, + + /** + * @private + * @throws {CANVAS_INIT_ERROR} If canvas can not be initialized + */ + _createUpperCanvas: function () { + var lowerCanvasClass = this.lowerCanvasEl.className.replace(/\s*lower-canvas\s*/, ''), + lowerCanvasEl = this.lowerCanvasEl, upperCanvasEl = this.upperCanvasEl; + + // there is no need to create a new upperCanvas element if we have already one. + if (upperCanvasEl) { + upperCanvasEl.className = ''; + } + else { + upperCanvasEl = this._createCanvasElement(); + this.upperCanvasEl = upperCanvasEl; + } + fabric.util.addClass(upperCanvasEl, 'upper-canvas ' + lowerCanvasClass); + + this.wrapperEl.appendChild(upperCanvasEl); + + this._copyCanvasStyle(lowerCanvasEl, upperCanvasEl); + this._applyCanvasStyle(upperCanvasEl); + this.contextTop = upperCanvasEl.getContext('2d'); + }, + + /** + * @private + */ + _createCacheCanvas: function () { + this.cacheCanvasEl = this._createCanvasElement(); + this.cacheCanvasEl.setAttribute('width', this.width); + this.cacheCanvasEl.setAttribute('height', this.height); + this.contextCache = this.cacheCanvasEl.getContext('2d'); + }, + + /** + * @private + */ + _initWrapperElement: function () { + this.wrapperEl = fabric.util.wrapElement(this.lowerCanvasEl, 'div', { + 'class': this.containerClass + }); + fabric.util.setStyle(this.wrapperEl, { + width: this.width + 'px', + height: this.height + 'px', + position: 'relative' + }); + fabric.util.makeElementUnselectable(this.wrapperEl); + }, + + /** + * @private + * @param {HTMLElement} element canvas element to apply styles on + */ + _applyCanvasStyle: function (element) { + var width = this.width || element.width, + height = this.height || element.height; + + fabric.util.setStyle(element, { + position: 'absolute', + width: width + 'px', + height: height + 'px', + left: 0, + top: 0, + 'touch-action': this.allowTouchScrolling ? 'manipulation' : 'none', + '-ms-touch-action': this.allowTouchScrolling ? 'manipulation' : 'none' + }); + element.width = width; + element.height = height; + fabric.util.makeElementUnselectable(element); + }, + + /** + * Copy the entire inline style from one element (fromEl) to another (toEl) + * @private + * @param {Element} fromEl Element style is copied from + * @param {Element} toEl Element copied style is applied to + */ + _copyCanvasStyle: function (fromEl, toEl) { + toEl.style.cssText = fromEl.style.cssText; + }, + + /** + * Returns context of canvas where object selection is drawn + * @return {CanvasRenderingContext2D} + */ + getSelectionContext: function() { + return this.contextTop; + }, + + /** + * Returns <canvas> element on which object selection is drawn + * @return {HTMLCanvasElement} + */ + getSelectionElement: function () { + return this.upperCanvasEl; + }, + + /** + * Returns currently active object + * @return {fabric.Object} active object + */ + getActiveObject: function () { + return this._activeObject; + }, + + /** + * Returns an array with the current selected objects + * @return {fabric.Object} active object + */ + getActiveObjects: function () { + var active = this._activeObject; + if (active) { + if (active.type === 'activeSelection' && active._objects) { + return active._objects.slice(0); + } + else { + return [active]; + } + } + return []; + }, + + /** + * @private + * @param {fabric.Object} obj Object that was removed + */ + _onObjectRemoved: function(obj) { + // removing active object should fire "selection:cleared" events + if (obj === this._activeObject) { + this.fire('before:selection:cleared', { target: obj }); + this._discardActiveObject(); + this.fire('selection:cleared', { target: obj }); + obj.fire('deselected'); + } + if (obj === this._hoveredTarget){ + this._hoveredTarget = null; + this._hoveredTargets = []; + } + this.callSuper('_onObjectRemoved', obj); + }, + + /** + * @private + * Compares the old activeObject with the current one and fires correct events + * @param {fabric.Object} obj old activeObject + */ + _fireSelectionEvents: function(oldObjects, e) { + var somethingChanged = false, objects = this.getActiveObjects(), + added = [], removed = [], opt = { e: e }; + oldObjects.forEach(function(oldObject) { + if (objects.indexOf(oldObject) === -1) { + somethingChanged = true; + oldObject.fire('deselected', opt); + removed.push(oldObject); + } + }); + objects.forEach(function(object) { + if (oldObjects.indexOf(object) === -1) { + somethingChanged = true; + object.fire('selected', opt); + added.push(object); + } + }); + if (oldObjects.length > 0 && objects.length > 0) { + opt.selected = added; + opt.deselected = removed; + // added for backward compatibility + opt.updated = added[0] || removed[0]; + opt.target = this._activeObject; + somethingChanged && this.fire('selection:updated', opt); + } + else if (objects.length > 0) { + opt.selected = added; + // added for backward compatibility + opt.target = this._activeObject; + this.fire('selection:created', opt); + } + else if (oldObjects.length > 0) { + opt.deselected = removed; + this.fire('selection:cleared', opt); + } + }, + + /** + * Sets given object as the only active object on canvas + * @param {fabric.Object} object Object to set as an active one + * @param {Event} [e] Event (passed along when firing "object:selected") + * @return {fabric.Canvas} thisArg + * @chainable + */ + setActiveObject: function (object, e) { + var currentActives = this.getActiveObjects(); + this._setActiveObject(object, e); + this._fireSelectionEvents(currentActives, e); + return this; + }, + + /** + * @private + * @param {Object} object to set as active + * @param {Event} [e] Event (passed along when firing "object:selected") + * @return {Boolean} true if the selection happened + */ + _setActiveObject: function(object, e) { + if (this._activeObject === object) { + return false; + } + if (!this._discardActiveObject(e, object)) { + return false; + } + if (object.onSelect({ e: e })) { + return false; + } + this._activeObject = object; + return true; + }, + + /** + * @private + */ + _discardActiveObject: function(e, object) { + var obj = this._activeObject; + if (obj) { + // onDeselect return TRUE to cancel selection; + if (obj.onDeselect({ e: e, object: object })) { + return false; + } + this._activeObject = null; + } + return true; + }, + + /** + * Discards currently active object and fire events. If the function is called by fabric + * as a consequence of a mouse event, the event is passed as a parameter and + * sent to the fire function for the custom events. When used as a method the + * e param does not have any application. + * @param {event} e + * @return {fabric.Canvas} thisArg + * @chainable + */ + discardActiveObject: function (e) { + var currentActives = this.getActiveObjects(), activeObject = this.getActiveObject(); + if (currentActives.length) { + this.fire('before:selection:cleared', { target: activeObject, e: e }); + } + this._discardActiveObject(e); + this._fireSelectionEvents(currentActives, e); + return this; + }, + + /** + * Clears a canvas element and removes all event listeners + * @return {fabric.Canvas} thisArg + * @chainable + */ + dispose: function () { + var wrapper = this.wrapperEl; + this.removeListeners(); + wrapper.removeChild(this.upperCanvasEl); + wrapper.removeChild(this.lowerCanvasEl); + this.contextCache = null; + this.contextTop = null; + ['upperCanvasEl', 'cacheCanvasEl'].forEach((function(element) { + fabric.util.cleanUpJsdomNode(this[element]); + this[element] = undefined; + }).bind(this)); + if (wrapper.parentNode) { + wrapper.parentNode.replaceChild(this.lowerCanvasEl, this.wrapperEl); + } + delete this.wrapperEl; + fabric.StaticCanvas.prototype.dispose.call(this); + return this; + }, + + /** + * Clears all contexts (background, main, top) of an instance + * @return {fabric.Canvas} thisArg + * @chainable + */ + clear: function () { + // this.discardActiveGroup(); + this.discardActiveObject(); + this.clearContext(this.contextTop); + return this.callSuper('clear'); + }, + + /** + * Draws objects' controls (borders/controls) + * @param {CanvasRenderingContext2D} ctx Context to render controls on + */ + drawControls: function(ctx) { + var activeObject = this._activeObject; + + if (activeObject) { + activeObject._renderControls(ctx); + } + }, + + /** + * @private + */ + _toObject: function(instance, methodName, propertiesToInclude) { + //If the object is part of the current selection group, it should + //be transformed appropriately + //i.e. it should be serialised as it would appear if the selection group + //were to be destroyed. + var originalProperties = this._realizeGroupTransformOnObject(instance), + object = this.callSuper('_toObject', instance, methodName, propertiesToInclude); + //Undo the damage we did by changing all of its properties + this._unwindGroupTransformOnObject(instance, originalProperties); + return object; + }, + + /** + * Realises an object's group transformation on it + * @private + * @param {fabric.Object} [instance] the object to transform (gets mutated) + * @returns the original values of instance which were changed + */ + _realizeGroupTransformOnObject: function(instance) { + if (instance.group && instance.group.type === 'activeSelection' && this._activeObject === instance.group) { + var layoutProps = ['angle', 'flipX', 'flipY', 'left', 'scaleX', 'scaleY', 'skewX', 'skewY', 'top']; + //Copy all the positionally relevant properties across now + var originalValues = {}; + layoutProps.forEach(function(prop) { + originalValues[prop] = instance[prop]; + }); + this._activeObject.realizeTransform(instance); + return originalValues; + } + else { + return null; + } + }, + + /** + * Restores the changed properties of instance + * @private + * @param {fabric.Object} [instance] the object to un-transform (gets mutated) + * @param {Object} [originalValues] the original values of instance, as returned by _realizeGroupTransformOnObject + */ + _unwindGroupTransformOnObject: function(instance, originalValues) { + if (originalValues) { + instance.set(originalValues); + } + }, + + /** + * @private + */ + _setSVGObject: function(markup, instance, reviver) { + //If the object is in a selection group, simulate what would happen to that + //object when the group is deselected + var originalProperties = this._realizeGroupTransformOnObject(instance); + this.callSuper('_setSVGObject', markup, instance, reviver); + this._unwindGroupTransformOnObject(instance, originalProperties); + }, + + setViewportTransform: function (vpt) { + if (this.renderOnAddRemove && this._activeObject && this._activeObject.isEditing) { + this._activeObject.clearContextTop(); + } + fabric.StaticCanvas.prototype.setViewportTransform.call(this, vpt); + } + }); + + // copying static properties manually to work around Opera's bug, + // where "prototype" property is enumerable and overrides existing prototype + for (var prop in fabric.StaticCanvas) { + if (prop !== 'prototype') { + fabric.Canvas[prop] = fabric.StaticCanvas[prop]; + } + } +})(); +(function() { + + var addListener = fabric.util.addListener, + removeListener = fabric.util.removeListener, + RIGHT_CLICK = 3, MIDDLE_CLICK = 2, LEFT_CLICK = 1, + addEventOptions = { passive: false }; + + function checkClick(e, value) { + return e.button && (e.button === value - 1); + } + + fabric.util.object.extend(fabric.Canvas.prototype, /** @lends fabric.Canvas.prototype */ { + + /** + * Contains the id of the touch event that owns the fabric transform + * @type Number + * @private + */ + mainTouchId: null, + + /** + * Adds mouse listeners to canvas + * @private + */ + _initEventListeners: function () { + // in case we initialized the class twice. This should not happen normally + // but in some kind of applications where the canvas element may be changed + // this is a workaround to having double listeners. + this.removeListeners(); + this._bindEvents(); + this.addOrRemove(addListener, 'add'); + }, + + /** + * return an event prefix pointer or mouse. + * @private + */ + _getEventPrefix: function () { + // ToDo infinite-drawing-canvas, pen should be handled as pointer. + // we need to add all down/move/out/enter... for pointer + return this.enablePointerEvents ? 'pointer' : 'mouse'; + }, + + addOrRemove: function(functor, eventjsFunctor) { + var canvasElement = this.upperCanvasEl, + eventTypePrefix = this._getEventPrefix(); + functor(fabric.window, 'resize', this._onResize); + functor(canvasElement, eventTypePrefix + 'down', this._onMouseDown); + functor(canvasElement, eventTypePrefix + 'move', this._onMouseMove, addEventOptions); + functor(canvasElement, eventTypePrefix + 'out', this._onMouseOut); + functor(canvasElement, eventTypePrefix + 'enter', this._onMouseEnter); + functor(canvasElement, 'wheel', this._onMouseWheel); + functor(canvasElement, 'contextmenu', this._onContextMenu); + functor(canvasElement, 'dblclick', this._onDoubleClick); + functor(canvasElement, 'dragover', this._onDragOver); + functor(canvasElement, 'dragenter', this._onDragEnter); + functor(canvasElement, 'dragleave', this._onDragLeave); + functor(canvasElement, 'drop', this._onDrop); + if (!this.enablePointerEvents) { + functor(canvasElement, 'touchstart', this._onTouchStart, addEventOptions); + // ToDo infinite-drawing-canvas, pen should be handled as pointer. + // we need to add all down/move/out/enter... for pointer + } + if (typeof eventjs !== 'undefined' && eventjsFunctor in eventjs) { + eventjs[eventjsFunctor](canvasElement, 'gesture', this._onGesture); + eventjs[eventjsFunctor](canvasElement, 'drag', this._onDrag); + eventjs[eventjsFunctor](canvasElement, 'orientation', this._onOrientationChange); + eventjs[eventjsFunctor](canvasElement, 'shake', this._onShake); + eventjs[eventjsFunctor](canvasElement, 'longpress', this._onLongPress); + } + }, + + /** + * Removes all event listeners + */ + removeListeners: function() { + this.addOrRemove(removeListener, 'remove'); + // if you dispose on a mouseDown, before mouse up, you need to clean document to... + var eventTypePrefix = this._getEventPrefix(); + removeListener(fabric.document, eventTypePrefix + 'up', this._onMouseUp); + removeListener(fabric.document, 'touchend', this._onTouchEnd, addEventOptions); + removeListener(fabric.document, eventTypePrefix + 'move', this._onMouseMove, addEventOptions); + removeListener(fabric.document, 'touchmove', this._onMouseMove, addEventOptions); + }, + + /** + * @private + */ + _bindEvents: function() { + if (this.eventsBound) { + // for any reason we pass here twice we do not want to bind events twice. + return; + } + this._onMouseDown = this._onMouseDown.bind(this); + this._onTouchStart = this._onTouchStart.bind(this); + this._onMouseMove = this._onMouseMove.bind(this); + this._onMouseUp = this._onMouseUp.bind(this); + this._onTouchEnd = this._onTouchEnd.bind(this); + this._onResize = this._onResize.bind(this); + this._onGesture = this._onGesture.bind(this); + this._onDrag = this._onDrag.bind(this); + this._onShake = this._onShake.bind(this); + this._onLongPress = this._onLongPress.bind(this); + this._onOrientationChange = this._onOrientationChange.bind(this); + this._onMouseWheel = this._onMouseWheel.bind(this); + this._onMouseOut = this._onMouseOut.bind(this); + this._onMouseEnter = this._onMouseEnter.bind(this); + this._onContextMenu = this._onContextMenu.bind(this); + this._onDoubleClick = this._onDoubleClick.bind(this); + this._onDragOver = this._onDragOver.bind(this); + this._onDragEnter = this._simpleEventHandler.bind(this, 'dragenter'); + this._onDragLeave = this._simpleEventHandler.bind(this, 'dragleave'); + this._onDrop = this._simpleEventHandler.bind(this, 'drop'); + this.eventsBound = true; + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js gesture + * @param {Event} [self] Inner Event object + */ + _onGesture: function(e, self) { + this.__onTransformGesture && this.__onTransformGesture(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js drag + * @param {Event} [self] Inner Event object + */ + _onDrag: function(e, self) { + this.__onDrag && this.__onDrag(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on wheel event + */ + _onMouseWheel: function(e) { + this.__onMouseWheel(e); + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onMouseOut: function(e) { + var target = this._hoveredTarget; + this.fire('mouse:out', { target: target, e: e }); + this._hoveredTarget = null; + target && target.fire('mouseout', { e: e }); + + var _this = this; + this._hoveredTargets.forEach(function(_target){ + _this.fire('mouse:out', { target: target, e: e }); + _target && target.fire('mouseout', { e: e }); + }); + this._hoveredTargets = []; + + if (this._iTextInstances) { + this._iTextInstances.forEach(function(obj) { + if (obj.isEditing) { + obj.hiddenTextarea.focus(); + } + }); + } + }, + + /** + * @private + * @param {Event} e Event object fired on mouseenter + */ + _onMouseEnter: function(e) { + // This find target and consequent 'mouse:over' is used to + // clear old instances on hovered target. + // calling findTarget has the side effect of killing target.__corner. + // as a short term fix we are not firing this if we are currently transforming. + // as a long term fix we need to separate the action of finding a target with the + // side effects we added to it. + if (!this._currentTransform && !this.findTarget(e)) { + this.fire('mouse:over', { target: null, e: e }); + this._hoveredTarget = null; + this._hoveredTargets = []; + } + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js orientation change + * @param {Event} [self] Inner Event object + */ + _onOrientationChange: function(e, self) { + this.__onOrientationChange && this.__onOrientationChange(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js shake + * @param {Event} [self] Inner Event object + */ + _onShake: function(e, self) { + this.__onShake && this.__onShake(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js shake + * @param {Event} [self] Inner Event object + */ + _onLongPress: function(e, self) { + this.__onLongPress && this.__onLongPress(e, self); + }, + + /** + * prevent default to allow drop event to be fired + * @private + * @param {Event} [e] Event object fired on Event.js shake + */ + _onDragOver: function(e) { + e.preventDefault(); + var target = this._simpleEventHandler('dragover', e); + this._fireEnterLeaveEvents(target, e); + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onContextMenu: function (e) { + if (this.stopContextMenu) { + e.stopPropagation(); + e.preventDefault(); + } + return false; + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onDoubleClick: function (e) { + this._cacheTransformEventData(e); + this._handleEvent(e, 'dblclick'); + this._resetTransformEventData(e); + }, + + /** + * Return a the id of an event. + * returns either the pointerId or the identifier or 0 for the mouse event + * @private + * @param {Event} evt Event object + */ + getPointerId: function(evt) { + var changedTouches = evt.changedTouches; + + if (changedTouches) { + return changedTouches[0] && changedTouches[0].identifier; + } + + if (this.enablePointerEvents) { + return evt.pointerId; + } + + return -1; + }, + + /** + * Determines if an event has the id of the event that is considered main + * @private + * @param {evt} event Event object + */ + _isMainEvent: function(evt) { + if (evt.isPrimary === true) { + return true; + } + if (evt.isPrimary === false) { + return false; + } + if (evt.type === 'touchend' && evt.touches.length === 0) { + return true; + } + if (evt.changedTouches) { + return evt.changedTouches[0].identifier === this.mainTouchId; + } + return true; + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onTouchStart: function(e) { + e.preventDefault(); + if (this.mainTouchId === null) { + this.mainTouchId = this.getPointerId(e); + } + this.__onMouseDown(e); + this._resetTransformEventData(); + var canvasElement = this.upperCanvasEl, + eventTypePrefix = this._getEventPrefix(); + addListener(fabric.document, 'touchend', this._onTouchEnd, addEventOptions); + addListener(fabric.document, 'touchmove', this._onMouseMove, addEventOptions); + // Unbind mousedown to prevent double triggers from touch devices + removeListener(canvasElement, eventTypePrefix + 'down', this._onMouseDown); + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onMouseDown: function (e) { + this.__onMouseDown(e); + this._resetTransformEventData(); + var canvasElement = this.upperCanvasEl, + eventTypePrefix = this._getEventPrefix(); + removeListener(canvasElement, eventTypePrefix + 'move', this._onMouseMove, addEventOptions); + addListener(fabric.document, eventTypePrefix + 'up', this._onMouseUp); + addListener(fabric.document, eventTypePrefix + 'move', this._onMouseMove, addEventOptions); + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onTouchEnd: function(e) { + if (e.touches.length > 0) { + // if there are still touches stop here + return; + } + this.__onMouseUp(e); + this._resetTransformEventData(); + this.mainTouchId = null; + var eventTypePrefix = this._getEventPrefix(); + removeListener(fabric.document, 'touchend', this._onTouchEnd, addEventOptions); + removeListener(fabric.document, 'touchmove', this._onMouseMove, addEventOptions); + var _this = this; + if (this._willAddMouseDown) { + clearTimeout(this._willAddMouseDown); + } + this._willAddMouseDown = setTimeout(function() { + // Wait 400ms before rebinding mousedown to prevent double triggers + // from touch devices + addListener(_this.upperCanvasEl, eventTypePrefix + 'down', _this._onMouseDown); + _this._willAddMouseDown = 0; + }, 400); + }, + + /** + * @private + * @param {Event} e Event object fired on mouseup + */ + _onMouseUp: function (e) { + this.__onMouseUp(e); + this._resetTransformEventData(); + var canvasElement = this.upperCanvasEl, + eventTypePrefix = this._getEventPrefix(); + if (this._isMainEvent(e)) { + removeListener(fabric.document, eventTypePrefix + 'up', this._onMouseUp); + removeListener(fabric.document, eventTypePrefix + 'move', this._onMouseMove, addEventOptions); + addListener(canvasElement, eventTypePrefix + 'move', this._onMouseMove, addEventOptions); + } + }, + + /** + * @private + * @param {Event} e Event object fired on mousemove + */ + _onMouseMove: function (e) { + !this.allowTouchScrolling && e.preventDefault && e.preventDefault(); + this.__onMouseMove(e); + }, + + /** + * @private + */ + _onResize: function () { + this.calcOffset(); + }, + + /** + * Decides whether the canvas should be redrawn in mouseup and mousedown events. + * @private + * @param {Object} target + */ + _shouldRender: function(target) { + var activeObject = this._activeObject; + + if ( + !!activeObject !== !!target || + (activeObject && target && (activeObject !== target)) + ) { + // this covers: switch of target, from target to no target, selection of target + // multiSelection with key and mouse + return true; + } + else if (activeObject && activeObject.isEditing) { + // if we mouse up/down over a editing textbox a cursor change, + // there is no need to re render + return false; + } + return false; + }, + + /** + * Method that defines the actions when mouse is released on canvas. + * The method resets the currentTransform parameters, store the image corner + * position in the image object and render the canvas on top. + * @private + * @param {Event} e Event object fired on mouseup + */ + __onMouseUp: function (e) { + var target, transform = this._currentTransform, + groupSelector = this._groupSelector, shouldRender = false, + isClick = (!groupSelector || (groupSelector.left === 0 && groupSelector.top === 0)); + this._cacheTransformEventData(e); + target = this._target; + this._handleEvent(e, 'up:before'); + // if right/middle click just fire events and return + // target undefined will make the _handleEvent search the target + if (checkClick(e, RIGHT_CLICK)) { + if (this.fireRightClick) { + this._handleEvent(e, 'up', RIGHT_CLICK, isClick); + } + return; + } + + if (checkClick(e, MIDDLE_CLICK)) { + if (this.fireMiddleClick) { + this._handleEvent(e, 'up', MIDDLE_CLICK, isClick); + } + this._resetTransformEventData(); + return; + } + + if (this.isDrawingMode && this._isCurrentlyDrawing) { + this._onMouseUpInDrawingMode(e); + return; + } + + if (!this._isMainEvent(e)) { + return; + } + if (transform) { + this._finalizeCurrentTransform(e); + shouldRender = transform.actionPerformed; + } + if (!isClick) { + var targetWasActive = target === this._activeObject; + this._maybeGroupObjects(e); + if (!shouldRender) { + shouldRender = ( + this._shouldRender(target) || + (!targetWasActive && target === this._activeObject) + ); + } + } + if (target) { + var corner = target._findTargetCorner( + this.getPointer(e, true), + fabric.util.isTouchEvent(e) + ); + var control = target.controls[corner], + mouseUpHandler = control && control.getMouseUpHandler(e, target, control); + if (mouseUpHandler) { + mouseUpHandler(e, target, control); + } + target.isMoving = false; + } + this._setCursorFromEvent(e, target); + this._handleEvent(e, 'up', LEFT_CLICK, isClick); + this._groupSelector = null; + this._currentTransform = null; + // reset the target information about which corner is selected + target && (target.__corner = 0); + if (shouldRender) { + this.requestRenderAll(); + } + else if (!isClick) { + this.renderTop(); + } + }, + + /** + * @private + * Handle event firing for target and subtargets + * @param {Event} e event from mouse + * @param {String} eventType event to fire (up, down or move) + * @return {Fabric.Object} target return the the target found, for internal reasons. + */ + _simpleEventHandler: function(eventType, e) { + var target = this.findTarget(e), + targets = this.targets, + options = { + e: e, + target: target, + subTargets: targets, + }; + this.fire(eventType, options); + target && target.fire(eventType, options); + if (!targets) { + return target; + } + for (var i = 0; i < targets.length; i++) { + targets[i].fire(eventType, options); + } + return target; + }, + + /** + * @private + * Handle event firing for target and subtargets + * @param {Event} e event from mouse + * @param {String} eventType event to fire (up, down or move) + * @param {fabric.Object} targetObj receiving event + * @param {Number} [button] button used in the event 1 = left, 2 = middle, 3 = right + * @param {Boolean} isClick for left button only, indicates that the mouse up happened without move. + */ + _handleEvent: function(e, eventType, button, isClick) { + var target = this._target, + targets = this.targets || [], + options = { + e: e, + target: target, + subTargets: targets, + button: button || LEFT_CLICK, + isClick: isClick || false, + pointer: this._pointer, + absolutePointer: this._absolutePointer, + transform: this._currentTransform + }; + if (eventType === 'up') { + options.currentTarget = this.findTarget(e); + options.currentSubTargets = this.targets; + } + this.fire('mouse:' + eventType, options); + target && target.fire('mouse' + eventType, options); + for (var i = 0; i < targets.length; i++) { + targets[i].fire('mouse' + eventType, options); + } + }, + + /** + * @private + * @param {Event} e send the mouse event that generate the finalize down, so it can be used in the event + */ + _finalizeCurrentTransform: function(e) { + + var transform = this._currentTransform, + target = transform.target, + eventName, + options = { + e: e, + target: target, + transform: transform, + action: transform.action, + }; + + if (target._scaling) { + target._scaling = false; + } + + target.setCoords(); + + if (transform.actionPerformed || (this.stateful && target.hasStateChanged())) { + if (transform.actionPerformed) { + // this is not friendly to the new control api. + // is deprecated. + eventName = this._addEventOptions(options, transform); + this._fire(eventName, options); + } + this._fire('modified', options); + } + }, + + /** + * Mutate option object in order to add by property and give back the event name. + * @private + * @deprecated since 4.2.0 + * @param {Object} options to mutate + * @param {Object} transform to inspect action from + */ + _addEventOptions: function(options, transform) { + // we can probably add more details at low cost + // scale change, rotation changes, translation changes + var eventName, by; + switch (transform.action) { + case 'scaleX': + eventName = 'scaled'; + by = 'x'; + break; + case 'scaleY': + eventName = 'scaled'; + by = 'y'; + break; + case 'skewX': + eventName = 'skewed'; + by = 'x'; + break; + case 'skewY': + eventName = 'skewed'; + by = 'y'; + break; + case 'scale': + eventName = 'scaled'; + by = 'equally'; + break; + case 'rotate': + eventName = 'rotated'; + break; + case 'drag': + eventName = 'moved'; + break; + } + options.by = by; + return eventName; + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onMouseDownInDrawingMode: function(e) { + this._isCurrentlyDrawing = true; + if (this.getActiveObject()) { + this.discardActiveObject(e).requestRenderAll(); + } + var pointer = this.getPointer(e); + this.freeDrawingBrush.onMouseDown(pointer, { e: e, pointer: pointer }); + this._handleEvent(e, 'down'); + }, + + /** + * @private + * @param {Event} e Event object fired on mousemove + */ + _onMouseMoveInDrawingMode: function(e) { + if (this._isCurrentlyDrawing) { + var pointer = this.getPointer(e); + this.freeDrawingBrush.onMouseMove(pointer, { e: e, pointer: pointer }); + } + this.setCursor(this.freeDrawingCursor); + this._handleEvent(e, 'move'); + }, + + /** + * @private + * @param {Event} e Event object fired on mouseup + */ + _onMouseUpInDrawingMode: function(e) { + var pointer = this.getPointer(e); + this._isCurrentlyDrawing = this.freeDrawingBrush.onMouseUp({ e: e, pointer: pointer }); + this._handleEvent(e, 'up'); + }, + + /** + * Method that defines the actions when mouse is clicked on canvas. + * The method inits the currentTransform parameters and renders all the + * canvas so the current image can be placed on the top canvas and the rest + * in on the container one. + * @private + * @param {Event} e Event object fired on mousedown + */ + __onMouseDown: function (e) { + this._cacheTransformEventData(e); + this._handleEvent(e, 'down:before'); + var target = this._target; + // if right click just fire events + if (checkClick(e, RIGHT_CLICK)) { + if (this.fireRightClick) { + this._handleEvent(e, 'down', RIGHT_CLICK); + } + return; + } + + if (checkClick(e, MIDDLE_CLICK)) { + if (this.fireMiddleClick) { + this._handleEvent(e, 'down', MIDDLE_CLICK); + } + return; + } + + if (this.isDrawingMode) { + this._onMouseDownInDrawingMode(e); + return; + } + + if (!this._isMainEvent(e)) { + return; + } + + // ignore if some object is being transformed at this moment + if (this._currentTransform) { + return; + } + + var pointer = this._pointer; + // save pointer for check in __onMouseUp event + this._previousPointer = pointer; + var shouldRender = this._shouldRender(target), + shouldGroup = this._shouldGroup(e, target); + if (this._shouldClearSelection(e, target)) { + this.discardActiveObject(e); + } + else if (shouldGroup) { + this._handleGrouping(e, target); + target = this._activeObject; + } + + if (this.selection && (!target || + (!target.selectable && !target.isEditing && target !== this._activeObject))) { + this._groupSelector = { + ex: pointer.x, + ey: pointer.y, + top: 0, + left: 0 + }; + } + + if (target) { + var alreadySelected = target === this._activeObject; + if (target.selectable) { + this.setActiveObject(target, e); + } + var corner = target._findTargetCorner( + this.getPointer(e, true), + fabric.util.isTouchEvent(e) + ); + target.__corner = corner; + if (target === this._activeObject && (corner || !shouldGroup)) { + var control = target.controls[corner], + mouseDownHandler = control && control.getMouseDownHandler(e, target, control); + if (mouseDownHandler) { + mouseDownHandler(e, target, control); + } + this._setupCurrentTransform(e, target, alreadySelected); + } + } + this._handleEvent(e, 'down'); + // we must renderAll so that we update the visuals + (shouldRender || shouldGroup) && this.requestRenderAll(); + }, + + /** + * reset cache form common information needed during event processing + * @private + */ + _resetTransformEventData: function() { + this._target = null; + this._pointer = null; + this._absolutePointer = null; + }, + + /** + * Cache common information needed during event processing + * @private + * @param {Event} e Event object fired on event + */ + _cacheTransformEventData: function(e) { + // reset in order to avoid stale caching + this._resetTransformEventData(); + this._pointer = this.getPointer(e, true); + this._absolutePointer = this.restorePointerVpt(this._pointer); + this._target = this._currentTransform ? this._currentTransform.target : this.findTarget(e) || null; + }, + + /** + * @private + */ + _beforeTransform: function(e) { + var t = this._currentTransform; + this.stateful && t.target.saveState(); + this.fire('before:transform', { + e: e, + transform: t, + }); + }, + + /** + * Method that defines the actions when mouse is hovering the canvas. + * The currentTransform parameter will define whether the user is rotating/scaling/translating + * an image or neither of them (only hovering). A group selection is also possible and would cancel + * all any other type of action. + * In case of an image transformation only the top canvas will be rendered. + * @private + * @param {Event} e Event object fired on mousemove + */ + __onMouseMove: function (e) { + this._handleEvent(e, 'move:before'); + this._cacheTransformEventData(e); + var target, pointer; + + if (this.isDrawingMode) { + this._onMouseMoveInDrawingMode(e); + return; + } + + if (!this._isMainEvent(e)) { + return; + } + + var groupSelector = this._groupSelector; + + // We initially clicked in an empty area, so we draw a box for multiple selection + if (groupSelector) { + pointer = this._pointer; + + groupSelector.left = pointer.x - groupSelector.ex; + groupSelector.top = pointer.y - groupSelector.ey; + + this.renderTop(); + } + else if (!this._currentTransform) { + target = this.findTarget(e) || null; + this._setCursorFromEvent(e, target); + this._fireOverOutEvents(target, e); + } + else { + this._transformObject(e); + } + this._handleEvent(e, 'move'); + this._resetTransformEventData(); + }, + + /** + * Manage the mouseout, mouseover events for the fabric object on the canvas + * @param {Fabric.Object} target the target where the target from the mousemove event + * @param {Event} e Event object fired on mousemove + * @private + */ + _fireOverOutEvents: function(target, e) { + var _hoveredTarget = this._hoveredTarget, + _hoveredTargets = this._hoveredTargets, targets = this.targets, + length = Math.max(_hoveredTargets.length, targets.length); + + this.fireSyntheticInOutEvents(target, e, { + oldTarget: _hoveredTarget, + evtOut: 'mouseout', + canvasEvtOut: 'mouse:out', + evtIn: 'mouseover', + canvasEvtIn: 'mouse:over', + }); + for (var i = 0; i < length; i++){ + this.fireSyntheticInOutEvents(targets[i], e, { + oldTarget: _hoveredTargets[i], + evtOut: 'mouseout', + evtIn: 'mouseover', + }); + } + this._hoveredTarget = target; + this._hoveredTargets = this.targets.concat(); + }, + + /** + * Manage the dragEnter, dragLeave events for the fabric objects on the canvas + * @param {Fabric.Object} target the target where the target from the onDrag event + * @param {Event} e Event object fired on ondrag + * @private + */ + _fireEnterLeaveEvents: function(target, e) { + var _draggedoverTarget = this._draggedoverTarget, + _hoveredTargets = this._hoveredTargets, targets = this.targets, + length = Math.max(_hoveredTargets.length, targets.length); + + this.fireSyntheticInOutEvents(target, e, { + oldTarget: _draggedoverTarget, + evtOut: 'dragleave', + evtIn: 'dragenter', + }); + for (var i = 0; i < length; i++) { + this.fireSyntheticInOutEvents(targets[i], e, { + oldTarget: _hoveredTargets[i], + evtOut: 'dragleave', + evtIn: 'dragenter', + }); + } + this._draggedoverTarget = target; + }, + + /** + * Manage the synthetic in/out events for the fabric objects on the canvas + * @param {Fabric.Object} target the target where the target from the supported events + * @param {Event} e Event object fired + * @param {Object} config configuration for the function to work + * @param {String} config.targetName property on the canvas where the old target is stored + * @param {String} [config.canvasEvtOut] name of the event to fire at canvas level for out + * @param {String} config.evtOut name of the event to fire for out + * @param {String} [config.canvasEvtIn] name of the event to fire at canvas level for in + * @param {String} config.evtIn name of the event to fire for in + * @private + */ + fireSyntheticInOutEvents: function(target, e, config) { + var inOpt, outOpt, oldTarget = config.oldTarget, outFires, inFires, + targetChanged = oldTarget !== target, canvasEvtIn = config.canvasEvtIn, canvasEvtOut = config.canvasEvtOut; + if (targetChanged) { + inOpt = { e: e, target: target, previousTarget: oldTarget }; + outOpt = { e: e, target: oldTarget, nextTarget: target }; + } + inFires = target && targetChanged; + outFires = oldTarget && targetChanged; + if (outFires) { + canvasEvtOut && this.fire(canvasEvtOut, outOpt); + oldTarget.fire(config.evtOut, outOpt); + } + if (inFires) { + canvasEvtIn && this.fire(canvasEvtIn, inOpt); + target.fire(config.evtIn, inOpt); + } + }, + + /** + * Method that defines actions when an Event Mouse Wheel + * @param {Event} e Event object fired on mouseup + */ + __onMouseWheel: function(e) { + this._cacheTransformEventData(e); + this._handleEvent(e, 'wheel'); + this._resetTransformEventData(); + }, + + /** + * @private + * @param {Event} e Event fired on mousemove + */ + _transformObject: function(e) { + var pointer = this.getPointer(e), + transform = this._currentTransform; + + transform.reset = false; + transform.target.isMoving = true; + transform.shiftKey = e.shiftKey; + transform.altKey = e[this.centeredKey]; + + this._performTransformAction(e, transform, pointer); + transform.actionPerformed && this.requestRenderAll(); + }, + + /** + * @private + */ + _performTransformAction: function(e, transform, pointer) { + var x = pointer.x, + y = pointer.y, + action = transform.action, + actionPerformed = false, + actionHandler = transform.actionHandler; + // this object could be created from the function in the control handlers + + + if (actionHandler) { + actionPerformed = actionHandler(e, transform, x, y); + } + if (action === 'drag' && actionPerformed) { + this.setCursor(transform.target.moveCursor || this.moveCursor); + } + transform.actionPerformed = transform.actionPerformed || actionPerformed; + }, + + /** + * @private + */ + _fire: fabric.controlsUtils.fireEvent, + + /** + * Sets the cursor depending on where the canvas is being hovered. + * Note: very buggy in Opera + * @param {Event} e Event object + * @param {Object} target Object that the mouse is hovering, if so. + */ + _setCursorFromEvent: function (e, target) { + if (!target) { + this.setCursor(this.defaultCursor); + return false; + } + var hoverCursor = target.hoverCursor || this.hoverCursor, + activeSelection = this._activeObject && this._activeObject.type === 'activeSelection' ? + this._activeObject : null, + // only show proper corner when group selection is not active + corner = (!activeSelection || !activeSelection.contains(target)) + // here we call findTargetCorner always with undefined for the touch parameter. + // we assume that if you are using a cursor you do not need to interact with + // the bigger touch area. + && target._findTargetCorner(this.getPointer(e, true)); + + if (!corner) { + if (target.subTargetCheck){ + // hoverCursor should come from top-most subTarget, + // so we walk the array backwards + this.targets.concat().reverse().map(function(_target){ + hoverCursor = _target.hoverCursor || hoverCursor; + }); + } + this.setCursor(hoverCursor); + } + else { + this.setCursor(this.getCornerCursor(corner, target, e)); + } + }, + + /** + * @private + */ + getCornerCursor: function(corner, target, e) { + var control = target.controls[corner]; + return control.cursorStyleHandler(e, control, target); + } + }); +})(); +(function() { + + var min = Math.min, + max = Math.max; + + fabric.util.object.extend(fabric.Canvas.prototype, /** @lends fabric.Canvas.prototype */ { + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + * @return {Boolean} + */ + _shouldGroup: function(e, target) { + var activeObject = this._activeObject; + return activeObject && this._isSelectionKeyPressed(e) && target && target.selectable && this.selection && + (activeObject !== target || activeObject.type === 'activeSelection') && !target.onSelect({ e: e }); + }, + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + */ + _handleGrouping: function (e, target) { + var activeObject = this._activeObject; + // avoid multi select when shift click on a corner + if (activeObject.__corner) { + return; + } + if (target === activeObject) { + // if it's a group, find target again, using activeGroup objects + target = this.findTarget(e, true); + // if even object is not found or we are on activeObjectCorner, bail out + if (!target || !target.selectable) { + return; + } + } + if (activeObject && activeObject.type === 'activeSelection') { + this._updateActiveSelection(target, e); + } + else { + this._createActiveSelection(target, e); + } + }, + + /** + * @private + */ + _updateActiveSelection: function(target, e) { + var activeSelection = this._activeObject, + currentActiveObjects = activeSelection._objects.slice(0); + if (activeSelection.contains(target)) { + activeSelection.removeWithUpdate(target); + this._hoveredTarget = target; + this._hoveredTargets = this.targets.concat(); + if (activeSelection.size() === 1) { + // activate last remaining object + this._setActiveObject(activeSelection.item(0), e); + } + } + else { + activeSelection.addWithUpdate(target); + this._hoveredTarget = activeSelection; + this._hoveredTargets = this.targets.concat(); + } + this._fireSelectionEvents(currentActiveObjects, e); + }, + + /** + * @private + */ + _createActiveSelection: function(target, e) { + var currentActives = this.getActiveObjects(), group = this._createGroup(target); + this._hoveredTarget = group; + // ISSUE 4115: should we consider subTargets here? + // this._hoveredTargets = []; + // this._hoveredTargets = this.targets.concat(); + this._setActiveObject(group, e); + this._fireSelectionEvents(currentActives, e); + }, + + /** + * @private + * @param {Object} target + */ + _createGroup: function(target) { + var objects = this._objects, + isActiveLower = objects.indexOf(this._activeObject) < objects.indexOf(target), + groupObjects = isActiveLower + ? [this._activeObject, target] + : [target, this._activeObject]; + this._activeObject.isEditing && this._activeObject.exitEditing(); + return new fabric.ActiveSelection(groupObjects, { + canvas: this + }); + }, + + /** + * @private + * @param {Event} e mouse event + */ + _groupSelectedObjects: function (e) { + + var group = this._collectObjects(e), + aGroup; + + // do not create group for 1 element only + if (group.length === 1) { + this.setActiveObject(group[0], e); + } + else if (group.length > 1) { + aGroup = new fabric.ActiveSelection(group.reverse(), { + canvas: this + }); + this.setActiveObject(aGroup, e); + } + }, + + /** + * @private + */ + _collectObjects: function(e) { + var group = [], + currentObject, + x1 = this._groupSelector.ex, + y1 = this._groupSelector.ey, + x2 = x1 + this._groupSelector.left, + y2 = y1 + this._groupSelector.top, + selectionX1Y1 = new fabric.Point(min(x1, x2), min(y1, y2)), + selectionX2Y2 = new fabric.Point(max(x1, x2), max(y1, y2)), + allowIntersect = !this.selectionFullyContained, + isClick = x1 === x2 && y1 === y2; + // we iterate reverse order to collect top first in case of click. + for (var i = this._objects.length; i--; ) { + currentObject = this._objects[i]; + + if (!currentObject || !currentObject.selectable || !currentObject.visible) { + continue; + } + + if ((allowIntersect && currentObject.intersectsWithRect(selectionX1Y1, selectionX2Y2)) || + currentObject.isContainedWithinRect(selectionX1Y1, selectionX2Y2) || + (allowIntersect && currentObject.containsPoint(selectionX1Y1)) || + (allowIntersect && currentObject.containsPoint(selectionX2Y2)) + ) { + group.push(currentObject); + // only add one object if it's a click + if (isClick) { + break; + } + } + } + + if (group.length > 1) { + group = group.filter(function(object) { + return !object.onSelect({ e: e }); + }); + } + + return group; + }, + + /** + * @private + */ + _maybeGroupObjects: function(e) { + if (this.selection && this._groupSelector) { + this._groupSelectedObjects(e); + } + this.setCursor(this.defaultCursor); + // clear selection and current transformation + this._groupSelector = null; + } + }); + +})(); +(function () { + fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Exports canvas element to a dataurl image. Note that when multiplier is used, cropping is scaled appropriately + * @param {Object} [options] Options object + * @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png" + * @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg. + * @param {Number} [options.multiplier=1] Multiplier to scale by, to have consistent + * @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14 + * @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14 + * @param {Number} [options.width] Cropping width. Introduced in v1.2.14 + * @param {Number} [options.height] Cropping height. Introduced in v1.2.14 + * @param {Boolean} [options.enableRetinaScaling] Enable retina scaling for clone image. Introduce in 2.0.0 + * @return {String} Returns a data: URL containing a representation of the object in the format specified by options.format + * @see {@link http://jsfiddle.net/fabricjs/NfZVb/|jsFiddle demo} + * @example Generate jpeg dataURL with lower quality + * var dataURL = canvas.toDataURL({ + * format: 'jpeg', + * quality: 0.8 + * }); + * @example Generate cropped png dataURL (clipping of canvas) + * var dataURL = canvas.toDataURL({ + * format: 'png', + * left: 100, + * top: 100, + * width: 200, + * height: 200 + * }); + * @example Generate double scaled png dataURL + * var dataURL = canvas.toDataURL({ + * format: 'png', + * multiplier: 2 + * }); + */ + toDataURL: function (options) { + options || (options = { }); + + var format = options.format || 'png', + quality = options.quality || 1, + multiplier = (options.multiplier || 1) * (options.enableRetinaScaling ? this.getRetinaScaling() : 1), + canvasEl = this.toCanvasElement(multiplier, options); + return fabric.util.toDataURL(canvasEl, format, quality); + }, + + /** + * Create a new HTMLCanvas element painted with the current canvas content. + * No need to resize the actual one or repaint it. + * Will transfer object ownership to a new canvas, paint it, and set everything back. + * This is an intermediary step used to get to a dataUrl but also it is useful to + * create quick image copies of a canvas without passing for the dataUrl string + * @param {Number} [multiplier] a zoom factor. + * @param {Object} [cropping] Cropping informations + * @param {Number} [cropping.left] Cropping left offset. + * @param {Number} [cropping.top] Cropping top offset. + * @param {Number} [cropping.width] Cropping width. + * @param {Number} [cropping.height] Cropping height. + */ + toCanvasElement: function(multiplier, cropping) { + multiplier = multiplier || 1; + cropping = cropping || { }; + var scaledWidth = (cropping.width || this.width) * multiplier, + scaledHeight = (cropping.height || this.height) * multiplier, + zoom = this.getZoom(), + originalWidth = this.width, + originalHeight = this.height, + newZoom = zoom * multiplier, + vp = this.viewportTransform, + translateX = (vp[4] - (cropping.left || 0)) * multiplier, + translateY = (vp[5] - (cropping.top || 0)) * multiplier, + originalInteractive = this.interactive, + newVp = [newZoom, 0, 0, newZoom, translateX, translateY], + originalRetina = this.enableRetinaScaling, + canvasEl = fabric.util.createCanvasElement(), + originalContextTop = this.contextTop; + canvasEl.width = scaledWidth; + canvasEl.height = scaledHeight; + this.contextTop = null; + this.enableRetinaScaling = false; + this.interactive = false; + this.viewportTransform = newVp; + this.width = scaledWidth; + this.height = scaledHeight; + this.calcViewportBoundaries(); + this.renderCanvas(canvasEl.getContext('2d'), this._objects); + this.viewportTransform = vp; + this.width = originalWidth; + this.height = originalHeight; + this.calcViewportBoundaries(); + this.interactive = originalInteractive; + this.enableRetinaScaling = originalRetina; + this.contextTop = originalContextTop; + return canvasEl; + }, + }); + +})(); +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + /** + * Populates canvas with data from the specified JSON. + * JSON format must conform to the one of {@link fabric.Canvas#toJSON} + * @param {String|Object} json JSON string or object + * @param {Function} callback Callback, invoked when json is parsed + * and corresponding objects (e.g: {@link fabric.Image}) + * are initialized + * @param {Function} [reviver] Method for further parsing of JSON elements, called after each fabric object created. + * @return {fabric.Canvas} instance + * @chainable + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#deserialization} + * @see {@link http://jsfiddle.net/fabricjs/fmgXt/|jsFiddle demo} + * @example loadFromJSON + * canvas.loadFromJSON(json, canvas.renderAll.bind(canvas)); + * @example loadFromJSON with reviver + * canvas.loadFromJSON(json, canvas.renderAll.bind(canvas), function(o, object) { + * // `o` = json object + * // `object` = fabric.Object instance + * // ... do some stuff ... + * }); + */ + loadFromJSON: function (json, callback, reviver) { + if (!json) { + return; + } + + // serialize if it wasn't already + var serialized = (typeof json === 'string') + ? JSON.parse(json) + : fabric.util.object.clone(json); + + var _this = this, + clipPath = serialized.clipPath, + renderOnAddRemove = this.renderOnAddRemove; + + this.renderOnAddRemove = false; + + delete serialized.clipPath; + + this._enlivenObjects(serialized.objects, function (enlivenedObjects) { + _this.clear(); + _this._setBgOverlay(serialized, function () { + if (clipPath) { + _this._enlivenObjects([clipPath], function (enlivenedCanvasClip) { + _this.clipPath = enlivenedCanvasClip[0]; + _this.__setupCanvas.call(_this, serialized, enlivenedObjects, renderOnAddRemove, callback); + }); + } + else { + _this.__setupCanvas.call(_this, serialized, enlivenedObjects, renderOnAddRemove, callback); + } + }); + }, reviver); + return this; + }, + + /** + * @private + * @param {Object} serialized Object with background and overlay information + * @param {Array} restored canvas objects + * @param {Function} cached renderOnAddRemove callback + * @param {Function} callback Invoked after all background and overlay images/patterns loaded + */ + __setupCanvas: function(serialized, enlivenedObjects, renderOnAddRemove, callback) { + var _this = this; + enlivenedObjects.forEach(function(obj, index) { + // we splice the array just in case some custom classes restored from JSON + // will add more object to canvas at canvas init. + _this.insertAt(obj, index); + }); + this.renderOnAddRemove = renderOnAddRemove; + // remove parts i cannot set as options + delete serialized.objects; + delete serialized.backgroundImage; + delete serialized.overlayImage; + delete serialized.background; + delete serialized.overlay; + // this._initOptions does too many things to just + // call it. Normally loading an Object from JSON + // create the Object instance. Here the Canvas is + // already an instance and we are just loading things over it + this._setOptions(serialized); + this.renderAll(); + callback && callback(); + }, + + /** + * @private + * @param {Object} serialized Object with background and overlay information + * @param {Function} callback Invoked after all background and overlay images/patterns loaded + */ + _setBgOverlay: function(serialized, callback) { + var loaded = { + backgroundColor: false, + overlayColor: false, + backgroundImage: false, + overlayImage: false + }; + + if (!serialized.backgroundImage && !serialized.overlayImage && !serialized.background && !serialized.overlay) { + callback && callback(); + return; + } + + var cbIfLoaded = function () { + if (loaded.backgroundImage && loaded.overlayImage && loaded.backgroundColor && loaded.overlayColor) { + callback && callback(); + } + }; + + this.__setBgOverlay('backgroundImage', serialized.backgroundImage, loaded, cbIfLoaded); + this.__setBgOverlay('overlayImage', serialized.overlayImage, loaded, cbIfLoaded); + this.__setBgOverlay('backgroundColor', serialized.background, loaded, cbIfLoaded); + this.__setBgOverlay('overlayColor', serialized.overlay, loaded, cbIfLoaded); + }, + + /** + * @private + * @param {String} property Property to set (backgroundImage, overlayImage, backgroundColor, overlayColor) + * @param {(Object|String)} value Value to set + * @param {Object} loaded Set loaded property to true if property is set + * @param {Object} callback Callback function to invoke after property is set + */ + __setBgOverlay: function(property, value, loaded, callback) { + var _this = this; + + if (!value) { + loaded[property] = true; + callback && callback(); + return; + } + + if (property === 'backgroundImage' || property === 'overlayImage') { + fabric.util.enlivenObjects([value], function(enlivedObject){ + _this[property] = enlivedObject[0]; + loaded[property] = true; + callback && callback(); + }); + } + else { + this['set' + fabric.util.string.capitalize(property, true)](value, function() { + loaded[property] = true; + callback && callback(); + }); + } + }, + + /** + * @private + * @param {Array} objects + * @param {Function} callback + * @param {Function} [reviver] + */ + _enlivenObjects: function (objects, callback, reviver) { + if (!objects || objects.length === 0) { + callback && callback([]); + return; + } + + fabric.util.enlivenObjects(objects, function(enlivenedObjects) { + callback && callback(enlivenedObjects); + }, null, reviver); + }, + + /** + * @private + * @param {String} format + * @param {Function} callback + */ + _toDataURL: function (format, callback) { + this.clone(function (clone) { + callback(clone.toDataURL(format)); + }); + }, + + /** + * @private + * @param {String} format + * @param {Number} multiplier + * @param {Function} callback + */ + _toDataURLWithMultiplier: function (format, multiplier, callback) { + this.clone(function (clone) { + callback(clone.toDataURLWithMultiplier(format, multiplier)); + }); + }, + + /** + * Clones canvas instance + * @param {Object} [callback] Receives cloned instance as a first argument + * @param {Array} [properties] Array of properties to include in the cloned canvas and children + */ + clone: function (callback, properties) { + var data = JSON.stringify(this.toJSON(properties)); + this.cloneWithoutData(function(clone) { + clone.loadFromJSON(data, function() { + callback && callback(clone); + }); + }); + }, + + /** + * Clones canvas instance without cloning existing data. + * This essentially copies canvas dimensions, clipping properties, etc. + * but leaves data empty (so that you can populate it with your own) + * @param {Object} [callback] Receives cloned instance as a first argument + */ + cloneWithoutData: function(callback) { + var el = fabric.util.createCanvasElement(); + + el.width = this.width; + el.height = this.height; + + var clone = new fabric.Canvas(el); + if (this.backgroundImage) { + clone.setBackgroundImage(this.backgroundImage.src, function() { + clone.renderAll(); + callback && callback(clone); + }); + clone.backgroundImageOpacity = this.backgroundImageOpacity; + clone.backgroundImageStretch = this.backgroundImageStretch; + } + else { + callback && callback(clone); + } + } +}); +/** + * Adds support for multi-touch gestures using the Event.js library. + * Fires the following custom events: + * - touch:gesture + * - touch:drag + * - touch:orientation + * - touch:shake + * - touch:longpress + */ +(function() { + + var degreesToRadians = fabric.util.degreesToRadians, + radiansToDegrees = fabric.util.radiansToDegrees; + + fabric.util.object.extend(fabric.Canvas.prototype, /** @lends fabric.Canvas.prototype */ { + /** + * Method that defines actions when an Event.js gesture is detected on an object. Currently only supports + * 2 finger gestures. + * @param {Event} e Event object by Event.js + * @param {Event} self Event proxy object by Event.js + */ + __onTransformGesture: function(e, self) { + + if (this.isDrawingMode || !e.touches || e.touches.length !== 2 || 'gesture' !== self.gesture) { + return; + } + + var target = this.findTarget(e); + if ('undefined' !== typeof target) { + this.__gesturesParams = { + e: e, + self: self, + target: target + }; + + this.__gesturesRenderer(); + } + + this.fire('touch:gesture', { + target: target, e: e, self: self + }); + }, + __gesturesParams: null, + __gesturesRenderer: function() { + + if (this.__gesturesParams === null || this._currentTransform === null) { + return; + } + + var self = this.__gesturesParams.self, + t = this._currentTransform, + e = this.__gesturesParams.e; + + t.action = 'scale'; + t.originX = t.originY = 'center'; + + this._scaleObjectBy(self.scale, e); + + if (self.rotation !== 0) { + t.action = 'rotate'; + this._rotateObjectByAngle(self.rotation, e); + } + + this.requestRenderAll(); + + t.action = 'drag'; + }, + + /** + * Method that defines actions when an Event.js drag is detected. + * + * @param {Event} e Event object by Event.js + * @param {Event} self Event proxy object by Event.js + */ + __onDrag: function(e, self) { + this.fire('touch:drag', { + e: e, self: self + }); + }, + + /** + * Method that defines actions when an Event.js orientation event is detected. + * + * @param {Event} e Event object by Event.js + * @param {Event} self Event proxy object by Event.js + */ + __onOrientationChange: function(e, self) { + this.fire('touch:orientation', { + e: e, self: self + }); + }, + + /** + * Method that defines actions when an Event.js shake event is detected. + * + * @param {Event} e Event object by Event.js + * @param {Event} self Event proxy object by Event.js + */ + __onShake: function(e, self) { + this.fire('touch:shake', { + e: e, self: self + }); + }, + + /** + * Method that defines actions when an Event.js longpress event is detected. + * + * @param {Event} e Event object by Event.js + * @param {Event} self Event proxy object by Event.js + */ + __onLongPress: function(e, self) { + this.fire('touch:longpress', { + e: e, self: self + }); + }, + + /** + * Scales an object by a factor + * @param {Number} s The scale factor to apply to the current scale level + * @param {Event} e Event object by Event.js + */ + _scaleObjectBy: function(s, e) { + var t = this._currentTransform, + target = t.target; + t.gestureScale = s; + target._scaling = true; + return fabric.controlsUtils.scalingEqually(e, t, 0, 0); + }, + + /** + * Rotates object by an angle + * @param {Number} curAngle The angle of rotation in degrees + * @param {Event} e Event object by Event.js + */ + _rotateObjectByAngle: function(curAngle, e) { + var t = this._currentTransform; + + if (t.target.get('lockRotation')) { + return; + } + t.target.rotate(radiansToDegrees(degreesToRadians(curAngle) + t.theta)); + this._fire('rotating', { + target: t.target, + e: e, + transform: t, + }); + } + }); +})(); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + clone = fabric.util.object.clone, + toFixed = fabric.util.toFixed, + capitalize = fabric.util.string.capitalize, + degreesToRadians = fabric.util.degreesToRadians, + supportsLineDash = fabric.StaticCanvas.supports('setLineDash'), + objectCaching = !fabric.isLikelyNode, + ALIASING_LIMIT = 2; + + if (fabric.Object) { + return; + } + + /** + * Root object class from which all 2d shape classes inherit from + * @class fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1#objects} + * @see {@link fabric.Object#initialize} for constructor definition + * + * @fires added + * @fires removed + * + * @fires selected + * @fires deselected + * @fires modified + * @fires modified + * @fires moved + * @fires scaled + * @fires rotated + * @fires skewed + * + * @fires rotating + * @fires scaling + * @fires moving + * @fires skewing + * + * @fires mousedown + * @fires mouseup + * @fires mouseover + * @fires mouseout + * @fires mousewheel + * @fires mousedblclick + * + * @fires dragover + * @fires dragenter + * @fires dragleave + * @fires drop + */ + fabric.Object = fabric.util.createClass(fabric.CommonMethods, /** @lends fabric.Object.prototype */ { + + /** + * Type of an object (rect, circle, path, etc.). + * Note that this property is meant to be read-only and not meant to be modified. + * If you modify, certain parts of Fabric (such as JSON loading) won't work correctly. + * @type String + * @default + */ + type: 'object', + + /** + * Horizontal origin of transformation of an object (one of "left", "right", "center") + * See http://jsfiddle.net/1ow02gea/244/ on how originX/originY affect objects in groups + * @type String + * @default + */ + originX: 'left', + + /** + * Vertical origin of transformation of an object (one of "top", "bottom", "center") + * See http://jsfiddle.net/1ow02gea/244/ on how originX/originY affect objects in groups + * @type String + * @default + */ + originY: 'top', + + /** + * Top position of an object. Note that by default it's relative to object top. You can change this by setting originY={top/center/bottom} + * @type Number + * @default + */ + top: 0, + + /** + * Left position of an object. Note that by default it's relative to object left. You can change this by setting originX={left/center/right} + * @type Number + * @default + */ + left: 0, + + /** + * Object width + * @type Number + * @default + */ + width: 0, + + /** + * Object height + * @type Number + * @default + */ + height: 0, + + /** + * Object scale factor (horizontal) + * @type Number + * @default + */ + scaleX: 1, + + /** + * Object scale factor (vertical) + * @type Number + * @default + */ + scaleY: 1, + + /** + * When true, an object is rendered as flipped horizontally + * @type Boolean + * @default + */ + flipX: false, + + /** + * When true, an object is rendered as flipped vertically + * @type Boolean + * @default + */ + flipY: false, + + /** + * Opacity of an object + * @type Number + * @default + */ + opacity: 1, + + /** + * Angle of rotation of an object (in degrees) + * @type Number + * @default + */ + angle: 0, + + /** + * Angle of skew on x axes of an object (in degrees) + * @type Number + * @default + */ + skewX: 0, + + /** + * Angle of skew on y axes of an object (in degrees) + * @type Number + * @default + */ + skewY: 0, + + /** + * Size of object's controlling corners (in pixels) + * @type Number + * @default + */ + cornerSize: 13, + + /** + * Size of object's controlling corners when touch interaction is detected + * @type Number + * @default + */ + touchCornerSize: 24, + + /** + * When true, object's controlling corners are rendered as transparent inside (i.e. stroke instead of fill) + * @type Boolean + * @default + */ + transparentCorners: true, + + /** + * Default cursor value used when hovering over this object on canvas + * @type String + * @default + */ + hoverCursor: null, + + /** + * Default cursor value used when moving this object on canvas + * @type String + * @default + */ + moveCursor: null, + + /** + * Padding between object and its controlling borders (in pixels) + * @type Number + * @default + */ + padding: 0, + + /** + * Color of controlling borders of an object (when it's active) + * @type String + * @default + */ + borderColor: 'rgb(178,204,255)', + + /** + * Array specifying dash pattern of an object's borders (hasBorder must be true) + * @since 1.6.2 + * @type Array + */ + borderDashArray: null, + + /** + * Color of controlling corners of an object (when it's active) + * @type String + * @default + */ + cornerColor: 'rgb(178,204,255)', + + /** + * Color of controlling corners of an object (when it's active and transparentCorners false) + * @since 1.6.2 + * @type String + * @default + */ + cornerStrokeColor: null, + + /** + * Specify style of control, 'rect' or 'circle' + * @since 1.6.2 + * @type String + */ + cornerStyle: 'rect', + + /** + * Array specifying dash pattern of an object's control (hasBorder must be true) + * @since 1.6.2 + * @type Array + */ + cornerDashArray: null, + + /** + * When true, this object will use center point as the origin of transformation + * when being scaled via the controls. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredScaling: false, + + /** + * When true, this object will use center point as the origin of transformation + * when being rotated via the controls. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredRotation: true, + + /** + * Color of object's fill + * takes css colors https://www.w3.org/TR/css-color-3/ + * @type String + * @default + */ + fill: 'rgb(0,0,0)', + + /** + * Fill rule used to fill an object + * accepted values are nonzero, evenodd + * Backwards incompatibility note: This property was used for setting globalCompositeOperation until v1.4.12 (use `fabric.Object#globalCompositeOperation` instead) + * @type String + * @default + */ + fillRule: 'nonzero', + + /** + * Composite rule used for canvas globalCompositeOperation + * @type String + * @default + */ + globalCompositeOperation: 'source-over', + + /** + * Background color of an object. + * takes css colors https://www.w3.org/TR/css-color-3/ + * @type String + * @default + */ + backgroundColor: '', + + /** + * Selection Background color of an object. colored layer behind the object when it is active. + * does not mix good with globalCompositeOperation methods. + * @type String + * @default + */ + selectionBackgroundColor: '', + + /** + * When defined, an object is rendered via stroke and this property specifies its color + * takes css colors https://www.w3.org/TR/css-color-3/ + * @type String + * @default + */ + stroke: null, + + /** + * Width of a stroke used to render this object + * @type Number + * @default + */ + strokeWidth: 1, + + /** + * Array specifying dash pattern of an object's stroke (stroke must be defined) + * @type Array + */ + strokeDashArray: null, + + /** + * Line offset of an object's stroke + * @type Number + * @default + */ + strokeDashOffset: 0, + + /** + * Line endings style of an object's stroke (one of "butt", "round", "square") + * @type String + * @default + */ + strokeLineCap: 'butt', + + /** + * Corner style of an object's stroke (one of "bevil", "round", "miter") + * @type String + * @default + */ + strokeLineJoin: 'miter', + + /** + * Maximum miter length (used for strokeLineJoin = "miter") of an object's stroke + * @type Number + * @default + */ + strokeMiterLimit: 4, + + /** + * Shadow object representing shadow of this shape + * @type fabric.Shadow + * @default + */ + shadow: null, + + /** + * Opacity of object's controlling borders when object is active and moving + * @type Number + * @default + */ + borderOpacityWhenMoving: 0.4, + + /** + * Scale factor of object's controlling borders + * bigger number will make a thicker border + * border is 1, so this is basically a border tickness + * since there is no way to change the border itself. + * @type Number + * @default + */ + borderScaleFactor: 1, + + /** + * Minimum allowed scale value of an object + * @type Number + * @default + */ + minScaleLimit: 0, + + /** + * When set to `false`, an object can not be selected for modification (using either point-click-based or group-based selection). + * But events still fire on it. + * @type Boolean + * @default + */ + selectable: true, + + /** + * When set to `false`, an object can not be a target of events. All events propagate through it. Introduced in v1.3.4 + * @type Boolean + * @default + */ + evented: true, + + /** + * When set to `false`, an object is not rendered on canvas + * @type Boolean + * @default + */ + visible: true, + + /** + * When set to `false`, object's controls are not displayed and can not be used to manipulate object + * @type Boolean + * @default + */ + hasControls: true, + + /** + * When set to `false`, object's controlling borders are not rendered + * @type Boolean + * @default + */ + hasBorders: true, + + /** + * When set to `true`, objects are "found" on canvas on per-pixel basis rather than according to bounding box + * @type Boolean + * @default + */ + perPixelTargetFind: false, + + /** + * When `false`, default object's values are not included in its serialization + * @type Boolean + * @default + */ + includeDefaultValues: true, + + /** + * When `true`, object horizontal movement is locked + * @type Boolean + * @default + */ + lockMovementX: false, + + /** + * When `true`, object vertical movement is locked + * @type Boolean + * @default + */ + lockMovementY: false, + + /** + * When `true`, object rotation is locked + * @type Boolean + * @default + */ + lockRotation: false, + + /** + * When `true`, object horizontal scaling is locked + * @type Boolean + * @default + */ + lockScalingX: false, + + /** + * When `true`, object vertical scaling is locked + * @type Boolean + * @default + */ + lockScalingY: false, + + /** + * When `true`, object horizontal skewing is locked + * @type Boolean + * @default + */ + lockSkewingX: false, + + /** + * When `true`, object vertical skewing is locked + * @type Boolean + * @default + */ + lockSkewingY: false, + + /** + * When `true`, object cannot be flipped by scaling into negative values + * @type Boolean + * @default + */ + lockScalingFlip: false, + + /** + * When `true`, object is not exported in OBJECT/JSON + * @since 1.6.3 + * @type Boolean + * @default + */ + excludeFromExport: false, + + /** + * When `true`, object is cached on an additional canvas. + * When `false`, object is not cached unless necessary ( clipPath ) + * default to true + * @since 1.7.0 + * @type Boolean + * @default true + */ + objectCaching: objectCaching, + + /** + * When `true`, object properties are checked for cache invalidation. In some particular + * situation you may want this to be disabled ( spray brush, very big, groups) + * or if your application does not allow you to modify properties for groups child you want + * to disable it for groups. + * default to false + * since 1.7.0 + * @type Boolean + * @default false + */ + statefullCache: false, + + /** + * When `true`, cache does not get updated during scaling. The picture will get blocky if scaled + * too much and will be redrawn with correct details at the end of scaling. + * this setting is performance and application dependant. + * default to true + * since 1.7.0 + * @type Boolean + * @default true + */ + noScaleCache: true, + + /** + * When `false`, the stoke width will scale with the object. + * When `true`, the stroke will always match the exact pixel size entered for stroke width. + * default to false + * @since 2.6.0 + * @type Boolean + * @default false + * @type Boolean + * @default false + */ + strokeUniform: false, + + /** + * When set to `true`, object's cache will be rerendered next render call. + * since 1.7.0 + * @type Boolean + * @default true + */ + dirty: true, + + /** + * keeps the value of the last hovered corner during mouse move. + * 0 is no corner, or 'mt', 'ml', 'mtr' etc.. + * It should be private, but there is no harm in using it as + * a read-only property. + * @type number|string|any + * @default 0 + */ + __corner: 0, + + /** + * Determines if the fill or the stroke is drawn first (one of "fill" or "stroke") + * @type String + * @default + */ + paintFirst: 'fill', + + /** + * List of properties to consider when checking if state + * of an object is changed (fabric.Object#hasStateChanged) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: ( + 'top left width height scaleX scaleY flipX flipY originX originY transformMatrix ' + + 'stroke strokeWidth strokeDashArray strokeLineCap strokeDashOffset strokeLineJoin strokeMiterLimit ' + + 'angle opacity fill globalCompositeOperation shadow visible backgroundColor ' + + 'skewX skewY fillRule paintFirst clipPath strokeUniform' + ).split(' '), + + /** + * List of properties to consider when checking if cache needs refresh + * Those properties are checked by statefullCache ON ( or lazy mode if we want ) or from single + * calls to Object.set(key, value). If the key is in this list, the object is marked as dirty + * and refreshed at the next render + * @type Array + */ + cacheProperties: ( + 'fill stroke strokeWidth strokeDashArray width height paintFirst strokeUniform' + + ' strokeLineCap strokeDashOffset strokeLineJoin strokeMiterLimit backgroundColor clipPath' + ).split(' '), + + /** + * List of properties to consider for animating colors. + * @type Array + */ + colorProperties: ( + 'fill stroke backgroundColor' + ).split(' '), + + /** + * a fabricObject that, without stroke define a clipping area with their shape. filled in black + * the clipPath object gets used when the object has rendered, and the context is placed in the center + * of the object cacheCanvas. + * If you want 0,0 of a clipPath to align with an object center, use clipPath.originX/Y to 'center' + * @type fabric.Object + */ + clipPath: undefined, + + /** + * Meaningful ONLY when the object is used as clipPath. + * if true, the clipPath will make the object clip to the outside of the clipPath + * since 2.4.0 + * @type boolean + * @default false + */ + inverted: false, + + /** + * Meaningful ONLY when the object is used as clipPath. + * if true, the clipPath will have its top and left relative to canvas, and will + * not be influenced by the object transform. This will make the clipPath relative + * to the canvas, but clipping just a particular object. + * WARNING this is beta, this feature may change or be renamed. + * since 2.4.0 + * @type boolean + * @default false + */ + absolutePositioned: false, + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + if (options) { + this.setOptions(options); + } + }, + + /** + * Create a the canvas used to keep the cached copy of the object + * @private + */ + _createCacheCanvas: function() { + this._cacheProperties = {}; + this._cacheCanvas = fabric.util.createCanvasElement(); + this._cacheContext = this._cacheCanvas.getContext('2d'); + this._updateCacheCanvas(); + // if canvas gets created, is empty, so dirty. + this.dirty = true; + }, + + /** + * Limit the cache dimensions so that X * Y do not cross fabric.perfLimitSizeTotal + * and each side do not cross fabric.cacheSideLimit + * those numbers are configurable so that you can get as much detail as you want + * making bargain with performances. + * @param {Object} dims + * @param {Object} dims.width width of canvas + * @param {Object} dims.height height of canvas + * @param {Object} dims.zoomX zoomX zoom value to unscale the canvas before drawing cache + * @param {Object} dims.zoomY zoomY zoom value to unscale the canvas before drawing cache + * @return {Object}.width width of canvas + * @return {Object}.height height of canvas + * @return {Object}.zoomX zoomX zoom value to unscale the canvas before drawing cache + * @return {Object}.zoomY zoomY zoom value to unscale the canvas before drawing cache + */ + _limitCacheSize: function(dims) { + var perfLimitSizeTotal = fabric.perfLimitSizeTotal, + width = dims.width, height = dims.height, + max = fabric.maxCacheSideLimit, min = fabric.minCacheSideLimit; + if (width <= max && height <= max && width * height <= perfLimitSizeTotal) { + if (width < min) { + dims.width = min; + } + if (height < min) { + dims.height = min; + } + return dims; + } + var ar = width / height, limitedDims = fabric.util.limitDimsByArea(ar, perfLimitSizeTotal), + capValue = fabric.util.capValue, + x = capValue(min, limitedDims.x, max), + y = capValue(min, limitedDims.y, max); + if (width > x) { + dims.zoomX /= width / x; + dims.width = x; + dims.capped = true; + } + if (height > y) { + dims.zoomY /= height / y; + dims.height = y; + dims.capped = true; + } + return dims; + }, + + /** + * Return the dimension and the zoom level needed to create a cache canvas + * big enough to host the object to be cached. + * @private + * @return {Object}.x width of object to be cached + * @return {Object}.y height of object to be cached + * @return {Object}.width width of canvas + * @return {Object}.height height of canvas + * @return {Object}.zoomX zoomX zoom value to unscale the canvas before drawing cache + * @return {Object}.zoomY zoomY zoom value to unscale the canvas before drawing cache + */ + _getCacheCanvasDimensions: function() { + var objectScale = this.getTotalObjectScaling(), + // caculate dimensions without skewing + dim = this._getTransformedDimensions(0, 0), + neededX = dim.x * objectScale.scaleX / this.scaleX, + neededY = dim.y * objectScale.scaleY / this.scaleY; + return { + // for sure this ALIASING_LIMIT is slightly creating problem + // in situation in which the cache canvas gets an upper limit + // also objectScale contains already scaleX and scaleY + width: neededX + ALIASING_LIMIT, + height: neededY + ALIASING_LIMIT, + zoomX: objectScale.scaleX, + zoomY: objectScale.scaleY, + x: neededX, + y: neededY + }; + }, + + /** + * Update width and height of the canvas for cache + * returns true or false if canvas needed resize. + * @private + * @return {Boolean} true if the canvas has been resized + */ + _updateCacheCanvas: function() { + var targetCanvas = this.canvas; + if (this.noScaleCache && targetCanvas && targetCanvas._currentTransform) { + var target = targetCanvas._currentTransform.target, + action = targetCanvas._currentTransform.action; + if (this === target && action.slice && action.slice(0, 5) === 'scale') { + return false; + } + } + var canvas = this._cacheCanvas, + dims = this._limitCacheSize(this._getCacheCanvasDimensions()), + minCacheSize = fabric.minCacheSideLimit, + width = dims.width, height = dims.height, drawingWidth, drawingHeight, + zoomX = dims.zoomX, zoomY = dims.zoomY, + dimensionsChanged = width !== this.cacheWidth || height !== this.cacheHeight, + zoomChanged = this.zoomX !== zoomX || this.zoomY !== zoomY, + shouldRedraw = dimensionsChanged || zoomChanged, + additionalWidth = 0, additionalHeight = 0, shouldResizeCanvas = false; + if (dimensionsChanged) { + var canvasWidth = this._cacheCanvas.width, + canvasHeight = this._cacheCanvas.height, + sizeGrowing = width > canvasWidth || height > canvasHeight, + sizeShrinking = (width < canvasWidth * 0.9 || height < canvasHeight * 0.9) && + canvasWidth > minCacheSize && canvasHeight > minCacheSize; + shouldResizeCanvas = sizeGrowing || sizeShrinking; + if (sizeGrowing && !dims.capped && (width > minCacheSize || height > minCacheSize)) { + additionalWidth = width * 0.1; + additionalHeight = height * 0.1; + } + } + if (shouldRedraw) { + if (shouldResizeCanvas) { + canvas.width = Math.ceil(width + additionalWidth); + canvas.height = Math.ceil(height + additionalHeight); + } + else { + this._cacheContext.setTransform(1, 0, 0, 1, 0, 0); + this._cacheContext.clearRect(0, 0, canvas.width, canvas.height); + } + drawingWidth = dims.x / 2; + drawingHeight = dims.y / 2; + this.cacheTranslationX = Math.round(canvas.width / 2 - drawingWidth) + drawingWidth; + this.cacheTranslationY = Math.round(canvas.height / 2 - drawingHeight) + drawingHeight; + this.cacheWidth = width; + this.cacheHeight = height; + this._cacheContext.translate(this.cacheTranslationX, this.cacheTranslationY); + this._cacheContext.scale(zoomX, zoomY); + this.zoomX = zoomX; + this.zoomY = zoomY; + return true; + } + return false; + }, + + /** + * Sets object's properties from options + * @param {Object} [options] Options object + */ + setOptions: function(options) { + this._setOptions(options); + this._initGradient(options.fill, 'fill'); + this._initGradient(options.stroke, 'stroke'); + this._initPattern(options.fill, 'fill'); + this._initPattern(options.stroke, 'stroke'); + }, + + /** + * Transforms context when rendering an object + * @param {CanvasRenderingContext2D} ctx Context + */ + transform: function(ctx) { + var needFullTransform = (this.group && !this.group._transformDone) || + (this.group && this.canvas && ctx === this.canvas.contextTop); + var m = this.calcTransformMatrix(!needFullTransform); + ctx.transform(m[0], m[1], m[2], m[3], m[4], m[5]); + }, + + /** + * Returns an object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, + + object = { + type: this.type, + version: fabric.version, + originX: this.originX, + originY: this.originY, + left: toFixed(this.left, NUM_FRACTION_DIGITS), + top: toFixed(this.top, NUM_FRACTION_DIGITS), + width: toFixed(this.width, NUM_FRACTION_DIGITS), + height: toFixed(this.height, NUM_FRACTION_DIGITS), + fill: (this.fill && this.fill.toObject) ? this.fill.toObject() : this.fill, + stroke: (this.stroke && this.stroke.toObject) ? this.stroke.toObject() : this.stroke, + strokeWidth: toFixed(this.strokeWidth, NUM_FRACTION_DIGITS), + strokeDashArray: this.strokeDashArray ? this.strokeDashArray.concat() : this.strokeDashArray, + strokeLineCap: this.strokeLineCap, + strokeDashOffset: this.strokeDashOffset, + strokeLineJoin: this.strokeLineJoin, + // strokeUniform: this.strokeUniform, + strokeMiterLimit: toFixed(this.strokeMiterLimit, NUM_FRACTION_DIGITS), + scaleX: toFixed(this.scaleX, NUM_FRACTION_DIGITS), + scaleY: toFixed(this.scaleY, NUM_FRACTION_DIGITS), + angle: toFixed(this.angle, NUM_FRACTION_DIGITS), + flipX: this.flipX, + flipY: this.flipY, + opacity: toFixed(this.opacity, NUM_FRACTION_DIGITS), + shadow: (this.shadow && this.shadow.toObject) ? this.shadow.toObject() : this.shadow, + visible: this.visible, + backgroundColor: this.backgroundColor, + fillRule: this.fillRule, + paintFirst: this.paintFirst, + globalCompositeOperation: this.globalCompositeOperation, + skewX: toFixed(this.skewX, NUM_FRACTION_DIGITS), + skewY: toFixed(this.skewY, NUM_FRACTION_DIGITS), + }; + + if (this.clipPath) { + object.clipPath = this.clipPath.toObject(propertiesToInclude); + object.clipPath.inverted = this.clipPath.inverted; + object.clipPath.absolutePositioned = this.clipPath.absolutePositioned; + } + + fabric.util.populateWithProperties(this, object, propertiesToInclude); + if (!this.includeDefaultValues) { + object = this._removeDefaultValues(object); + } + + return object; + }, + + /** + * Returns (dataless) object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + // will be overwritten by subclasses + return this.toObject(propertiesToInclude); + }, + + /** + * @private + * @param {Object} object + */ + _removeDefaultValues: function(object) { + var prototype = fabric.util.getKlass(object.type).prototype, + stateProperties = prototype.stateProperties; + stateProperties.forEach(function(prop) { + if (prop === 'left' || prop === 'top') { + return; + } + if (object[prop] === prototype[prop]) { + delete object[prop]; + } + var isArray = Object.prototype.toString.call(object[prop]) === '[object Array]' && + Object.prototype.toString.call(prototype[prop]) === '[object Array]'; + + // basically a check for [] === [] + if (isArray && object[prop].length === 0 && prototype[prop].length === 0) { + delete object[prop]; + } + }); + + return object; + }, + + /** + * Returns a string representation of an instance + * @return {String} + */ + toString: function() { + return '#'; + }, + + /** + * Return the object scale factor counting also the group scaling + * @return {Object} object with scaleX and scaleY properties + */ + getObjectScaling: function() { + var options = fabric.util.qrDecompose(this.calcTransformMatrix()); + return { scaleX: Math.abs(options.scaleX), scaleY: Math.abs(options.scaleY) }; + }, + + /** + * Return the object scale factor counting also the group scaling, zoom and retina + * @return {Object} object with scaleX and scaleY properties + */ + getTotalObjectScaling: function() { + var scale = this.getObjectScaling(), scaleX = scale.scaleX, scaleY = scale.scaleY; + if (this.canvas) { + var zoom = this.canvas.getZoom(); + var retina = this.canvas.getRetinaScaling(); + scaleX *= zoom * retina; + scaleY *= zoom * retina; + } + return { scaleX: scaleX, scaleY: scaleY }; + }, + + /** + * Return the object opacity counting also the group property + * @return {Number} + */ + getObjectOpacity: function() { + var opacity = this.opacity; + if (this.group) { + opacity *= this.group.getObjectOpacity(); + } + return opacity; + }, + + /** + * @private + * @param {String} key + * @param {*} value + * @return {fabric.Object} thisArg + */ + _set: function(key, value) { + var shouldConstrainValue = (key === 'scaleX' || key === 'scaleY'), + isChanged = this[key] !== value, groupNeedsUpdate = false; + + if (shouldConstrainValue) { + value = this._constrainScale(value); + } + if (key === 'scaleX' && value < 0) { + this.flipX = !this.flipX; + value *= -1; + } + else if (key === 'scaleY' && value < 0) { + this.flipY = !this.flipY; + value *= -1; + } + else if (key === 'shadow' && value && !(value instanceof fabric.Shadow)) { + value = new fabric.Shadow(value); + } + else if (key === 'dirty' && this.group) { + this.group.set('dirty', value); + } + + this[key] = value; + + if (isChanged) { + groupNeedsUpdate = this.group && this.group.isOnACache(); + if (this.cacheProperties.indexOf(key) > -1) { + this.dirty = true; + groupNeedsUpdate && this.group.set('dirty', true); + } + else if (groupNeedsUpdate && this.stateProperties.indexOf(key) > -1) { + this.group.set('dirty', true); + } + } + + return this; + }, + + /** + * This callback function is called by the parent group of an object every + * time a non-delegated property changes on the group. It is passed the key + * and value as parameters. Not adding in this function's signature to avoid + * Travis build error about unused variables. + */ + setOnGroup: function() { + // implemented by sub-classes, as needed. + }, + + /** + * Retrieves viewportTransform from Object's canvas if possible + * @method getViewportTransform + * @memberOf fabric.Object.prototype + * @return {Array} + */ + getViewportTransform: function() { + if (this.canvas && this.canvas.viewportTransform) { + return this.canvas.viewportTransform; + } + return fabric.iMatrix.concat(); + }, + + /* + * @private + * return if the object would be visible in rendering + * @memberOf fabric.Object.prototype + * @return {Boolean} + */ + isNotVisible: function() { + return this.opacity === 0 || + (!this.width && !this.height && this.strokeWidth === 0) || + !this.visible; + }, + + /** + * Renders an object on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + render: function(ctx) { + // do not render if width/height are zeros or object is not visible + if (this.isNotVisible()) { + return; + } + if (this.canvas && this.canvas.skipOffscreen && !this.group && !this.isOnScreen()) { + return; + } + ctx.save(); + this._setupCompositeOperation(ctx); + this.drawSelectionBackground(ctx); + this.transform(ctx); + this._setOpacity(ctx); + this._setShadow(ctx, this); + if (this.shouldCache()) { + this.renderCache(); + this.drawCacheOnCanvas(ctx); + } + else { + this._removeCacheCanvas(); + this.dirty = false; + this.drawObject(ctx); + if (this.objectCaching && this.statefullCache) { + this.saveState({ propertySet: 'cacheProperties' }); + } + } + ctx.restore(); + }, + + renderCache: function(options) { + options = options || {}; + if (!this._cacheCanvas) { + this._createCacheCanvas(); + } + if (this.isCacheDirty()) { + this.statefullCache && this.saveState({ propertySet: 'cacheProperties' }); + this.drawObject(this._cacheContext, options.forClipping); + this.dirty = false; + } + }, + + /** + * Remove cacheCanvas and its dimensions from the objects + */ + _removeCacheCanvas: function() { + this._cacheCanvas = null; + this.cacheWidth = 0; + this.cacheHeight = 0; + }, + + /** + * return true if the object will draw a stroke + * Does not consider text styles. This is just a shortcut used at rendering time + * We want it to be an aproximation and be fast. + * wrote to avoid extra caching, it has to return true when stroke happens, + * can guess when it will not happen at 100% chance, does not matter if it misses + * some use case where the stroke is invisible. + * @since 3.0.0 + * @returns Boolean + */ + hasStroke: function() { + return this.stroke && this.stroke !== 'transparent' && this.strokeWidth !== 0; + }, + + /** + * return true if the object will draw a fill + * Does not consider text styles. This is just a shortcut used at rendering time + * We want it to be an aproximation and be fast. + * wrote to avoid extra caching, it has to return true when fill happens, + * can guess when it will not happen at 100% chance, does not matter if it misses + * some use case where the fill is invisible. + * @since 3.0.0 + * @returns Boolean + */ + hasFill: function() { + return this.fill && this.fill !== 'transparent'; + }, + + /** + * When set to `true`, force the object to have its own cache, even if it is inside a group + * it may be needed when your object behave in a particular way on the cache and always needs + * its own isolated canvas to render correctly. + * Created to be overridden + * since 1.7.12 + * @returns Boolean + */ + needsItsOwnCache: function() { + if (this.paintFirst === 'stroke' && + this.hasFill() && this.hasStroke() && typeof this.shadow === 'object') { + return true; + } + if (this.clipPath) { + return true; + } + return false; + }, + + /** + * Decide if the object should cache or not. Create its own cache level + * objectCaching is a global flag, wins over everything + * needsItsOwnCache should be used when the object drawing method requires + * a cache step. None of the fabric classes requires it. + * Generally you do not cache objects in groups because the group outside is cached. + * Read as: cache if is needed, or if the feature is enabled but we are not already caching. + * @return {Boolean} + */ + shouldCache: function() { + this.ownCaching = this.needsItsOwnCache() || ( + this.objectCaching && + (!this.group || !this.group.isOnACache()) + ); + return this.ownCaching; + }, + + /** + * Check if this object or a child object will cast a shadow + * used by Group.shouldCache to know if child has a shadow recursively + * @return {Boolean} + */ + willDrawShadow: function() { + return !!this.shadow && (this.shadow.offsetX !== 0 || this.shadow.offsetY !== 0); + }, + + /** + * Execute the drawing operation for an object clipPath + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + drawClipPathOnCache: function(ctx) { + var path = this.clipPath; + ctx.save(); + // DEBUG: uncomment this line, comment the following + // ctx.globalAlpha = 0.4 + if (path.inverted) { + ctx.globalCompositeOperation = 'destination-out'; + } + else { + ctx.globalCompositeOperation = 'destination-in'; + } + //ctx.scale(1 / 2, 1 / 2); + if (path.absolutePositioned) { + var m = fabric.util.invertTransform(this.calcTransformMatrix()); + ctx.transform(m[0], m[1], m[2], m[3], m[4], m[5]); + } + path.transform(ctx); + ctx.scale(1 / path.zoomX, 1 / path.zoomY); + ctx.drawImage(path._cacheCanvas, -path.cacheTranslationX, -path.cacheTranslationY); + ctx.restore(); + }, + + /** + * Execute the drawing operation for an object on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + drawObject: function(ctx, forClipping) { + var originalFill = this.fill, originalStroke = this.stroke; + if (forClipping) { + this.fill = 'black'; + this.stroke = ''; + this._setClippingProperties(ctx); + } + else { + this._renderBackground(ctx); + this._setStrokeStyles(ctx, this); + this._setFillStyles(ctx, this); + } + this._render(ctx); + this._drawClipPath(ctx); + this.fill = originalFill; + this.stroke = originalStroke; + }, + + _drawClipPath: function(ctx) { + var path = this.clipPath; + if (!path) { return; } + // needed to setup a couple of variables + // path canvas gets overridden with this one. + // TODO find a better solution? + path.canvas = this.canvas; + path.shouldCache(); + path._transformDone = true; + path.renderCache({ forClipping: true }); + this.drawClipPathOnCache(ctx); + }, + + /** + * Paint the cached copy of the object on the target context. + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + drawCacheOnCanvas: function(ctx) { + ctx.scale(1 / this.zoomX, 1 / this.zoomY); + ctx.drawImage(this._cacheCanvas, -this.cacheTranslationX, -this.cacheTranslationY); + }, + + /** + * Check if cache is dirty + * @param {Boolean} skipCanvas skip canvas checks because this object is painted + * on parent canvas. + */ + isCacheDirty: function(skipCanvas) { + if (this.isNotVisible()) { + return false; + } + if (this._cacheCanvas && !skipCanvas && this._updateCacheCanvas()) { + // in this case the context is already cleared. + return true; + } + else { + if (this.dirty || + (this.clipPath && this.clipPath.absolutePositioned) || + (this.statefullCache && this.hasStateChanged('cacheProperties')) + ) { + if (this._cacheCanvas && !skipCanvas) { + var width = this.cacheWidth / this.zoomX; + var height = this.cacheHeight / this.zoomY; + this._cacheContext.clearRect(-width / 2, -height / 2, width, height); + } + return true; + } + } + return false; + }, + + /** + * Draws a background for the object big as its untransformed dimensions + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderBackground: function(ctx) { + if (!this.backgroundColor) { + return; + } + var dim = this._getNonTransformedDimensions(); + ctx.fillStyle = this.backgroundColor; + + ctx.fillRect( + -dim.x / 2, + -dim.y / 2, + dim.x, + dim.y + ); + // if there is background color no other shadows + // should be casted + this._removeShadow(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _setOpacity: function(ctx) { + if (this.group && !this.group._transformDone) { + ctx.globalAlpha = this.getObjectOpacity(); + } + else { + ctx.globalAlpha *= this.opacity; + } + }, + + _setStrokeStyles: function(ctx, decl) { + if (decl.stroke) { + ctx.lineWidth = decl.strokeWidth; + ctx.lineCap = decl.strokeLineCap; + ctx.lineDashOffset = decl.strokeDashOffset; + ctx.lineJoin = decl.strokeLineJoin; + ctx.miterLimit = decl.strokeMiterLimit; + ctx.strokeStyle = decl.stroke.toLive + ? decl.stroke.toLive(ctx, this) + : decl.stroke; + } + }, + + _setFillStyles: function(ctx, decl) { + if (decl.fill) { + ctx.fillStyle = decl.fill.toLive + ? decl.fill.toLive(ctx, this) + : decl.fill; + } + }, + + _setClippingProperties: function(ctx) { + ctx.globalAlpha = 1; + ctx.strokeStyle = 'transparent'; + ctx.fillStyle = '#000000'; + }, + + /** + * @private + * Sets line dash + * @param {CanvasRenderingContext2D} ctx Context to set the dash line on + * @param {Array} dashArray array representing dashes + * @param {Function} alternative function to call if browser does not support lineDash + */ + _setLineDash: function(ctx, dashArray, alternative) { + if (!dashArray || dashArray.length === 0) { + return; + } + // Spec requires the concatenation of two copies the dash list when the number of elements is odd + if (1 & dashArray.length) { + dashArray.push.apply(dashArray, dashArray); + } + if (supportsLineDash) { + ctx.setLineDash(dashArray); + } + else { + alternative && alternative(ctx); + } + }, + + /** + * Renders controls and borders for the object + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Object} [styleOverride] properties to override the object style + */ + _renderControls: function(ctx, styleOverride) { + var vpt = this.getViewportTransform(), + matrix = this.calcTransformMatrix(), + options, drawBorders, drawControls; + styleOverride = styleOverride || { }; + drawBorders = typeof styleOverride.hasBorders !== 'undefined' ? styleOverride.hasBorders : this.hasBorders; + drawControls = typeof styleOverride.hasControls !== 'undefined' ? styleOverride.hasControls : this.hasControls; + matrix = fabric.util.multiplyTransformMatrices(vpt, matrix); + options = fabric.util.qrDecompose(matrix); + ctx.save(); + ctx.translate(options.translateX, options.translateY); + ctx.lineWidth = 1 * this.borderScaleFactor; + if (!this.group) { + ctx.globalAlpha = this.isMoving ? this.borderOpacityWhenMoving : 1; + } + if (styleOverride.forActiveSelection) { + ctx.rotate(degreesToRadians(options.angle)); + drawBorders && this.drawBordersInGroup(ctx, options, styleOverride); + } + else { + ctx.rotate(degreesToRadians(this.angle)); + drawBorders && this.drawBorders(ctx, styleOverride); + } + drawControls && this.drawControls(ctx, styleOverride); + ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _setShadow: function(ctx) { + if (!this.shadow) { + return; + } + + var shadow = this.shadow, canvas = this.canvas, scaling, + multX = (canvas && canvas.viewportTransform[0]) || 1, + multY = (canvas && canvas.viewportTransform[3]) || 1; + if (shadow.nonScaling) { + scaling = { scaleX: 1, scaleY: 1 }; + } + else { + scaling = this.getObjectScaling(); + } + if (canvas && canvas._isRetinaScaling()) { + multX *= fabric.devicePixelRatio; + multY *= fabric.devicePixelRatio; + } + ctx.shadowColor = shadow.color; + ctx.shadowBlur = shadow.blur * fabric.browserShadowBlurConstant * + (multX + multY) * (scaling.scaleX + scaling.scaleY) / 4; + ctx.shadowOffsetX = shadow.offsetX * multX * scaling.scaleX; + ctx.shadowOffsetY = shadow.offsetY * multY * scaling.scaleY; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _removeShadow: function(ctx) { + if (!this.shadow) { + return; + } + + ctx.shadowColor = ''; + ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Object} filler fabric.Pattern or fabric.Gradient + * @return {Object} offset.offsetX offset for text rendering + * @return {Object} offset.offsetY offset for text rendering + */ + _applyPatternGradientTransform: function(ctx, filler) { + if (!filler || !filler.toLive) { + return { offsetX: 0, offsetY: 0 }; + } + var t = filler.gradientTransform || filler.patternTransform; + var offsetX = -this.width / 2 + filler.offsetX || 0, + offsetY = -this.height / 2 + filler.offsetY || 0; + + if (filler.gradientUnits === 'percentage') { + ctx.transform(this.width, 0, 0, this.height, offsetX, offsetY); + } + else { + ctx.transform(1, 0, 0, 1, offsetX, offsetY); + } + if (t) { + ctx.transform(t[0], t[1], t[2], t[3], t[4], t[5]); + } + return { offsetX: offsetX, offsetY: offsetY }; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderPaintInOrder: function(ctx) { + if (this.paintFirst === 'stroke') { + this._renderStroke(ctx); + this._renderFill(ctx); + } + else { + this._renderFill(ctx); + this._renderStroke(ctx); + } + }, + + /** + * @private + * function that actually render something on the context. + * empty here to allow Obects to work on tests to benchmark fabric functionalites + * not related to rendering + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(/* ctx */) { + + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderFill: function(ctx) { + if (!this.fill) { + return; + } + + ctx.save(); + this._applyPatternGradientTransform(ctx, this.fill); + if (this.fillRule === 'evenodd') { + ctx.fill('evenodd'); + } + else { + ctx.fill(); + } + ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderStroke: function(ctx) { + if (!this.stroke || this.strokeWidth === 0) { + return; + } + + if (this.shadow && !this.shadow.affectStroke) { + this._removeShadow(ctx); + } + + ctx.save(); + if (this.strokeUniform && this.group) { + var scaling = this.getObjectScaling(); + ctx.scale(1 / scaling.scaleX, 1 / scaling.scaleY); + } + else if (this.strokeUniform) { + ctx.scale(1 / this.scaleX, 1 / this.scaleY); + } + this._setLineDash(ctx, this.strokeDashArray, this._renderDashedStroke); + if (this.stroke.toLive && this.stroke.gradientUnits === 'percentage') { + // need to transform gradient in a pattern. + // this is a slow process. If you are hitting this codepath, and the object + // is not using caching, you should consider switching it on. + // we need a canvas as big as the current object caching canvas. + this._applyPatternForTransformedGradient(ctx, this.stroke); + } + else { + this._applyPatternGradientTransform(ctx, this.stroke); + } + ctx.stroke(); + ctx.restore(); + }, + + /** + * This function try to patch the missing gradientTransform on canvas gradients. + * transforming a context to transform the gradient, is going to transform the stroke too. + * we want to transform the gradient but not the stroke operation, so we create + * a transformed gradient on a pattern and then we use the pattern instead of the gradient. + * this method has drwabacks: is slow, is in low resolution, needs a patch for when the size + * is limited. + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {fabric.Gradient} filler a fabric gradient instance + */ + _applyPatternForTransformedGradient: function(ctx, filler) { + var dims = this._limitCacheSize(this._getCacheCanvasDimensions()), + pCanvas = fabric.util.createCanvasElement(), pCtx, retinaScaling = this.canvas.getRetinaScaling(), + width = dims.x / this.scaleX / retinaScaling, height = dims.y / this.scaleY / retinaScaling; + pCanvas.width = width; + pCanvas.height = height; + pCtx = pCanvas.getContext('2d'); + pCtx.beginPath(); pCtx.moveTo(0, 0); pCtx.lineTo(width, 0); pCtx.lineTo(width, height); + pCtx.lineTo(0, height); pCtx.closePath(); + pCtx.translate(width / 2, height / 2); + pCtx.scale( + dims.zoomX / this.scaleX / retinaScaling, + dims.zoomY / this.scaleY / retinaScaling + ); + this._applyPatternGradientTransform(pCtx, filler); + pCtx.fillStyle = filler.toLive(ctx); + pCtx.fill(); + ctx.translate(-this.width / 2 - this.strokeWidth / 2, -this.height / 2 - this.strokeWidth / 2); + ctx.scale( + retinaScaling * this.scaleX / dims.zoomX, + retinaScaling * this.scaleY / dims.zoomY + ); + ctx.strokeStyle = pCtx.createPattern(pCanvas, 'no-repeat'); + }, + + /** + * This function is an helper for svg import. it returns the center of the object in the svg + * untransformed coordinates + * @private + * @return {Object} center point from element coordinates + */ + _findCenterFromElement: function() { + return { x: this.left + this.width / 2, y: this.top + this.height / 2 }; + }, + + /** + * This function is an helper for svg import. it decompose the transformMatrix + * and assign properties to object. + * untransformed coordinates + * @private + * @chainable + */ + _assignTransformMatrixProps: function() { + if (this.transformMatrix) { + var options = fabric.util.qrDecompose(this.transformMatrix); + this.flipX = false; + this.flipY = false; + this.set('scaleX', options.scaleX); + this.set('scaleY', options.scaleY); + this.angle = options.angle; + this.skewX = options.skewX; + this.skewY = 0; + } + }, + + /** + * This function is an helper for svg import. it removes the transform matrix + * and set to object properties that fabricjs can handle + * @private + * @param {Object} preserveAspectRatioOptions + * @return {thisArg} + */ + _removeTransformMatrix: function(preserveAspectRatioOptions) { + var center = this._findCenterFromElement(); + if (this.transformMatrix) { + this._assignTransformMatrixProps(); + center = fabric.util.transformPoint(center, this.transformMatrix); + } + this.transformMatrix = null; + if (preserveAspectRatioOptions) { + this.scaleX *= preserveAspectRatioOptions.scaleX; + this.scaleY *= preserveAspectRatioOptions.scaleY; + this.cropX = preserveAspectRatioOptions.cropX; + this.cropY = preserveAspectRatioOptions.cropY; + center.x += preserveAspectRatioOptions.offsetLeft; + center.y += preserveAspectRatioOptions.offsetTop; + this.width = preserveAspectRatioOptions.width; + this.height = preserveAspectRatioOptions.height; + } + this.setPositionByOrigin(center, 'center', 'center'); + }, + + /** + * Clones an instance, using a callback method will work for every object. + * @param {Function} callback Callback is invoked with a clone as a first argument + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + */ + clone: function(callback, propertiesToInclude) { + var objectForm = this.toObject(propertiesToInclude); + if (this.constructor.fromObject) { + this.constructor.fromObject(objectForm, callback); + } + else { + fabric.Object._fromObject('Object', objectForm, callback); + } + }, + + /** + * Creates an instance of fabric.Image out of an object + * could make use of both toDataUrl or toCanvasElement. + * @param {Function} callback callback, invoked with an instance as a first argument + * @param {Object} [options] for clone as image, passed to toDataURL + * @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png" + * @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg. + * @param {Number} [options.multiplier=1] Multiplier to scale by + * @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14 + * @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14 + * @param {Number} [options.width] Cropping width. Introduced in v1.2.14 + * @param {Number} [options.height] Cropping height. Introduced in v1.2.14 + * @param {Boolean} [options.enableRetinaScaling] Enable retina scaling for clone image. Introduce in 1.6.4 + * @param {Boolean} [options.withoutTransform] Remove current object transform ( no scale , no angle, no flip, no skew ). Introduced in 2.3.4 + * @param {Boolean} [options.withoutShadow] Remove current object shadow. Introduced in 2.4.2 + * @return {fabric.Object} thisArg + */ + cloneAsImage: function(callback, options) { + var canvasEl = this.toCanvasElement(options); + if (callback) { + callback(new fabric.Image(canvasEl)); + } + return this; + }, + + /** + * Converts an object into a HTMLCanvas element + * @param {Object} options Options object + * @param {Number} [options.multiplier=1] Multiplier to scale by + * @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14 + * @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14 + * @param {Number} [options.width] Cropping width. Introduced in v1.2.14 + * @param {Number} [options.height] Cropping height. Introduced in v1.2.14 + * @param {Boolean} [options.enableRetinaScaling] Enable retina scaling for clone image. Introduce in 1.6.4 + * @param {Boolean} [options.withoutTransform] Remove current object transform ( no scale , no angle, no flip, no skew ). Introduced in 2.3.4 + * @param {Boolean} [options.withoutShadow] Remove current object shadow. Introduced in 2.4.2 + * @return {HTMLCanvasElement} Returns DOM element with the fabric.Object + */ + toCanvasElement: function(options) { + options || (options = { }); + + var utils = fabric.util, origParams = utils.saveObjectTransform(this), + originalGroup = this.group, + originalShadow = this.shadow, abs = Math.abs, + multiplier = (options.multiplier || 1) * (options.enableRetinaScaling ? fabric.devicePixelRatio : 1); + delete this.group; + if (options.withoutTransform) { + utils.resetObjectTransform(this); + } + if (options.withoutShadow) { + this.shadow = null; + } + + var el = fabric.util.createCanvasElement(), + // skip canvas zoom and calculate with setCoords now. + boundingRect = this.getBoundingRect(true, true), + shadow = this.shadow, scaling, + shadowOffset = { x: 0, y: 0 }, shadowBlur, + width, height; + + if (shadow) { + shadowBlur = shadow.blur; + if (shadow.nonScaling) { + scaling = { scaleX: 1, scaleY: 1 }; + } + else { + scaling = this.getObjectScaling(); + } + // consider non scaling shadow. + shadowOffset.x = 2 * Math.round(abs(shadow.offsetX) + shadowBlur) * (abs(scaling.scaleX)); + shadowOffset.y = 2 * Math.round(abs(shadow.offsetY) + shadowBlur) * (abs(scaling.scaleY)); + } + width = boundingRect.width + shadowOffset.x; + height = boundingRect.height + shadowOffset.y; + // if the current width/height is not an integer + // we need to make it so. + el.width = Math.ceil(width); + el.height = Math.ceil(height); + var canvas = new fabric.StaticCanvas(el, { + enableRetinaScaling: false, + renderOnAddRemove: false, + skipOffscreen: false, + }); + if (options.format === 'jpeg') { + canvas.backgroundColor = '#fff'; + } + this.setPositionByOrigin(new fabric.Point(canvas.width / 2, canvas.height / 2), 'center', 'center'); + + var originalCanvas = this.canvas; + canvas.add(this); + var canvasEl = canvas.toCanvasElement(multiplier || 1, options); + this.shadow = originalShadow; + this.set('canvas', originalCanvas); + if (originalGroup) { + this.group = originalGroup; + } + this.set(origParams).setCoords(); + // canvas.dispose will call image.dispose that will nullify the elements + // since this canvas is a simple element for the process, we remove references + // to objects in this way in order to avoid object trashing. + canvas._objects = []; + canvas.dispose(); + canvas = null; + + return canvasEl; + }, + + /** + * Converts an object into a data-url-like string + * @param {Object} options Options object + * @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png" + * @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg. + * @param {Number} [options.multiplier=1] Multiplier to scale by + * @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14 + * @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14 + * @param {Number} [options.width] Cropping width. Introduced in v1.2.14 + * @param {Number} [options.height] Cropping height. Introduced in v1.2.14 + * @param {Boolean} [options.enableRetinaScaling] Enable retina scaling for clone image. Introduce in 1.6.4 + * @param {Boolean} [options.withoutTransform] Remove current object transform ( no scale , no angle, no flip, no skew ). Introduced in 2.3.4 + * @param {Boolean} [options.withoutShadow] Remove current object shadow. Introduced in 2.4.2 + * @return {String} Returns a data: URL containing a representation of the object in the format specified by options.format + */ + toDataURL: function(options) { + options || (options = { }); + return fabric.util.toDataURL(this.toCanvasElement(options), options.format || 'png', options.quality || 1); + }, + + /** + * Returns true if specified type is identical to the type of an instance + * @param {String} type Type to check against + * @return {Boolean} + */ + isType: function(type) { + return this.type === type; + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance (is 1 unless subclassed) + */ + complexity: function() { + return 1; + }, + + /** + * Returns a JSON representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} JSON + */ + toJSON: function(propertiesToInclude) { + // delegate, not alias + return this.toObject(propertiesToInclude); + }, + + /** + * Sets "angle" of an instance with centered rotation + * @param {Number} angle Angle value (in degrees) + * @return {fabric.Object} thisArg + * @chainable + */ + rotate: function(angle) { + var shouldCenterOrigin = (this.originX !== 'center' || this.originY !== 'center') && this.centeredRotation; + + if (shouldCenterOrigin) { + this._setOriginToCenter(); + } + + this.set('angle', angle); + + if (shouldCenterOrigin) { + this._resetOrigin(); + } + + return this; + }, + + /** + * Centers object horizontally on canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + centerH: function () { + this.canvas && this.canvas.centerObjectH(this); + return this; + }, + + /** + * Centers object horizontally on current viewport of canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + viewportCenterH: function () { + this.canvas && this.canvas.viewportCenterObjectH(this); + return this; + }, + + /** + * Centers object vertically on canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + centerV: function () { + this.canvas && this.canvas.centerObjectV(this); + return this; + }, + + /** + * Centers object vertically on current viewport of canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + viewportCenterV: function () { + this.canvas && this.canvas.viewportCenterObjectV(this); + return this; + }, + + /** + * Centers object vertically and horizontally on canvas to which is was added last + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + center: function () { + this.canvas && this.canvas.centerObject(this); + return this; + }, + + /** + * Centers object on current viewport of canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + viewportCenter: function () { + this.canvas && this.canvas.viewportCenterObject(this); + return this; + }, + + /** + * Returns coordinates of a pointer relative to an object + * @param {Event} e Event to operate upon + * @param {Object} [pointer] Pointer to operate upon (instead of event) + * @return {Object} Coordinates of a pointer (x, y) + */ + getLocalPointer: function(e, pointer) { + pointer = pointer || this.canvas.getPointer(e); + var pClicked = new fabric.Point(pointer.x, pointer.y), + objectLeftTop = this._getLeftTopCoords(); + if (this.angle) { + pClicked = fabric.util.rotatePoint( + pClicked, objectLeftTop, degreesToRadians(-this.angle)); + } + return { + x: pClicked.x - objectLeftTop.x, + y: pClicked.y - objectLeftTop.y + }; + }, + + /** + * Sets canvas globalCompositeOperation for specific object + * custom composition operation for the particular object can be specified using globalCompositeOperation property + * @param {CanvasRenderingContext2D} ctx Rendering canvas context + */ + _setupCompositeOperation: function (ctx) { + if (this.globalCompositeOperation) { + ctx.globalCompositeOperation = this.globalCompositeOperation; + } + } + }); + + fabric.util.createAccessors && fabric.util.createAccessors(fabric.Object); + + extend(fabric.Object.prototype, fabric.Observable); + + /** + * Defines the number of fraction digits to use when serializing object values. + * You can use it to increase/decrease precision of such values like left, top, scaleX, scaleY, etc. + * @static + * @memberOf fabric.Object + * @constant + * @type Number + */ + fabric.Object.NUM_FRACTION_DIGITS = 2; + + fabric.Object._fromObject = function(className, object, callback, extraParam) { + var klass = fabric[className]; + object = clone(object, true); + fabric.util.enlivenPatterns([object.fill, object.stroke], function(patterns) { + if (typeof patterns[0] !== 'undefined') { + object.fill = patterns[0]; + } + if (typeof patterns[1] !== 'undefined') { + object.stroke = patterns[1]; + } + fabric.util.enlivenObjects([object.clipPath], function(enlivedProps) { + object.clipPath = enlivedProps[0]; + var instance = extraParam ? new klass(object[extraParam], object) : new klass(object); + callback && callback(instance); + }); + }); + }; + + /** + * Unique id used internally when creating SVG elements + * @static + * @memberOf fabric.Object + * @type Number + */ + fabric.Object.__uid = 0; +})(typeof exports !== 'undefined' ? exports : this); +(function() { + + var degreesToRadians = fabric.util.degreesToRadians, + originXOffset = { + left: -0.5, + center: 0, + right: 0.5 + }, + originYOffset = { + top: -0.5, + center: 0, + bottom: 0.5 + }; + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Translates the coordinates from a set of origin to another (based on the object's dimensions) + * @param {fabric.Point} point The point which corresponds to the originX and originY params + * @param {String} fromOriginX Horizontal origin: 'left', 'center' or 'right' + * @param {String} fromOriginY Vertical origin: 'top', 'center' or 'bottom' + * @param {String} toOriginX Horizontal origin: 'left', 'center' or 'right' + * @param {String} toOriginY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + translateToGivenOrigin: function(point, fromOriginX, fromOriginY, toOriginX, toOriginY) { + var x = point.x, + y = point.y, + offsetX, offsetY, dim; + + if (typeof fromOriginX === 'string') { + fromOriginX = originXOffset[fromOriginX]; + } + else { + fromOriginX -= 0.5; + } + + if (typeof toOriginX === 'string') { + toOriginX = originXOffset[toOriginX]; + } + else { + toOriginX -= 0.5; + } + + offsetX = toOriginX - fromOriginX; + + if (typeof fromOriginY === 'string') { + fromOriginY = originYOffset[fromOriginY]; + } + else { + fromOriginY -= 0.5; + } + + if (typeof toOriginY === 'string') { + toOriginY = originYOffset[toOriginY]; + } + else { + toOriginY -= 0.5; + } + + offsetY = toOriginY - fromOriginY; + + if (offsetX || offsetY) { + dim = this._getTransformedDimensions(); + x = point.x + offsetX * dim.x; + y = point.y + offsetY * dim.y; + } + + return new fabric.Point(x, y); + }, + + /** + * Translates the coordinates from origin to center coordinates (based on the object's dimensions) + * @param {fabric.Point} point The point which corresponds to the originX and originY params + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + translateToCenterPoint: function(point, originX, originY) { + var p = this.translateToGivenOrigin(point, originX, originY, 'center', 'center'); + if (this.angle) { + return fabric.util.rotatePoint(p, point, degreesToRadians(this.angle)); + } + return p; + }, + + /** + * Translates the coordinates from center to origin coordinates (based on the object's dimensions) + * @param {fabric.Point} center The point which corresponds to center of the object + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + translateToOriginPoint: function(center, originX, originY) { + var p = this.translateToGivenOrigin(center, 'center', 'center', originX, originY); + if (this.angle) { + return fabric.util.rotatePoint(p, center, degreesToRadians(this.angle)); + } + return p; + }, + + /** + * Returns the real center coordinates of the object + * @return {fabric.Point} + */ + getCenterPoint: function() { + var leftTop = new fabric.Point(this.left, this.top); + return this.translateToCenterPoint(leftTop, this.originX, this.originY); + }, + + /** + * Returns the coordinates of the object based on center coordinates + * @param {fabric.Point} point The point which corresponds to the originX and originY params + * @return {fabric.Point} + */ + // getOriginPoint: function(center) { + // return this.translateToOriginPoint(center, this.originX, this.originY); + // }, + + /** + * Returns the coordinates of the object as if it has a different origin + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + getPointByOrigin: function(originX, originY) { + var center = this.getCenterPoint(); + return this.translateToOriginPoint(center, originX, originY); + }, + + /** + * Returns the point in local coordinates + * @param {fabric.Point} point The point relative to the global coordinate system + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + toLocalPoint: function(point, originX, originY) { + var center = this.getCenterPoint(), + p, p2; + + if (typeof originX !== 'undefined' && typeof originY !== 'undefined' ) { + p = this.translateToGivenOrigin(center, 'center', 'center', originX, originY); + } + else { + p = new fabric.Point(this.left, this.top); + } + + p2 = new fabric.Point(point.x, point.y); + if (this.angle) { + p2 = fabric.util.rotatePoint(p2, center, -degreesToRadians(this.angle)); + } + return p2.subtractEquals(p); + }, + + /** + * Returns the point in global coordinates + * @param {fabric.Point} The point relative to the local coordinate system + * @return {fabric.Point} + */ + // toGlobalPoint: function(point) { + // return fabric.util.rotatePoint(point, this.getCenterPoint(), degreesToRadians(this.angle)).addEquals(new fabric.Point(this.left, this.top)); + // }, + + /** + * Sets the position of the object taking into consideration the object's origin + * @param {fabric.Point} pos The new position of the object + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {void} + */ + setPositionByOrigin: function(pos, originX, originY) { + var center = this.translateToCenterPoint(pos, originX, originY), + position = this.translateToOriginPoint(center, this.originX, this.originY); + this.set('left', position.x); + this.set('top', position.y); + }, + + /** + * @param {String} to One of 'left', 'center', 'right' + */ + adjustPosition: function(to) { + var angle = degreesToRadians(this.angle), + hypotFull = this.getScaledWidth(), + xFull = fabric.util.cos(angle) * hypotFull, + yFull = fabric.util.sin(angle) * hypotFull, + offsetFrom, offsetTo; + + //TODO: this function does not consider mixed situation like top, center. + if (typeof this.originX === 'string') { + offsetFrom = originXOffset[this.originX]; + } + else { + offsetFrom = this.originX - 0.5; + } + if (typeof to === 'string') { + offsetTo = originXOffset[to]; + } + else { + offsetTo = to - 0.5; + } + this.left += xFull * (offsetTo - offsetFrom); + this.top += yFull * (offsetTo - offsetFrom); + this.setCoords(); + this.originX = to; + }, + + /** + * Sets the origin/position of the object to it's center point + * @private + * @return {void} + */ + _setOriginToCenter: function() { + this._originalOriginX = this.originX; + this._originalOriginY = this.originY; + + var center = this.getCenterPoint(); + + this.originX = 'center'; + this.originY = 'center'; + + this.left = center.x; + this.top = center.y; + }, + + /** + * Resets the origin/position of the object to it's original origin + * @private + * @return {void} + */ + _resetOrigin: function() { + var originPoint = this.translateToOriginPoint( + this.getCenterPoint(), + this._originalOriginX, + this._originalOriginY); + + this.originX = this._originalOriginX; + this.originY = this._originalOriginY; + + this.left = originPoint.x; + this.top = originPoint.y; + + this._originalOriginX = null; + this._originalOriginY = null; + }, + + /** + * @private + */ + _getLeftTopCoords: function() { + return this.translateToOriginPoint(this.getCenterPoint(), 'left', 'top'); + }, + }); + +})(); +(function() { + + function arrayFromCoords(coords) { + return [ + new fabric.Point(coords.tl.x, coords.tl.y), + new fabric.Point(coords.tr.x, coords.tr.y), + new fabric.Point(coords.br.x, coords.br.y), + new fabric.Point(coords.bl.x, coords.bl.y) + ]; + } + + var util = fabric.util, + degreesToRadians = util.degreesToRadians, + multiplyMatrices = util.multiplyTransformMatrices, + transformPoint = util.transformPoint; + + util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Describe object's corner position in canvas element coordinates. + * properties are depending on control keys and padding the main controls. + * each property is an object with x, y and corner. + * The `corner` property contains in a similar manner the 4 points of the + * interactive area of the corner. + * The coordinates depends from the controls positionHandler and are used + * to draw and locate controls + * @memberOf fabric.Object.prototype + */ + oCoords: null, + + /** + * Describe object's corner position in canvas object absolute coordinates + * properties are tl,tr,bl,br and describe the four main corner. + * each property is an object with x, y, instance of Fabric.Point. + * The coordinates depends from this properties: width, height, scaleX, scaleY + * skewX, skewY, angle, strokeWidth, top, left. + * Those coordinates are useful to understand where an object is. They get updated + * with oCoords but they do not need to be updated when zoom or panning change. + * The coordinates get updated with @method setCoords. + * You can calculate them without updating with @method calcACoords(); + * @memberOf fabric.Object.prototype + */ + aCoords: null, + + /** + * Describe object's corner position in canvas element coordinates. + * includes padding. Used of object detection. + * set and refreshed with setCoords and calcCoords. + * @memberOf fabric.Object.prototype + */ + lineCoords: null, + + /** + * storage for object transform matrix + */ + ownMatrixCache: null, + + /** + * storage for object full transform matrix + */ + matrixCache: null, + + /** + * custom controls interface + * controls are added by default_controls.js + */ + controls: { }, + + /** + * return correct set of coordinates for intersection + * this will return either aCoords or lineCoords. + * @param {Boolean} absolute will return aCoords if true or lineCoords + * @return {Object} {tl, tr, br, bl} points + */ + _getCoords: function(absolute, calculate) { + if (calculate) { + return (absolute ? this.calcACoords() : this.calcLineCoords()); + } + if (!this.aCoords || !this.lineCoords) { + this.setCoords(true); + } + return (absolute ? this.aCoords : this.lineCoords); + }, + + /** + * return correct set of coordinates for intersection + * this will return either aCoords or lineCoords. + * The coords are returned in an array. + * @return {Array} [tl, tr, br, bl] of points + */ + getCoords: function(absolute, calculate) { + return arrayFromCoords(this._getCoords(absolute, calculate)); + }, + + /** + * Checks if object intersects with an area formed by 2 points + * @param {Object} pointTL top-left point of area + * @param {Object} pointBR bottom-right point of area + * @param {Boolean} [absolute] use coordinates without viewportTransform + * @param {Boolean} [calculate] use coordinates of current position instead of .oCoords + * @return {Boolean} true if object intersects with an area formed by 2 points + */ + intersectsWithRect: function(pointTL, pointBR, absolute, calculate) { + var coords = this.getCoords(absolute, calculate), + intersection = fabric.Intersection.intersectPolygonRectangle( + coords, + pointTL, + pointBR + ); + return intersection.status === 'Intersection'; + }, + + /** + * Checks if object intersects with another object + * @param {Object} other Object to test + * @param {Boolean} [absolute] use coordinates without viewportTransform + * @param {Boolean} [calculate] use coordinates of current position instead of .oCoords + * @return {Boolean} true if object intersects with another object + */ + intersectsWithObject: function(other, absolute, calculate) { + var intersection = fabric.Intersection.intersectPolygonPolygon( + this.getCoords(absolute, calculate), + other.getCoords(absolute, calculate) + ); + + return intersection.status === 'Intersection' + || other.isContainedWithinObject(this, absolute, calculate) + || this.isContainedWithinObject(other, absolute, calculate); + }, + + /** + * Checks if object is fully contained within area of another object + * @param {Object} other Object to test + * @param {Boolean} [absolute] use coordinates without viewportTransform + * @param {Boolean} [calculate] use coordinates of current position instead of .oCoords + * @return {Boolean} true if object is fully contained within area of another object + */ + isContainedWithinObject: function(other, absolute, calculate) { + var points = this.getCoords(absolute, calculate), + otherCoords = absolute ? other.aCoords : other.lineCoords, + i = 0, lines = other._getImageLines(otherCoords); + for (; i < 4; i++) { + if (!other.containsPoint(points[i], lines)) { + return false; + } + } + return true; + }, + + /** + * Checks if object is fully contained within area formed by 2 points + * @param {Object} pointTL top-left point of area + * @param {Object} pointBR bottom-right point of area + * @param {Boolean} [absolute] use coordinates without viewportTransform + * @param {Boolean} [calculate] use coordinates of current position instead of .oCoords + * @return {Boolean} true if object is fully contained within area formed by 2 points + */ + isContainedWithinRect: function(pointTL, pointBR, absolute, calculate) { + var boundingRect = this.getBoundingRect(absolute, calculate); + + return ( + boundingRect.left >= pointTL.x && + boundingRect.left + boundingRect.width <= pointBR.x && + boundingRect.top >= pointTL.y && + boundingRect.top + boundingRect.height <= pointBR.y + ); + }, + + /** + * Checks if point is inside the object + * @param {fabric.Point} point Point to check against + * @param {Object} [lines] object returned from @method _getImageLines + * @param {Boolean} [absolute] use coordinates without viewportTransform + * @param {Boolean} [calculate] use coordinates of current position instead of .oCoords + * @return {Boolean} true if point is inside the object + */ + containsPoint: function(point, lines, absolute, calculate) { + var coords = this._getCoords(absolute, calculate), + lines = lines || this._getImageLines(coords), + xPoints = this._findCrossPoints(point, lines); + // if xPoints is odd then point is inside the object + return (xPoints !== 0 && xPoints % 2 === 1); + }, + + /** + * Checks if object is contained within the canvas with current viewportTransform + * the check is done stopping at first point that appears on screen + * @param {Boolean} [calculate] use coordinates of current position instead of .aCoords + * @return {Boolean} true if object is fully or partially contained within canvas + */ + isOnScreen: function(calculate) { + if (!this.canvas) { + return false; + } + var pointTL = this.canvas.vptCoords.tl, pointBR = this.canvas.vptCoords.br; + var points = this.getCoords(true, calculate); + // if some point is on screen, the object is on screen. + if (points.some(function(point) { + return point.x <= pointBR.x && point.x >= pointTL.x && + point.y <= pointBR.y && point.y >= pointTL.y; + })) { + return true; + } + // no points on screen, check intersection with absolute coordinates + if (this.intersectsWithRect(pointTL, pointBR, true, calculate)) { + return true; + } + return this._containsCenterOfCanvas(pointTL, pointBR, calculate); + }, + + /** + * Checks if the object contains the midpoint between canvas extremities + * Does not make sense outside the context of isOnScreen and isPartiallyOnScreen + * @private + * @param {Fabric.Point} pointTL Top Left point + * @param {Fabric.Point} pointBR Top Right point + * @param {Boolean} calculate use coordinates of current position instead of .oCoords + * @return {Boolean} true if the object contains the point + */ + _containsCenterOfCanvas: function(pointTL, pointBR, calculate) { + // worst case scenario the object is so big that contains the screen + var centerPoint = { x: (pointTL.x + pointBR.x) / 2, y: (pointTL.y + pointBR.y) / 2 }; + if (this.containsPoint(centerPoint, null, true, calculate)) { + return true; + } + return false; + }, + + /** + * Checks if object is partially contained within the canvas with current viewportTransform + * @param {Boolean} [calculate] use coordinates of current position instead of .oCoords + * @return {Boolean} true if object is partially contained within canvas + */ + isPartiallyOnScreen: function(calculate) { + if (!this.canvas) { + return false; + } + var pointTL = this.canvas.vptCoords.tl, pointBR = this.canvas.vptCoords.br; + if (this.intersectsWithRect(pointTL, pointBR, true, calculate)) { + return true; + } + var allPointsAreOutside = this.getCoords(true, calculate).every(function(point) { + return (point.x >= pointBR.x || point.x <= pointTL.x) && + (point.y >= pointBR.y || point.y <= pointTL.y); + }); + return allPointsAreOutside && this._containsCenterOfCanvas(pointTL, pointBR, calculate); + }, + + /** + * Method that returns an object with the object edges in it, given the coordinates of the corners + * @private + * @param {Object} oCoords Coordinates of the object corners + */ + _getImageLines: function(oCoords) { + + var lines = { + topline: { + o: oCoords.tl, + d: oCoords.tr + }, + rightline: { + o: oCoords.tr, + d: oCoords.br + }, + bottomline: { + o: oCoords.br, + d: oCoords.bl + }, + leftline: { + o: oCoords.bl, + d: oCoords.tl + } + }; + + // // debugging + // if (this.canvas.contextTop) { + // this.canvas.contextTop.fillRect(lines.bottomline.d.x, lines.bottomline.d.y, 2, 2); + // this.canvas.contextTop.fillRect(lines.bottomline.o.x, lines.bottomline.o.y, 2, 2); + // + // this.canvas.contextTop.fillRect(lines.leftline.d.x, lines.leftline.d.y, 2, 2); + // this.canvas.contextTop.fillRect(lines.leftline.o.x, lines.leftline.o.y, 2, 2); + // + // this.canvas.contextTop.fillRect(lines.topline.d.x, lines.topline.d.y, 2, 2); + // this.canvas.contextTop.fillRect(lines.topline.o.x, lines.topline.o.y, 2, 2); + // + // this.canvas.contextTop.fillRect(lines.rightline.d.x, lines.rightline.d.y, 2, 2); + // this.canvas.contextTop.fillRect(lines.rightline.o.x, lines.rightline.o.y, 2, 2); + // } + + return lines; + }, + + /** + * Helper method to determine how many cross points are between the 4 object edges + * and the horizontal line determined by a point on canvas + * @private + * @param {fabric.Point} point Point to check + * @param {Object} lines Coordinates of the object being evaluated + */ + // remove yi, not used but left code here just in case. + _findCrossPoints: function(point, lines) { + var b1, b2, a1, a2, xi, // yi, + xcount = 0, + iLine; + + for (var lineKey in lines) { + iLine = lines[lineKey]; + // optimisation 1: line below point. no cross + if ((iLine.o.y < point.y) && (iLine.d.y < point.y)) { + continue; + } + // optimisation 2: line above point. no cross + if ((iLine.o.y >= point.y) && (iLine.d.y >= point.y)) { + continue; + } + // optimisation 3: vertical line case + if ((iLine.o.x === iLine.d.x) && (iLine.o.x >= point.x)) { + xi = iLine.o.x; + // yi = point.y; + } + // calculate the intersection point + else { + b1 = 0; + b2 = (iLine.d.y - iLine.o.y) / (iLine.d.x - iLine.o.x); + a1 = point.y - b1 * point.x; + a2 = iLine.o.y - b2 * iLine.o.x; + + xi = -(a1 - a2) / (b1 - b2); + // yi = a1 + b1 * xi; + } + // dont count xi < point.x cases + if (xi >= point.x) { + xcount += 1; + } + // optimisation 4: specific for square images + if (xcount === 2) { + break; + } + } + return xcount; + }, + + /** + * Returns coordinates of object's bounding rectangle (left, top, width, height) + * the box is intended as aligned to axis of canvas. + * @param {Boolean} [absolute] use coordinates without viewportTransform + * @param {Boolean} [calculate] use coordinates of current position instead of .oCoords / .aCoords + * @return {Object} Object with left, top, width, height properties + */ + getBoundingRect: function(absolute, calculate) { + var coords = this.getCoords(absolute, calculate); + return util.makeBoundingBoxFromPoints(coords); + }, + + /** + * Returns width of an object's bounding box counting transformations + * before 2.0 it was named getWidth(); + * @return {Number} width value + */ + getScaledWidth: function() { + return this._getTransformedDimensions().x; + }, + + /** + * Returns height of an object bounding box counting transformations + * before 2.0 it was named getHeight(); + * @return {Number} height value + */ + getScaledHeight: function() { + return this._getTransformedDimensions().y; + }, + + /** + * Makes sure the scale is valid and modifies it if necessary + * @private + * @param {Number} value + * @return {Number} + */ + _constrainScale: function(value) { + if (Math.abs(value) < this.minScaleLimit) { + if (value < 0) { + return -this.minScaleLimit; + } + else { + return this.minScaleLimit; + } + } + else if (value === 0) { + return 0.0001; + } + return value; + }, + + /** + * Scales an object (equally by x and y) + * @param {Number} value Scale factor + * @return {fabric.Object} thisArg + * @chainable + */ + scale: function(value) { + this._set('scaleX', value); + this._set('scaleY', value); + return this.setCoords(); + }, + + /** + * Scales an object to a given width, with respect to bounding box (scaling by x/y equally) + * @param {Number} value New width value + * @param {Boolean} absolute ignore viewport + * @return {fabric.Object} thisArg + * @chainable + */ + scaleToWidth: function(value, absolute) { + // adjust to bounding rect factor so that rotated shapes would fit as well + var boundingRectFactor = this.getBoundingRect(absolute).width / this.getScaledWidth(); + return this.scale(value / this.width / boundingRectFactor); + }, + + /** + * Scales an object to a given height, with respect to bounding box (scaling by x/y equally) + * @param {Number} value New height value + * @param {Boolean} absolute ignore viewport + * @return {fabric.Object} thisArg + * @chainable + */ + scaleToHeight: function(value, absolute) { + // adjust to bounding rect factor so that rotated shapes would fit as well + var boundingRectFactor = this.getBoundingRect(absolute).height / this.getScaledHeight(); + return this.scale(value / this.height / boundingRectFactor); + }, + + /** + * Calculates and returns the .coords of an object. + * unused by the library, only for the end dev. + * @return {Object} Object with tl, tr, br, bl .... + * @chainable + * @deprecated + */ + calcCoords: function(absolute) { + // this is a compatibility function to avoid removing calcCoords now. + if (absolute) { + return this.calcACoords(); + } + return this.calcOCoords(); + }, + + calcLineCoords: function() { + var vpt = this.getViewportTransform(), + padding = this.padding, angle = degreesToRadians(this.angle), + cos = util.cos(angle), sin = util.sin(angle), + cosP = cos * padding, sinP = sin * padding, cosPSinP = cosP + sinP, + cosPMinusSinP = cosP - sinP, aCoords = this.calcACoords(); + + var lineCoords = { + tl: transformPoint(aCoords.tl, vpt), + tr: transformPoint(aCoords.tr, vpt), + bl: transformPoint(aCoords.bl, vpt), + br: transformPoint(aCoords.br, vpt), + }; + + if (padding) { + lineCoords.tl.x -= cosPMinusSinP; + lineCoords.tl.y -= cosPSinP; + lineCoords.tr.x += cosPSinP; + lineCoords.tr.y -= cosPMinusSinP; + lineCoords.bl.x -= cosPSinP; + lineCoords.bl.y += cosPMinusSinP; + lineCoords.br.x += cosPMinusSinP; + lineCoords.br.y += cosPSinP; + } + + return lineCoords; + }, + + calcOCoords: function() { + var rotateMatrix = this._calcRotateMatrix(), + translateMatrix = this._calcTranslateMatrix(), + vpt = this.getViewportTransform(), + startMatrix = multiplyMatrices(vpt, translateMatrix), + finalMatrix = multiplyMatrices(startMatrix, rotateMatrix), + finalMatrix = multiplyMatrices(finalMatrix, [1 / vpt[0], 0, 0, 1 / vpt[3], 0, 0]), + dim = this._calculateCurrentDimensions(), + coords = {}; + this.forEachControl(function(control, key, fabricObject) { + coords[key] = control.positionHandler(dim, finalMatrix, fabricObject); + }); + + // debug code + // var canvas = this.canvas; + // setTimeout(function() { + // canvas.contextTop.clearRect(0, 0, 700, 700); + // canvas.contextTop.fillStyle = 'green'; + // Object.keys(coords).forEach(function(key) { + // var control = coords[key]; + // canvas.contextTop.fillRect(control.x, control.y, 3, 3); + // }); + // }, 50); + return coords; + }, + + calcACoords: function() { + var rotateMatrix = this._calcRotateMatrix(), + translateMatrix = this._calcTranslateMatrix(), + finalMatrix = multiplyMatrices(translateMatrix, rotateMatrix), + dim = this._getTransformedDimensions(), + w = dim.x / 2, h = dim.y / 2; + return { + // corners + tl: transformPoint({ x: -w, y: -h }, finalMatrix), + tr: transformPoint({ x: w, y: -h }, finalMatrix), + bl: transformPoint({ x: -w, y: h }, finalMatrix), + br: transformPoint({ x: w, y: h }, finalMatrix) + }; + }, + + /** + * Sets corner position coordinates based on current angle, width and height. + * oCoords are used to find the corners + * aCoords are used to quickly find an object on the canvas + * lineCoords are used to quickly find object during pointer events. + * See {@link https://github.com/kangax/fabric.js/wiki/When-to-call-setCoords|When-to-call-setCoords} + * @param {Boolean} [skipCorners] skip calculation of oCoords. + * @return {fabric.Object} thisArg + * @chainable + */ + setCoords: function(skipCorners) { + this.aCoords = this.calcACoords(); + // in case we are in a group, for how the inner group target check works, + // lineCoords are exactly aCoords. Since the vpt gets absorbed by the normalized pointer. + this.lineCoords = this.group ? this.aCoords : this.calcLineCoords(); + if (skipCorners) { + return this; + } + // set coordinates of the draggable boxes in the corners used to scale/rotate the image + this.oCoords = this.calcOCoords(); + this._setCornerCoords && this._setCornerCoords(); + return this; + }, + + /** + * calculate rotation matrix of an object + * @return {Array} rotation matrix for the object + */ + _calcRotateMatrix: function() { + return util.calcRotateMatrix(this); + }, + + /** + * calculate the translation matrix for an object transform + * @return {Array} rotation matrix for the object + */ + _calcTranslateMatrix: function() { + var center = this.getCenterPoint(); + return [1, 0, 0, 1, center.x, center.y]; + }, + + transformMatrixKey: function(skipGroup) { + var sep = '_', prefix = ''; + if (!skipGroup && this.group) { + prefix = this.group.transformMatrixKey(skipGroup) + sep; + }; + return prefix + this.top + sep + this.left + sep + this.scaleX + sep + this.scaleY + + sep + this.skewX + sep + this.skewY + sep + this.angle + sep + this.originX + sep + this.originY + + sep + this.width + sep + this.height + sep + this.strokeWidth + this.flipX + this.flipY; + }, + + /** + * calculate transform matrix that represents the current transformations from the + * object's properties. + * @param {Boolean} [skipGroup] return transform matrix for object not counting parent transformations + * There are some situation in which this is useful to avoid the fake rotation. + * @return {Array} transform matrix for the object + */ + calcTransformMatrix: function(skipGroup) { + var matrix = this.calcOwnMatrix(); + if (skipGroup || !this.group) { + return matrix; + } + var key = this.transformMatrixKey(skipGroup), cache = this.matrixCache || (this.matrixCache = {}); + if (cache.key === key) { + return cache.value; + } + if (this.group) { + matrix = multiplyMatrices(this.group.calcTransformMatrix(false), matrix); + } + cache.key = key; + cache.value = matrix; + return matrix; + }, + + /** + * calculate transform matrix that represents the current transformations from the + * object's properties, this matrix does not include the group transformation + * @return {Array} transform matrix for the object + */ + calcOwnMatrix: function() { + var key = this.transformMatrixKey(true), cache = this.ownMatrixCache || (this.ownMatrixCache = {}); + if (cache.key === key) { + return cache.value; + } + var tMatrix = this._calcTranslateMatrix(), + options = { + angle: this.angle, + translateX: tMatrix[4], + translateY: tMatrix[5], + scaleX: this.scaleX, + scaleY: this.scaleY, + skewX: this.skewX, + skewY: this.skewY, + flipX: this.flipX, + flipY: this.flipY, + }; + cache.key = key; + cache.value = util.composeMatrix(options); + return cache.value; + }, + + /* + * Calculate object dimensions from its properties + * @private + * @deprecated since 3.4.0, please use fabric.util._calcDimensionsTransformMatrix + * not including or including flipX, flipY to emulate the flipping boolean + * @return {Object} .x width dimension + * @return {Object} .y height dimension + */ + _calcDimensionsTransformMatrix: function(skewX, skewY, flipping) { + return util.calcDimensionsMatrix({ + skewX: skewX, + skewY: skewY, + scaleX: this.scaleX * (flipping && this.flipX ? -1 : 1), + scaleY: this.scaleY * (flipping && this.flipY ? -1 : 1) + }); + }, + + /* + * Calculate object dimensions from its properties + * @private + * @return {Object} .x width dimension + * @return {Object} .y height dimension + */ + _getNonTransformedDimensions: function() { + var strokeWidth = this.strokeWidth, + w = this.width + strokeWidth, + h = this.height + strokeWidth; + return { x: w, y: h }; + }, + + /* + * Calculate object bounding box dimensions from its properties scale, skew. + * @param {Number} skewX, a value to override current skewX + * @param {Number} skewY, a value to override current skewY + * @private + * @return {Object} .x width dimension + * @return {Object} .y height dimension + */ + _getTransformedDimensions: function(skewX, skewY) { + if (typeof skewX === 'undefined') { + skewX = this.skewX; + } + if (typeof skewY === 'undefined') { + skewY = this.skewY; + } + var dimensions = this._getNonTransformedDimensions(), dimX, dimY, + noSkew = skewX === 0 && skewY === 0; + + if (this.strokeUniform) { + dimX = this.width; + dimY = this.height; + } + else { + dimX = dimensions.x; + dimY = dimensions.y; + } + if (noSkew) { + return this._finalizeDimensions(dimX * this.scaleX, dimY * this.scaleY); + } + var bbox = util.sizeAfterTransform(dimX, dimY, { + scaleX: this.scaleX, + scaleY: this.scaleY, + skewX: skewX, + skewY: skewY, + }); + return this._finalizeDimensions(bbox.x, bbox.y); + }, + + /* + * Calculate object bounding box dimensions from its properties scale, skew. + * @param Number width width of the bbox + * @param Number height height of the bbox + * @private + * @return {Object} .x finalized width dimension + * @return {Object} .y finalized height dimension + */ + _finalizeDimensions: function(width, height) { + return this.strokeUniform ? + { x: width + this.strokeWidth, y: height + this.strokeWidth } + : + { x: width, y: height }; + }, + + /* + * Calculate object dimensions for controls box, including padding and canvas zoom. + * and active selection + * private + */ + _calculateCurrentDimensions: function() { + var vpt = this.getViewportTransform(), + dim = this._getTransformedDimensions(), + p = transformPoint(dim, vpt, true); + return p.scalarAdd(2 * this.padding); + }, + }); +})(); +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Moves an object to the bottom of the stack of drawn objects + * @return {fabric.Object} thisArg + * @chainable + */ + sendToBack: function() { + if (this.group) { + fabric.StaticCanvas.prototype.sendToBack.call(this.group, this); + } + else if (this.canvas) { + this.canvas.sendToBack(this); + } + return this; + }, + + /** + * Moves an object to the top of the stack of drawn objects + * @return {fabric.Object} thisArg + * @chainable + */ + bringToFront: function() { + if (this.group) { + fabric.StaticCanvas.prototype.bringToFront.call(this.group, this); + } + else if (this.canvas) { + this.canvas.bringToFront(this); + } + return this; + }, + + /** + * Moves an object down in stack of drawn objects + * @param {Boolean} [intersecting] If `true`, send object behind next lower intersecting object + * @return {fabric.Object} thisArg + * @chainable + */ + sendBackwards: function(intersecting) { + if (this.group) { + fabric.StaticCanvas.prototype.sendBackwards.call(this.group, this, intersecting); + } + else if (this.canvas) { + this.canvas.sendBackwards(this, intersecting); + } + return this; + }, + + /** + * Moves an object up in stack of drawn objects + * @param {Boolean} [intersecting] If `true`, send object in front of next upper intersecting object + * @return {fabric.Object} thisArg + * @chainable + */ + bringForward: function(intersecting) { + if (this.group) { + fabric.StaticCanvas.prototype.bringForward.call(this.group, this, intersecting); + } + else if (this.canvas) { + this.canvas.bringForward(this, intersecting); + } + return this; + }, + + /** + * Moves an object to specified level in stack of drawn objects + * @param {Number} index New position of object + * @return {fabric.Object} thisArg + * @chainable + */ + moveTo: function(index) { + if (this.group && this.group.type !== 'activeSelection') { + fabric.StaticCanvas.prototype.moveTo.call(this.group, this, index); + } + else if (this.canvas) { + this.canvas.moveTo(this, index); + } + return this; + } +}); +/* _TO_SVG_START_ */ +(function() { + function getSvgColorString(prop, value) { + if (!value) { + return prop + ': none; '; + } + else if (value.toLive) { + return prop + ': url(#SVGID_' + value.id + '); '; + } + else { + var color = new fabric.Color(value), + str = prop + ': ' + color.toRgb() + '; ', + opacity = color.getAlpha(); + if (opacity !== 1) { + //change the color in rgb + opacity + str += prop + '-opacity: ' + opacity.toString() + '; '; + } + return str; + } + } + + var toFixed = fabric.util.toFixed; + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + /** + * Returns styles-string for svg-export + * @param {Boolean} skipShadow a boolean to skip shadow filter output + * @return {String} + */ + getSvgStyles: function(skipShadow) { + + var fillRule = this.fillRule ? this.fillRule : 'nonzero', + strokeWidth = this.strokeWidth ? this.strokeWidth : '0', + strokeDashArray = this.strokeDashArray ? this.strokeDashArray.join(' ') : 'none', + strokeDashOffset = this.strokeDashOffset ? this.strokeDashOffset : '0', + strokeLineCap = this.strokeLineCap ? this.strokeLineCap : 'butt', + strokeLineJoin = this.strokeLineJoin ? this.strokeLineJoin : 'miter', + strokeMiterLimit = this.strokeMiterLimit ? this.strokeMiterLimit : '4', + opacity = typeof this.opacity !== 'undefined' ? this.opacity : '1', + visibility = this.visible ? '' : ' visibility: hidden;', + filter = skipShadow ? '' : this.getSvgFilter(), + fill = getSvgColorString('fill', this.fill), + stroke = getSvgColorString('stroke', this.stroke); + + return [ + stroke, + 'stroke-width: ', strokeWidth, '; ', + 'stroke-dasharray: ', strokeDashArray, '; ', + 'stroke-linecap: ', strokeLineCap, '; ', + 'stroke-dashoffset: ', strokeDashOffset, '; ', + 'stroke-linejoin: ', strokeLineJoin, '; ', + 'stroke-miterlimit: ', strokeMiterLimit, '; ', + fill, + 'fill-rule: ', fillRule, '; ', + 'opacity: ', opacity, ';', + filter, + visibility + ].join(''); + }, + + /** + * Returns styles-string for svg-export + * @param {Object} style the object from which to retrieve style properties + * @param {Boolean} useWhiteSpace a boolean to include an additional attribute in the style. + * @return {String} + */ + getSvgSpanStyles: function(style, useWhiteSpace) { + var term = '; '; + var fontFamily = style.fontFamily ? + 'font-family: ' + (((style.fontFamily.indexOf('\'') === -1 && style.fontFamily.indexOf('"') === -1) ? + '\'' + style.fontFamily + '\'' : style.fontFamily)) + term : ''; + var strokeWidth = style.strokeWidth ? 'stroke-width: ' + style.strokeWidth + term : '', + fontFamily = fontFamily, + fontSize = style.fontSize ? 'font-size: ' + style.fontSize + 'px' + term : '', + fontStyle = style.fontStyle ? 'font-style: ' + style.fontStyle + term : '', + fontWeight = style.fontWeight ? 'font-weight: ' + style.fontWeight + term : '', + fill = style.fill ? getSvgColorString('fill', style.fill) : '', + stroke = style.stroke ? getSvgColorString('stroke', style.stroke) : '', + textDecoration = this.getSvgTextDecoration(style), + deltaY = style.deltaY ? 'baseline-shift: ' + (-style.deltaY) + '; ' : ''; + if (textDecoration) { + textDecoration = 'text-decoration: ' + textDecoration + term; + } + + return [ + stroke, + strokeWidth, + fontFamily, + fontSize, + fontStyle, + fontWeight, + textDecoration, + fill, + deltaY, + useWhiteSpace ? 'white-space: pre; ' : '' + ].join(''); + }, + + /** + * Returns text-decoration property for svg-export + * @param {Object} style the object from which to retrieve style properties + * @return {String} + */ + getSvgTextDecoration: function(style) { + return ['overline', 'underline', 'line-through'].filter(function(decoration) { + return style[decoration.replace('-', '')]; + }).join(' '); + }, + + /** + * Returns filter for svg shadow + * @return {String} + */ + getSvgFilter: function() { + return this.shadow ? 'filter: url(#SVGID_' + this.shadow.id + ');' : ''; + }, + + /** + * Returns id attribute for svg output + * @return {String} + */ + getSvgCommons: function() { + return [ + this.id ? 'id="' + this.id + '" ' : '', + this.clipPath ? 'clip-path="url(#' + this.clipPath.clipPathId + ')" ' : '', + ].join(''); + }, + + /** + * Returns transform-string for svg-export + * @param {Boolean} use the full transform or the single object one. + * @return {String} + */ + getSvgTransform: function(full, additionalTransform) { + var transform = full ? this.calcTransformMatrix() : this.calcOwnMatrix(), + svgTransform = 'transform="' + fabric.util.matrixToSVG(transform); + return svgTransform + + (additionalTransform || '') + '" '; + }, + + _setSVGBg: function(textBgRects) { + if (this.backgroundColor) { + var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS; + textBgRects.push( + '\t\t\n'); + } + }, + + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + return this._createBaseSVGMarkup(this._toSVG(reviver), { reviver: reviver }); + }, + + /** + * Returns svg clipPath representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toClipPathSVG: function(reviver) { + return '\t' + this._createBaseClipPathSVGMarkup(this._toSVG(reviver), { reviver: reviver }); + }, + + /** + * @private + */ + _createBaseClipPathSVGMarkup: function(objectMarkup, options) { + options = options || {}; + var reviver = options.reviver, + additionalTransform = options.additionalTransform || '', + commonPieces = [ + this.getSvgTransform(true, additionalTransform), + this.getSvgCommons(), + ].join(''), + // insert commons in the markup, style and svgCommons + index = objectMarkup.indexOf('COMMON_PARTS'); + objectMarkup[index] = commonPieces; + return reviver ? reviver(objectMarkup.join('')) : objectMarkup.join(''); + }, + + /** + * @private + */ + _createBaseSVGMarkup: function(objectMarkup, options) { + options = options || {}; + var noStyle = options.noStyle, + reviver = options.reviver, + styleInfo = noStyle ? '' : 'style="' + this.getSvgStyles() + '" ', + shadowInfo = options.withShadow ? 'style="' + this.getSvgFilter() + '" ' : '', + clipPath = this.clipPath, + vectorEffect = this.strokeUniform ? 'vector-effect="non-scaling-stroke" ' : '', + absoluteClipPath = clipPath && clipPath.absolutePositioned, + stroke = this.stroke, fill = this.fill, shadow = this.shadow, + commonPieces, markup = [], clipPathMarkup, + // insert commons in the markup, style and svgCommons + index = objectMarkup.indexOf('COMMON_PARTS'), + additionalTransform = options.additionalTransform; + if (clipPath) { + clipPath.clipPathId = 'CLIPPATH_' + fabric.Object.__uid++; + clipPathMarkup = '\n' + + clipPath.toClipPathSVG(reviver) + + '\n'; + } + if (absoluteClipPath) { + markup.push( + '\n' + ); + } + markup.push( + '\n' + ); + commonPieces = [ + styleInfo, + vectorEffect, + noStyle ? '' : this.addPaintOrder(), ' ', + additionalTransform ? 'transform="' + additionalTransform + '" ' : '', + ].join(''); + objectMarkup[index] = commonPieces; + if (fill && fill.toLive) { + markup.push(fill.toSVG(this)); + } + if (stroke && stroke.toLive) { + markup.push(stroke.toSVG(this)); + } + if (shadow) { + markup.push(shadow.toSVG(this)); + } + if (clipPath) { + markup.push(clipPathMarkup); + } + markup.push(objectMarkup.join('')); + markup.push('\n'); + absoluteClipPath && markup.push('\n'); + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + + addPaintOrder: function() { + return this.paintFirst !== 'fill' ? ' paint-order="' + this.paintFirst + '" ' : ''; + } + }); +})(); +/* _TO_SVG_END_ */ +(function() { + + var extend = fabric.util.object.extend, + originalSet = 'stateProperties'; + + /* + Depends on `stateProperties` + */ + function saveProps(origin, destination, props) { + var tmpObj = { }, deep = true; + props.forEach(function(prop) { + tmpObj[prop] = origin[prop]; + }); + + extend(origin[destination], tmpObj, deep); + } + + function _isEqual(origValue, currentValue, firstPass) { + if (origValue === currentValue) { + // if the objects are identical, return + return true; + } + else if (Array.isArray(origValue)) { + if (!Array.isArray(currentValue) || origValue.length !== currentValue.length) { + return false; + } + for (var i = 0, len = origValue.length; i < len; i++) { + if (!_isEqual(origValue[i], currentValue[i])) { + return false; + } + } + return true; + } + else if (origValue && typeof origValue === 'object') { + var keys = Object.keys(origValue), key; + if (!currentValue || + typeof currentValue !== 'object' || + (!firstPass && keys.length !== Object.keys(currentValue).length) + ) { + return false; + } + for (var i = 0, len = keys.length; i < len; i++) { + key = keys[i]; + // since clipPath is in the statefull cache list and the clipPath objects + // would be iterated as an object, this would lead to possible infinite recursion + // we do not want to compare those. + if (key === 'canvas' || key === 'group') { + continue; + } + if (!_isEqual(origValue[key], currentValue[key])) { + return false; + } + } + return true; + } + } + + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Returns true if object state (one of its state properties) was changed + * @param {String} [propertySet] optional name for the set of property we want to save + * @return {Boolean} true if instance' state has changed since `{@link fabric.Object#saveState}` was called + */ + hasStateChanged: function(propertySet) { + propertySet = propertySet || originalSet; + var dashedPropertySet = '_' + propertySet; + if (Object.keys(this[dashedPropertySet]).length < this[propertySet].length) { + return true; + } + return !_isEqual(this[dashedPropertySet], this, true); + }, + + /** + * Saves state of an object + * @param {Object} [options] Object with additional `stateProperties` array to include when saving state + * @return {fabric.Object} thisArg + */ + saveState: function(options) { + var propertySet = options && options.propertySet || originalSet, + destination = '_' + propertySet; + if (!this[destination]) { + return this.setupState(options); + } + saveProps(this, destination, this[propertySet]); + if (options && options.stateProperties) { + saveProps(this, destination, options.stateProperties); + } + return this; + }, + + /** + * Setups state of an object + * @param {Object} [options] Object with additional `stateProperties` array to include when saving state + * @return {fabric.Object} thisArg + */ + setupState: function(options) { + options = options || { }; + var propertySet = options.propertySet || originalSet; + options.propertySet = propertySet; + this['_' + propertySet] = { }; + this.saveState(options); + return this; + } + }); +})(); +(function() { + + var degreesToRadians = fabric.util.degreesToRadians; + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + /** + * Determines which corner has been clicked + * @private + * @param {Object} pointer The pointer indicating the mouse position + * @return {String|Boolean} corner code (tl, tr, bl, br, etc.), or false if nothing is found + */ + _findTargetCorner: function(pointer, forTouch) { + // objects in group, anykind, are not self modificable, + // must not return an hovered corner. + if (!this.hasControls || this.group || (!this.canvas || this.canvas._activeObject !== this)) { + return false; + } + + var ex = pointer.x, + ey = pointer.y, + xPoints, + lines, keys = Object.keys(this.oCoords), + j = keys.length - 1, i; + this.__corner = 0; + + // cycle in reverse order so we pick first the one on top + for (; j >= 0; j--) { + i = keys[j]; + if (!this.isControlVisible(i)) { + continue; + } + + lines = this._getImageLines(forTouch ? this.oCoords[i].touchCorner : this.oCoords[i].corner); + // debugging + + // this.canvas.contextTop.fillRect(lines.bottomline.d.x, lines.bottomline.d.y, 2, 2); + // this.canvas.contextTop.fillRect(lines.bottomline.o.x, lines.bottomline.o.y, 2, 2); + // + // this.canvas.contextTop.fillRect(lines.leftline.d.x, lines.leftline.d.y, 2, 2); + // this.canvas.contextTop.fillRect(lines.leftline.o.x, lines.leftline.o.y, 2, 2); + // + // this.canvas.contextTop.fillRect(lines.topline.d.x, lines.topline.d.y, 2, 2); + // this.canvas.contextTop.fillRect(lines.topline.o.x, lines.topline.o.y, 2, 2); + // + // this.canvas.contextTop.fillRect(lines.rightline.d.x, lines.rightline.d.y, 2, 2); + // this.canvas.contextTop.fillRect(lines.rightline.o.x, lines.rightline.o.y, 2, 2); + + xPoints = this._findCrossPoints({ x: ex, y: ey }, lines); + if (xPoints !== 0 && xPoints % 2 === 1) { + this.__corner = i; + return i; + } + } + return false; + }, + + /** + * Calls a function for each control. The function gets called, + * with the control, the object that is calling the iterator and the control's key + * @param {Function} fn function to iterate over the controls over + */ + forEachControl: function(fn) { + for (var i in this.controls) { + fn(this.controls[i], i, this); + }; + }, + + /** + * Sets the coordinates of the draggable boxes in the corners of + * the image used to scale/rotate it. + * note: if we would switch to ROUND corner area, all of this would disappear. + * everything would resolve to a single point and a pythagorean theorem for the distance + * @private + */ + _setCornerCoords: function() { + var coords = this.oCoords, + newTheta = degreesToRadians(45 - this.angle), + cosTheta = fabric.util.cos(newTheta), + sinTheta = fabric.util.sin(newTheta), + /* Math.sqrt(2 * Math.pow(this.cornerSize, 2)) / 2, */ + /* 0.707106 stands for sqrt(2)/2 */ + cornerHypotenuse = this.cornerSize * 0.707106, + touchHypotenuse = this.touchCornerSize * 0.707106, + cosHalfOffset = cornerHypotenuse * cosTheta, + sinHalfOffset = cornerHypotenuse * sinTheta, + touchCosHalfOffset = touchHypotenuse * cosTheta, + touchSinHalfOffset = touchHypotenuse * sinTheta, + x, y; + + for (var control in coords) { + x = coords[control].x; + y = coords[control].y; + coords[control].corner = { + tl: { + x: x - sinHalfOffset, + y: y - cosHalfOffset + }, + tr: { + x: x + cosHalfOffset, + y: y - sinHalfOffset + }, + bl: { + x: x - cosHalfOffset, + y: y + sinHalfOffset + }, + br: { + x: x + sinHalfOffset, + y: y + cosHalfOffset + } + }; + coords[control].touchCorner = { + tl: { + x: x - touchSinHalfOffset, + y: y - touchCosHalfOffset + }, + tr: { + x: x + touchCosHalfOffset, + y: y - touchSinHalfOffset + }, + bl: { + x: x - touchCosHalfOffset, + y: y + touchSinHalfOffset + }, + br: { + x: x + touchSinHalfOffset, + y: y + touchCosHalfOffset + } + }; + } + }, + + /** + * Draws a colored layer behind the object, inside its selection borders. + * Requires public options: padding, selectionBackgroundColor + * this function is called when the context is transformed + * has checks to be skipped when the object is on a staticCanvas + * @param {CanvasRenderingContext2D} ctx Context to draw on + * @return {fabric.Object} thisArg + * @chainable + */ + drawSelectionBackground: function(ctx) { + if (!this.selectionBackgroundColor || + (this.canvas && !this.canvas.interactive) || + (this.canvas && this.canvas._activeObject !== this) + ) { + return this; + } + ctx.save(); + var center = this.getCenterPoint(), wh = this._calculateCurrentDimensions(), + vpt = this.canvas.viewportTransform; + ctx.translate(center.x, center.y); + ctx.scale(1 / vpt[0], 1 / vpt[3]); + ctx.rotate(degreesToRadians(this.angle)); + ctx.fillStyle = this.selectionBackgroundColor; + ctx.fillRect(-wh.x / 2, -wh.y / 2, wh.x, wh.y); + ctx.restore(); + return this; + }, + + /** + * Draws borders of an object's bounding box. + * Requires public properties: width, height + * Requires public options: padding, borderColor + * @param {CanvasRenderingContext2D} ctx Context to draw on + * @param {Object} styleOverride object to override the object style + * @return {fabric.Object} thisArg + * @chainable + */ + drawBorders: function(ctx, styleOverride) { + styleOverride = styleOverride || {}; + var wh = this._calculateCurrentDimensions(), + strokeWidth = this.borderScaleFactor, + width = wh.x + strokeWidth, + height = wh.y + strokeWidth, + hasControls = typeof styleOverride.hasControls !== 'undefined' ? + styleOverride.hasControls : this.hasControls, + shouldStroke = false; + + ctx.save(); + ctx.strokeStyle = styleOverride.borderColor || this.borderColor; + this._setLineDash(ctx, styleOverride.borderDashArray || this.borderDashArray, null); + + ctx.strokeRect( + -width / 2, + -height / 2, + width, + height + ); + + if (hasControls) { + ctx.beginPath(); + this.forEachControl(function(control, key, fabricObject) { + // in this moment, the ctx is centered on the object. + // width and height of the above function are the size of the bbox. + if (control.withConnection && control.getVisibility(fabricObject, key)) { + // reset movement for each control + shouldStroke = true; + ctx.moveTo(control.x * width, control.y * height); + ctx.lineTo( + control.x * width + control.offsetX, + control.y * height + control.offsetY + ); + } + }); + if (shouldStroke) { + ctx.stroke(); + } + } + ctx.restore(); + return this; + }, + + /** + * Draws borders of an object's bounding box when it is inside a group. + * Requires public properties: width, height + * Requires public options: padding, borderColor + * @param {CanvasRenderingContext2D} ctx Context to draw on + * @param {object} options object representing current object parameters + * @param {Object} styleOverride object to override the object style + * @return {fabric.Object} thisArg + * @chainable + */ + drawBordersInGroup: function(ctx, options, styleOverride) { + styleOverride = styleOverride || {}; + var bbox = fabric.util.sizeAfterTransform(this.width, this.height, options), + strokeWidth = this.strokeWidth, + strokeUniform = this.strokeUniform, + borderScaleFactor = this.borderScaleFactor, + width = + bbox.x + strokeWidth * (strokeUniform ? this.canvas.getZoom() : options.scaleX) + borderScaleFactor, + height = + bbox.y + strokeWidth * (strokeUniform ? this.canvas.getZoom() : options.scaleY) + borderScaleFactor; + ctx.save(); + this._setLineDash(ctx, styleOverride.borderDashArray || this.borderDashArray, null); + ctx.strokeStyle = styleOverride.borderColor || this.borderColor; + ctx.strokeRect( + -width / 2, + -height / 2, + width, + height + ); + + ctx.restore(); + return this; + }, + + /** + * Draws corners of an object's bounding box. + * Requires public properties: width, height + * Requires public options: cornerSize, padding + * @param {CanvasRenderingContext2D} ctx Context to draw on + * @param {Object} styleOverride object to override the object style + * @return {fabric.Object} thisArg + * @chainable + */ + drawControls: function(ctx, styleOverride) { + styleOverride = styleOverride || {}; + ctx.save(); + ctx.setTransform(this.canvas.getRetinaScaling(), 0, 0, this.canvas.getRetinaScaling(), 0, 0); + ctx.strokeStyle = ctx.fillStyle = styleOverride.cornerColor || this.cornerColor; + if (!this.transparentCorners) { + ctx.strokeStyle = styleOverride.cornerStrokeColor || this.cornerStrokeColor; + } + this._setLineDash(ctx, styleOverride.cornerDashArray || this.cornerDashArray, null); + this.setCoords(); + this.forEachControl(function(control, key, fabricObject) { + if (control.getVisibility(fabricObject, key)) { + control.render(ctx, + fabricObject.oCoords[key].x, + fabricObject.oCoords[key].y, styleOverride, fabricObject); + } + }); + ctx.restore(); + + return this; + }, + + /** + * Returns true if the specified control is visible, false otherwise. + * @param {String} controlKey The key of the control. Possible values are 'tl', 'tr', 'br', 'bl', 'ml', 'mt', 'mr', 'mb', 'mtr'. + * @returns {Boolean} true if the specified control is visible, false otherwise + */ + isControlVisible: function(controlKey) { + return this.controls[controlKey] && this.controls[controlKey].getVisibility(this, controlKey); + }, + + /** + * Sets the visibility of the specified control. + * @param {String} controlKey The key of the control. Possible values are 'tl', 'tr', 'br', 'bl', 'ml', 'mt', 'mr', 'mb', 'mtr'. + * @param {Boolean} visible true to set the specified control visible, false otherwise + * @return {fabric.Object} thisArg + * @chainable + */ + setControlVisible: function(controlKey, visible) { + if (!this._controlsVisibility) { + this._controlsVisibility = {}; + } + this._controlsVisibility[controlKey] = visible; + return this; + }, + + /** + * Sets the visibility state of object controls. + * @param {Object} [options] Options object + * @param {Boolean} [options.bl] true to enable the bottom-left control, false to disable it + * @param {Boolean} [options.br] true to enable the bottom-right control, false to disable it + * @param {Boolean} [options.mb] true to enable the middle-bottom control, false to disable it + * @param {Boolean} [options.ml] true to enable the middle-left control, false to disable it + * @param {Boolean} [options.mr] true to enable the middle-right control, false to disable it + * @param {Boolean} [options.mt] true to enable the middle-top control, false to disable it + * @param {Boolean} [options.tl] true to enable the top-left control, false to disable it + * @param {Boolean} [options.tr] true to enable the top-right control, false to disable it + * @param {Boolean} [options.mtr] true to enable the middle-top-rotate control, false to disable it + * @return {fabric.Object} thisArg + * @chainable + */ + setControlsVisibility: function(options) { + options || (options = { }); + + for (var p in options) { + this.setControlVisible(p, options[p]); + } + return this; + }, + + + /** + * This callback function is called every time _discardActiveObject or _setActiveObject + * try to to deselect this object. If the function returns true, the process is cancelled + * @param {Object} [options] options sent from the upper functions + * @param {Event} [options.e] event if the process is generated by an event + */ + onDeselect: function() { + // implemented by sub-classes, as needed. + }, + + + /** + * This callback function is called every time _discardActiveObject or _setActiveObject + * try to to select this object. If the function returns true, the process is cancelled + * @param {Object} [options] options sent from the upper functions + * @param {Event} [options.e] event if the process is generated by an event + */ + onSelect: function() { + // implemented by sub-classes, as needed. + } + }); +})(); +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Animation duration (in ms) for fx* methods + * @type Number + * @default + */ + FX_DURATION: 500, + + /** + * Centers object horizontally with animation. + * @param {fabric.Object} object Object to center + * @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxCenterObjectH: function (object, callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: object.left, + endValue: this.getCenter().left, + duration: this.FX_DURATION, + onChange: function(value) { + object.set('left', value); + _this.requestRenderAll(); + onChange(); + }, + onComplete: function() { + object.setCoords(); + onComplete(); + } + }); + + return this; + }, + + /** + * Centers object vertically with animation. + * @param {fabric.Object} object Object to center + * @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxCenterObjectV: function (object, callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: object.top, + endValue: this.getCenter().top, + duration: this.FX_DURATION, + onChange: function(value) { + object.set('top', value); + _this.requestRenderAll(); + onChange(); + }, + onComplete: function() { + object.setCoords(); + onComplete(); + } + }); + + return this; + }, + + /** + * Same as `fabric.Canvas#remove` but animated + * @param {fabric.Object} object Object to remove + * @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxRemove: function (object, callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: object.opacity, + endValue: 0, + duration: this.FX_DURATION, + onChange: function(value) { + object.set('opacity', value); + _this.requestRenderAll(); + onChange(); + }, + onComplete: function () { + _this.remove(object); + onComplete(); + } + }); + + return this; + } +}); + +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + /** + * Animates object's properties + * @param {String|Object} property Property to animate (if string) or properties to animate (if object) + * @param {Number|Object} value Value to animate property to (if string was given first) or options object + * @return {fabric.Object} thisArg + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2#animation} + * @chainable + * + * As object — multiple properties + * + * object.animate({ left: ..., top: ... }); + * object.animate({ left: ..., top: ... }, { duration: ... }); + * + * As string — one property + * + * object.animate('left', ...); + * object.animate('left', { duration: ... }); + * + */ + animate: function() { + if (arguments[0] && typeof arguments[0] === 'object') { + var propsToAnimate = [], prop, skipCallbacks; + for (prop in arguments[0]) { + propsToAnimate.push(prop); + } + for (var i = 0, len = propsToAnimate.length; i < len; i++) { + prop = propsToAnimate[i]; + skipCallbacks = i !== len - 1; + this._animate(prop, arguments[0][prop], arguments[1], skipCallbacks); + } + } + else { + this._animate.apply(this, arguments); + } + return this; + }, + + /** + * @private + * @param {String} property Property to animate + * @param {String} to Value to animate to + * @param {Object} [options] Options object + * @param {Boolean} [skipCallbacks] When true, callbacks like onchange and oncomplete are not invoked + */ + _animate: function(property, to, options, skipCallbacks) { + var _this = this, propPair; + + to = to.toString(); + + if (!options) { + options = { }; + } + else { + options = fabric.util.object.clone(options); + } + + if (~property.indexOf('.')) { + propPair = property.split('.'); + } + + var propIsColor = + _this.colorProperties.indexOf(property) > -1 || + (propPair && _this.colorProperties.indexOf(propPair[1]) > -1); + + var currentValue = propPair + ? this.get(propPair[0])[propPair[1]] + : this.get(property); + + if (!('from' in options)) { + options.from = currentValue; + } + + if (!propIsColor) { + if (~to.indexOf('=')) { + to = currentValue + parseFloat(to.replace('=', '')); + } + else { + to = parseFloat(to); + } + } + + var _options = { + startValue: options.from, + endValue: to, + byValue: options.by, + easing: options.easing, + duration: options.duration, + abort: options.abort && function () { + return options.abort.call(_this); + }, + onChange: function (value, valueProgress, timeProgress) { + if (propPair) { + _this[propPair[0]][propPair[1]] = value; + } + else { + _this.set(property, value); + } + if (skipCallbacks) { + return; + } + options.onChange && options.onChange(value, valueProgress, timeProgress); + }, + onComplete: function (value, valueProgress, timeProgress) { + if (skipCallbacks) { + return; + } + + _this.setCoords(); + options.onComplete && options.onComplete(value, valueProgress, timeProgress); + } + }; + + if (propIsColor) { + fabric.util.animateColor(_options.startValue, _options.endValue, _options.duration, _options); + } + else { + fabric.util.animate(_options); + } + } +}); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + clone = fabric.util.object.clone, + coordProps = { x1: 1, x2: 1, y1: 1, y2: 1 }, + supportsLineDash = fabric.StaticCanvas.supports('setLineDash'); + + if (fabric.Line) { + fabric.warn('fabric.Line is already defined'); + return; + } + + /** + * Line class + * @class fabric.Line + * @extends fabric.Object + * @see {@link fabric.Line#initialize} for constructor definition + */ + fabric.Line = fabric.util.createClass(fabric.Object, /** @lends fabric.Line.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'line', + + /** + * x value or first line edge + * @type Number + * @default + */ + x1: 0, + + /** + * y value or first line edge + * @type Number + * @default + */ + y1: 0, + + /** + * x value or second line edge + * @type Number + * @default + */ + x2: 0, + + /** + * y value or second line edge + * @type Number + * @default + */ + y2: 0, + + cacheProperties: fabric.Object.prototype.cacheProperties.concat('x1', 'x2', 'y1', 'y2'), + + /** + * Constructor + * @param {Array} [points] Array of points + * @param {Object} [options] Options object + * @return {fabric.Line} thisArg + */ + initialize: function(points, options) { + if (!points) { + points = [0, 0, 0, 0]; + } + + this.callSuper('initialize', options); + + this.set('x1', points[0]); + this.set('y1', points[1]); + this.set('x2', points[2]); + this.set('y2', points[3]); + + this._setWidthHeight(options); + }, + + /** + * @private + * @param {Object} [options] Options + */ + _setWidthHeight: function(options) { + options || (options = { }); + + this.width = Math.abs(this.x2 - this.x1); + this.height = Math.abs(this.y2 - this.y1); + + this.left = 'left' in options + ? options.left + : this._getLeftToOriginX(); + + this.top = 'top' in options + ? options.top + : this._getTopToOriginY(); + }, + + /** + * @private + * @param {String} key + * @param {*} value + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + if (typeof coordProps[key] !== 'undefined') { + this._setWidthHeight(); + } + return this; + }, + + /** + * @private + * @return {Number} leftToOriginX Distance from left edge of canvas to originX of Line. + */ + _getLeftToOriginX: makeEdgeToOriginGetter( + { // property names + origin: 'originX', + axis1: 'x1', + axis2: 'x2', + dimension: 'width' + }, + { // possible values of origin + nearest: 'left', + center: 'center', + farthest: 'right' + } + ), + + /** + * @private + * @return {Number} topToOriginY Distance from top edge of canvas to originY of Line. + */ + _getTopToOriginY: makeEdgeToOriginGetter( + { // property names + origin: 'originY', + axis1: 'y1', + axis2: 'y2', + dimension: 'height' + }, + { // possible values of origin + nearest: 'top', + center: 'center', + farthest: 'bottom' + } + ), + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + ctx.beginPath(); + + if (!this.strokeDashArray || this.strokeDashArray && supportsLineDash) { + // move from center (of virtual box) to its left/top corner + // we can't assume x1, y1 is top left and x2, y2 is bottom right + var p = this.calcLinePoints(); + ctx.moveTo(p.x1, p.y1); + ctx.lineTo(p.x2, p.y2); + } + + ctx.lineWidth = this.strokeWidth; + + // TODO: test this + // make sure setting "fill" changes color of a line + // (by copying fillStyle to strokeStyle, since line is stroked, not filled) + var origStrokeStyle = ctx.strokeStyle; + ctx.strokeStyle = this.stroke || ctx.fillStyle; + this.stroke && this._renderStroke(ctx); + ctx.strokeStyle = origStrokeStyle; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var p = this.calcLinePoints(); + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, p.x1, p.y1, p.x2, p.y2, this.strokeDashArray); + ctx.closePath(); + }, + + /** + * This function is an helper for svg import. it returns the center of the object in the svg + * untransformed coordinates + * @private + * @return {Object} center point from element coordinates + */ + _findCenterFromElement: function() { + return { + x: (this.x1 + this.x2) / 2, + y: (this.y1 + this.y2) / 2, + }; + }, + + /** + * Returns object representation of an instance + * @methd toObject + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), this.calcLinePoints()); + }, + + /* + * Calculate object dimensions from its properties + * @private + */ + _getNonTransformedDimensions: function() { + var dim = this.callSuper('_getNonTransformedDimensions'); + if (this.strokeLineCap === 'butt') { + if (this.width === 0) { + dim.y -= this.strokeWidth; + } + if (this.height === 0) { + dim.x -= this.strokeWidth; + } + } + return dim; + }, + + /** + * Recalculates line points given width and height + * @private + */ + calcLinePoints: function() { + var xMult = this.x1 <= this.x2 ? -1 : 1, + yMult = this.y1 <= this.y2 ? -1 : 1, + x1 = (xMult * this.width * 0.5), + y1 = (yMult * this.height * 0.5), + x2 = (xMult * this.width * -0.5), + y2 = (yMult * this.height * -0.5); + + return { + x1: x1, + x2: x2, + y1: y1, + y2: y2 + }; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + var p = this.calcLinePoints(); + return [ + '\n' + ]; + }, + /* _TO_SVG_END_ */ + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Line.fromElement}) + * @static + * @memberOf fabric.Line + * @see http://www.w3.org/TR/SVG/shapes.html#LineElement + */ + fabric.Line.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x1 y1 x2 y2'.split(' ')); + + /** + * Returns fabric.Line instance from an SVG element + * @static + * @memberOf fabric.Line + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @param {Function} [callback] callback function invoked after parsing + */ + fabric.Line.fromElement = function(element, callback, options) { + options = options || { }; + var parsedAttributes = fabric.parseAttributes(element, fabric.Line.ATTRIBUTE_NAMES), + points = [ + parsedAttributes.x1 || 0, + parsedAttributes.y1 || 0, + parsedAttributes.x2 || 0, + parsedAttributes.y2 || 0 + ]; + callback(new fabric.Line(points, extend(parsedAttributes, options))); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Line instance from an object representation + * @static + * @memberOf fabric.Line + * @param {Object} object Object to create an instance from + * @param {function} [callback] invoked with new instance as first argument + */ + fabric.Line.fromObject = function(object, callback) { + function _callback(instance) { + delete instance.points; + callback && callback(instance); + }; + var options = clone(object, true); + options.points = [object.x1, object.y1, object.x2, object.y2]; + fabric.Object._fromObject('Line', options, _callback, 'points'); + }; + + /** + * Produces a function that calculates distance from canvas edge to Line origin. + */ + function makeEdgeToOriginGetter(propertyNames, originValues) { + var origin = propertyNames.origin, + axis1 = propertyNames.axis1, + axis2 = propertyNames.axis2, + dimension = propertyNames.dimension, + nearest = originValues.nearest, + center = originValues.center, + farthest = originValues.farthest; + + return function() { + switch (this.get(origin)) { + case nearest: + return Math.min(this.get(axis1), this.get(axis2)); + case center: + return Math.min(this.get(axis1), this.get(axis2)) + (0.5 * this.get(dimension)); + case farthest: + return Math.max(this.get(axis1), this.get(axis2)); + } + }; + + } + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + pi = Math.PI; + + if (fabric.Circle) { + fabric.warn('fabric.Circle is already defined.'); + return; + } + + /** + * Circle class + * @class fabric.Circle + * @extends fabric.Object + * @see {@link fabric.Circle#initialize} for constructor definition + */ + fabric.Circle = fabric.util.createClass(fabric.Object, /** @lends fabric.Circle.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'circle', + + /** + * Radius of this circle + * @type Number + * @default + */ + radius: 0, + + /** + * Start angle of the circle, moving clockwise + * deprectated type, this should be in degree, this was an oversight. + * probably will change to degrees in next major version + * @type Number + * @default 0 + */ + startAngle: 0, + + /** + * End angle of the circle + * deprectated type, this should be in degree, this was an oversight. + * probably will change to degrees in next major version + * @type Number + * @default 2Pi + */ + endAngle: pi * 2, + + cacheProperties: fabric.Object.prototype.cacheProperties.concat('radius', 'startAngle', 'endAngle'), + + /** + * @private + * @param {String} key + * @param {*} value + * @return {fabric.Circle} thisArg + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + + if (key === 'radius') { + this.setRadius(value); + } + + return this; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return this.callSuper('toObject', ['radius', 'startAngle', 'endAngle'].concat(propertiesToInclude)); + }, + + /* _TO_SVG_START_ */ + + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + var svgString, x = 0, y = 0, + angle = (this.endAngle - this.startAngle) % ( 2 * pi); + + if (angle === 0) { + svgString = [ + '\n' + ]; + } + else { + var startX = fabric.util.cos(this.startAngle) * this.radius, + startY = fabric.util.sin(this.startAngle) * this.radius, + endX = fabric.util.cos(this.endAngle) * this.radius, + endY = fabric.util.sin(this.endAngle) * this.radius, + largeFlag = angle > pi ? '1' : '0'; + svgString = [ + '\n' + ]; + } + return svgString; + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render on + */ + _render: function(ctx) { + ctx.beginPath(); + ctx.arc( + 0, + 0, + this.radius, + this.startAngle, + this.endAngle, false); + this._renderPaintInOrder(ctx); + }, + + /** + * Returns horizontal radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRadiusX: function() { + return this.get('radius') * this.get('scaleX'); + }, + + /** + * Returns vertical radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRadiusY: function() { + return this.get('radius') * this.get('scaleY'); + }, + + /** + * Sets radius of an object (and updates width accordingly) + * @return {fabric.Circle} thisArg + */ + setRadius: function(value) { + this.radius = value; + return this.set('width', value * 2).set('height', value * 2); + }, + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Circle.fromElement}) + * @static + * @memberOf fabric.Circle + * @see: http://www.w3.org/TR/SVG/shapes.html#CircleElement + */ + fabric.Circle.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('cx cy r'.split(' ')); + + /** + * Returns {@link fabric.Circle} instance from an SVG element + * @static + * @memberOf fabric.Circle + * @param {SVGElement} element Element to parse + * @param {Function} [callback] Options callback invoked after parsing is finished + * @param {Object} [options] Options object + * @throws {Error} If value of `r` attribute is missing or invalid + */ + fabric.Circle.fromElement = function(element, callback) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Circle.ATTRIBUTE_NAMES); + + if (!isValidRadius(parsedAttributes)) { + throw new Error('value of `r` attribute is required and can not be negative'); + } + + parsedAttributes.left = (parsedAttributes.left || 0) - parsedAttributes.radius; + parsedAttributes.top = (parsedAttributes.top || 0) - parsedAttributes.radius; + callback(new fabric.Circle(parsedAttributes)); + }; + + /** + * @private + */ + function isValidRadius(attributes) { + return (('radius' in attributes) && (attributes.radius >= 0)); + } + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Circle} instance from an object representation + * @static + * @memberOf fabric.Circle + * @param {Object} object Object to create an instance from + * @param {function} [callback] invoked with new instance as first argument + * @return {Object} Instance of fabric.Circle + */ + fabric.Circle.fromObject = function(object, callback) { + return fabric.Object._fromObject('Circle', object, callback); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Triangle) { + fabric.warn('fabric.Triangle is already defined'); + return; + } + + /** + * Triangle class + * @class fabric.Triangle + * @extends fabric.Object + * @return {fabric.Triangle} thisArg + * @see {@link fabric.Triangle#initialize} for constructor definition + */ + fabric.Triangle = fabric.util.createClass(fabric.Object, /** @lends fabric.Triangle.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'triangle', + + /** + * Width is set to 100 to compensate the old initialize code that was setting it to 100 + * @type Number + * @default + */ + width: 100, + + /** + * Height is set to 100 to compensate the old initialize code that was setting it to 100 + * @type Number + * @default + */ + height: 100, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + var widthBy2 = this.width / 2, + heightBy2 = this.height / 2; + + ctx.beginPath(); + ctx.moveTo(-widthBy2, heightBy2); + ctx.lineTo(0, -heightBy2); + ctx.lineTo(widthBy2, heightBy2); + ctx.closePath(); + + this._renderPaintInOrder(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var widthBy2 = this.width / 2, + heightBy2 = this.height / 2; + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, -widthBy2, heightBy2, 0, -heightBy2, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, 0, -heightBy2, widthBy2, heightBy2, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, widthBy2, heightBy2, -widthBy2, heightBy2, this.strokeDashArray); + ctx.closePath(); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + var widthBy2 = this.width / 2, + heightBy2 = this.height / 2, + points = [ + -widthBy2 + ' ' + heightBy2, + '0 ' + -heightBy2, + widthBy2 + ' ' + heightBy2 + ].join(','); + return [ + '' + ]; + }, + /* _TO_SVG_END_ */ + }); + + /** + * Returns {@link fabric.Triangle} instance from an object representation + * @static + * @memberOf fabric.Triangle + * @param {Object} object Object to create an instance from + * @param {function} [callback] invoked with new instance as first argument + */ + fabric.Triangle.fromObject = function(object, callback) { + return fabric.Object._fromObject('Triangle', object, callback); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + piBy2 = Math.PI * 2; + + if (fabric.Ellipse) { + fabric.warn('fabric.Ellipse is already defined.'); + return; + } + + /** + * Ellipse class + * @class fabric.Ellipse + * @extends fabric.Object + * @return {fabric.Ellipse} thisArg + * @see {@link fabric.Ellipse#initialize} for constructor definition + */ + fabric.Ellipse = fabric.util.createClass(fabric.Object, /** @lends fabric.Ellipse.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'ellipse', + + /** + * Horizontal radius + * @type Number + * @default + */ + rx: 0, + + /** + * Vertical radius + * @type Number + * @default + */ + ry: 0, + + cacheProperties: fabric.Object.prototype.cacheProperties.concat('rx', 'ry'), + + /** + * Constructor + * @param {Object} [options] Options object + * @return {fabric.Ellipse} thisArg + */ + initialize: function(options) { + this.callSuper('initialize', options); + this.set('rx', options && options.rx || 0); + this.set('ry', options && options.ry || 0); + }, + + /** + * @private + * @param {String} key + * @param {*} value + * @return {fabric.Ellipse} thisArg + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + switch (key) { + + case 'rx': + this.rx = value; + this.set('width', value * 2); + break; + + case 'ry': + this.ry = value; + this.set('height', value * 2); + break; + + } + return this; + }, + + /** + * Returns horizontal radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRx: function() { + return this.get('rx') * this.get('scaleX'); + }, + + /** + * Returns Vertical radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRy: function() { + return this.get('ry') * this.get('scaleY'); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return this.callSuper('toObject', ['rx', 'ry'].concat(propertiesToInclude)); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + return [ + '\n' + ]; + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render on + */ + _render: function(ctx) { + ctx.beginPath(); + ctx.save(); + ctx.transform(1, 0, 0, this.ry / this.rx, 0, 0); + ctx.arc( + 0, + 0, + this.rx, + 0, + piBy2, + false); + ctx.restore(); + this._renderPaintInOrder(ctx); + }, + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Ellipse.fromElement}) + * @static + * @memberOf fabric.Ellipse + * @see http://www.w3.org/TR/SVG/shapes.html#EllipseElement + */ + fabric.Ellipse.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('cx cy rx ry'.split(' ')); + + /** + * Returns {@link fabric.Ellipse} instance from an SVG element + * @static + * @memberOf fabric.Ellipse + * @param {SVGElement} element Element to parse + * @param {Function} [callback] Options callback invoked after parsing is finished + * @return {fabric.Ellipse} + */ + fabric.Ellipse.fromElement = function(element, callback) { + + var parsedAttributes = fabric.parseAttributes(element, fabric.Ellipse.ATTRIBUTE_NAMES); + + parsedAttributes.left = (parsedAttributes.left || 0) - parsedAttributes.rx; + parsedAttributes.top = (parsedAttributes.top || 0) - parsedAttributes.ry; + callback(new fabric.Ellipse(parsedAttributes)); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Ellipse} instance from an object representation + * @static + * @memberOf fabric.Ellipse + * @param {Object} object Object to create an instance from + * @param {function} [callback] invoked with new instance as first argument + * @return {fabric.Ellipse} + */ + fabric.Ellipse.fromObject = function(object, callback) { + return fabric.Object._fromObject('Ellipse', object, callback); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend; + + if (fabric.Rect) { + fabric.warn('fabric.Rect is already defined'); + return; + } + + /** + * Rectangle class + * @class fabric.Rect + * @extends fabric.Object + * @return {fabric.Rect} thisArg + * @see {@link fabric.Rect#initialize} for constructor definition + */ + fabric.Rect = fabric.util.createClass(fabric.Object, /** @lends fabric.Rect.prototype */ { + + /** + * List of properties to consider when checking if state of an object is changed ({@link fabric.Object#hasStateChanged}) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: fabric.Object.prototype.stateProperties.concat('rx', 'ry'), + + /** + * Type of an object + * @type String + * @default + */ + type: 'rect', + + /** + * Horizontal border radius + * @type Number + * @default + */ + rx: 0, + + /** + * Vertical border radius + * @type Number + * @default + */ + ry: 0, + + cacheProperties: fabric.Object.prototype.cacheProperties.concat('rx', 'ry'), + + /** + * Constructor + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(options) { + this.callSuper('initialize', options); + this._initRxRy(); + }, + + /** + * Initializes rx/ry attributes + * @private + */ + _initRxRy: function() { + if (this.rx && !this.ry) { + this.ry = this.rx; + } + else if (this.ry && !this.rx) { + this.rx = this.ry; + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + + // 1x1 case (used in spray brush) optimization was removed because + // with caching and higher zoom level this makes more damage than help + + var rx = this.rx ? Math.min(this.rx, this.width / 2) : 0, + ry = this.ry ? Math.min(this.ry, this.height / 2) : 0, + w = this.width, + h = this.height, + x = -this.width / 2, + y = -this.height / 2, + isRounded = rx !== 0 || ry !== 0, + /* "magic number" for bezier approximations of arcs (http://itc.ktu.lt/itc354/Riskus354.pdf) */ + k = 1 - 0.5522847498; + ctx.beginPath(); + + ctx.moveTo(x + rx, y); + + ctx.lineTo(x + w - rx, y); + isRounded && ctx.bezierCurveTo(x + w - k * rx, y, x + w, y + k * ry, x + w, y + ry); + + ctx.lineTo(x + w, y + h - ry); + isRounded && ctx.bezierCurveTo(x + w, y + h - k * ry, x + w - k * rx, y + h, x + w - rx, y + h); + + ctx.lineTo(x + rx, y + h); + isRounded && ctx.bezierCurveTo(x + k * rx, y + h, x, y + h - k * ry, x, y + h - ry); + + ctx.lineTo(x, y + ry); + isRounded && ctx.bezierCurveTo(x, y + k * ry, x + k * rx, y, x + rx, y); + + ctx.closePath(); + + this._renderPaintInOrder(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var x = -this.width / 2, + y = -this.height / 2, + w = this.width, + h = this.height; + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, x, y, x + w, y, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y, x + w, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y + h, x, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x, y + h, x, y, this.strokeDashArray); + ctx.closePath(); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return this.callSuper('toObject', ['rx', 'ry'].concat(propertiesToInclude)); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + var x = -this.width / 2, y = -this.height / 2; + return [ + '\n' + ]; + }, + /* _TO_SVG_END_ */ + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Rect.fromElement`) + * @static + * @memberOf fabric.Rect + * @see: http://www.w3.org/TR/SVG/shapes.html#RectElement + */ + fabric.Rect.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x y rx ry width height'.split(' ')); + + /** + * Returns {@link fabric.Rect} instance from an SVG element + * @static + * @memberOf fabric.Rect + * @param {SVGElement} element Element to parse + * @param {Function} callback callback function invoked after parsing + * @param {Object} [options] Options object + */ + fabric.Rect.fromElement = function(element, callback, options) { + if (!element) { + return callback(null); + } + options = options || { }; + + var parsedAttributes = fabric.parseAttributes(element, fabric.Rect.ATTRIBUTE_NAMES); + parsedAttributes.left = parsedAttributes.left || 0; + parsedAttributes.top = parsedAttributes.top || 0; + parsedAttributes.height = parsedAttributes.height || 0; + parsedAttributes.width = parsedAttributes.width || 0; + var rect = new fabric.Rect(extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes)); + rect.visible = rect.visible && rect.width > 0 && rect.height > 0; + callback(rect); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Rect} instance from an object representation + * @static + * @memberOf fabric.Rect + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Rect instance is created + */ + fabric.Rect.fromObject = function(object, callback) { + return fabric.Object._fromObject('Rect', object, callback); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + min = fabric.util.array.min, + max = fabric.util.array.max, + toFixed = fabric.util.toFixed; + + if (fabric.Polyline) { + fabric.warn('fabric.Polyline is already defined'); + return; + } + + /** + * Polyline class + * @class fabric.Polyline + * @extends fabric.Object + * @see {@link fabric.Polyline#initialize} for constructor definition + */ + fabric.Polyline = fabric.util.createClass(fabric.Object, /** @lends fabric.Polyline.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'polyline', + + /** + * Points array + * @type Array + * @default + */ + points: null, + + cacheProperties: fabric.Object.prototype.cacheProperties.concat('points'), + + /** + * Constructor + * @param {Array} points Array of points (where each point is an object with x and y) + * @param {Object} [options] Options object + * @return {fabric.Polyline} thisArg + * @example + * var poly = new fabric.Polyline([ + * { x: 10, y: 10 }, + * { x: 50, y: 30 }, + * { x: 40, y: 70 }, + * { x: 60, y: 50 }, + * { x: 100, y: 150 }, + * { x: 40, y: 100 } + * ], { + * stroke: 'red', + * left: 100, + * top: 100 + * }); + */ + initialize: function(points, options) { + options = options || {}; + this.points = points || []; + this.callSuper('initialize', options); + this._setPositionDimensions(options); + }, + + _setPositionDimensions: function(options) { + var calcDim = this._calcDimensions(options), correctLeftTop; + this.width = calcDim.width; + this.height = calcDim.height; + if (!options.fromSVG) { + correctLeftTop = this.translateToGivenOrigin( + { x: calcDim.left - this.strokeWidth / 2, y: calcDim.top - this.strokeWidth / 2 }, + 'left', + 'top', + this.originX, + this.originY + ); + } + if (typeof options.left === 'undefined') { + this.left = options.fromSVG ? calcDim.left : correctLeftTop.x; + } + if (typeof options.top === 'undefined') { + this.top = options.fromSVG ? calcDim.top : correctLeftTop.y; + } + this.pathOffset = { + x: calcDim.left + this.width / 2, + y: calcDim.top + this.height / 2 + }; + }, + + /** + * Calculate the polygon min and max point from points array, + * returning an object with left, top, widht, height to measure the + * polygon size + * @return {Object} object.left X coordinate of the polygon leftmost point + * @return {Object} object.top Y coordinate of the polygon topmost point + * @return {Object} object.width distance between X coordinates of the polygon leftmost and rightmost point + * @return {Object} object.height distance between Y coordinates of the polygon topmost and bottommost point + * @private + */ + _calcDimensions: function() { + + var points = this.points, + minX = min(points, 'x') || 0, + minY = min(points, 'y') || 0, + maxX = max(points, 'x') || 0, + maxY = max(points, 'y') || 0, + width = (maxX - minX), + height = (maxY - minY); + + return { + left: minX, + top: minY, + width: width, + height: height + }; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + points: this.points.concat() + }); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + var points = [], diffX = this.pathOffset.x, diffY = this.pathOffset.y, + NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS; + + for (var i = 0, len = this.points.length; i < len; i++) { + points.push( + toFixed(this.points[i].x - diffX, NUM_FRACTION_DIGITS), ',', + toFixed(this.points[i].y - diffY, NUM_FRACTION_DIGITS), ' ' + ); + } + return [ + '<' + this.type + ' ', 'COMMON_PARTS', + 'points="', points.join(''), + '" />\n' + ]; + }, + /* _TO_SVG_END_ */ + + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + commonRender: function(ctx) { + var point, len = this.points.length, + x = this.pathOffset.x, + y = this.pathOffset.y; + + if (!len || isNaN(this.points[len - 1].y)) { + // do not draw if no points or odd points + // NaN comes from parseFloat of a empty string in parser + return false; + } + ctx.beginPath(); + ctx.moveTo(this.points[0].x - x, this.points[0].y - y); + for (var i = 0; i < len; i++) { + point = this.points[i]; + ctx.lineTo(point.x - x, point.y - y); + } + return true; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + if (!this.commonRender(ctx)) { + return; + } + this._renderPaintInOrder(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var p1, p2; + + ctx.beginPath(); + for (var i = 0, len = this.points.length; i < len; i++) { + p1 = this.points[i]; + p2 = this.points[i + 1] || p1; + fabric.util.drawDashedLine(ctx, p1.x, p1.y, p2.x, p2.y, this.strokeDashArray); + } + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return this.get('points').length; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Polyline.fromElement}) + * @static + * @memberOf fabric.Polyline + * @see: http://www.w3.org/TR/SVG/shapes.html#PolylineElement + */ + fabric.Polyline.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(); + + /** + * Returns fabric.Polyline instance from an SVG element + * @static + * @memberOf fabric.Polyline + * @param {SVGElement} element Element to parser + * @param {Function} callback callback function invoked after parsing + * @param {Object} [options] Options object + */ + fabric.Polyline.fromElementGenerator = function(_class) { + return function(element, callback, options) { + if (!element) { + return callback(null); + } + options || (options = { }); + + var points = fabric.parsePointsAttribute(element.getAttribute('points')), + parsedAttributes = fabric.parseAttributes(element, fabric[_class].ATTRIBUTE_NAMES); + parsedAttributes.fromSVG = true; + callback(new fabric[_class](points, extend(parsedAttributes, options))); + }; + }; + + fabric.Polyline.fromElement = fabric.Polyline.fromElementGenerator('Polyline'); + + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Polyline instance from an object representation + * @static + * @memberOf fabric.Polyline + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Path instance is created + */ + fabric.Polyline.fromObject = function(object, callback) { + return fabric.Object._fromObject('Polyline', object, callback, 'points'); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Polygon) { + fabric.warn('fabric.Polygon is already defined'); + return; + } + + /** + * Polygon class + * @class fabric.Polygon + * @extends fabric.Polyline + * @see {@link fabric.Polygon#initialize} for constructor definition + */ + fabric.Polygon = fabric.util.createClass(fabric.Polyline, /** @lends fabric.Polygon.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'polygon', + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + if (!this.commonRender(ctx)) { + return; + } + ctx.closePath(); + this._renderPaintInOrder(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + this.callSuper('_renderDashedStroke', ctx); + ctx.closePath(); + }, + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Polygon.fromElement`) + * @static + * @memberOf fabric.Polygon + * @see: http://www.w3.org/TR/SVG/shapes.html#PolygonElement + */ + fabric.Polygon.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(); + + /** + * Returns {@link fabric.Polygon} instance from an SVG element + * @static + * @memberOf fabric.Polygon + * @param {SVGElement} element Element to parse + * @param {Function} callback callback function invoked after parsing + * @param {Object} [options] Options object + */ + fabric.Polygon.fromElement = fabric.Polyline.fromElementGenerator('Polygon'); + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Polygon instance from an object representation + * @static + * @memberOf fabric.Polygon + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Path instance is created + */ + fabric.Polygon.fromObject = function(object, callback) { + return fabric.Object._fromObject('Polygon', object, callback, 'points'); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + min = fabric.util.array.min, + max = fabric.util.array.max, + extend = fabric.util.object.extend, + _toString = Object.prototype.toString, + toFixed = fabric.util.toFixed; + + if (fabric.Path) { + fabric.warn('fabric.Path is already defined'); + return; + } + + /** + * Path class + * @class fabric.Path + * @extends fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1#path_and_pathgroup} + * @see {@link fabric.Path#initialize} for constructor definition + */ + fabric.Path = fabric.util.createClass(fabric.Object, /** @lends fabric.Path.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'path', + + /** + * Array of path points + * @type Array + * @default + */ + path: null, + + cacheProperties: fabric.Object.prototype.cacheProperties.concat('path', 'fillRule'), + + stateProperties: fabric.Object.prototype.stateProperties.concat('path'), + + /** + * Constructor + * @param {Array|String} path Path data (sequence of coordinates and corresponding "command" tokens) + * @param {Object} [options] Options object + * @return {fabric.Path} thisArg + */ + initialize: function(path, options) { + options = options || { }; + this.callSuper('initialize', options); + if (!path) { + path = []; + } + + var fromArray = _toString.call(path) === '[object Array]'; + + this.path = fromArray + ? fabric.util.makePathSimpler(path) + + : fabric.util.makePathSimpler( + fabric.util.parsePath(path) + ); + + if (!this.path) { + return; + } + fabric.Polyline.prototype._setPositionDimensions.call(this, options); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render path on + */ + _renderPathCommands: function(ctx) { + var current, // current instruction + subpathStartX = 0, + subpathStartY = 0, + x = 0, // current x + y = 0, // current y + controlX = 0, // current control point x + controlY = 0, // current control point y + l = -this.pathOffset.x, + t = -this.pathOffset.y; + + ctx.beginPath(); + + for (var i = 0, len = this.path.length; i < len; ++i) { + + current = this.path[i]; + + switch (current[0]) { // first letter + + case 'L': // lineto, absolute + x = current[1]; + y = current[2]; + ctx.lineTo(x + l, y + t); + break; + + case 'M': // moveTo, absolute + x = current[1]; + y = current[2]; + subpathStartX = x; + subpathStartY = y; + ctx.moveTo(x + l, y + t); + break; + + case 'C': // bezierCurveTo, absolute + x = current[5]; + y = current[6]; + controlX = current[3]; + controlY = current[4]; + ctx.bezierCurveTo( + current[1] + l, + current[2] + t, + controlX + l, + controlY + t, + x + l, + y + t + ); + break; + + case 'Q': // quadraticCurveTo, absolute + ctx.quadraticCurveTo( + current[1] + l, + current[2] + t, + current[3] + l, + current[4] + t + ); + x = current[3]; + y = current[4]; + controlX = current[1]; + controlY = current[2]; + break; + + case 'z': + case 'Z': + x = subpathStartX; + y = subpathStartY; + ctx.closePath(); + break; + } + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render path on + */ + _render: function(ctx) { + this._renderPathCommands(ctx); + this._renderPaintInOrder(ctx); + }, + + /** + * Returns string representation of an instance + * @return {String} string representation of an instance + */ + toString: function() { + return '#'; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + path: this.path.map(function(item) { return item.slice(); }), + }); + }, + + /** + * Returns dataless object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + var o = this.toObject(['sourcePath'].concat(propertiesToInclude)); + if (o.sourcePath) { + delete o.path; + } + return o; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + var path = this.path.map(function(path) { + return path.join(' '); + }).join(' '); + return [ + '\n' + ]; + }, + + _getOffsetTransform: function() { + var digits = fabric.Object.NUM_FRACTION_DIGITS; + return ' translate(' + toFixed(-this.pathOffset.x, digits) + ', ' + + toFixed(-this.pathOffset.y, digits) + ')'; + }, + + /** + * Returns svg clipPath representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toClipPathSVG: function(reviver) { + var additionalTransform = this._getOffsetTransform(); + return '\t' + this._createBaseClipPathSVGMarkup( + this._toSVG(), { reviver: reviver, additionalTransform: additionalTransform } + ); + }, + + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var additionalTransform = this._getOffsetTransform(); + return this._createBaseSVGMarkup(this._toSVG(), { reviver: reviver, additionalTransform: additionalTransform }); + }, + /* _TO_SVG_END_ */ + + /** + * Returns number representation of an instance complexity + * @return {Number} complexity of this instance + */ + complexity: function() { + return this.path.length; + }, + + /** + * @private + */ + _calcDimensions: function() { + + var aX = [], + aY = [], + current, // current instruction + subpathStartX = 0, + subpathStartY = 0, + x = 0, // current x + y = 0, // current y + bounds; + + for (var i = 0, len = this.path.length; i < len; ++i) { + + current = this.path[i]; + + switch (current[0]) { // first letter + + case 'L': // lineto, absolute + x = current[1]; + y = current[2]; + bounds = []; + break; + + case 'M': // moveTo, absolute + x = current[1]; + y = current[2]; + subpathStartX = x; + subpathStartY = y; + bounds = []; + break; + + case 'C': // bezierCurveTo, absolute + bounds = fabric.util.getBoundsOfCurve(x, y, + current[1], + current[2], + current[3], + current[4], + current[5], + current[6] + ); + x = current[5]; + y = current[6]; + break; + + case 'Q': // quadraticCurveTo, absolute + bounds = fabric.util.getBoundsOfCurve(x, y, + current[1], + current[2], + current[1], + current[2], + current[3], + current[4] + ); + x = current[3]; + y = current[4]; + break; + + case 'z': + case 'Z': + x = subpathStartX; + y = subpathStartY; + break; + } + bounds.forEach(function (point) { + aX.push(point.x); + aY.push(point.y); + }); + aX.push(x); + aY.push(y); + } + + var minX = min(aX) || 0, + minY = min(aY) || 0, + maxX = max(aX) || 0, + maxY = max(aY) || 0, + deltaX = maxX - minX, + deltaY = maxY - minY; + + return { + left: minX, + top: minY, + width: deltaX, + height: deltaY + }; + } + }); + + /** + * Creates an instance of fabric.Path from an object + * @static + * @memberOf fabric.Path + * @param {Object} object + * @param {Function} [callback] Callback to invoke when an fabric.Path instance is created + */ + fabric.Path.fromObject = function(object, callback) { + if (typeof object.sourcePath === 'string') { + var pathUrl = object.sourcePath; + fabric.loadSVGFromURL(pathUrl, function (elements) { + var path = elements[0]; + path.setOptions(object); + callback && callback(path); + }); + } + else { + fabric.Object._fromObject('Path', object, callback, 'path'); + } + }; + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Path.fromElement`) + * @static + * @memberOf fabric.Path + * @see http://www.w3.org/TR/SVG/paths.html#PathElement + */ + fabric.Path.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(['d']); + + /** + * Creates an instance of fabric.Path from an SVG element + * @static + * @memberOf fabric.Path + * @param {SVGElement} element to parse + * @param {Function} callback Callback to invoke when an fabric.Path instance is created + * @param {Object} [options] Options object + * @param {Function} [callback] Options callback invoked after parsing is finished + */ + fabric.Path.fromElement = function(element, callback, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Path.ATTRIBUTE_NAMES); + parsedAttributes.fromSVG = true; + callback(new fabric.Path(parsedAttributes.d, extend(parsedAttributes, options))); + }; + /* _FROM_SVG_END_ */ + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + min = fabric.util.array.min, + max = fabric.util.array.max; + + if (fabric.Group) { + return; + } + + /** + * Group class + * @class fabric.Group + * @extends fabric.Object + * @mixes fabric.Collection + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#groups} + * @see {@link fabric.Group#initialize} for constructor definition + */ + fabric.Group = fabric.util.createClass(fabric.Object, fabric.Collection, /** @lends fabric.Group.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'group', + + /** + * Width of stroke + * @type Number + * @default + */ + strokeWidth: 0, + + /** + * Indicates if click, mouseover, mouseout events & hoverCursor should also check for subtargets + * @type Boolean + * @default + */ + subTargetCheck: false, + + /** + * Groups are container, do not render anything on theyr own, ence no cache properties + * @type Array + * @default + */ + cacheProperties: [], + + /** + * setOnGroup is a method used for TextBox that is no more used since 2.0.0 The behavior is still + * available setting this boolean to true. + * @type Boolean + * @since 2.0.0 + * @default + */ + useSetOnGroup: false, + + /** + * Constructor + * @param {Object} objects Group objects + * @param {Object} [options] Options object + * @param {Boolean} [isAlreadyGrouped] if true, objects have been grouped already. + * @return {Object} thisArg + */ + initialize: function(objects, options, isAlreadyGrouped) { + options = options || {}; + this._objects = []; + // if objects enclosed in a group have been grouped already, + // we cannot change properties of objects. + // Thus we need to set options to group without objects, + isAlreadyGrouped && this.callSuper('initialize', options); + this._objects = objects || []; + for (var i = this._objects.length; i--; ) { + this._objects[i].group = this; + } + + if (!isAlreadyGrouped) { + var center = options && options.centerPoint; + // we want to set origins before calculating the bounding box. + // so that the topleft can be set with that in mind. + // if specific top and left are passed, are overwritten later + // with the callSuper('initialize', options) + if (options.originX !== undefined) { + this.originX = options.originX; + } + if (options.originY !== undefined) { + this.originY = options.originY; + } + // if coming from svg i do not want to calc bounds. + // i assume width and height are passed along options + center || this._calcBounds(); + this._updateObjectsCoords(center); + delete options.centerPoint; + this.callSuper('initialize', options); + } + else { + this._updateObjectsACoords(); + } + + this.setCoords(); + }, + + /** + * @private + */ + _updateObjectsACoords: function() { + var skipControls = true; + for (var i = this._objects.length; i--; ){ + this._objects[i].setCoords(skipControls); + } + }, + + /** + * @private + * @param {Boolean} [skipCoordsChange] if true, coordinates of objects enclosed in a group do not change + */ + _updateObjectsCoords: function(center) { + var center = center || this.getCenterPoint(); + for (var i = this._objects.length; i--; ){ + this._updateObjectCoords(this._objects[i], center); + } + }, + + /** + * @private + * @param {Object} object + * @param {fabric.Point} center, current center of group. + */ + _updateObjectCoords: function(object, center) { + var objectLeft = object.left, + objectTop = object.top, + skipControls = true; + + object.set({ + left: objectLeft - center.x, + top: objectTop - center.y + }); + object.group = this; + object.setCoords(skipControls); + }, + + /** + * Returns string represenation of a group + * @return {String} + */ + toString: function() { + return '#'; + }, + + /** + * Adds an object to a group; Then recalculates group's dimension, position. + * @param {Object} object + * @return {fabric.Group} thisArg + * @chainable + */ + addWithUpdate: function(object) { + this._restoreObjectsState(); + fabric.util.resetObjectTransform(this); + if (object) { + this._objects.push(object); + object.group = this; + object._set('canvas', this.canvas); + } + this._calcBounds(); + this._updateObjectsCoords(); + this.setCoords(); + this.dirty = true; + return this; + }, + + /** + * Removes an object from a group; Then recalculates group's dimension, position. + * @param {Object} object + * @return {fabric.Group} thisArg + * @chainable + */ + removeWithUpdate: function(object) { + this._restoreObjectsState(); + fabric.util.resetObjectTransform(this); + + this.remove(object); + this._calcBounds(); + this._updateObjectsCoords(); + this.setCoords(); + this.dirty = true; + return this; + }, + + /** + * @private + */ + _onObjectAdded: function(object) { + this.dirty = true; + object.group = this; + object._set('canvas', this.canvas); + }, + + /** + * @private + */ + _onObjectRemoved: function(object) { + this.dirty = true; + delete object.group; + }, + + /** + * @private + */ + _set: function(key, value) { + var i = this._objects.length; + if (this.useSetOnGroup) { + while (i--) { + this._objects[i].setOnGroup(key, value); + } + } + if (key === 'canvas') { + while (i--) { + this._objects[i]._set(key, value); + } + } + fabric.Object.prototype._set.call(this, key, value); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + var _includeDefaultValues = this.includeDefaultValues; + var objsToObject = this._objects.map(function(obj) { + var originalDefaults = obj.includeDefaultValues; + obj.includeDefaultValues = _includeDefaultValues; + var _obj = obj.toObject(propertiesToInclude); + obj.includeDefaultValues = originalDefaults; + return _obj; + }); + var obj = fabric.Object.prototype.toObject.call(this, propertiesToInclude); + obj.objects = objsToObject; + return obj; + }, + + /** + * Returns object representation of an instance, in dataless mode. + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + var objsToObject, sourcePath = this.sourcePath; + if (sourcePath) { + objsToObject = sourcePath; + } + else { + var _includeDefaultValues = this.includeDefaultValues; + objsToObject = this._objects.map(function(obj) { + var originalDefaults = obj.includeDefaultValues; + obj.includeDefaultValues = _includeDefaultValues; + var _obj = obj.toDatalessObject(propertiesToInclude); + obj.includeDefaultValues = originalDefaults; + return _obj; + }); + } + var obj = fabric.Object.prototype.toDatalessObject.call(this, propertiesToInclude); + obj.objects = objsToObject; + return obj; + }, + + /** + * Renders instance on a given context + * @param {CanvasRenderingContext2D} ctx context to render instance on + */ + render: function(ctx) { + this._transformDone = true; + this.callSuper('render', ctx); + this._transformDone = false; + }, + + /** + * Decide if the object should cache or not. Create its own cache level + * needsItsOwnCache should be used when the object drawing method requires + * a cache step. None of the fabric classes requires it. + * Generally you do not cache objects in groups because the group is already cached. + * @return {Boolean} + */ + shouldCache: function() { + var ownCache = fabric.Object.prototype.shouldCache.call(this); + if (ownCache) { + for (var i = 0, len = this._objects.length; i < len; i++) { + if (this._objects[i].willDrawShadow()) { + this.ownCaching = false; + return false; + } + } + } + return ownCache; + }, + + /** + * Check if this object or a child object will cast a shadow + * @return {Boolean} + */ + willDrawShadow: function() { + if (fabric.Object.prototype.willDrawShadow.call(this)) { + return true; + } + for (var i = 0, len = this._objects.length; i < len; i++) { + if (this._objects[i].willDrawShadow()) { + return true; + } + } + return false; + }, + + /** + * Check if this group or its parent group are caching, recursively up + * @return {Boolean} + */ + isOnACache: function() { + return this.ownCaching || (this.group && this.group.isOnACache()); + }, + + /** + * Execute the drawing operation for an object on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + drawObject: function(ctx) { + for (var i = 0, len = this._objects.length; i < len; i++) { + this._objects[i].render(ctx); + } + this._drawClipPath(ctx); + }, + + /** + * Check if cache is dirty + */ + isCacheDirty: function(skipCanvas) { + if (this.callSuper('isCacheDirty', skipCanvas)) { + return true; + } + if (!this.statefullCache) { + return false; + } + for (var i = 0, len = this._objects.length; i < len; i++) { + if (this._objects[i].isCacheDirty(true)) { + if (this._cacheCanvas) { + // if this group has not a cache canvas there is nothing to clean + var x = this.cacheWidth / this.zoomX, y = this.cacheHeight / this.zoomY; + this._cacheContext.clearRect(-x / 2, -y / 2, x, y); + } + return true; + } + } + return false; + }, + + /** + * Retores original state of each of group objects (original state is that which was before group was created). + * @private + * @return {fabric.Group} thisArg + * @chainable + */ + _restoreObjectsState: function() { + this._objects.forEach(this._restoreObjectState, this); + return this; + }, + + /** + * Realises the transform from this group onto the supplied object + * i.e. it tells you what would happen if the supplied object was in + * the group, and then the group was destroyed. It mutates the supplied + * object. + * @param {fabric.Object} object + * @return {fabric.Object} transformedObject + */ + realizeTransform: function(object) { + var matrix = object.calcTransformMatrix(), + options = fabric.util.qrDecompose(matrix), + center = new fabric.Point(options.translateX, options.translateY); + object.flipX = false; + object.flipY = false; + object.set('scaleX', options.scaleX); + object.set('scaleY', options.scaleY); + object.skewX = options.skewX; + object.skewY = options.skewY; + object.angle = options.angle; + object.setPositionByOrigin(center, 'center', 'center'); + return object; + }, + + /** + * Restores original state of a specified object in group + * @private + * @param {fabric.Object} object + * @return {fabric.Group} thisArg + */ + _restoreObjectState: function(object) { + this.realizeTransform(object); + delete object.group; + object.setCoords(); + return this; + }, + + /** + * Destroys a group (restoring state of its objects) + * @return {fabric.Group} thisArg + * @chainable + */ + destroy: function() { + // when group is destroyed objects needs to get a repaint to be eventually + // displayed on canvas. + this._objects.forEach(function(object) { + object.set('dirty', true); + }); + return this._restoreObjectsState(); + }, + + /** + * make a group an active selection, remove the group from canvas + * the group has to be on canvas for this to work. + * @return {fabric.ActiveSelection} thisArg + * @chainable + */ + toActiveSelection: function() { + if (!this.canvas) { + return; + } + var objects = this._objects, canvas = this.canvas; + this._objects = []; + var options = this.toObject(); + delete options.objects; + var activeSelection = new fabric.ActiveSelection([]); + activeSelection.set(options); + activeSelection.type = 'activeSelection'; + canvas.remove(this); + objects.forEach(function(object) { + object.group = activeSelection; + object.dirty = true; + canvas.add(object); + }); + activeSelection.canvas = canvas; + activeSelection._objects = objects; + canvas._activeObject = activeSelection; + activeSelection.setCoords(); + return activeSelection; + }, + + /** + * Destroys a group (restoring state of its objects) + * @return {fabric.Group} thisArg + * @chainable + */ + ungroupOnCanvas: function() { + return this._restoreObjectsState(); + }, + + /** + * Sets coordinates of all objects inside group + * @return {fabric.Group} thisArg + * @chainable + */ + setObjectsCoords: function() { + var skipControls = true; + this.forEachObject(function(object) { + object.setCoords(skipControls); + }); + return this; + }, + + /** + * @private + */ + _calcBounds: function(onlyWidthHeight) { + var aX = [], + aY = [], + o, prop, + props = ['tr', 'br', 'bl', 'tl'], + i = 0, iLen = this._objects.length, + j, jLen = props.length; + + for ( ; i < iLen; ++i) { + o = this._objects[i]; + o.aCoords = o.calcACoords(); + for (j = 0; j < jLen; j++) { + prop = props[j]; + aX.push(o.aCoords[prop].x); + aY.push(o.aCoords[prop].y); + } + } + + this._getBounds(aX, aY, onlyWidthHeight); + }, + + /** + * @private + */ + _getBounds: function(aX, aY, onlyWidthHeight) { + var minXY = new fabric.Point(min(aX), min(aY)), + maxXY = new fabric.Point(max(aX), max(aY)), + top = minXY.y || 0, left = minXY.x || 0, + width = (maxXY.x - minXY.x) || 0, + height = (maxXY.y - minXY.y) || 0; + this.width = width; + this.height = height; + if (!onlyWidthHeight) { + // the bounding box always finds the topleft most corner. + // whatever is the group origin, we set up here the left/top position. + this.setPositionByOrigin({ x: left, y: top }, 'left', 'top'); + } + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + _toSVG: function(reviver) { + var svgString = ['\n']; + + for (var i = 0, len = this._objects.length; i < len; i++) { + svgString.push('\t\t', this._objects[i].toSVG(reviver)); + } + svgString.push('\n'); + return svgString; + }, + + /** + * Returns styles-string for svg-export, specific version for group + * @return {String} + */ + getSvgStyles: function() { + var opacity = typeof this.opacity !== 'undefined' && this.opacity !== 1 ? + 'opacity: ' + this.opacity + ';' : '', + visibility = this.visible ? '' : ' visibility: hidden;'; + return [ + opacity, + this.getSvgFilter(), + visibility + ].join(''); + }, + + /** + * Returns svg clipPath representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toClipPathSVG: function(reviver) { + var svgString = []; + + for (var i = 0, len = this._objects.length; i < len; i++) { + svgString.push('\t', this._objects[i].toClipPathSVG(reviver)); + } + + return this._createBaseClipPathSVGMarkup(svgString, { reviver: reviver }); + }, + /* _TO_SVG_END_ */ + }); + + /** + * Returns {@link fabric.Group} instance from an object representation + * @static + * @memberOf fabric.Group + * @param {Object} object Object to create a group from + * @param {Function} [callback] Callback to invoke when an group instance is created + */ + fabric.Group.fromObject = function(object, callback) { + var objects = object.objects, + options = fabric.util.object.clone(object, true); + delete options.objects; + if (typeof objects === 'string') { + // it has to be an url or something went wrong. + fabric.loadSVGFromURL(objects, function (elements) { + var group = fabric.util.groupSVGElements(elements, object, objects); + group.set(options); + callback && callback(group); + }); + return; + } + fabric.util.enlivenObjects(objects, function(enlivenedObjects) { + fabric.util.enlivenObjects([object.clipPath], function(enlivedClipPath) { + var options = fabric.util.object.clone(object, true); + options.clipPath = enlivedClipPath[0]; + delete options.objects; + callback && callback(new fabric.Group(enlivenedObjects, options, true)); + }); + }); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.ActiveSelection) { + return; + } + + /** + * Group class + * @class fabric.ActiveSelection + * @extends fabric.Group + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#groups} + * @see {@link fabric.ActiveSelection#initialize} for constructor definition + */ + fabric.ActiveSelection = fabric.util.createClass(fabric.Group, /** @lends fabric.ActiveSelection.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'activeSelection', + + /** + * Constructor + * @param {Object} objects ActiveSelection objects + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(objects, options) { + options = options || {}; + this._objects = objects || []; + for (var i = this._objects.length; i--; ) { + this._objects[i].group = this; + } + + if (options.originX) { + this.originX = options.originX; + } + if (options.originY) { + this.originY = options.originY; + } + this._calcBounds(); + this._updateObjectsCoords(); + fabric.Object.prototype.initialize.call(this, options); + this.setCoords(); + }, + + /** + * Change te activeSelection to a normal group, + * High level function that automatically adds it to canvas as + * active object. no events fired. + * @since 2.0.0 + * @return {fabric.Group} + */ + toGroup: function() { + var objects = this._objects.concat(); + this._objects = []; + var options = fabric.Object.prototype.toObject.call(this); + var newGroup = new fabric.Group([]); + delete options.type; + newGroup.set(options); + objects.forEach(function(object) { + object.canvas.remove(object); + object.group = newGroup; + }); + newGroup._objects = objects; + if (!this.canvas) { + return newGroup; + } + var canvas = this.canvas; + canvas.add(newGroup); + canvas._activeObject = newGroup; + newGroup.setCoords(); + return newGroup; + }, + + /** + * If returns true, deselection is cancelled. + * @since 2.0.0 + * @return {Boolean} [cancel] + */ + onDeselect: function() { + this.destroy(); + return false; + }, + + /** + * Returns string representation of a group + * @return {String} + */ + toString: function() { + return '#'; + }, + + /** + * Decide if the object should cache or not. Create its own cache level + * objectCaching is a global flag, wins over everything + * needsItsOwnCache should be used when the object drawing method requires + * a cache step. None of the fabric classes requires it. + * Generally you do not cache objects in groups because the group outside is cached. + * @return {Boolean} + */ + shouldCache: function() { + return false; + }, + + /** + * Check if this group or its parent group are caching, recursively up + * @return {Boolean} + */ + isOnACache: function() { + return false; + }, + + /** + * Renders controls and borders for the object + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Object} [styleOverride] properties to override the object style + * @param {Object} [childrenOverride] properties to override the children overrides + */ + _renderControls: function(ctx, styleOverride, childrenOverride) { + ctx.save(); + ctx.globalAlpha = this.isMoving ? this.borderOpacityWhenMoving : 1; + this.callSuper('_renderControls', ctx, styleOverride); + childrenOverride = childrenOverride || { }; + if (typeof childrenOverride.hasControls === 'undefined') { + childrenOverride.hasControls = false; + } + childrenOverride.forActiveSelection = true; + for (var i = 0, len = this._objects.length; i < len; i++) { + this._objects[i]._renderControls(ctx, childrenOverride); + } + ctx.restore(); + }, + }); + + /** + * Returns {@link fabric.ActiveSelection} instance from an object representation + * @static + * @memberOf fabric.ActiveSelection + * @param {Object} object Object to create a group from + * @param {Function} [callback] Callback to invoke when an ActiveSelection instance is created + */ + fabric.ActiveSelection.fromObject = function(object, callback) { + fabric.util.enlivenObjects(object.objects, function(enlivenedObjects) { + delete object.objects; + callback && callback(new fabric.ActiveSelection(enlivenedObjects, object, true)); + }); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var extend = fabric.util.object.extend; + + if (!global.fabric) { + global.fabric = { }; + } + + if (global.fabric.Image) { + fabric.warn('fabric.Image is already defined.'); + return; + } + + /** + * Image class + * @class fabric.Image + * @extends fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1#images} + * @see {@link fabric.Image#initialize} for constructor definition + */ + fabric.Image = fabric.util.createClass(fabric.Object, /** @lends fabric.Image.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'image', + + /** + * Width of a stroke. + * For image quality a stroke multiple of 2 gives better results. + * @type Number + * @default + */ + strokeWidth: 0, + + /** + * When calling {@link fabric.Image.getSrc}, return value from element src with `element.getAttribute('src')`. + * This allows for relative urls as image src. + * @since 2.7.0 + * @type Boolean + * @default + */ + srcFromAttribute: false, + + /** + * private + * contains last value of scaleX to detect + * if the Image got resized after the last Render + * @type Number + */ + _lastScaleX: 1, + + /** + * private + * contains last value of scaleY to detect + * if the Image got resized after the last Render + * @type Number + */ + _lastScaleY: 1, + + /** + * private + * contains last value of scaling applied by the apply filter chain + * @type Number + */ + _filterScalingX: 1, + + /** + * private + * contains last value of scaling applied by the apply filter chain + * @type Number + */ + _filterScalingY: 1, + + /** + * minimum scale factor under which any resizeFilter is triggered to resize the image + * 0 will disable the automatic resize. 1 will trigger automatically always. + * number bigger than 1 are not implemented yet. + * @type Number + */ + minimumScaleTrigger: 0.5, + + /** + * List of properties to consider when checking if + * state of an object is changed ({@link fabric.Object#hasStateChanged}) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: fabric.Object.prototype.stateProperties.concat('cropX', 'cropY'), + + /** + * key used to retrieve the texture representing this image + * @since 2.0.0 + * @type String + * @default + */ + cacheKey: '', + + /** + * Image crop in pixels from original image size. + * @since 2.0.0 + * @type Number + * @default + */ + cropX: 0, + + /** + * Image crop in pixels from original image size. + * @since 2.0.0 + * @type Number + * @default + */ + cropY: 0, + + /** + * Indicates whether this canvas will use image smoothing when painting this image. + * Also influence if the cacheCanvas for this image uses imageSmoothing + * @since 4.0.0-beta.11 + * @type Boolean + * @default + */ + imageSmoothing: true, + + /** + * Constructor + * @param {HTMLImageElement | String} element Image element + * @param {Object} [options] Options object + * @param {function} [callback] callback function to call after eventual filters applied. + * @return {fabric.Image} thisArg + */ + initialize: function(element, options) { + options || (options = { }); + this.filters = []; + this.cacheKey = 'texture' + fabric.Object.__uid++; + this.callSuper('initialize', options); + this._initElement(element, options); + }, + + /** + * Returns image element which this instance if based on + * @return {HTMLImageElement} Image element + */ + getElement: function() { + return this._element || {}; + }, + + /** + * Sets image element for this instance to a specified one. + * If filters defined they are applied to new image. + * You might need to call `canvas.renderAll` and `object.setCoords` after replacing, to render new image and update controls area. + * @param {HTMLImageElement} element + * @param {Object} [options] Options object + * @return {fabric.Image} thisArg + * @chainable + */ + setElement: function(element, options) { + this.removeTexture(this.cacheKey); + this.removeTexture(this.cacheKey + '_filtered'); + this._element = element; + this._originalElement = element; + this._initConfig(options); + if (this.filters.length !== 0) { + this.applyFilters(); + } + // resizeFilters work on the already filtered copy. + // we need to apply resizeFilters AFTER normal filters. + // applyResizeFilters is run more often than normal fiters + // and is triggered by user interactions rather than dev code + if (this.resizeFilter) { + this.applyResizeFilters(); + } + return this; + }, + + /** + * Delete a single texture if in webgl mode + */ + removeTexture: function(key) { + var backend = fabric.filterBackend; + if (backend && backend.evictCachesForKey) { + backend.evictCachesForKey(key); + } + }, + + /** + * Delete textures, reference to elements and eventually JSDOM cleanup + */ + dispose: function() { + this.removeTexture(this.cacheKey); + this.removeTexture(this.cacheKey + '_filtered'); + this._cacheContext = undefined; + ['_originalElement', '_element', '_filteredEl', '_cacheCanvas'].forEach((function(element) { + fabric.util.cleanUpJsdomNode(this[element]); + this[element] = undefined; + }).bind(this)); + }, + + /** + * Get the crossOrigin value (of the corresponding image element) + */ + getCrossOrigin: function() { + return this._originalElement && (this._originalElement.crossOrigin || null); + }, + + /** + * Returns original size of an image + * @return {Object} Object with "width" and "height" properties + */ + getOriginalSize: function() { + var element = this.getElement(); + return { + width: element.naturalWidth || element.width, + height: element.naturalHeight || element.height + }; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _stroke: function(ctx) { + if (!this.stroke || this.strokeWidth === 0) { + return; + } + var w = this.width / 2, h = this.height / 2; + ctx.beginPath(); + ctx.moveTo(-w, -h); + ctx.lineTo(w, -h); + ctx.lineTo(w, h); + ctx.lineTo(-w, h); + ctx.lineTo(-w, -h); + ctx.closePath(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var x = -this.width / 2, + y = -this.height / 2, + w = this.width, + h = this.height; + + ctx.save(); + this._setStrokeStyles(ctx, this); + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, x, y, x + w, y, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y, x + w, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y + h, x, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x, y + h, x, y, this.strokeDashArray); + ctx.closePath(); + ctx.restore(); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + var filters = []; + + this.filters.forEach(function(filterObj) { + if (filterObj) { + filters.push(filterObj.toObject()); + } + }); + var object = extend( + this.callSuper( + 'toObject', + ['cropX', 'cropY'].concat(propertiesToInclude) + ), { + src: this.getSrc(), + crossOrigin: this.getCrossOrigin(), + filters: filters, + }); + if (this.resizeFilter) { + object.resizeFilter = this.resizeFilter.toObject(); + } + return object; + }, + + /** + * Returns true if an image has crop applied, inspecting values of cropX,cropY,width,hight. + * @return {Boolean} + */ + hasCrop: function() { + return this.cropX || this.cropY || this.width < this._element.width || this.height < this._element.height; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + var svgString = [], imageMarkup = [], strokeSvg, element = this._element, + x = -this.width / 2, y = -this.height / 2, clipPath = '', imageRendering = ''; + if (!element) { + return []; + } + if (this.hasCrop()) { + var clipPathId = fabric.Object.__uid++; + svgString.push( + '\n', + '\t\n', + '\n' + ); + clipPath = ' clip-path="url(#imageCrop_' + clipPathId + ')" '; + } + if (!this.imageSmoothing) { + imageRendering = '" image-rendering="optimizeSpeed'; + } + imageMarkup.push('\t\n'); + + if (this.stroke || this.strokeDashArray) { + var origFill = this.fill; + this.fill = null; + strokeSvg = [ + '\t\n' + ]; + this.fill = origFill; + } + if (this.paintFirst !== 'fill') { + svgString = svgString.concat(strokeSvg, imageMarkup); + } + else { + svgString = svgString.concat(imageMarkup, strokeSvg); + } + return svgString; + }, + /* _TO_SVG_END_ */ + + /** + * Returns source of an image + * @param {Boolean} filtered indicates if the src is needed for svg + * @return {String} Source of an image + */ + getSrc: function(filtered) { + var element = filtered ? this._element : this._originalElement; + if (element) { + if (element.toDataURL) { + return element.toDataURL(); + } + + if (this.srcFromAttribute) { + return element.getAttribute('src'); + } + else { + return element.src; + } + } + else { + return this.src || ''; + } + }, + + /** + * Sets source of an image + * @param {String} src Source string (URL) + * @param {Function} [callback] Callback is invoked when image has been loaded (and all filters have been applied) + * @param {Object} [options] Options object + * @param {String} [options.crossOrigin] crossOrigin value (one of "", "anonymous", "use-credentials") + * @see https://developer.mozilla.org/en-US/docs/HTML/CORS_settings_attributes + * @return {fabric.Image} thisArg + * @chainable + */ + setSrc: function(src, callback, options) { + fabric.util.loadImage(src, function(img, isError) { + this.setElement(img, options); + this._setWidthHeight(); + callback && callback(this, isError); + }, this, options && options.crossOrigin); + return this; + }, + + /** + * Returns string representation of an instance + * @return {String} String representation of an instance + */ + toString: function() { + return '#'; + }, + + applyResizeFilters: function() { + var filter = this.resizeFilter, + minimumScale = this.minimumScaleTrigger, + objectScale = this.getTotalObjectScaling(), + scaleX = objectScale.scaleX, + scaleY = objectScale.scaleY, + elementToFilter = this._filteredEl || this._originalElement; + if (this.group) { + this.set('dirty', true); + } + if (!filter || (scaleX > minimumScale && scaleY > minimumScale)) { + this._element = elementToFilter; + this._filterScalingX = 1; + this._filterScalingY = 1; + this._lastScaleX = scaleX; + this._lastScaleY = scaleY; + return; + } + if (!fabric.filterBackend) { + fabric.filterBackend = fabric.initFilterBackend(); + } + var canvasEl = fabric.util.createCanvasElement(), + cacheKey = this._filteredEl ? (this.cacheKey + '_filtered') : this.cacheKey, + sourceWidth = elementToFilter.width, sourceHeight = elementToFilter.height; + canvasEl.width = sourceWidth; + canvasEl.height = sourceHeight; + this._element = canvasEl; + this._lastScaleX = filter.scaleX = scaleX; + this._lastScaleY = filter.scaleY = scaleY; + fabric.filterBackend.applyFilters( + [filter], elementToFilter, sourceWidth, sourceHeight, this._element, cacheKey); + this._filterScalingX = canvasEl.width / this._originalElement.width; + this._filterScalingY = canvasEl.height / this._originalElement.height; + }, + + /** + * Applies filters assigned to this image (from "filters" array) or from filter param + * @method applyFilters + * @param {Array} filters to be applied + * @param {Boolean} forResizing specify if the filter operation is a resize operation + * @return {thisArg} return the fabric.Image object + * @chainable + */ + applyFilters: function(filters) { + + filters = filters || this.filters || []; + filters = filters.filter(function(filter) { return filter && !filter.isNeutralState(); }); + this.set('dirty', true); + + // needs to clear out or WEBGL will not resize correctly + this.removeTexture(this.cacheKey + '_filtered'); + + if (filters.length === 0) { + this._element = this._originalElement; + this._filteredEl = null; + this._filterScalingX = 1; + this._filterScalingY = 1; + return this; + } + + var imgElement = this._originalElement, + sourceWidth = imgElement.naturalWidth || imgElement.width, + sourceHeight = imgElement.naturalHeight || imgElement.height; + + if (this._element === this._originalElement) { + // if the element is the same we need to create a new element + var canvasEl = fabric.util.createCanvasElement(); + canvasEl.width = sourceWidth; + canvasEl.height = sourceHeight; + this._element = canvasEl; + this._filteredEl = canvasEl; + } + else { + // clear the existing element to get new filter data + // also dereference the eventual resized _element + this._element = this._filteredEl; + this._filteredEl.getContext('2d').clearRect(0, 0, sourceWidth, sourceHeight); + // we also need to resize again at next renderAll, so remove saved _lastScaleX/Y + this._lastScaleX = 1; + this._lastScaleY = 1; + } + if (!fabric.filterBackend) { + fabric.filterBackend = fabric.initFilterBackend(); + } + fabric.filterBackend.applyFilters( + filters, this._originalElement, sourceWidth, sourceHeight, this._element, this.cacheKey); + if (this._originalElement.width !== this._element.width || + this._originalElement.height !== this._element.height) { + this._filterScalingX = this._element.width / this._originalElement.width; + this._filterScalingY = this._element.height / this._originalElement.height; + } + return this; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + fabric.util.setImageSmoothing(ctx, this.imageSmoothing); + if (this.isMoving !== true && this.resizeFilter && this._needsResize()) { + this.applyResizeFilters(); + } + this._stroke(ctx); + this._renderPaintInOrder(ctx); + }, + + /** + * Paint the cached copy of the object on the target context. + * it will set the imageSmoothing for the draw operation + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + drawCacheOnCanvas: function(ctx) { + fabric.util.setImageSmoothing(ctx, this.imageSmoothing); + fabric.Object.prototype.drawCacheOnCanvas.call(this, ctx); + }, + + /** + * Decide if the object should cache or not. Create its own cache level + * needsItsOwnCache should be used when the object drawing method requires + * a cache step. None of the fabric classes requires it. + * Generally you do not cache objects in groups because the group outside is cached. + * This is the special image version where we would like to avoid caching where possible. + * Essentially images do not benefit from caching. They may require caching, and in that + * case we do it. Also caching an image usually ends in a loss of details. + * A full performance audit should be done. + * @return {Boolean} + */ + shouldCache: function() { + return this.needsItsOwnCache(); + }, + + _renderFill: function(ctx) { + var elementToDraw = this._element; + if (!elementToDraw) { + return; + } + var scaleX = this._filterScalingX, scaleY = this._filterScalingY, + w = this.width, h = this.height, min = Math.min, max = Math.max, + // crop values cannot be lesser than 0. + cropX = max(this.cropX, 0), cropY = max(this.cropY, 0), + elWidth = elementToDraw.naturalWidth || elementToDraw.width, + elHeight = elementToDraw.naturalHeight || elementToDraw.height, + sX = cropX * scaleX, + sY = cropY * scaleY, + // the width height cannot exceed element width/height, starting from the crop offset. + sW = min(w * scaleX, elWidth - sX), + sH = min(h * scaleY, elHeight - sY), + x = -w / 2, y = -h / 2, + maxDestW = min(w, elWidth / scaleX - cropX), + maxDestH = min(h, elHeight / scaleX - cropY); + + elementToDraw && ctx.drawImage(elementToDraw, sX, sY, sW, sH, x, y, maxDestW, maxDestH); + }, + + /** + * needed to check if image needs resize + * @private + */ + _needsResize: function() { + var scale = this.getTotalObjectScaling(); + return (scale.scaleX !== this._lastScaleX || scale.scaleY !== this._lastScaleY); + }, + + /** + * @private + */ + _resetWidthHeight: function() { + this.set(this.getOriginalSize()); + }, + + /** + * The Image class's initialization method. This method is automatically + * called by the constructor. + * @private + * @param {HTMLImageElement|String} element The element representing the image + * @param {Object} [options] Options object + */ + _initElement: function(element, options) { + this.setElement(fabric.util.getById(element), options); + fabric.util.addClass(this.getElement(), fabric.Image.CSS_CANVAS); + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initConfig: function(options) { + options || (options = { }); + this.setOptions(options); + this._setWidthHeight(options); + }, + + /** + * @private + * @param {Array} filters to be initialized + * @param {Function} callback Callback to invoke when all fabric.Image.filters instances are created + */ + _initFilters: function(filters, callback) { + if (filters && filters.length) { + fabric.util.enlivenObjects(filters, function(enlivenedObjects) { + callback && callback(enlivenedObjects); + }, 'fabric.Image.filters'); + } + else { + callback && callback(); + } + }, + + /** + * @private + * Set the width and the height of the image object, using the element or the + * options. + * @param {Object} [options] Object with width/height properties + */ + _setWidthHeight: function(options) { + options || (options = { }); + var el = this.getElement(); + this.width = options.width || el.naturalWidth || el.width || 0; + this.height = options.height || el.naturalHeight || el.height || 0; + }, + + /** + * Calculate offset for center and scale factor for the image in order to respect + * the preserveAspectRatio attribute + * @private + * @return {Object} + */ + parsePreserveAspectRatioAttribute: function() { + var pAR = fabric.util.parsePreserveAspectRatioAttribute(this.preserveAspectRatio || ''), + rWidth = this._element.width, rHeight = this._element.height, + scaleX = 1, scaleY = 1, offsetLeft = 0, offsetTop = 0, cropX = 0, cropY = 0, + offset, pWidth = this.width, pHeight = this.height, parsedAttributes = { width: pWidth, height: pHeight }; + if (pAR && (pAR.alignX !== 'none' || pAR.alignY !== 'none')) { + if (pAR.meetOrSlice === 'meet') { + scaleX = scaleY = fabric.util.findScaleToFit(this._element, parsedAttributes); + offset = (pWidth - rWidth * scaleX) / 2; + if (pAR.alignX === 'Min') { + offsetLeft = -offset; + } + if (pAR.alignX === 'Max') { + offsetLeft = offset; + } + offset = (pHeight - rHeight * scaleY) / 2; + if (pAR.alignY === 'Min') { + offsetTop = -offset; + } + if (pAR.alignY === 'Max') { + offsetTop = offset; + } + } + if (pAR.meetOrSlice === 'slice') { + scaleX = scaleY = fabric.util.findScaleToCover(this._element, parsedAttributes); + offset = rWidth - pWidth / scaleX; + if (pAR.alignX === 'Mid') { + cropX = offset / 2; + } + if (pAR.alignX === 'Max') { + cropX = offset; + } + offset = rHeight - pHeight / scaleY; + if (pAR.alignY === 'Mid') { + cropY = offset / 2; + } + if (pAR.alignY === 'Max') { + cropY = offset; + } + rWidth = pWidth / scaleX; + rHeight = pHeight / scaleY; + } + } + else { + scaleX = pWidth / rWidth; + scaleY = pHeight / rHeight; + } + return { + width: rWidth, + height: rHeight, + scaleX: scaleX, + scaleY: scaleY, + offsetLeft: offsetLeft, + offsetTop: offsetTop, + cropX: cropX, + cropY: cropY + }; + } + }); + + /** + * Default CSS class name for canvas + * @static + * @type String + * @default + */ + fabric.Image.CSS_CANVAS = 'canvas-img'; + + /** + * Alias for getSrc + * @static + */ + fabric.Image.prototype.getSvgSrc = fabric.Image.prototype.getSrc; + + /** + * Creates an instance of fabric.Image from its object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} callback Callback to invoke when an image instance is created + */ + fabric.Image.fromObject = function(_object, callback) { + var object = fabric.util.object.clone(_object); + fabric.util.loadImage(object.src, function(img, isError) { + if (isError) { + callback && callback(null, true); + return; + } + fabric.Image.prototype._initFilters.call(object, object.filters, function(filters) { + object.filters = filters || []; + fabric.Image.prototype._initFilters.call(object, [object.resizeFilter], function(resizeFilters) { + object.resizeFilter = resizeFilters[0]; + fabric.util.enlivenObjects([object.clipPath], function(enlivedProps) { + object.clipPath = enlivedProps[0]; + var image = new fabric.Image(img, object); + callback(image, false); + }); + }); + }); + }, null, object.crossOrigin); + }; + + /** + * Creates an instance of fabric.Image from an URL string + * @static + * @param {String} url URL to create an image from + * @param {Function} [callback] Callback to invoke when image is created (newly created image is passed as a first argument). Second argument is a boolean indicating if an error occured or not. + * @param {Object} [imgOptions] Options object + */ + fabric.Image.fromURL = function(url, callback, imgOptions) { + fabric.util.loadImage(url, function(img, isError) { + callback && callback(new fabric.Image(img, imgOptions), isError); + }, null, imgOptions && imgOptions.crossOrigin); + }; + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Image.fromElement}) + * @static + * @see {@link http://www.w3.org/TR/SVG/struct.html#ImageElement} + */ + fabric.Image.ATTRIBUTE_NAMES = + fabric.SHARED_ATTRIBUTES.concat( + 'x y width height preserveAspectRatio xlink:href crossOrigin image-rendering'.split(' ') + ); + + /** + * Returns {@link fabric.Image} instance from an SVG element + * @static + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @param {Function} callback Callback to execute when fabric.Image object is created + * @return {fabric.Image} Instance of fabric.Image + */ + fabric.Image.fromElement = function(element, callback, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Image.ATTRIBUTE_NAMES); + fabric.Image.fromURL(parsedAttributes['xlink:href'], callback, + extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes)); + }; + /* _FROM_SVG_END_ */ + +})(typeof exports !== 'undefined' ? exports : this); +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * @private + * @return {Number} angle value + */ + _getAngleValueForStraighten: function() { + var angle = this.angle % 360; + if (angle > 0) { + return Math.round((angle - 1) / 90) * 90; + } + return Math.round(angle / 90) * 90; + }, + + /** + * Straightens an object (rotating it from current angle to one of 0, 90, 180, 270, etc. depending on which is closer) + * @return {fabric.Object} thisArg + * @chainable + */ + straighten: function() { + this.rotate(this._getAngleValueForStraighten()); + return this; + }, + + /** + * Same as {@link fabric.Object.prototype.straighten} but with animation + * @param {Object} callbacks Object with callback functions + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Object} thisArg + * @chainable + */ + fxStraighten: function(callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: this.get('angle'), + endValue: this._getAngleValueForStraighten(), + duration: this.FX_DURATION, + onChange: function(value) { + _this.rotate(value); + onChange(); + }, + onComplete: function() { + _this.setCoords(); + onComplete(); + }, + }); + + return this; + } +}); + +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Straightens object, then rerenders canvas + * @param {fabric.Object} object Object to straighten + * @return {fabric.Canvas} thisArg + * @chainable + */ + straightenObject: function (object) { + object.straighten(); + this.requestRenderAll(); + return this; + }, + + /** + * Same as {@link fabric.Canvas.prototype.straightenObject}, but animated + * @param {fabric.Object} object Object to straighten + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxStraightenObject: function (object) { + object.fxStraighten({ + onChange: this.requestRenderAllBound + }); + return this; + } +}); +(function() { + + 'use strict'; + + /** + * Tests if webgl supports certain precision + * @param {WebGL} Canvas WebGL context to test on + * @param {String} Precision to test can be any of following: 'lowp', 'mediump', 'highp' + * @returns {Boolean} Whether the user's browser WebGL supports given precision. + */ + function testPrecision(gl, precision){ + var fragmentSource = 'precision ' + precision + ' float;\nvoid main(){}'; + var fragmentShader = gl.createShader(gl.FRAGMENT_SHADER); + gl.shaderSource(fragmentShader, fragmentSource); + gl.compileShader(fragmentShader); + if (!gl.getShaderParameter(fragmentShader, gl.COMPILE_STATUS)) { + return false; + } + return true; + } + + /** + * Indicate whether this filtering backend is supported by the user's browser. + * @param {Number} tileSize check if the tileSize is supported + * @returns {Boolean} Whether the user's browser supports WebGL. + */ + fabric.isWebglSupported = function(tileSize) { + if (fabric.isLikelyNode) { + return false; + } + tileSize = tileSize || fabric.WebglFilterBackend.prototype.tileSize; + var canvas = document.createElement('canvas'); + var gl = canvas.getContext('webgl') || canvas.getContext('experimental-webgl'); + var isSupported = false; + // eslint-disable-next-line + if (gl) { + fabric.maxTextureSize = gl.getParameter(gl.MAX_TEXTURE_SIZE); + isSupported = fabric.maxTextureSize >= tileSize; + var precisions = ['highp', 'mediump', 'lowp']; + for (var i = 0; i < 3; i++){ + if (testPrecision(gl, precisions[i])){ + fabric.webGlPrecision = precisions[i]; + break; + }; + } + } + this.isSupported = isSupported; + return isSupported; + }; + + fabric.WebglFilterBackend = WebglFilterBackend; + + /** + * WebGL filter backend. + */ + function WebglFilterBackend(options) { + if (options && options.tileSize) { + this.tileSize = options.tileSize; + } + this.setupGLContext(this.tileSize, this.tileSize); + this.captureGPUInfo(); + }; + + WebglFilterBackend.prototype = /** @lends fabric.WebglFilterBackend.prototype */ { + + tileSize: 2048, + + /** + * Experimental. This object is a sort of repository of help layers used to avoid + * of recreating them during frequent filtering. If you are previewing a filter with + * a slider you problably do not want to create help layers every filter step. + * in this object there will be appended some canvases, created once, resized sometimes + * cleared never. Clearing is left to the developer. + **/ + resources: { + + }, + + /** + * Setup a WebGL context suitable for filtering, and bind any needed event handlers. + */ + setupGLContext: function(width, height) { + this.dispose(); + this.createWebGLCanvas(width, height); + // eslint-disable-next-line + this.aPosition = new Float32Array([0, 0, 0, 1, 1, 0, 1, 1]); + this.chooseFastestCopyGLTo2DMethod(width, height); + }, + + /** + * Pick a method to copy data from GL context to 2d canvas. In some browsers using + * putImageData is faster than drawImage for that specific operation. + */ + chooseFastestCopyGLTo2DMethod: function(width, height) { + var canMeasurePerf = typeof window.performance !== 'undefined', canUseImageData; + try { + new ImageData(1, 1); + canUseImageData = true; + } + catch (e) { + canUseImageData = false; + } + // eslint-disable-next-line no-undef + var canUseArrayBuffer = typeof ArrayBuffer !== 'undefined'; + // eslint-disable-next-line no-undef + var canUseUint8Clamped = typeof Uint8ClampedArray !== 'undefined'; + + if (!(canMeasurePerf && canUseImageData && canUseArrayBuffer && canUseUint8Clamped)) { + return; + } + + var targetCanvas = fabric.util.createCanvasElement(); + // eslint-disable-next-line no-undef + var imageBuffer = new ArrayBuffer(width * height * 4); + if (fabric.forceGLPutImageData) { + this.imageBuffer = imageBuffer; + this.copyGLTo2D = copyGLTo2DPutImageData; + return; + } + var testContext = { + imageBuffer: imageBuffer, + destinationWidth: width, + destinationHeight: height, + targetCanvas: targetCanvas + }; + var startTime, drawImageTime, putImageDataTime; + targetCanvas.width = width; + targetCanvas.height = height; + + startTime = window.performance.now(); + copyGLTo2DDrawImage.call(testContext, this.gl, testContext); + drawImageTime = window.performance.now() - startTime; + + startTime = window.performance.now(); + copyGLTo2DPutImageData.call(testContext, this.gl, testContext); + putImageDataTime = window.performance.now() - startTime; + + if (drawImageTime > putImageDataTime) { + this.imageBuffer = imageBuffer; + this.copyGLTo2D = copyGLTo2DPutImageData; + } + else { + this.copyGLTo2D = copyGLTo2DDrawImage; + } + }, + + /** + * Create a canvas element and associated WebGL context and attaches them as + * class properties to the GLFilterBackend class. + */ + createWebGLCanvas: function(width, height) { + var canvas = fabric.util.createCanvasElement(); + canvas.width = width; + canvas.height = height; + var glOptions = { + alpha: true, + premultipliedAlpha: false, + depth: false, + stencil: false, + antialias: false + }, + gl = canvas.getContext('webgl', glOptions); + if (!gl) { + gl = canvas.getContext('experimental-webgl', glOptions); + } + if (!gl) { + return; + } + gl.clearColor(0, 0, 0, 0); + // this canvas can fire webglcontextlost and webglcontextrestored + this.canvas = canvas; + this.gl = gl; + }, + + /** + * Attempts to apply the requested filters to the source provided, drawing the filtered output + * to the provided target canvas. + * + * @param {Array} filters The filters to apply. + * @param {HTMLImageElement|HTMLCanvasElement} source The source to be filtered. + * @param {Number} width The width of the source input. + * @param {Number} height The height of the source input. + * @param {HTMLCanvasElement} targetCanvas The destination for filtered output to be drawn. + * @param {String|undefined} cacheKey A key used to cache resources related to the source. If + * omitted, caching will be skipped. + */ + applyFilters: function(filters, source, width, height, targetCanvas, cacheKey) { + var gl = this.gl; + var cachedTexture; + if (cacheKey) { + cachedTexture = this.getCachedTexture(cacheKey, source); + } + var pipelineState = { + originalWidth: source.width || source.originalWidth, + originalHeight: source.height || source.originalHeight, + sourceWidth: width, + sourceHeight: height, + destinationWidth: width, + destinationHeight: height, + context: gl, + sourceTexture: this.createTexture(gl, width, height, !cachedTexture && source), + targetTexture: this.createTexture(gl, width, height), + originalTexture: cachedTexture || + this.createTexture(gl, width, height, !cachedTexture && source), + passes: filters.length, + webgl: true, + aPosition: this.aPosition, + programCache: this.programCache, + pass: 0, + filterBackend: this, + targetCanvas: targetCanvas + }; + var tempFbo = gl.createFramebuffer(); + gl.bindFramebuffer(gl.FRAMEBUFFER, tempFbo); + filters.forEach(function(filter) { filter && filter.applyTo(pipelineState); }); + resizeCanvasIfNeeded(pipelineState); + this.copyGLTo2D(gl, pipelineState); + gl.bindTexture(gl.TEXTURE_2D, null); + gl.deleteTexture(pipelineState.sourceTexture); + gl.deleteTexture(pipelineState.targetTexture); + gl.deleteFramebuffer(tempFbo); + targetCanvas.getContext('2d').setTransform(1, 0, 0, 1, 0, 0); + return pipelineState; + }, + + /** + * Detach event listeners, remove references, and clean up caches. + */ + dispose: function() { + if (this.canvas) { + this.canvas = null; + this.gl = null; + } + this.clearWebGLCaches(); + }, + + /** + * Wipe out WebGL-related caches. + */ + clearWebGLCaches: function() { + this.programCache = {}; + this.textureCache = {}; + }, + + /** + * Create a WebGL texture object. + * + * Accepts specific dimensions to initialize the textuer to or a source image. + * + * @param {WebGLRenderingContext} gl The GL context to use for creating the texture. + * @param {Number} width The width to initialize the texture at. + * @param {Number} height The height to initialize the texture. + * @param {HTMLImageElement|HTMLCanvasElement} textureImageSource A source for the texture data. + * @returns {WebGLTexture} + */ + createTexture: function(gl, width, height, textureImageSource) { + var texture = gl.createTexture(); + gl.bindTexture(gl.TEXTURE_2D, texture); + gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, gl.NEAREST); + gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, gl.NEAREST); + gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE); + gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE); + if (textureImageSource) { + gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, gl.RGBA, gl.UNSIGNED_BYTE, textureImageSource); + } + else { + gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, width, height, 0, gl.RGBA, gl.UNSIGNED_BYTE, null); + } + return texture; + }, + + /** + * Can be optionally used to get a texture from the cache array + * + * If an existing texture is not found, a new texture is created and cached. + * + * @param {String} uniqueId A cache key to use to find an existing texture. + * @param {HTMLImageElement|HTMLCanvasElement} textureImageSource A source to use to create the + * texture cache entry if one does not already exist. + */ + getCachedTexture: function(uniqueId, textureImageSource) { + if (this.textureCache[uniqueId]) { + return this.textureCache[uniqueId]; + } + else { + var texture = this.createTexture( + this.gl, textureImageSource.width, textureImageSource.height, textureImageSource); + this.textureCache[uniqueId] = texture; + return texture; + } + }, + + /** + * Clear out cached resources related to a source image that has been + * filtered previously. + * + * @param {String} cacheKey The cache key provided when the source image was filtered. + */ + evictCachesForKey: function(cacheKey) { + if (this.textureCache[cacheKey]) { + this.gl.deleteTexture(this.textureCache[cacheKey]); + delete this.textureCache[cacheKey]; + } + }, + + copyGLTo2D: copyGLTo2DDrawImage, + + /** + * Attempt to extract GPU information strings from a WebGL context. + * + * Useful information when debugging or blacklisting specific GPUs. + * + * @returns {Object} A GPU info object with renderer and vendor strings. + */ + captureGPUInfo: function() { + if (this.gpuInfo) { + return this.gpuInfo; + } + var gl = this.gl, gpuInfo = { renderer: '', vendor: '' }; + if (!gl) { + return gpuInfo; + } + var ext = gl.getExtension('WEBGL_debug_renderer_info'); + if (ext) { + var renderer = gl.getParameter(ext.UNMASKED_RENDERER_WEBGL); + var vendor = gl.getParameter(ext.UNMASKED_VENDOR_WEBGL); + if (renderer) { + gpuInfo.renderer = renderer.toLowerCase(); + } + if (vendor) { + gpuInfo.vendor = vendor.toLowerCase(); + } + } + this.gpuInfo = gpuInfo; + return gpuInfo; + }, + }; +})(); + +function resizeCanvasIfNeeded(pipelineState) { + var targetCanvas = pipelineState.targetCanvas, + width = targetCanvas.width, height = targetCanvas.height, + dWidth = pipelineState.destinationWidth, + dHeight = pipelineState.destinationHeight; + + if (width !== dWidth || height !== dHeight) { + targetCanvas.width = dWidth; + targetCanvas.height = dHeight; + } +} + +/** + * Copy an input WebGL canvas on to an output 2D canvas. + * + * The WebGL canvas is assumed to be upside down, with the top-left pixel of the + * desired output image appearing in the bottom-left corner of the WebGL canvas. + * + * @param {WebGLRenderingContext} sourceContext The WebGL context to copy from. + * @param {HTMLCanvasElement} targetCanvas The 2D target canvas to copy on to. + * @param {Object} pipelineState The 2D target canvas to copy on to. + */ +function copyGLTo2DDrawImage(gl, pipelineState) { + var glCanvas = gl.canvas, targetCanvas = pipelineState.targetCanvas, + ctx = targetCanvas.getContext('2d'); + ctx.translate(0, targetCanvas.height); // move it down again + ctx.scale(1, -1); // vertical flip + // where is my image on the big glcanvas? + var sourceY = glCanvas.height - targetCanvas.height; + ctx.drawImage(glCanvas, 0, sourceY, targetCanvas.width, targetCanvas.height, 0, 0, + targetCanvas.width, targetCanvas.height); +} + +/** + * Copy an input WebGL canvas on to an output 2D canvas using 2d canvas' putImageData + * API. Measurably faster than using ctx.drawImage in Firefox (version 54 on OSX Sierra). + * + * @param {WebGLRenderingContext} sourceContext The WebGL context to copy from. + * @param {HTMLCanvasElement} targetCanvas The 2D target canvas to copy on to. + * @param {Object} pipelineState The 2D target canvas to copy on to. + */ +function copyGLTo2DPutImageData(gl, pipelineState) { + var targetCanvas = pipelineState.targetCanvas, ctx = targetCanvas.getContext('2d'), + dWidth = pipelineState.destinationWidth, + dHeight = pipelineState.destinationHeight, + numBytes = dWidth * dHeight * 4; + + // eslint-disable-next-line no-undef + var u8 = new Uint8Array(this.imageBuffer, 0, numBytes); + // eslint-disable-next-line no-undef + var u8Clamped = new Uint8ClampedArray(this.imageBuffer, 0, numBytes); + + gl.readPixels(0, 0, dWidth, dHeight, gl.RGBA, gl.UNSIGNED_BYTE, u8); + var imgData = new ImageData(u8Clamped, dWidth, dHeight); + ctx.putImageData(imgData, 0, 0); +} +(function() { + + 'use strict'; + + var noop = function() {}; + + fabric.Canvas2dFilterBackend = Canvas2dFilterBackend; + + /** + * Canvas 2D filter backend. + */ + function Canvas2dFilterBackend() {}; + + Canvas2dFilterBackend.prototype = /** @lends fabric.Canvas2dFilterBackend.prototype */ { + evictCachesForKey: noop, + dispose: noop, + clearWebGLCaches: noop, + + /** + * Experimental. This object is a sort of repository of help layers used to avoid + * of recreating them during frequent filtering. If you are previewing a filter with + * a slider you probably do not want to create help layers every filter step. + * in this object there will be appended some canvases, created once, resized sometimes + * cleared never. Clearing is left to the developer. + **/ + resources: { + + }, + + /** + * Apply a set of filters against a source image and draw the filtered output + * to the provided destination canvas. + * + * @param {EnhancedFilter} filters The filter to apply. + * @param {HTMLImageElement|HTMLCanvasElement} sourceElement The source to be filtered. + * @param {Number} sourceWidth The width of the source input. + * @param {Number} sourceHeight The height of the source input. + * @param {HTMLCanvasElement} targetCanvas The destination for filtered output to be drawn. + */ + applyFilters: function(filters, sourceElement, sourceWidth, sourceHeight, targetCanvas) { + var ctx = targetCanvas.getContext('2d'); + ctx.drawImage(sourceElement, 0, 0, sourceWidth, sourceHeight); + var imageData = ctx.getImageData(0, 0, sourceWidth, sourceHeight); + var originalImageData = ctx.getImageData(0, 0, sourceWidth, sourceHeight); + var pipelineState = { + sourceWidth: sourceWidth, + sourceHeight: sourceHeight, + imageData: imageData, + originalEl: sourceElement, + originalImageData: originalImageData, + canvasEl: targetCanvas, + ctx: ctx, + filterBackend: this, + }; + filters.forEach(function(filter) { filter.applyTo(pipelineState); }); + if (pipelineState.imageData.width !== sourceWidth || pipelineState.imageData.height !== sourceHeight) { + targetCanvas.width = pipelineState.imageData.width; + targetCanvas.height = pipelineState.imageData.height; + } + ctx.putImageData(pipelineState.imageData, 0, 0); + return pipelineState; + }, + + }; +})(); +/** + * @namespace fabric.Image.filters + * @memberOf fabric.Image + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2#image_filters} + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + */ +fabric.Image = fabric.Image || { }; +fabric.Image.filters = fabric.Image.filters || { }; + +/** + * Root filter class from which all filter classes inherit from + * @class fabric.Image.filters.BaseFilter + * @memberOf fabric.Image.filters + */ +fabric.Image.filters.BaseFilter = fabric.util.createClass(/** @lends fabric.Image.filters.BaseFilter.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'BaseFilter', + + /** + * Array of attributes to send with buffers. do not modify + * @private + */ + + vertexSource: 'attribute vec2 aPosition;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vTexCoord = aPosition;\n' + + 'gl_Position = vec4(aPosition * 2.0 - 1.0, 0.0, 1.0);\n' + + '}', + + fragmentSource: 'precision highp float;\n' + + 'varying vec2 vTexCoord;\n' + + 'uniform sampler2D uTexture;\n' + + 'void main() {\n' + + 'gl_FragColor = texture2D(uTexture, vTexCoord);\n' + + '}', + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + if (options) { + this.setOptions(options); + } + }, + + /** + * Sets filter's properties from options + * @param {Object} [options] Options object + */ + setOptions: function(options) { + for (var prop in options) { + this[prop] = options[prop]; + } + }, + + /** + * Compile this filter's shader program. + * + * @param {WebGLRenderingContext} gl The GL canvas context to use for shader compilation. + * @param {String} fragmentSource fragmentShader source for compilation + * @param {String} vertexSource vertexShader source for compilation + */ + createProgram: function(gl, fragmentSource, vertexSource) { + fragmentSource = fragmentSource || this.fragmentSource; + vertexSource = vertexSource || this.vertexSource; + if (fabric.webGlPrecision !== 'highp'){ + fragmentSource = fragmentSource.replace( + /precision highp float/g, + 'precision ' + fabric.webGlPrecision + ' float' + ); + } + var vertexShader = gl.createShader(gl.VERTEX_SHADER); + gl.shaderSource(vertexShader, vertexSource); + gl.compileShader(vertexShader); + if (!gl.getShaderParameter(vertexShader, gl.COMPILE_STATUS)) { + throw new Error( + // eslint-disable-next-line prefer-template + 'Vertex shader compile error for ' + this.type + ': ' + + gl.getShaderInfoLog(vertexShader) + ); + } + + var fragmentShader = gl.createShader(gl.FRAGMENT_SHADER); + gl.shaderSource(fragmentShader, fragmentSource); + gl.compileShader(fragmentShader); + if (!gl.getShaderParameter(fragmentShader, gl.COMPILE_STATUS)) { + throw new Error( + // eslint-disable-next-line prefer-template + 'Fragment shader compile error for ' + this.type + ': ' + + gl.getShaderInfoLog(fragmentShader) + ); + } + + var program = gl.createProgram(); + gl.attachShader(program, vertexShader); + gl.attachShader(program, fragmentShader); + gl.linkProgram(program); + if (!gl.getProgramParameter(program, gl.LINK_STATUS)) { + throw new Error( + // eslint-disable-next-line prefer-template + 'Shader link error for "${this.type}" ' + + gl.getProgramInfoLog(program) + ); + } + + var attributeLocations = this.getAttributeLocations(gl, program); + var uniformLocations = this.getUniformLocations(gl, program) || { }; + uniformLocations.uStepW = gl.getUniformLocation(program, 'uStepW'); + uniformLocations.uStepH = gl.getUniformLocation(program, 'uStepH'); + return { + program: program, + attributeLocations: attributeLocations, + uniformLocations: uniformLocations + }; + }, + + /** + * Return a map of attribute names to WebGLAttributeLocation objects. + * + * @param {WebGLRenderingContext} gl The canvas context used to compile the shader program. + * @param {WebGLShaderProgram} program The shader program from which to take attribute locations. + * @returns {Object} A map of attribute names to attribute locations. + */ + getAttributeLocations: function(gl, program) { + return { + aPosition: gl.getAttribLocation(program, 'aPosition'), + }; + }, + + /** + * Return a map of uniform names to WebGLUniformLocation objects. + * + * Intended to be overridden by subclasses. + * + * @param {WebGLRenderingContext} gl The canvas context used to compile the shader program. + * @param {WebGLShaderProgram} program The shader program from which to take uniform locations. + * @returns {Object} A map of uniform names to uniform locations. + */ + getUniformLocations: function (/* gl, program */) { + // in case i do not need any special uniform i need to return an empty object + return { }; + }, + + /** + * Send attribute data from this filter to its shader program on the GPU. + * + * @param {WebGLRenderingContext} gl The canvas context used to compile the shader program. + * @param {Object} attributeLocations A map of shader attribute names to their locations. + */ + sendAttributeData: function(gl, attributeLocations, aPositionData) { + var attributeLocation = attributeLocations.aPosition; + var buffer = gl.createBuffer(); + gl.bindBuffer(gl.ARRAY_BUFFER, buffer); + gl.enableVertexAttribArray(attributeLocation); + gl.vertexAttribPointer(attributeLocation, 2, gl.FLOAT, false, 0, 0); + gl.bufferData(gl.ARRAY_BUFFER, aPositionData, gl.STATIC_DRAW); + }, + + _setupFrameBuffer: function(options) { + var gl = options.context, width, height; + if (options.passes > 1) { + width = options.destinationWidth; + height = options.destinationHeight; + if (options.sourceWidth !== width || options.sourceHeight !== height) { + gl.deleteTexture(options.targetTexture); + options.targetTexture = options.filterBackend.createTexture(gl, width, height); + } + gl.framebufferTexture2D(gl.FRAMEBUFFER, gl.COLOR_ATTACHMENT0, gl.TEXTURE_2D, + options.targetTexture, 0); + } + else { + // draw last filter on canvas and not to framebuffer. + gl.bindFramebuffer(gl.FRAMEBUFFER, null); + gl.finish(); + } + }, + + _swapTextures: function(options) { + options.passes--; + options.pass++; + var temp = options.targetTexture; + options.targetTexture = options.sourceTexture; + options.sourceTexture = temp; + }, + + /** + * Generic isNeutral implementation for one parameter based filters. + * Used only in image applyFilters to discard filters that will not have an effect + * on the image + * Other filters may need their own verison ( ColorMatrix, HueRotation, gamma, ComposedFilter ) + * @param {Object} options + **/ + isNeutralState: function(/* options */) { + var main = this.mainParameter, + _class = fabric.Image.filters[this.type].prototype; + if (main) { + if (Array.isArray(_class[main])) { + for (var i = _class[main].length; i--;) { + if (this[main][i] !== _class[main][i]) { + return false; + } + } + return true; + } + else { + return _class[main] === this[main]; + } + } + else { + return false; + } + }, + + /** + * Apply this filter to the input image data provided. + * + * Determines whether to use WebGL or Canvas2D based on the options.webgl flag. + * + * @param {Object} options + * @param {Number} options.passes The number of filters remaining to be executed + * @param {Boolean} options.webgl Whether to use webgl to render the filter. + * @param {WebGLTexture} options.sourceTexture The texture setup as the source to be filtered. + * @param {WebGLTexture} options.targetTexture The texture where filtered output should be drawn. + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + applyTo: function(options) { + if (options.webgl) { + this._setupFrameBuffer(options); + this.applyToWebGL(options); + this._swapTextures(options); + } + else { + this.applyTo2d(options); + } + }, + + /** + * Retrieves the cached shader. + * @param {Object} options + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + retrieveShader: function(options) { + if (!options.programCache.hasOwnProperty(this.type)) { + options.programCache[this.type] = this.createProgram(options.context); + } + return options.programCache[this.type]; + }, + + /** + * Apply this filter using webgl. + * + * @param {Object} options + * @param {Number} options.passes The number of filters remaining to be executed + * @param {Boolean} options.webgl Whether to use webgl to render the filter. + * @param {WebGLTexture} options.originalTexture The texture of the original input image. + * @param {WebGLTexture} options.sourceTexture The texture setup as the source to be filtered. + * @param {WebGLTexture} options.targetTexture The texture where filtered output should be drawn. + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + applyToWebGL: function(options) { + var gl = options.context; + var shader = this.retrieveShader(options); + if (options.pass === 0 && options.originalTexture) { + gl.bindTexture(gl.TEXTURE_2D, options.originalTexture); + } + else { + gl.bindTexture(gl.TEXTURE_2D, options.sourceTexture); + } + gl.useProgram(shader.program); + this.sendAttributeData(gl, shader.attributeLocations, options.aPosition); + + gl.uniform1f(shader.uniformLocations.uStepW, 1 / options.sourceWidth); + gl.uniform1f(shader.uniformLocations.uStepH, 1 / options.sourceHeight); + + this.sendUniformData(gl, shader.uniformLocations); + gl.viewport(0, 0, options.destinationWidth, options.destinationHeight); + gl.drawArrays(gl.TRIANGLE_STRIP, 0, 4); + }, + + bindAdditionalTexture: function(gl, texture, textureUnit) { + gl.activeTexture(textureUnit); + gl.bindTexture(gl.TEXTURE_2D, texture); + // reset active texture to 0 as usual + gl.activeTexture(gl.TEXTURE0); + }, + + unbindAdditionalTexture: function(gl, textureUnit) { + gl.activeTexture(textureUnit); + gl.bindTexture(gl.TEXTURE_2D, null); + gl.activeTexture(gl.TEXTURE0); + }, + + getMainParameter: function() { + return this[this.mainParameter]; + }, + + setMainParameter: function(value) { + this[this.mainParameter] = value; + }, + + /** + * Send uniform data from this filter to its shader program on the GPU. + * + * Intended to be overridden by subclasses. + * + * @param {WebGLRenderingContext} gl The canvas context used to compile the shader program. + * @param {Object} uniformLocations A map of shader uniform names to their locations. + */ + sendUniformData: function(/* gl, uniformLocations */) { + // Intentionally left blank. Override me in subclasses. + }, + + /** + * If needed by a 2d filter, this functions can create an helper canvas to be used + * remember that options.targetCanvas is available for use till end of chain. + */ + createHelpLayer: function(options) { + if (!options.helpLayer) { + var helpLayer = document.createElement('canvas'); + helpLayer.width = options.sourceWidth; + helpLayer.height = options.sourceHeight; + options.helpLayer = helpLayer; + } + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + var object = { type: this.type }, mainP = this.mainParameter; + if (mainP) { + object[mainP] = this[mainP]; + } + return object; + }, + + /** + * Returns a JSON representation of an instance + * @return {Object} JSON + */ + toJSON: function() { + // delegate, not alias + return this.toObject(); + } +}); + +fabric.Image.filters.BaseFilter.fromObject = function(object, callback) { + var filter = new fabric.Image.filters[object.type](object); + callback && callback(filter); + return filter; +}; +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Color Matrix filter class + * @class fabric.Image.filters.ColorMatrix + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.ColorMatrix#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @see {@Link http://www.webwasp.co.uk/tutorials/219/Color_Matrix_Filter.php} + * @see {@Link http://phoboslab.org/log/2013/11/fast-image-filters-with-webgl} + * @example Kodachrome filter + * var filter = new fabric.Image.filters.ColorMatrix({ + * matrix: [ + 1.1285582396593525, -0.3967382283601348, -0.03992559172921793, 0, 63.72958762196502, + -0.16404339962244616, 1.0835251566291304, -0.05498805115633132, 0, 24.732407896706203, + -0.16786010706155763, -0.5603416277695248, 1.6014850761964943, 0, 35.62982807460946, + 0, 0, 0, 1, 0 + ] + * }); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.ColorMatrix = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.ColorMatrix.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'ColorMatrix', + + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'varying vec2 vTexCoord;\n' + + 'uniform mat4 uColorMatrix;\n' + + 'uniform vec4 uConstants;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'color *= uColorMatrix;\n' + + 'color += uConstants;\n' + + 'gl_FragColor = color;\n' + + '}', + + /** + * Colormatrix for pixels. + * array of 20 floats. Numbers in positions 4, 9, 14, 19 loose meaning + * outside the -1, 1 range. + * 0.0039215686 is the part of 1 that get translated to 1 in 2d + * @param {Array} matrix array of 20 numbers. + * @default + */ + matrix: [ + 1, 0, 0, 0, 0, + 0, 1, 0, 0, 0, + 0, 0, 1, 0, 0, + 0, 0, 0, 1, 0 + ], + + mainParameter: 'matrix', + + /** + * Lock the colormatrix on the color part, skipping alpha, manly for non webgl scenario + * to save some calculation + */ + colorsOnly: true, + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + this.callSuper('initialize', options); + // create a new array instead mutating the prototype with push + this.matrix = this.matrix.slice(0); + }, + + /** + * Apply the ColorMatrix operation to a Uint8Array representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8Array to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, + data = imageData.data, + iLen = data.length, + m = this.matrix, + r, g, b, a, i, colorsOnly = this.colorsOnly; + + for (i = 0; i < iLen; i += 4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + if (colorsOnly) { + data[i] = r * m[0] + g * m[1] + b * m[2] + m[4] * 255; + data[i + 1] = r * m[5] + g * m[6] + b * m[7] + m[9] * 255; + data[i + 2] = r * m[10] + g * m[11] + b * m[12] + m[14] * 255; + } + else { + a = data[i + 3]; + data[i] = r * m[0] + g * m[1] + b * m[2] + a * m[3] + m[4] * 255; + data[i + 1] = r * m[5] + g * m[6] + b * m[7] + a * m[8] + m[9] * 255; + data[i + 2] = r * m[10] + g * m[11] + b * m[12] + a * m[13] + m[14] * 255; + data[i + 3] = r * m[15] + g * m[16] + b * m[17] + a * m[18] + m[19] * 255; + } + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uColorMatrix: gl.getUniformLocation(program, 'uColorMatrix'), + uConstants: gl.getUniformLocation(program, 'uConstants'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + var m = this.matrix, + matrix = [ + m[0], m[1], m[2], m[3], + m[5], m[6], m[7], m[8], + m[10], m[11], m[12], m[13], + m[15], m[16], m[17], m[18] + ], + constants = [m[4], m[9], m[14], m[19]]; + gl.uniformMatrix4fv(uniformLocations.uColorMatrix, false, matrix); + gl.uniform4fv(uniformLocations.uConstants, constants); + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] function to invoke after filter creation + * @return {fabric.Image.filters.ColorMatrix} Instance of fabric.Image.filters.ColorMatrix + */ + fabric.Image.filters.ColorMatrix.fromObject = fabric.Image.filters.BaseFilter.fromObject; +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Brightness filter class + * @class fabric.Image.filters.Brightness + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Brightness#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Brightness({ + * brightness: 0.05 + * }); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.Brightness = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Brightness.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Brightness', + + /** + * Fragment source for the brightness program + */ + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uBrightness;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'color.rgb += uBrightness;\n' + + 'gl_FragColor = color;\n' + + '}', + + /** + * Brightness value, from -1 to 1. + * translated to -255 to 255 for 2d + * 0.0039215686 is the part of 1 that get translated to 1 in 2d + * @param {Number} brightness + * @default + */ + brightness: 0, + + /** + * Describe the property that is the filter parameter + * @param {String} m + * @default + */ + mainParameter: 'brightness', + + /** + * Apply the Brightness operation to a Uint8ClampedArray representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8ClampedArray to be filtered. + */ + applyTo2d: function(options) { + if (this.brightness === 0) { + return; + } + var imageData = options.imageData, + data = imageData.data, i, len = data.length, + brightness = Math.round(this.brightness * 255); + for (i = 0; i < len; i += 4) { + data[i] = data[i] + brightness; + data[i + 1] = data[i + 1] + brightness; + data[i + 2] = data[i + 2] + brightness; + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uBrightness: gl.getUniformLocation(program, 'uBrightness'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform1f(uniformLocations.uBrightness, this.brightness); + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Brightness} Instance of fabric.Image.filters.Brightness + */ + fabric.Image.filters.Brightness.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Adapted from html5rocks article + * @class fabric.Image.filters.Convolute + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Convolute#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example Sharpen filter + * var filter = new fabric.Image.filters.Convolute({ + * matrix: [ 0, -1, 0, + * -1, 5, -1, + * 0, -1, 0 ] + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + * @example Blur filter + * var filter = new fabric.Image.filters.Convolute({ + * matrix: [ 1/9, 1/9, 1/9, + * 1/9, 1/9, 1/9, + * 1/9, 1/9, 1/9 ] + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + * @example Emboss filter + * var filter = new fabric.Image.filters.Convolute({ + * matrix: [ 1, 1, 1, + * 1, 0.7, -1, + * -1, -1, -1 ] + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + * @example Emboss filter with opaqueness + * var filter = new fabric.Image.filters.Convolute({ + * opaque: true, + * matrix: [ 1, 1, 1, + * 1, 0.7, -1, + * -1, -1, -1 ] + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + */ + filters.Convolute = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Convolute.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Convolute', + + /* + * Opaque value (true/false) + */ + opaque: false, + + /* + * matrix for the filter, max 9x9 + */ + matrix: [0, 0, 0, 0, 1, 0, 0, 0, 0], + + /** + * Fragment source for the brightness program + */ + fragmentSource: { + Convolute_3_1: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[9];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 0);\n' + + 'for (float h = 0.0; h < 3.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 3.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 1), uStepH * (h - 1));\n' + + 'color += texture2D(uTexture, vTexCoord + matrixPos) * uMatrix[int(h * 3.0 + w)];\n' + + '}\n' + + '}\n' + + 'gl_FragColor = color;\n' + + '}', + Convolute_3_0: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[9];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 1);\n' + + 'for (float h = 0.0; h < 3.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 3.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 1.0), uStepH * (h - 1.0));\n' + + 'color.rgb += texture2D(uTexture, vTexCoord + matrixPos).rgb * uMatrix[int(h * 3.0 + w)];\n' + + '}\n' + + '}\n' + + 'float alpha = texture2D(uTexture, vTexCoord).a;\n' + + 'gl_FragColor = color;\n' + + 'gl_FragColor.a = alpha;\n' + + '}', + Convolute_5_1: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[25];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 0);\n' + + 'for (float h = 0.0; h < 5.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 5.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 2.0), uStepH * (h - 2.0));\n' + + 'color += texture2D(uTexture, vTexCoord + matrixPos) * uMatrix[int(h * 5.0 + w)];\n' + + '}\n' + + '}\n' + + 'gl_FragColor = color;\n' + + '}', + Convolute_5_0: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[25];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 1);\n' + + 'for (float h = 0.0; h < 5.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 5.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 2.0), uStepH * (h - 2.0));\n' + + 'color.rgb += texture2D(uTexture, vTexCoord + matrixPos).rgb * uMatrix[int(h * 5.0 + w)];\n' + + '}\n' + + '}\n' + + 'float alpha = texture2D(uTexture, vTexCoord).a;\n' + + 'gl_FragColor = color;\n' + + 'gl_FragColor.a = alpha;\n' + + '}', + Convolute_7_1: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[49];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 0);\n' + + 'for (float h = 0.0; h < 7.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 7.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 3.0), uStepH * (h - 3.0));\n' + + 'color += texture2D(uTexture, vTexCoord + matrixPos) * uMatrix[int(h * 7.0 + w)];\n' + + '}\n' + + '}\n' + + 'gl_FragColor = color;\n' + + '}', + Convolute_7_0: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[49];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 1);\n' + + 'for (float h = 0.0; h < 7.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 7.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 3.0), uStepH * (h - 3.0));\n' + + 'color.rgb += texture2D(uTexture, vTexCoord + matrixPos).rgb * uMatrix[int(h * 7.0 + w)];\n' + + '}\n' + + '}\n' + + 'float alpha = texture2D(uTexture, vTexCoord).a;\n' + + 'gl_FragColor = color;\n' + + 'gl_FragColor.a = alpha;\n' + + '}', + Convolute_9_1: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[81];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 0);\n' + + 'for (float h = 0.0; h < 9.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 9.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 4.0), uStepH * (h - 4.0));\n' + + 'color += texture2D(uTexture, vTexCoord + matrixPos) * uMatrix[int(h * 9.0 + w)];\n' + + '}\n' + + '}\n' + + 'gl_FragColor = color;\n' + + '}', + Convolute_9_0: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[81];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 1);\n' + + 'for (float h = 0.0; h < 9.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 9.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 4.0), uStepH * (h - 4.0));\n' + + 'color.rgb += texture2D(uTexture, vTexCoord + matrixPos).rgb * uMatrix[int(h * 9.0 + w)];\n' + + '}\n' + + '}\n' + + 'float alpha = texture2D(uTexture, vTexCoord).a;\n' + + 'gl_FragColor = color;\n' + + 'gl_FragColor.a = alpha;\n' + + '}', + }, + + /** + * Constructor + * @memberOf fabric.Image.filters.Convolute.prototype + * @param {Object} [options] Options object + * @param {Boolean} [options.opaque=false] Opaque value (true/false) + * @param {Array} [options.matrix] Filter matrix + */ + + + /** + * Retrieves the cached shader. + * @param {Object} options + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + retrieveShader: function(options) { + var size = Math.sqrt(this.matrix.length); + var cacheKey = this.type + '_' + size + '_' + (this.opaque ? 1 : 0); + var shaderSource = this.fragmentSource[cacheKey]; + if (!options.programCache.hasOwnProperty(cacheKey)) { + options.programCache[cacheKey] = this.createProgram(options.context, shaderSource); + } + return options.programCache[cacheKey]; + }, + + /** + * Apply the Brightness operation to a Uint8ClampedArray representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8ClampedArray to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, + data = imageData.data, + weights = this.matrix, + side = Math.round(Math.sqrt(weights.length)), + halfSide = Math.floor(side / 2), + sw = imageData.width, + sh = imageData.height, + output = options.ctx.createImageData(sw, sh), + dst = output.data, + // go through the destination image pixels + alphaFac = this.opaque ? 1 : 0, + r, g, b, a, dstOff, + scx, scy, srcOff, wt, + x, y, cx, cy; + + for (y = 0; y < sh; y++) { + for (x = 0; x < sw; x++) { + dstOff = (y * sw + x) * 4; + // calculate the weighed sum of the source image pixels that + // fall under the convolution matrix + r = 0; g = 0; b = 0; a = 0; + + for (cy = 0; cy < side; cy++) { + for (cx = 0; cx < side; cx++) { + scy = y + cy - halfSide; + scx = x + cx - halfSide; + + // eslint-disable-next-line max-depth + if (scy < 0 || scy >= sh || scx < 0 || scx >= sw) { + continue; + } + + srcOff = (scy * sw + scx) * 4; + wt = weights[cy * side + cx]; + + r += data[srcOff] * wt; + g += data[srcOff + 1] * wt; + b += data[srcOff + 2] * wt; + // eslint-disable-next-line max-depth + if (!alphaFac) { + a += data[srcOff + 3] * wt; + } + } + } + dst[dstOff] = r; + dst[dstOff + 1] = g; + dst[dstOff + 2] = b; + if (!alphaFac) { + dst[dstOff + 3] = a; + } + else { + dst[dstOff + 3] = data[dstOff + 3]; + } + } + } + options.imageData = output; + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uMatrix: gl.getUniformLocation(program, 'uMatrix'), + uOpaque: gl.getUniformLocation(program, 'uOpaque'), + uHalfSize: gl.getUniformLocation(program, 'uHalfSize'), + uSize: gl.getUniformLocation(program, 'uSize'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform1fv(uniformLocations.uMatrix, this.matrix); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + opaque: this.opaque, + matrix: this.matrix + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Convolute} Instance of fabric.Image.filters.Convolute + */ + fabric.Image.filters.Convolute.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Grayscale image filter class + * @class fabric.Image.filters.Grayscale + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Grayscale(); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.Grayscale = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Grayscale.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Grayscale', + + fragmentSource: { + average: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'float average = (color.r + color.b + color.g) / 3.0;\n' + + 'gl_FragColor = vec4(average, average, average, color.a);\n' + + '}', + lightness: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform int uMode;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 col = texture2D(uTexture, vTexCoord);\n' + + 'float average = (max(max(col.r, col.g),col.b) + min(min(col.r, col.g),col.b)) / 2.0;\n' + + 'gl_FragColor = vec4(average, average, average, col.a);\n' + + '}', + luminosity: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform int uMode;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 col = texture2D(uTexture, vTexCoord);\n' + + 'float average = 0.21 * col.r + 0.72 * col.g + 0.07 * col.b;\n' + + 'gl_FragColor = vec4(average, average, average, col.a);\n' + + '}', + }, + + + /** + * Grayscale mode, between 'average', 'lightness', 'luminosity' + * @param {String} type + * @default + */ + mode: 'average', + + mainParameter: 'mode', + + /** + * Apply the Grayscale operation to a Uint8Array representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8Array to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, + data = imageData.data, i, + len = data.length, value, + mode = this.mode; + for (i = 0; i < len; i += 4) { + if (mode === 'average') { + value = (data[i] + data[i + 1] + data[i + 2]) / 3; + } + else if (mode === 'lightness') { + value = (Math.min(data[i], data[i + 1], data[i + 2]) + + Math.max(data[i], data[i + 1], data[i + 2])) / 2; + } + else if (mode === 'luminosity') { + value = 0.21 * data[i] + 0.72 * data[i + 1] + 0.07 * data[i + 2]; + } + data[i] = value; + data[i + 1] = value; + data[i + 2] = value; + } + }, + + /** + * Retrieves the cached shader. + * @param {Object} options + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + retrieveShader: function(options) { + var cacheKey = this.type + '_' + this.mode; + if (!options.programCache.hasOwnProperty(cacheKey)) { + var shaderSource = this.fragmentSource[this.mode]; + options.programCache[cacheKey] = this.createProgram(options.context, shaderSource); + } + return options.programCache[cacheKey]; + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uMode: gl.getUniformLocation(program, 'uMode'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + // default average mode. + var mode = 1; + gl.uniform1i(uniformLocations.uMode, mode); + }, + + /** + * Grayscale filter isNeutralState implementation + * The filter is never neutral + * on the image + **/ + isNeutralState: function() { + return false; + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Grayscale} Instance of fabric.Image.filters.Grayscale + */ + fabric.Image.filters.Grayscale.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Invert filter class + * @class fabric.Image.filters.Invert + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Invert(); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Invert = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Invert.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Invert', + + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform int uInvert;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'if (uInvert == 1) {\n' + + 'gl_FragColor = vec4(1.0 - color.r,1.0 -color.g,1.0 -color.b,color.a);\n' + + '} else {\n' + + 'gl_FragColor = color;\n' + + '}\n' + + '}', + + /** + * Filter invert. if false, does nothing + * @param {Boolean} invert + * @default + */ + invert: true, + + mainParameter: 'invert', + + /** + * Apply the Invert operation to a Uint8Array representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8Array to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, + data = imageData.data, i, + len = data.length; + for (i = 0; i < len; i += 4) { + data[i] = 255 - data[i]; + data[i + 1] = 255 - data[i + 1]; + data[i + 2] = 255 - data[i + 2]; + } + }, + + /** + * Invert filter isNeutralState implementation + * Used only in image applyFilters to discard filters that will not have an effect + * on the image + * @param {Object} options + **/ + isNeutralState: function() { + return !this.invert; + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uInvert: gl.getUniformLocation(program, 'uInvert'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform1i(uniformLocations.uInvert, this.invert); + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Invert} Instance of fabric.Image.filters.Invert + */ + fabric.Image.filters.Invert.fromObject = fabric.Image.filters.BaseFilter.fromObject; + + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Noise filter class + * @class fabric.Image.filters.Noise + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Noise#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Noise({ + * noise: 700 + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + */ + filters.Noise = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Noise.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Noise', + + /** + * Fragment source for the noise program + */ + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uStepH;\n' + + 'uniform float uNoise;\n' + + 'uniform float uSeed;\n' + + 'varying vec2 vTexCoord;\n' + + 'float rand(vec2 co, float seed, float vScale) {\n' + + 'return fract(sin(dot(co.xy * vScale ,vec2(12.9898 , 78.233))) * 43758.5453 * (seed + 0.01) / 2.0);\n' + + '}\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'color.rgb += (0.5 - rand(vTexCoord, uSeed, 0.1 / uStepH)) * uNoise;\n' + + 'gl_FragColor = color;\n' + + '}', + + /** + * Describe the property that is the filter parameter + * @param {String} m + * @default + */ + mainParameter: 'noise', + + /** + * Noise value, from + * @param {Number} noise + * @default + */ + noise: 0, + + /** + * Apply the Brightness operation to a Uint8ClampedArray representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8ClampedArray to be filtered. + */ + applyTo2d: function(options) { + if (this.noise === 0) { + return; + } + var imageData = options.imageData, + data = imageData.data, i, len = data.length, + noise = this.noise, rand; + + for (i = 0, len = data.length; i < len; i += 4) { + + rand = (0.5 - Math.random()) * noise; + + data[i] += rand; + data[i + 1] += rand; + data[i + 2] += rand; + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uNoise: gl.getUniformLocation(program, 'uNoise'), + uSeed: gl.getUniformLocation(program, 'uSeed'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform1f(uniformLocations.uNoise, this.noise / 255); + gl.uniform1f(uniformLocations.uSeed, Math.random()); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + noise: this.noise + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Noise} Instance of fabric.Image.filters.Noise + */ + fabric.Image.filters.Noise.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Pixelate filter class + * @class fabric.Image.filters.Pixelate + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Pixelate#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Pixelate({ + * blocksize: 8 + * }); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.Pixelate = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Pixelate.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Pixelate', + + blocksize: 4, + + mainParameter: 'blocksize', + + /** + * Fragment source for the Pixelate program + */ + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uBlocksize;\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'float blockW = uBlocksize * uStepW;\n' + + 'float blockH = uBlocksize * uStepW;\n' + + 'int posX = int(vTexCoord.x / blockW);\n' + + 'int posY = int(vTexCoord.y / blockH);\n' + + 'float fposX = float(posX);\n' + + 'float fposY = float(posY);\n' + + 'vec2 squareCoords = vec2(fposX * blockW, fposY * blockH);\n' + + 'vec4 color = texture2D(uTexture, squareCoords);\n' + + 'gl_FragColor = color;\n' + + '}', + + /** + * Apply the Pixelate operation to a Uint8ClampedArray representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8ClampedArray to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, + data = imageData.data, + iLen = imageData.height, + jLen = imageData.width, + index, i, j, r, g, b, a, + _i, _j, _iLen, _jLen; + + for (i = 0; i < iLen; i += this.blocksize) { + for (j = 0; j < jLen; j += this.blocksize) { + + index = (i * 4) * jLen + (j * 4); + + r = data[index]; + g = data[index + 1]; + b = data[index + 2]; + a = data[index + 3]; + + _iLen = Math.min(i + this.blocksize, iLen); + _jLen = Math.min(j + this.blocksize, jLen); + for (_i = i; _i < _iLen; _i++) { + for (_j = j; _j < _jLen; _j++) { + index = (_i * 4) * jLen + (_j * 4); + data[index] = r; + data[index + 1] = g; + data[index + 2] = b; + data[index + 3] = a; + } + } + } + } + }, + + /** + * Indicate when the filter is not gonna apply changes to the image + **/ + isNeutralState: function() { + return this.blocksize === 1; + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uBlocksize: gl.getUniformLocation(program, 'uBlocksize'), + uStepW: gl.getUniformLocation(program, 'uStepW'), + uStepH: gl.getUniformLocation(program, 'uStepH'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform1f(uniformLocations.uBlocksize, this.blocksize); + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Pixelate} Instance of fabric.Image.filters.Pixelate + */ + fabric.Image.filters.Pixelate.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Remove white filter class + * @class fabric.Image.filters.RemoveColor + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.RemoveColor#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.RemoveColor({ + * threshold: 0.2, + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + */ + filters.RemoveColor = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.RemoveColor.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'RemoveColor', + + /** + * Color to remove, in any format understood by fabric.Color. + * @param {String} type + * @default + */ + color: '#FFFFFF', + + /** + * Fragment source for the brightness program + */ + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform vec4 uLow;\n' + + 'uniform vec4 uHigh;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'gl_FragColor = texture2D(uTexture, vTexCoord);\n' + + 'if(all(greaterThan(gl_FragColor.rgb,uLow.rgb)) && all(greaterThan(uHigh.rgb,gl_FragColor.rgb))) {\n' + + 'gl_FragColor.a = 0.0;\n' + + '}\n' + + '}', + + /** + * distance to actual color, as value up or down from each r,g,b + * between 0 and 1 + **/ + distance: 0.02, + + /** + * For color to remove inside distance, use alpha channel for a smoother deletion + * NOT IMPLEMENTED YET + **/ + useAlpha: false, + + /** + * Constructor + * @memberOf fabric.Image.filters.RemoveWhite.prototype + * @param {Object} [options] Options object + * @param {Number} [options.color=#RRGGBB] Threshold value + * @param {Number} [options.distance=10] Distance value + */ + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo2d: function(options) { + var imageData = options.imageData, + data = imageData.data, i, + distance = this.distance * 255, + r, g, b, + source = new fabric.Color(this.color).getSource(), + lowC = [ + source[0] - distance, + source[1] - distance, + source[2] - distance, + ], + highC = [ + source[0] + distance, + source[1] + distance, + source[2] + distance, + ]; + + + for (i = 0; i < data.length; i += 4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + + if (r > lowC[0] && + g > lowC[1] && + b > lowC[2] && + r < highC[0] && + g < highC[1] && + b < highC[2]) { + data[i + 3] = 0; + } + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uLow: gl.getUniformLocation(program, 'uLow'), + uHigh: gl.getUniformLocation(program, 'uHigh'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + var source = new fabric.Color(this.color).getSource(), + distance = parseFloat(this.distance), + lowC = [ + 0 + source[0] / 255 - distance, + 0 + source[1] / 255 - distance, + 0 + source[2] / 255 - distance, + 1 + ], + highC = [ + source[0] / 255 + distance, + source[1] / 255 + distance, + source[2] / 255 + distance, + 1 + ]; + gl.uniform4fv(uniformLocations.uLow, lowC); + gl.uniform4fv(uniformLocations.uHigh, highC); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + color: this.color, + distance: this.distance + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.RemoveColor} Instance of fabric.Image.filters.RemoveWhite + */ + fabric.Image.filters.RemoveColor.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + var matrices = { + Brownie: [ + 0.59970,0.34553,-0.27082,0,0.186, + -0.03770,0.86095,0.15059,0,-0.1449, + 0.24113,-0.07441,0.44972,0,-0.02965, + 0,0,0,1,0 + ], + Vintage: [ + 0.62793,0.32021,-0.03965,0,0.03784, + 0.02578,0.64411,0.03259,0,0.02926, + 0.04660,-0.08512,0.52416,0,0.02023, + 0,0,0,1,0 + ], + Kodachrome: [ + 1.12855,-0.39673,-0.03992,0,0.24991, + -0.16404,1.08352,-0.05498,0,0.09698, + -0.16786,-0.56034,1.60148,0,0.13972, + 0,0,0,1,0 + ], + Technicolor: [ + 1.91252,-0.85453,-0.09155,0,0.04624, + -0.30878,1.76589,-0.10601,0,-0.27589, + -0.23110,-0.75018,1.84759,0,0.12137, + 0,0,0,1,0 + ], + Polaroid: [ + 1.438,-0.062,-0.062,0,0, + -0.122,1.378,-0.122,0,0, + -0.016,-0.016,1.483,0,0, + 0,0,0,1,0 + ], + Sepia: [ + 0.393, 0.769, 0.189, 0, 0, + 0.349, 0.686, 0.168, 0, 0, + 0.272, 0.534, 0.131, 0, 0, + 0, 0, 0, 1, 0 + ], + BlackWhite: [ + 1.5, 1.5, 1.5, 0, -1, + 1.5, 1.5, 1.5, 0, -1, + 1.5, 1.5, 1.5, 0, -1, + 0, 0, 0, 1, 0, + ] + }; + + for (var key in matrices) { + filters[key] = createClass(filters.ColorMatrix, /** @lends fabric.Image.filters.Sepia.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: key, + + /** + * Colormatrix for the effect + * array of 20 floats. Numbers in positions 4, 9, 14, 19 loose meaning + * outside the -1, 1 range. + * @param {Array} matrix array of 20 numbers. + * @default + */ + matrix: matrices[key], + + /** + * Lock the matrix export for this kind of static, parameter less filters. + */ + mainParameter: false, + /** + * Lock the colormatrix on the color part, skipping alpha + */ + colorsOnly: true, + + }); + fabric.Image.filters[key].fromObject = fabric.Image.filters.BaseFilter.fromObject; + } +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + 'use strict'; + + var fabric = global.fabric, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Color Blend filter class + * @class fabric.Image.filter.BlendColor + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @example + * var filter = new fabric.Image.filters.BlendColor({ + * color: '#000', + * mode: 'multiply' + * }); + * + * var filter = new fabric.Image.filters.BlendImage({ + * image: fabricImageObject, + * mode: 'multiply', + * alpha: 0.5 + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + */ + + filters.BlendColor = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Blend.prototype */ { + type: 'BlendColor', + + /** + * Color to make the blend operation with. default to a reddish color since black or white + * gives always strong result. + **/ + color: '#F95C63', + + /** + * Blend mode for the filter: one of multiply, add, diff, screen, subtract, + * darken, lighten, overlay, exclusion, tint. + **/ + mode: 'multiply', + + /** + * alpha value. represent the strength of the blend color operation. + **/ + alpha: 1, + + /** + * Fragment source for the Multiply program + */ + fragmentSource: { + multiply: 'gl_FragColor.rgb *= uColor.rgb;\n', + screen: 'gl_FragColor.rgb = 1.0 - (1.0 - gl_FragColor.rgb) * (1.0 - uColor.rgb);\n', + add: 'gl_FragColor.rgb += uColor.rgb;\n', + diff: 'gl_FragColor.rgb = abs(gl_FragColor.rgb - uColor.rgb);\n', + subtract: 'gl_FragColor.rgb -= uColor.rgb;\n', + lighten: 'gl_FragColor.rgb = max(gl_FragColor.rgb, uColor.rgb);\n', + darken: 'gl_FragColor.rgb = min(gl_FragColor.rgb, uColor.rgb);\n', + exclusion: 'gl_FragColor.rgb += uColor.rgb - 2.0 * (uColor.rgb * gl_FragColor.rgb);\n', + overlay: 'if (uColor.r < 0.5) {\n' + + 'gl_FragColor.r *= 2.0 * uColor.r;\n' + + '} else {\n' + + 'gl_FragColor.r = 1.0 - 2.0 * (1.0 - gl_FragColor.r) * (1.0 - uColor.r);\n' + + '}\n' + + 'if (uColor.g < 0.5) {\n' + + 'gl_FragColor.g *= 2.0 * uColor.g;\n' + + '} else {\n' + + 'gl_FragColor.g = 1.0 - 2.0 * (1.0 - gl_FragColor.g) * (1.0 - uColor.g);\n' + + '}\n' + + 'if (uColor.b < 0.5) {\n' + + 'gl_FragColor.b *= 2.0 * uColor.b;\n' + + '} else {\n' + + 'gl_FragColor.b = 1.0 - 2.0 * (1.0 - gl_FragColor.b) * (1.0 - uColor.b);\n' + + '}\n', + tint: 'gl_FragColor.rgb *= (1.0 - uColor.a);\n' + + 'gl_FragColor.rgb += uColor.rgb;\n', + }, + + /** + * build the fragment source for the filters, joining the common part with + * the specific one. + * @param {String} mode the mode of the filter, a key of this.fragmentSource + * @return {String} the source to be compiled + * @private + */ + buildSource: function(mode) { + return 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform vec4 uColor;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'gl_FragColor = color;\n' + + 'if (color.a > 0.0) {\n' + + this.fragmentSource[mode] + + '}\n' + + '}'; + }, + + /** + * Retrieves the cached shader. + * @param {Object} options + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + retrieveShader: function(options) { + var cacheKey = this.type + '_' + this.mode, shaderSource; + if (!options.programCache.hasOwnProperty(cacheKey)) { + shaderSource = this.buildSource(this.mode); + options.programCache[cacheKey] = this.createProgram(options.context, shaderSource); + } + return options.programCache[cacheKey]; + }, + + /** + * Apply the Blend operation to a Uint8ClampedArray representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8ClampedArray to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, + data = imageData.data, iLen = data.length, + tr, tg, tb, + r, g, b, + source, alpha1 = 1 - this.alpha; + + source = new fabric.Color(this.color).getSource(); + tr = source[0] * this.alpha; + tg = source[1] * this.alpha; + tb = source[2] * this.alpha; + + for (var i = 0; i < iLen; i += 4) { + + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + + switch (this.mode) { + case 'multiply': + data[i] = r * tr / 255; + data[i + 1] = g * tg / 255; + data[i + 2] = b * tb / 255; + break; + case 'screen': + data[i] = 255 - (255 - r) * (255 - tr) / 255; + data[i + 1] = 255 - (255 - g) * (255 - tg) / 255; + data[i + 2] = 255 - (255 - b) * (255 - tb) / 255; + break; + case 'add': + data[i] = r + tr; + data[i + 1] = g + tg; + data[i + 2] = b + tb; + break; + case 'diff': + case 'difference': + data[i] = Math.abs(r - tr); + data[i + 1] = Math.abs(g - tg); + data[i + 2] = Math.abs(b - tb); + break; + case 'subtract': + data[i] = r - tr; + data[i + 1] = g - tg; + data[i + 2] = b - tb; + break; + case 'darken': + data[i] = Math.min(r, tr); + data[i + 1] = Math.min(g, tg); + data[i + 2] = Math.min(b, tb); + break; + case 'lighten': + data[i] = Math.max(r, tr); + data[i + 1] = Math.max(g, tg); + data[i + 2] = Math.max(b, tb); + break; + case 'overlay': + data[i] = tr < 128 ? (2 * r * tr / 255) : (255 - 2 * (255 - r) * (255 - tr) / 255); + data[i + 1] = tg < 128 ? (2 * g * tg / 255) : (255 - 2 * (255 - g) * (255 - tg) / 255); + data[i + 2] = tb < 128 ? (2 * b * tb / 255) : (255 - 2 * (255 - b) * (255 - tb) / 255); + break; + case 'exclusion': + data[i] = tr + r - ((2 * tr * r) / 255); + data[i + 1] = tg + g - ((2 * tg * g) / 255); + data[i + 2] = tb + b - ((2 * tb * b) / 255); + break; + case 'tint': + data[i] = tr + r * alpha1; + data[i + 1] = tg + g * alpha1; + data[i + 2] = tb + b * alpha1; + } + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uColor: gl.getUniformLocation(program, 'uColor'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + var source = new fabric.Color(this.color).getSource(); + source[0] = this.alpha * source[0] / 255; + source[1] = this.alpha * source[1] / 255; + source[2] = this.alpha * source[2] / 255; + source[3] = this.alpha; + gl.uniform4fv(uniformLocations.uColor, source); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return { + type: this.type, + color: this.color, + mode: this.mode, + alpha: this.alpha + }; + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.BlendColor} Instance of fabric.Image.filters.BlendColor + */ + fabric.Image.filters.BlendColor.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + 'use strict'; + + var fabric = global.fabric, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Image Blend filter class + * @class fabric.Image.filter.BlendImage + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @example + * var filter = new fabric.Image.filters.BlendColor({ + * color: '#000', + * mode: 'multiply' + * }); + * + * var filter = new fabric.Image.filters.BlendImage({ + * image: fabricImageObject, + * mode: 'multiply', + * alpha: 0.5 + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + */ + + filters.BlendImage = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.BlendImage.prototype */ { + type: 'BlendImage', + + /** + * Color to make the blend operation with. default to a reddish color since black or white + * gives always strong result. + **/ + image: null, + + /** + * Blend mode for the filter: one of multiply, add, diff, screen, subtract, + * darken, lighten, overlay, exclusion, tint. + **/ + mode: 'multiply', + + /** + * alpha value. represent the strength of the blend image operation. + * not implemented. + **/ + alpha: 1, + + vertexSource: 'attribute vec2 aPosition;\n' + + 'varying vec2 vTexCoord;\n' + + 'varying vec2 vTexCoord2;\n' + + 'uniform mat3 uTransformMatrix;\n' + + 'void main() {\n' + + 'vTexCoord = aPosition;\n' + + 'vTexCoord2 = (uTransformMatrix * vec3(aPosition, 1.0)).xy;\n' + + 'gl_Position = vec4(aPosition * 2.0 - 1.0, 0.0, 1.0);\n' + + '}', + + /** + * Fragment source for the Multiply program + */ + fragmentSource: { + multiply: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform sampler2D uImage;\n' + + 'uniform vec4 uColor;\n' + + 'varying vec2 vTexCoord;\n' + + 'varying vec2 vTexCoord2;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'vec4 color2 = texture2D(uImage, vTexCoord2);\n' + + 'color.rgba *= color2.rgba;\n' + + 'gl_FragColor = color;\n' + + '}', + mask: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform sampler2D uImage;\n' + + 'uniform vec4 uColor;\n' + + 'varying vec2 vTexCoord;\n' + + 'varying vec2 vTexCoord2;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'vec4 color2 = texture2D(uImage, vTexCoord2);\n' + + 'color.a = color2.a;\n' + + 'gl_FragColor = color;\n' + + '}', + }, + + /** + * Retrieves the cached shader. + * @param {Object} options + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + retrieveShader: function(options) { + var cacheKey = this.type + '_' + this.mode; + var shaderSource = this.fragmentSource[this.mode]; + if (!options.programCache.hasOwnProperty(cacheKey)) { + options.programCache[cacheKey] = this.createProgram(options.context, shaderSource); + } + return options.programCache[cacheKey]; + }, + + applyToWebGL: function(options) { + // load texture to blend. + var gl = options.context, + texture = this.createTexture(options.filterBackend, this.image); + this.bindAdditionalTexture(gl, texture, gl.TEXTURE1); + this.callSuper('applyToWebGL', options); + this.unbindAdditionalTexture(gl, gl.TEXTURE1); + }, + + createTexture: function(backend, image) { + return backend.getCachedTexture(image.cacheKey, image._element); + }, + + /** + * Calculate a transformMatrix to adapt the image to blend over + * @param {Object} options + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + calculateMatrix: function() { + var image = this.image, + width = image._element.width, + height = image._element.height; + return [ + 1 / image.scaleX, 0, 0, + 0, 1 / image.scaleY, 0, + -image.left / width, -image.top / height, 1 + ]; + }, + + /** + * Apply the Blend operation to a Uint8ClampedArray representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8ClampedArray to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, + resources = options.filterBackend.resources, + data = imageData.data, iLen = data.length, + width = imageData.width, + height = imageData.height, + tr, tg, tb, ta, + r, g, b, a, + canvas1, context, image = this.image, blendData; + + if (!resources.blendImage) { + resources.blendImage = fabric.util.createCanvasElement(); + } + canvas1 = resources.blendImage; + context = canvas1.getContext('2d'); + if (canvas1.width !== width || canvas1.height !== height) { + canvas1.width = width; + canvas1.height = height; + } + else { + context.clearRect(0, 0, width, height); + } + context.setTransform(image.scaleX, 0, 0, image.scaleY, image.left, image.top); + context.drawImage(image._element, 0, 0, width, height); + blendData = context.getImageData(0, 0, width, height).data; + for (var i = 0; i < iLen; i += 4) { + + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + a = data[i + 3]; + + tr = blendData[i]; + tg = blendData[i + 1]; + tb = blendData[i + 2]; + ta = blendData[i + 3]; + + switch (this.mode) { + case 'multiply': + data[i] = r * tr / 255; + data[i + 1] = g * tg / 255; + data[i + 2] = b * tb / 255; + data[i + 3] = a * ta / 255; + break; + case 'mask': + data[i + 3] = ta; + break; + } + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uTransformMatrix: gl.getUniformLocation(program, 'uTransformMatrix'), + uImage: gl.getUniformLocation(program, 'uImage'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + var matrix = this.calculateMatrix(); + gl.uniform1i(uniformLocations.uImage, 1); // texture unit 1. + gl.uniformMatrix3fv(uniformLocations.uTransformMatrix, false, matrix); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return { + type: this.type, + image: this.image && this.image.toObject(), + mode: this.mode, + alpha: this.alpha + }; + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} callback to be invoked after filter creation + * @return {fabric.Image.filters.BlendImage} Instance of fabric.Image.filters.BlendImage + */ + fabric.Image.filters.BlendImage.fromObject = function(object, callback) { + fabric.Image.fromObject(object.image, function(image) { + var options = fabric.util.object.clone(object); + options.image = image; + callback(new fabric.Image.filters.BlendImage(options)); + }); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), pow = Math.pow, floor = Math.floor, + sqrt = Math.sqrt, abs = Math.abs, round = Math.round, sin = Math.sin, + ceil = Math.ceil, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Resize image filter class + * @class fabric.Image.filters.Resize + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Resize(); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Resize = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Resize.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Resize', + + /** + * Resize type + * for webgl resizeType is just lanczos, for canvas2d can be: + * bilinear, hermite, sliceHack, lanczos. + * @param {String} resizeType + * @default + */ + resizeType: 'hermite', + + /** + * Scale factor for resizing, x axis + * @param {Number} scaleX + * @default + */ + scaleX: 1, + + /** + * Scale factor for resizing, y axis + * @param {Number} scaleY + * @default + */ + scaleY: 1, + + /** + * LanczosLobes parameter for lanczos filter, valid for resizeType lanczos + * @param {Number} lanczosLobes + * @default + */ + lanczosLobes: 3, + + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uDelta: gl.getUniformLocation(program, 'uDelta'), + uTaps: gl.getUniformLocation(program, 'uTaps'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform2fv(uniformLocations.uDelta, this.horizontal ? [1 / this.width, 0] : [0, 1 / this.height]); + gl.uniform1fv(uniformLocations.uTaps, this.taps); + }, + + /** + * Retrieves the cached shader. + * @param {Object} options + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + retrieveShader: function(options) { + var filterWindow = this.getFilterWindow(), cacheKey = this.type + '_' + filterWindow; + if (!options.programCache.hasOwnProperty(cacheKey)) { + var fragmentShader = this.generateShader(filterWindow); + options.programCache[cacheKey] = this.createProgram(options.context, fragmentShader); + } + return options.programCache[cacheKey]; + }, + + getFilterWindow: function() { + var scale = this.tempScale; + return Math.ceil(this.lanczosLobes / scale); + }, + + getTaps: function() { + var lobeFunction = this.lanczosCreate(this.lanczosLobes), scale = this.tempScale, + filterWindow = this.getFilterWindow(), taps = new Array(filterWindow); + for (var i = 1; i <= filterWindow; i++) { + taps[i - 1] = lobeFunction(i * scale); + } + return taps; + }, + + /** + * Generate vertex and shader sources from the necessary steps numbers + * @param {Number} filterWindow + */ + generateShader: function(filterWindow) { + var offsets = new Array(filterWindow), + fragmentShader = this.fragmentSourceTOP, filterWindow; + + for (var i = 1; i <= filterWindow; i++) { + offsets[i - 1] = i + '.0 * uDelta'; + } + + fragmentShader += 'uniform float uTaps[' + filterWindow + '];\n'; + fragmentShader += 'void main() {\n'; + fragmentShader += ' vec4 color = texture2D(uTexture, vTexCoord);\n'; + fragmentShader += ' float sum = 1.0;\n'; + + offsets.forEach(function(offset, i) { + fragmentShader += ' color += texture2D(uTexture, vTexCoord + ' + offset + ') * uTaps[' + i + '];\n'; + fragmentShader += ' color += texture2D(uTexture, vTexCoord - ' + offset + ') * uTaps[' + i + '];\n'; + fragmentShader += ' sum += 2.0 * uTaps[' + i + '];\n'; + }); + fragmentShader += ' gl_FragColor = color / sum;\n'; + fragmentShader += '}'; + return fragmentShader; + }, + + fragmentSourceTOP: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform vec2 uDelta;\n' + + 'varying vec2 vTexCoord;\n', + + /** + * Apply the resize filter to the image + * Determines whether to use WebGL or Canvas2D based on the options.webgl flag. + * + * @param {Object} options + * @param {Number} options.passes The number of filters remaining to be executed + * @param {Boolean} options.webgl Whether to use webgl to render the filter. + * @param {WebGLTexture} options.sourceTexture The texture setup as the source to be filtered. + * @param {WebGLTexture} options.targetTexture The texture where filtered output should be drawn. + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + applyTo: function(options) { + if (options.webgl) { + options.passes++; + this.width = options.sourceWidth; + this.horizontal = true; + this.dW = Math.round(this.width * this.scaleX); + this.dH = options.sourceHeight; + this.tempScale = this.dW / this.width; + this.taps = this.getTaps(); + options.destinationWidth = this.dW; + this._setupFrameBuffer(options); + this.applyToWebGL(options); + this._swapTextures(options); + options.sourceWidth = options.destinationWidth; + + this.height = options.sourceHeight; + this.horizontal = false; + this.dH = Math.round(this.height * this.scaleY); + this.tempScale = this.dH / this.height; + this.taps = this.getTaps(); + options.destinationHeight = this.dH; + this._setupFrameBuffer(options); + this.applyToWebGL(options); + this._swapTextures(options); + options.sourceHeight = options.destinationHeight; + } + else { + this.applyTo2d(options); + } + }, + + isNeutralState: function() { + return this.scaleX === 1 && this.scaleY === 1; + }, + + lanczosCreate: function(lobes) { + return function(x) { + if (x >= lobes || x <= -lobes) { + return 0.0; + } + if (x < 1.19209290E-07 && x > -1.19209290E-07) { + return 1.0; + } + x *= Math.PI; + var xx = x / lobes; + return (sin(x) / x) * sin(xx) / xx; + }; + }, + + /** + * Applies filter to canvas element + * @memberOf fabric.Image.filters.Resize.prototype + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} scaleX + * @param {Number} scaleY + */ + applyTo2d: function(options) { + var imageData = options.imageData, + scaleX = this.scaleX, + scaleY = this.scaleY; + + this.rcpScaleX = 1 / scaleX; + this.rcpScaleY = 1 / scaleY; + + var oW = imageData.width, oH = imageData.height, + dW = round(oW * scaleX), dH = round(oH * scaleY), + newData; + + if (this.resizeType === 'sliceHack') { + newData = this.sliceByTwo(options, oW, oH, dW, dH); + } + else if (this.resizeType === 'hermite') { + newData = this.hermiteFastResize(options, oW, oH, dW, dH); + } + else if (this.resizeType === 'bilinear') { + newData = this.bilinearFiltering(options, oW, oH, dW, dH); + } + else if (this.resizeType === 'lanczos') { + newData = this.lanczosResize(options, oW, oH, dW, dH); + } + options.imageData = newData; + }, + + /** + * Filter sliceByTwo + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} oW Original Width + * @param {Number} oH Original Height + * @param {Number} dW Destination Width + * @param {Number} dH Destination Height + * @returns {ImageData} + */ + sliceByTwo: function(options, oW, oH, dW, dH) { + var imageData = options.imageData, + mult = 0.5, doneW = false, doneH = false, stepW = oW * mult, + stepH = oH * mult, resources = fabric.filterBackend.resources, + tmpCanvas, ctx, sX = 0, sY = 0, dX = oW, dY = 0; + if (!resources.sliceByTwo) { + resources.sliceByTwo = document.createElement('canvas'); + } + tmpCanvas = resources.sliceByTwo; + if (tmpCanvas.width < oW * 1.5 || tmpCanvas.height < oH) { + tmpCanvas.width = oW * 1.5; + tmpCanvas.height = oH; + } + ctx = tmpCanvas.getContext('2d'); + ctx.clearRect(0, 0, oW * 1.5, oH); + ctx.putImageData(imageData, 0, 0); + + dW = floor(dW); + dH = floor(dH); + + while (!doneW || !doneH) { + oW = stepW; + oH = stepH; + if (dW < floor(stepW * mult)) { + stepW = floor(stepW * mult); + } + else { + stepW = dW; + doneW = true; + } + if (dH < floor(stepH * mult)) { + stepH = floor(stepH * mult); + } + else { + stepH = dH; + doneH = true; + } + ctx.drawImage(tmpCanvas, sX, sY, oW, oH, dX, dY, stepW, stepH); + sX = dX; + sY = dY; + dY += stepH; + } + return ctx.getImageData(sX, sY, dW, dH); + }, + + /** + * Filter lanczosResize + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} oW Original Width + * @param {Number} oH Original Height + * @param {Number} dW Destination Width + * @param {Number} dH Destination Height + * @returns {ImageData} + */ + lanczosResize: function(options, oW, oH, dW, dH) { + + function process(u) { + var v, i, weight, idx, a, red, green, + blue, alpha, fX, fY; + center.x = (u + 0.5) * ratioX; + icenter.x = floor(center.x); + for (v = 0; v < dH; v++) { + center.y = (v + 0.5) * ratioY; + icenter.y = floor(center.y); + a = 0; red = 0; green = 0; blue = 0; alpha = 0; + for (i = icenter.x - range2X; i <= icenter.x + range2X; i++) { + if (i < 0 || i >= oW) { + continue; + } + fX = floor(1000 * abs(i - center.x)); + if (!cacheLanc[fX]) { + cacheLanc[fX] = { }; + } + for (var j = icenter.y - range2Y; j <= icenter.y + range2Y; j++) { + if (j < 0 || j >= oH) { + continue; + } + fY = floor(1000 * abs(j - center.y)); + if (!cacheLanc[fX][fY]) { + cacheLanc[fX][fY] = lanczos(sqrt(pow(fX * rcpRatioX, 2) + pow(fY * rcpRatioY, 2)) / 1000); + } + weight = cacheLanc[fX][fY]; + if (weight > 0) { + idx = (j * oW + i) * 4; + a += weight; + red += weight * srcData[idx]; + green += weight * srcData[idx + 1]; + blue += weight * srcData[idx + 2]; + alpha += weight * srcData[idx + 3]; + } + } + } + idx = (v * dW + u) * 4; + destData[idx] = red / a; + destData[idx + 1] = green / a; + destData[idx + 2] = blue / a; + destData[idx + 3] = alpha / a; + } + + if (++u < dW) { + return process(u); + } + else { + return destImg; + } + } + + var srcData = options.imageData.data, + destImg = options.ctx.createImageData(dW, dH), + destData = destImg.data, + lanczos = this.lanczosCreate(this.lanczosLobes), + ratioX = this.rcpScaleX, ratioY = this.rcpScaleY, + rcpRatioX = 2 / this.rcpScaleX, rcpRatioY = 2 / this.rcpScaleY, + range2X = ceil(ratioX * this.lanczosLobes / 2), + range2Y = ceil(ratioY * this.lanczosLobes / 2), + cacheLanc = { }, center = { }, icenter = { }; + + return process(0); + }, + + /** + * bilinearFiltering + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} oW Original Width + * @param {Number} oH Original Height + * @param {Number} dW Destination Width + * @param {Number} dH Destination Height + * @returns {ImageData} + */ + bilinearFiltering: function(options, oW, oH, dW, dH) { + var a, b, c, d, x, y, i, j, xDiff, yDiff, chnl, + color, offset = 0, origPix, ratioX = this.rcpScaleX, + ratioY = this.rcpScaleY, + w4 = 4 * (oW - 1), img = options.imageData, + pixels = img.data, destImage = options.ctx.createImageData(dW, dH), + destPixels = destImage.data; + for (i = 0; i < dH; i++) { + for (j = 0; j < dW; j++) { + x = floor(ratioX * j); + y = floor(ratioY * i); + xDiff = ratioX * j - x; + yDiff = ratioY * i - y; + origPix = 4 * (y * oW + x); + + for (chnl = 0; chnl < 4; chnl++) { + a = pixels[origPix + chnl]; + b = pixels[origPix + 4 + chnl]; + c = pixels[origPix + w4 + chnl]; + d = pixels[origPix + w4 + 4 + chnl]; + color = a * (1 - xDiff) * (1 - yDiff) + b * xDiff * (1 - yDiff) + + c * yDiff * (1 - xDiff) + d * xDiff * yDiff; + destPixels[offset++] = color; + } + } + } + return destImage; + }, + + /** + * hermiteFastResize + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} oW Original Width + * @param {Number} oH Original Height + * @param {Number} dW Destination Width + * @param {Number} dH Destination Height + * @returns {ImageData} + */ + hermiteFastResize: function(options, oW, oH, dW, dH) { + var ratioW = this.rcpScaleX, ratioH = this.rcpScaleY, + ratioWHalf = ceil(ratioW / 2), + ratioHHalf = ceil(ratioH / 2), + img = options.imageData, data = img.data, + img2 = options.ctx.createImageData(dW, dH), data2 = img2.data; + for (var j = 0; j < dH; j++) { + for (var i = 0; i < dW; i++) { + var x2 = (i + j * dW) * 4, weight = 0, weights = 0, weightsAlpha = 0, + gxR = 0, gxG = 0, gxB = 0, gxA = 0, centerY = (j + 0.5) * ratioH; + for (var yy = floor(j * ratioH); yy < (j + 1) * ratioH; yy++) { + var dy = abs(centerY - (yy + 0.5)) / ratioHHalf, + centerX = (i + 0.5) * ratioW, w0 = dy * dy; + for (var xx = floor(i * ratioW); xx < (i + 1) * ratioW; xx++) { + var dx = abs(centerX - (xx + 0.5)) / ratioWHalf, + w = sqrt(w0 + dx * dx); + /* eslint-disable max-depth */ + if (w > 1 && w < -1) { + continue; + } + //hermite filter + weight = 2 * w * w * w - 3 * w * w + 1; + if (weight > 0) { + dx = 4 * (xx + yy * oW); + //alpha + gxA += weight * data[dx + 3]; + weightsAlpha += weight; + //colors + if (data[dx + 3] < 255) { + weight = weight * data[dx + 3] / 250; + } + gxR += weight * data[dx]; + gxG += weight * data[dx + 1]; + gxB += weight * data[dx + 2]; + weights += weight; + } + /* eslint-enable max-depth */ + } + } + data2[x2] = gxR / weights; + data2[x2 + 1] = gxG / weights; + data2[x2 + 2] = gxB / weights; + data2[x2 + 3] = gxA / weightsAlpha; + } + } + return img2; + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return { + type: this.type, + scaleX: this.scaleX, + scaleY: this.scaleY, + resizeType: this.resizeType, + lanczosLobes: this.lanczosLobes + }; + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Resize} Instance of fabric.Image.filters.Resize + */ + fabric.Image.filters.Resize.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Contrast filter class + * @class fabric.Image.filters.Contrast + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Contrast#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Contrast({ + * contrast: 0.25 + * }); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.Contrast = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Contrast.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Contrast', + + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uContrast;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'float contrastF = 1.015 * (uContrast + 1.0) / (1.0 * (1.015 - uContrast));\n' + + 'color.rgb = contrastF * (color.rgb - 0.5) + 0.5;\n' + + 'gl_FragColor = color;\n' + + '}', + + /** + * contrast value, range from -1 to 1. + * @param {Number} contrast + * @default 0 + */ + contrast: 0, + + mainParameter: 'contrast', + + /** + * Constructor + * @memberOf fabric.Image.filters.Contrast.prototype + * @param {Object} [options] Options object + * @param {Number} [options.contrast=0] Value to contrast the image up (-1...1) + */ + + /** + * Apply the Contrast operation to a Uint8Array representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8Array to be filtered. + */ + applyTo2d: function(options) { + if (this.contrast === 0) { + return; + } + var imageData = options.imageData, i, len, + data = imageData.data, len = data.length, + contrast = Math.floor(this.contrast * 255), + contrastF = 259 * (contrast + 255) / (255 * (259 - contrast)); + + for (i = 0; i < len; i += 4) { + data[i] = contrastF * (data[i] - 128) + 128; + data[i + 1] = contrastF * (data[i + 1] - 128) + 128; + data[i + 2] = contrastF * (data[i + 2] - 128) + 128; + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uContrast: gl.getUniformLocation(program, 'uContrast'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform1f(uniformLocations.uContrast, this.contrast); + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Contrast} Instance of fabric.Image.filters.Contrast + */ + fabric.Image.filters.Contrast.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Saturate filter class + * @class fabric.Image.filters.Saturation + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Saturation#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Saturation({ + * saturation: 100 + * }); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.Saturation = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Saturation.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Saturation', + + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uSaturation;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'float rgMax = max(color.r, color.g);\n' + + 'float rgbMax = max(rgMax, color.b);\n' + + 'color.r += rgbMax != color.r ? (rgbMax - color.r) * uSaturation : 0.00;\n' + + 'color.g += rgbMax != color.g ? (rgbMax - color.g) * uSaturation : 0.00;\n' + + 'color.b += rgbMax != color.b ? (rgbMax - color.b) * uSaturation : 0.00;\n' + + 'gl_FragColor = color;\n' + + '}', + + saturation: 0, + + mainParameter: 'saturation', + + /** + * Constructor + * @memberOf fabric.Image.filters.Saturate.prototype + * @param {Object} [options] Options object + * @param {Number} [options.saturate=0] Value to saturate the image (-1...1) + */ + + /** + * Apply the Saturation operation to a Uint8ClampedArray representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8ClampedArray to be filtered. + */ + applyTo2d: function(options) { + if (this.saturation === 0) { + return; + } + var imageData = options.imageData, + data = imageData.data, len = data.length, + adjust = -this.saturation, i, max; + + for (i = 0; i < len; i += 4) { + max = Math.max(data[i], data[i + 1], data[i + 2]); + data[i] += max !== data[i] ? (max - data[i]) * adjust : 0; + data[i + 1] += max !== data[i + 1] ? (max - data[i + 1]) * adjust : 0; + data[i + 2] += max !== data[i + 2] ? (max - data[i + 2]) * adjust : 0; + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uSaturation: gl.getUniformLocation(program, 'uSaturation'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform1f(uniformLocations.uSaturation, -this.saturation); + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Saturation} Instance of fabric.Image.filters.Saturate + */ + fabric.Image.filters.Saturation.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Blur filter class + * @class fabric.Image.filters.Blur + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Blur#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Blur({ + * blur: 0.5 + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + */ + filters.Blur = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Blur.prototype */ { + + type: 'Blur', + + /* +'gl_FragColor = vec4(0.0);', +'gl_FragColor += texture2D(texture, vTexCoord + -7 * uDelta)*0.0044299121055113265;', +'gl_FragColor += texture2D(texture, vTexCoord + -6 * uDelta)*0.00895781211794;', +'gl_FragColor += texture2D(texture, vTexCoord + -5 * uDelta)*0.0215963866053;', +'gl_FragColor += texture2D(texture, vTexCoord + -4 * uDelta)*0.0443683338718;', +'gl_FragColor += texture2D(texture, vTexCoord + -3 * uDelta)*0.0776744219933;', +'gl_FragColor += texture2D(texture, vTexCoord + -2 * uDelta)*0.115876621105;', +'gl_FragColor += texture2D(texture, vTexCoord + -1 * uDelta)*0.147308056121;', +'gl_FragColor += texture2D(texture, vTexCoord )*0.159576912161;', +'gl_FragColor += texture2D(texture, vTexCoord + 1 * uDelta)*0.147308056121;', +'gl_FragColor += texture2D(texture, vTexCoord + 2 * uDelta)*0.115876621105;', +'gl_FragColor += texture2D(texture, vTexCoord + 3 * uDelta)*0.0776744219933;', +'gl_FragColor += texture2D(texture, vTexCoord + 4 * uDelta)*0.0443683338718;', +'gl_FragColor += texture2D(texture, vTexCoord + 5 * uDelta)*0.0215963866053;', +'gl_FragColor += texture2D(texture, vTexCoord + 6 * uDelta)*0.00895781211794;', +'gl_FragColor += texture2D(texture, vTexCoord + 7 * uDelta)*0.0044299121055113265;', +*/ + + /* eslint-disable max-len */ + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform vec2 uDelta;\n' + + 'varying vec2 vTexCoord;\n' + + 'const float nSamples = 15.0;\n' + + 'vec3 v3offset = vec3(12.9898, 78.233, 151.7182);\n' + + 'float random(vec3 scale) {\n' + + /* use the fragment position for a different seed per-pixel */ + 'return fract(sin(dot(gl_FragCoord.xyz, scale)) * 43758.5453);\n' + + '}\n' + + 'void main() {\n' + + 'vec4 color = vec4(0.0);\n' + + 'float total = 0.0;\n' + + 'float offset = random(v3offset);\n' + + 'for (float t = -nSamples; t <= nSamples; t++) {\n' + + 'float percent = (t + offset - 0.5) / nSamples;\n' + + 'float weight = 1.0 - abs(percent);\n' + + 'color += texture2D(uTexture, vTexCoord + uDelta * percent) * weight;\n' + + 'total += weight;\n' + + '}\n' + + 'gl_FragColor = color / total;\n' + + '}', + /* eslint-enable max-len */ + + /** + * blur value, in percentage of image dimensions. + * specific to keep the image blur constant at different resolutions + * range bewteen 0 and 1. + */ + blur: 0, + + mainParameter: 'blur', + + applyTo: function(options) { + if (options.webgl) { + // this aspectRatio is used to give the same blur to vertical and horizontal + this.aspectRatio = options.sourceWidth / options.sourceHeight; + options.passes++; + this._setupFrameBuffer(options); + this.horizontal = true; + this.applyToWebGL(options); + this._swapTextures(options); + this._setupFrameBuffer(options); + this.horizontal = false; + this.applyToWebGL(options); + this._swapTextures(options); + } + else { + this.applyTo2d(options); + } + }, + + applyTo2d: function(options) { + // paint canvasEl with current image data. + //options.ctx.putImageData(options.imageData, 0, 0); + options.imageData = this.simpleBlur(options); + }, + + simpleBlur: function(options) { + var resources = options.filterBackend.resources, canvas1, canvas2, + width = options.imageData.width, + height = options.imageData.height; + + if (!resources.blurLayer1) { + resources.blurLayer1 = fabric.util.createCanvasElement(); + resources.blurLayer2 = fabric.util.createCanvasElement(); + } + canvas1 = resources.blurLayer1; + canvas2 = resources.blurLayer2; + if (canvas1.width !== width || canvas1.height !== height) { + canvas2.width = canvas1.width = width; + canvas2.height = canvas1.height = height; + } + var ctx1 = canvas1.getContext('2d'), + ctx2 = canvas2.getContext('2d'), + nSamples = 15, + random, percent, j, i, + blur = this.blur * 0.06 * 0.5; + + // load first canvas + ctx1.putImageData(options.imageData, 0, 0); + ctx2.clearRect(0, 0, width, height); + + for (i = -nSamples; i <= nSamples; i++) { + random = (Math.random() - 0.5) / 4; + percent = i / nSamples; + j = blur * percent * width + random; + ctx2.globalAlpha = 1 - Math.abs(percent); + ctx2.drawImage(canvas1, j, random); + ctx1.drawImage(canvas2, 0, 0); + ctx2.globalAlpha = 1; + ctx2.clearRect(0, 0, canvas2.width, canvas2.height); + } + for (i = -nSamples; i <= nSamples; i++) { + random = (Math.random() - 0.5) / 4; + percent = i / nSamples; + j = blur * percent * height + random; + ctx2.globalAlpha = 1 - Math.abs(percent); + ctx2.drawImage(canvas1, random, j); + ctx1.drawImage(canvas2, 0, 0); + ctx2.globalAlpha = 1; + ctx2.clearRect(0, 0, canvas2.width, canvas2.height); + } + options.ctx.drawImage(canvas1, 0, 0); + var newImageData = options.ctx.getImageData(0, 0, canvas1.width, canvas1.height); + ctx1.globalAlpha = 1; + ctx1.clearRect(0, 0, canvas1.width, canvas1.height); + return newImageData; + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + delta: gl.getUniformLocation(program, 'uDelta'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + var delta = this.chooseRightDelta(); + gl.uniform2fv(uniformLocations.delta, delta); + }, + + /** + * choose right value of image percentage to blur with + * @returns {Array} a numeric array with delta values + */ + chooseRightDelta: function() { + var blurScale = 1, delta = [0, 0], blur; + if (this.horizontal) { + if (this.aspectRatio > 1) { + // image is wide, i want to shrink radius horizontal + blurScale = 1 / this.aspectRatio; + } + } + else { + if (this.aspectRatio < 1) { + // image is tall, i want to shrink radius vertical + blurScale = this.aspectRatio; + } + } + blur = blurScale * this.blur * 0.12; + if (this.horizontal) { + delta[0] = blur; + } + else { + delta[1] = blur; + } + return delta; + }, + }); + + /** + * Deserialize a JSON definition of a BlurFilter into a concrete instance. + */ + filters.Blur.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Gamma filter class + * @class fabric.Image.filters.Gamma + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Gamma#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Gamma({ + * gamma: [1, 0.5, 2.1] + * }); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.Gamma = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Gamma.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Gamma', + + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform vec3 uGamma;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'vec3 correction = (1.0 / uGamma);\n' + + 'color.r = pow(color.r, correction.r);\n' + + 'color.g = pow(color.g, correction.g);\n' + + 'color.b = pow(color.b, correction.b);\n' + + 'gl_FragColor = color;\n' + + 'gl_FragColor.rgb *= color.a;\n' + + '}', + + /** + * Gamma array value, from 0.01 to 2.2. + * @param {Array} gamma + * @default + */ + gamma: [1, 1, 1], + + /** + * Describe the property that is the filter parameter + * @param {String} m + * @default + */ + mainParameter: 'gamma', + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + this.gamma = [1, 1, 1]; + filters.BaseFilter.prototype.initialize.call(this, options); + }, + + /** + * Apply the Gamma operation to a Uint8Array representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8Array to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, data = imageData.data, + gamma = this.gamma, len = data.length, + rInv = 1 / gamma[0], gInv = 1 / gamma[1], + bInv = 1 / gamma[2], i; + + if (!this.rVals) { + // eslint-disable-next-line + this.rVals = new Uint8Array(256); + // eslint-disable-next-line + this.gVals = new Uint8Array(256); + // eslint-disable-next-line + this.bVals = new Uint8Array(256); + } + + // This is an optimization - pre-compute a look-up table for each color channel + // instead of performing these pow calls for each pixel in the image. + for (i = 0, len = 256; i < len; i++) { + this.rVals[i] = Math.pow(i / 255, rInv) * 255; + this.gVals[i] = Math.pow(i / 255, gInv) * 255; + this.bVals[i] = Math.pow(i / 255, bInv) * 255; + } + for (i = 0, len = data.length; i < len; i += 4) { + data[i] = this.rVals[data[i]]; + data[i + 1] = this.gVals[data[i + 1]]; + data[i + 2] = this.bVals[data[i + 2]]; + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uGamma: gl.getUniformLocation(program, 'uGamma'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform3fv(uniformLocations.uGamma, this.gamma); + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Gamma} Instance of fabric.Image.filters.Gamma + */ + fabric.Image.filters.Gamma.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * A container class that knows how to apply a sequence of filters to an input image. + */ + filters.Composed = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Composed.prototype */ { + + type: 'Composed', + + /** + * A non sparse array of filters to apply + */ + subFilters: [], + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + this.callSuper('initialize', options); + // create a new array instead mutating the prototype with push + this.subFilters = this.subFilters.slice(0); + }, + + /** + * Apply this container's filters to the input image provided. + * + * @param {Object} options + * @param {Number} options.passes The number of filters remaining to be applied. + */ + applyTo: function(options) { + options.passes += this.subFilters.length - 1; + this.subFilters.forEach(function(filter) { + filter.applyTo(options); + }); + }, + + /** + * Serialize this filter into JSON. + * + * @returns {Object} A JSON representation of this filter. + */ + toObject: function() { + return fabric.util.object.extend(this.callSuper('toObject'), { + subFilters: this.subFilters.map(function(filter) { return filter.toObject(); }), + }); + }, + + isNeutralState: function() { + return !this.subFilters.some(function(filter) { return !filter.isNeutralState(); }); + } + }); + + /** + * Deserialize a JSON definition of a ComposedFilter into a concrete instance. + */ + fabric.Image.filters.Composed.fromObject = function(object, callback) { + var filters = object.subFilters || [], + subFilters = filters.map(function(filter) { + return new fabric.Image.filters[filter.type](filter); + }), + instance = new fabric.Image.filters.Composed({ subFilters: subFilters }); + callback && callback(instance); + return instance; + }; +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * HueRotation filter class + * @class fabric.Image.filters.HueRotation + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.HueRotation#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.HueRotation({ + * rotation: -0.5 + * }); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.HueRotation = createClass(filters.ColorMatrix, /** @lends fabric.Image.filters.HueRotation.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'HueRotation', + + /** + * HueRotation value, from -1 to 1. + * the unit is radians + * @param {Number} myParameter + * @default + */ + rotation: 0, + + /** + * Describe the property that is the filter parameter + * @param {String} m + * @default + */ + mainParameter: 'rotation', + + calculateMatrix: function() { + var rad = this.rotation * Math.PI, cos = fabric.util.cos(rad), sin = fabric.util.sin(rad), + aThird = 1 / 3, aThirdSqtSin = Math.sqrt(aThird) * sin, OneMinusCos = 1 - cos; + this.matrix = [ + 1, 0, 0, 0, 0, + 0, 1, 0, 0, 0, + 0, 0, 1, 0, 0, + 0, 0, 0, 1, 0 + ]; + this.matrix[0] = cos + OneMinusCos / 3; + this.matrix[1] = aThird * OneMinusCos - aThirdSqtSin; + this.matrix[2] = aThird * OneMinusCos + aThirdSqtSin; + this.matrix[5] = aThird * OneMinusCos + aThirdSqtSin; + this.matrix[6] = cos + aThird * OneMinusCos; + this.matrix[7] = aThird * OneMinusCos - aThirdSqtSin; + this.matrix[10] = aThird * OneMinusCos - aThirdSqtSin; + this.matrix[11] = aThird * OneMinusCos + aThirdSqtSin; + this.matrix[12] = cos + aThird * OneMinusCos; + }, + + /** + * HueRotation isNeutralState implementation + * Used only in image applyFilters to discard filters that will not have an effect + * on the image + * @param {Object} options + **/ + isNeutralState: function(options) { + this.calculateMatrix(); + return filters.BaseFilter.prototype.isNeutralState.call(this, options); + }, + + /** + * Apply this filter to the input image data provided. + * + * Determines whether to use WebGL or Canvas2D based on the options.webgl flag. + * + * @param {Object} options + * @param {Number} options.passes The number of filters remaining to be executed + * @param {Boolean} options.webgl Whether to use webgl to render the filter. + * @param {WebGLTexture} options.sourceTexture The texture setup as the source to be filtered. + * @param {WebGLTexture} options.targetTexture The texture where filtered output should be drawn. + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + applyTo: function(options) { + this.calculateMatrix(); + filters.BaseFilter.prototype.applyTo.call(this, options); + }, + + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.HueRotation} Instance of fabric.Image.filters.HueRotation + */ + fabric.Image.filters.HueRotation.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + clone = fabric.util.object.clone; + + if (fabric.Text) { + fabric.warn('fabric.Text is already defined'); + return; + } + + /** + * Text class + * @class fabric.Text + * @extends fabric.Object + * @return {fabric.Text} thisArg + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2#text} + * @see {@link fabric.Text#initialize} for constructor definition + */ + fabric.Text = fabric.util.createClass(fabric.Object, /** @lends fabric.Text.prototype */ { + + /** + * Properties which when set cause object to change dimensions + * @type Array + * @private + */ + _dimensionAffectingProps: [ + 'fontSize', + 'fontWeight', + 'fontFamily', + 'fontStyle', + 'lineHeight', + 'text', + 'charSpacing', + 'textAlign', + 'styles', + ], + + /** + * @private + */ + _reNewline: /\r?\n/, + + /** + * Use this regular expression to filter for whitespaces that is not a new line. + * Mostly used when text is 'justify' aligned. + * @private + */ + _reSpacesAndTabs: /[ \t\r]/g, + + /** + * Use this regular expression to filter for whitespace that is not a new line. + * Mostly used when text is 'justify' aligned. + * @private + */ + _reSpaceAndTab: /[ \t\r]/, + + /** + * Use this regular expression to filter consecutive groups of non spaces. + * Mostly used when text is 'justify' aligned. + * @private + */ + _reWords: /\S+/g, + + /** + * Type of an object + * @type String + * @default + */ + type: 'text', + + /** + * Font size (in pixels) + * @type Number + * @default + */ + fontSize: 40, + + /** + * Font weight (e.g. bold, normal, 400, 600, 800) + * @type {(Number|String)} + * @default + */ + fontWeight: 'normal', + + /** + * Font family + * @type String + * @default + */ + fontFamily: 'Times New Roman', + + /** + * Text decoration underline. + * @type Boolean + * @default + */ + underline: false, + + /** + * Text decoration overline. + * @type Boolean + * @default + */ + overline: false, + + /** + * Text decoration linethrough. + * @type Boolean + * @default + */ + linethrough: false, + + /** + * Text alignment. Possible values: "left", "center", "right", "justify", + * "justify-left", "justify-center" or "justify-right". + * @type String + * @default + */ + textAlign: 'left', + + /** + * Font style . Possible values: "", "normal", "italic" or "oblique". + * @type String + * @default + */ + fontStyle: 'normal', + + /** + * Line height + * @type Number + * @default + */ + lineHeight: 1.16, + + /** + * Superscript schema object (minimum overlap) + * @type {Object} + * @default + */ + superscript: { + size: 0.60, // fontSize factor + baseline: -0.35 // baseline-shift factor (upwards) + }, + + /** + * Subscript schema object (minimum overlap) + * @type {Object} + * @default + */ + subscript: { + size: 0.60, // fontSize factor + baseline: 0.11 // baseline-shift factor (downwards) + }, + + /** + * Background color of text lines + * @type String + * @default + */ + textBackgroundColor: '', + + /** + * List of properties to consider when checking if + * state of an object is changed ({@link fabric.Object#hasStateChanged}) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: fabric.Object.prototype.stateProperties.concat('fontFamily', + 'fontWeight', + 'fontSize', + 'text', + 'underline', + 'overline', + 'linethrough', + 'textAlign', + 'fontStyle', + 'lineHeight', + 'textBackgroundColor', + 'charSpacing', + 'styles'), + + /** + * List of properties to consider when checking if cache needs refresh + * @type Array + */ + cacheProperties: fabric.Object.prototype.cacheProperties.concat('fontFamily', + 'fontWeight', + 'fontSize', + 'text', + 'underline', + 'overline', + 'linethrough', + 'textAlign', + 'fontStyle', + 'lineHeight', + 'textBackgroundColor', + 'charSpacing', + 'styles'), + + /** + * When defined, an object is rendered via stroke and this property specifies its color. + * Backwards incompatibility note: This property was named "strokeStyle" until v1.1.6 + * @type String + * @default + */ + stroke: null, + + /** + * Shadow object representing shadow of this shape. + * Backwards incompatibility note: This property was named "textShadow" (String) until v1.2.11 + * @type fabric.Shadow + * @default + */ + shadow: null, + + /** + * @private + */ + _fontSizeFraction: 0.222, + + /** + * @private + */ + offsets: { + underline: 0.10, + linethrough: -0.315, + overline: -0.88 + }, + + /** + * Text Line proportion to font Size (in pixels) + * @type Number + * @default + */ + _fontSizeMult: 1.13, + + /** + * additional space between characters + * expressed in thousands of em unit + * @type Number + * @default + */ + charSpacing: 0, + + /** + * Object containing character styles - top-level properties -> line numbers, + * 2nd-level properties - charater numbers + * @type Object + * @default + */ + styles: null, + + /** + * Reference to a context to measure text char or couple of chars + * the cacheContext of the canvas will be used or a freshly created one if the object is not on canvas + * once created it will be referenced on fabric._measuringContext to avoide creating a canvas for every + * text object created. + * @type {CanvasRenderingContext2D} + * @default + */ + _measuringContext: null, + + /** + * Baseline shift, stlyes only, keep at 0 for the main text object + * @type {Number} + * @default + */ + deltaY: 0, + + /** + * Array of properties that define a style unit (of 'styles'). + * @type {Array} + * @default + */ + _styleProperties: [ + 'stroke', + 'strokeWidth', + 'fill', + 'fontFamily', + 'fontSize', + 'fontWeight', + 'fontStyle', + 'underline', + 'overline', + 'linethrough', + 'deltaY', + 'textBackgroundColor', + ], + + /** + * contains characters bounding boxes + */ + __charBounds: [], + + /** + * use this size when measuring text. To avoid IE11 rounding errors + * @type {Number} + * @default + * @readonly + * @private + */ + CACHE_FONT_SIZE: 400, + + /** + * contains the min text width to avoid getting 0 + * @type {Number} + * @default + */ + MIN_TEXT_WIDTH: 2, + + /** + * Constructor + * @param {String} text Text string + * @param {Object} [options] Options object + * @return {fabric.Text} thisArg + */ + initialize: function(text, options) { + this.styles = options ? (options.styles || { }) : { }; + this.text = text; + this.__skipDimension = true; + this.callSuper('initialize', options); + this.__skipDimension = false; + this.initDimensions(); + this.setCoords(); + this.setupState({ propertySet: '_dimensionAffectingProps' }); + }, + + /** + * Return a contex for measurement of text string. + * if created it gets stored for reuse + * @param {String} text Text string + * @param {Object} [options] Options object + * @return {fabric.Text} thisArg + */ + getMeasuringContext: function() { + // if we did not return we have to measure something. + if (!fabric._measuringContext) { + fabric._measuringContext = this.canvas && this.canvas.contextCache || + fabric.util.createCanvasElement().getContext('2d'); + } + return fabric._measuringContext; + }, + + /** + * @private + * Divides text into lines of text and lines of graphemes. + */ + _splitText: function() { + var newLines = this._splitTextIntoLines(this.text); + this.textLines = newLines.lines; + this._textLines = newLines.graphemeLines; + this._unwrappedTextLines = newLines._unwrappedLines; + this._text = newLines.graphemeText; + return newLines; + }, + + /** + * Initialize or update text dimensions. + * Updates this.width and this.height with the proper values. + * Does not return dimensions. + */ + initDimensions: function() { + if (this.__skipDimension) { + return; + } + this._splitText(); + this._clearCache(); + this.width = this.calcTextWidth() || this.cursorWidth || this.MIN_TEXT_WIDTH; + if (this.textAlign.indexOf('justify') !== -1) { + // once text is measured we need to make space fatter to make justified text. + this.enlargeSpaces(); + } + this.height = this.calcTextHeight(); + this.saveState({ propertySet: '_dimensionAffectingProps' }); + }, + + /** + * Enlarge space boxes and shift the others + */ + enlargeSpaces: function() { + var diffSpace, currentLineWidth, numberOfSpaces, accumulatedSpace, line, charBound, spaces; + for (var i = 0, len = this._textLines.length; i < len; i++) { + if (this.textAlign !== 'justify' && (i === len - 1 || this.isEndOfWrapping(i))) { + continue; + } + accumulatedSpace = 0; + line = this._textLines[i]; + currentLineWidth = this.getLineWidth(i); + if (currentLineWidth < this.width && (spaces = this.textLines[i].match(this._reSpacesAndTabs))) { + numberOfSpaces = spaces.length; + diffSpace = (this.width - currentLineWidth) / numberOfSpaces; + for (var j = 0, jlen = line.length; j <= jlen; j++) { + charBound = this.__charBounds[i][j]; + if (this._reSpaceAndTab.test(line[j])) { + charBound.width += diffSpace; + charBound.kernedWidth += diffSpace; + charBound.left += accumulatedSpace; + accumulatedSpace += diffSpace; + } + else { + charBound.left += accumulatedSpace; + } + } + } + } + }, + + /** + * Detect if the text line is ended with an hard break + * text and itext do not have wrapping, return false + * @return {Boolean} + */ + isEndOfWrapping: function(lineIndex) { + return lineIndex === this._textLines.length - 1; + }, + + /** + * Detect if a line has a linebreak and so we need to account for it when moving + * and counting style. + * It return always for text and Itext. + * @return Number + */ + missingNewlineOffset: function() { + return 1; + }, + + /** + * Returns string representation of an instance + * @return {String} String representation of text object + */ + toString: function() { + return '#'; + }, + + /** + * Return the dimension and the zoom level needed to create a cache canvas + * big enough to host the object to be cached. + * @private + * @param {Object} dim.x width of object to be cached + * @param {Object} dim.y height of object to be cached + * @return {Object}.width width of canvas + * @return {Object}.height height of canvas + * @return {Object}.zoomX zoomX zoom value to unscale the canvas before drawing cache + * @return {Object}.zoomY zoomY zoom value to unscale the canvas before drawing cache + */ + _getCacheCanvasDimensions: function() { + var dims = this.callSuper('_getCacheCanvasDimensions'); + var fontSize = this.fontSize; + dims.width += fontSize * dims.zoomX; + dims.height += fontSize * dims.zoomY; + return dims; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + this._setTextStyles(ctx); + this._renderTextLinesBackground(ctx); + this._renderTextDecoration(ctx, 'underline'); + this._renderText(ctx); + this._renderTextDecoration(ctx, 'overline'); + this._renderTextDecoration(ctx, 'linethrough'); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderText: function(ctx) { + if (this.paintFirst === 'stroke') { + this._renderTextStroke(ctx); + this._renderTextFill(ctx); + } + else { + this._renderTextFill(ctx); + this._renderTextStroke(ctx); + } + }, + + /** + * Set the font parameter of the context with the object properties or with charStyle + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Object} [charStyle] object with font style properties + * @param {String} [charStyle.fontFamily] Font Family + * @param {Number} [charStyle.fontSize] Font size in pixels. ( without px suffix ) + * @param {String} [charStyle.fontWeight] Font weight + * @param {String} [charStyle.fontStyle] Font style (italic|normal) + */ + _setTextStyles: function(ctx, charStyle, forMeasuring) { + ctx.textBaseline = 'alphabetic'; + ctx.font = this._getFontDeclaration(charStyle, forMeasuring); + }, + + /** + * calculate and return the text Width measuring each line. + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @return {Number} Maximum width of fabric.Text object + */ + calcTextWidth: function() { + var maxWidth = this.getLineWidth(0); + + for (var i = 1, len = this._textLines.length; i < len; i++) { + var currentLineWidth = this.getLineWidth(i); + if (currentLineWidth > maxWidth) { + maxWidth = currentLineWidth; + } + } + return maxWidth; + }, + + /** + * @private + * @param {String} method Method name ("fillText" or "strokeText") + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} line Text to render + * @param {Number} left Left position of text + * @param {Number} top Top position of text + * @param {Number} lineIndex Index of a line in a text + */ + _renderTextLine: function(method, ctx, line, left, top, lineIndex) { + this._renderChars(method, ctx, line, left, top, lineIndex); + }, + + /** + * Renders the text background for lines, taking care of style + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextLinesBackground: function(ctx) { + if (!this.textBackgroundColor && !this.styleHas('textBackgroundColor')) { + return; + } + var lineTopOffset = 0, heightOfLine, + lineLeftOffset, originalFill = ctx.fillStyle, + line, lastColor, + leftOffset = this._getLeftOffset(), + topOffset = this._getTopOffset(), + boxStart = 0, boxWidth = 0, charBox, currentColor; + + for (var i = 0, len = this._textLines.length; i < len; i++) { + heightOfLine = this.getHeightOfLine(i); + if (!this.textBackgroundColor && !this.styleHas('textBackgroundColor', i)) { + lineTopOffset += heightOfLine; + continue; + } + line = this._textLines[i]; + lineLeftOffset = this._getLineLeftOffset(i); + boxWidth = 0; + boxStart = 0; + lastColor = this.getValueOfPropertyAt(i, 0, 'textBackgroundColor'); + for (var j = 0, jlen = line.length; j < jlen; j++) { + charBox = this.__charBounds[i][j]; + currentColor = this.getValueOfPropertyAt(i, j, 'textBackgroundColor'); + if (currentColor !== lastColor) { + ctx.fillStyle = lastColor; + lastColor && ctx.fillRect( + leftOffset + lineLeftOffset + boxStart, + topOffset + lineTopOffset, + boxWidth, + heightOfLine / this.lineHeight + ); + boxStart = charBox.left; + boxWidth = charBox.width; + lastColor = currentColor; + } + else { + boxWidth += charBox.kernedWidth; + } + } + if (currentColor) { + ctx.fillStyle = currentColor; + ctx.fillRect( + leftOffset + lineLeftOffset + boxStart, + topOffset + lineTopOffset, + boxWidth, + heightOfLine / this.lineHeight + ); + } + lineTopOffset += heightOfLine; + } + ctx.fillStyle = originalFill; + // if there is text background color no + // other shadows should be casted + this._removeShadow(ctx); + }, + + /** + * @private + * @param {Object} decl style declaration for cache + * @param {String} decl.fontFamily fontFamily + * @param {String} decl.fontStyle fontStyle + * @param {String} decl.fontWeight fontWeight + * @return {Object} reference to cache + */ + getFontCache: function(decl) { + var fontFamily = decl.fontFamily.toLowerCase(); + if (!fabric.charWidthsCache[fontFamily]) { + fabric.charWidthsCache[fontFamily] = { }; + } + var cache = fabric.charWidthsCache[fontFamily], + cacheProp = decl.fontStyle.toLowerCase() + '_' + (decl.fontWeight + '').toLowerCase(); + if (!cache[cacheProp]) { + cache[cacheProp] = { }; + } + return cache[cacheProp]; + }, + + /** + * apply all the character style to canvas for rendering + * @private + * @param {String} _char + * @param {Number} lineIndex + * @param {Number} charIndex + * @param {Object} [decl] + */ + _applyCharStyles: function(method, ctx, lineIndex, charIndex, styleDeclaration) { + + this._setFillStyles(ctx, styleDeclaration); + this._setStrokeStyles(ctx, styleDeclaration); + + ctx.font = this._getFontDeclaration(styleDeclaration); + }, + + /** + * measure and return the width of a single character. + * possibly overridden to accommodate different measure logic or + * to hook some external lib for character measurement + * @private + * @param {String} _char, char to be measured + * @param {Object} charStyle style of char to be measured + * @param {String} [previousChar] previous char + * @param {Object} [prevCharStyle] style of previous char + */ + _measureChar: function(_char, charStyle, previousChar, prevCharStyle) { + // first i try to return from cache + var fontCache = this.getFontCache(charStyle), fontDeclaration = this._getFontDeclaration(charStyle), + previousFontDeclaration = this._getFontDeclaration(prevCharStyle), couple = previousChar + _char, + stylesAreEqual = fontDeclaration === previousFontDeclaration, width, coupleWidth, previousWidth, + fontMultiplier = charStyle.fontSize / this.CACHE_FONT_SIZE, kernedWidth; + + if (previousChar && fontCache[previousChar] !== undefined) { + previousWidth = fontCache[previousChar]; + } + if (fontCache[_char] !== undefined) { + kernedWidth = width = fontCache[_char]; + } + if (stylesAreEqual && fontCache[couple] !== undefined) { + coupleWidth = fontCache[couple]; + kernedWidth = coupleWidth - previousWidth; + } + if (width === undefined || previousWidth === undefined || coupleWidth === undefined) { + var ctx = this.getMeasuringContext(); + // send a TRUE to specify measuring font size CACHE_FONT_SIZE + this._setTextStyles(ctx, charStyle, true); + } + if (width === undefined) { + kernedWidth = width = ctx.measureText(_char).width; + fontCache[_char] = width; + } + if (previousWidth === undefined && stylesAreEqual && previousChar) { + previousWidth = ctx.measureText(previousChar).width; + fontCache[previousChar] = previousWidth; + } + if (stylesAreEqual && coupleWidth === undefined) { + // we can measure the kerning couple and subtract the width of the previous character + coupleWidth = ctx.measureText(couple).width; + fontCache[couple] = coupleWidth; + kernedWidth = coupleWidth - previousWidth; + } + return { width: width * fontMultiplier, kernedWidth: kernedWidth * fontMultiplier }; + }, + + /** + * Computes height of character at given position + * @param {Number} line the line index number + * @param {Number} _char the character index number + * @return {Number} fontSize of the character + */ + getHeightOfChar: function(line, _char) { + return this.getValueOfPropertyAt(line, _char, 'fontSize'); + }, + + /** + * measure a text line measuring all characters. + * @param {Number} lineIndex line number + * @return {Number} Line width + */ + measureLine: function(lineIndex) { + var lineInfo = this._measureLine(lineIndex); + if (this.charSpacing !== 0) { + lineInfo.width -= this._getWidthOfCharSpacing(); + } + if (lineInfo.width < 0) { + lineInfo.width = 0; + } + return lineInfo; + }, + + /** + * measure every grapheme of a line, populating __charBounds + * @param {Number} lineIndex + * @return {Object} object.width total width of characters + * @return {Object} object.widthOfSpaces length of chars that match this._reSpacesAndTabs + */ + _measureLine: function(lineIndex) { + var width = 0, i, grapheme, line = this._textLines[lineIndex], prevGrapheme, + graphemeInfo, numOfSpaces = 0, lineBounds = new Array(line.length); + + this.__charBounds[lineIndex] = lineBounds; + for (i = 0; i < line.length; i++) { + grapheme = line[i]; + graphemeInfo = this._getGraphemeBox(grapheme, lineIndex, i, prevGrapheme); + lineBounds[i] = graphemeInfo; + width += graphemeInfo.kernedWidth; + prevGrapheme = grapheme; + } + // this latest bound box represent the last character of the line + // to simplify cursor handling in interactive mode. + lineBounds[i] = { + left: graphemeInfo ? graphemeInfo.left + graphemeInfo.width : 0, + width: 0, + kernedWidth: 0, + height: this.fontSize + }; + return { width: width, numOfSpaces: numOfSpaces }; + }, + + /** + * Measure and return the info of a single grapheme. + * needs the the info of previous graphemes already filled + * @private + * @param {String} grapheme to be measured + * @param {Number} lineIndex index of the line where the char is + * @param {Number} charIndex position in the line + * @param {String} [prevGrapheme] character preceding the one to be measured + */ + _getGraphemeBox: function(grapheme, lineIndex, charIndex, prevGrapheme, skipLeft) { + var style = this.getCompleteStyleDeclaration(lineIndex, charIndex), + prevStyle = prevGrapheme ? this.getCompleteStyleDeclaration(lineIndex, charIndex - 1) : { }, + info = this._measureChar(grapheme, style, prevGrapheme, prevStyle), + kernedWidth = info.kernedWidth, + width = info.width, charSpacing; + + if (this.charSpacing !== 0) { + charSpacing = this._getWidthOfCharSpacing(); + width += charSpacing; + kernedWidth += charSpacing; + } + + var box = { + width: width, + left: 0, + height: style.fontSize, + kernedWidth: kernedWidth, + deltaY: style.deltaY, + }; + if (charIndex > 0 && !skipLeft) { + var previousBox = this.__charBounds[lineIndex][charIndex - 1]; + box.left = previousBox.left + previousBox.width + info.kernedWidth - info.width; + } + return box; + }, + + /** + * Calculate height of line at 'lineIndex' + * @param {Number} lineIndex index of line to calculate + * @return {Number} + */ + getHeightOfLine: function(lineIndex) { + if (this.__lineHeights[lineIndex]) { + return this.__lineHeights[lineIndex]; + } + + var line = this._textLines[lineIndex], + // char 0 is measured before the line cycle because it nneds to char + // emptylines + maxHeight = this.getHeightOfChar(lineIndex, 0); + for (var i = 1, len = line.length; i < len; i++) { + maxHeight = Math.max(this.getHeightOfChar(lineIndex, i), maxHeight); + } + + return this.__lineHeights[lineIndex] = maxHeight * this.lineHeight * this._fontSizeMult; + }, + + /** + * Calculate text box height + */ + calcTextHeight: function() { + var lineHeight, height = 0; + for (var i = 0, len = this._textLines.length; i < len; i++) { + lineHeight = this.getHeightOfLine(i); + height += (i === len - 1 ? lineHeight / this.lineHeight : lineHeight); + } + return height; + }, + + /** + * @private + * @return {Number} Left offset + */ + _getLeftOffset: function() { + return -this.width / 2; + }, + + /** + * @private + * @return {Number} Top offset + */ + _getTopOffset: function() { + return -this.height / 2; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} method Method name ("fillText" or "strokeText") + */ + _renderTextCommon: function(ctx, method) { + ctx.save(); + var lineHeights = 0, left = this._getLeftOffset(), top = this._getTopOffset(), + offsets = this._applyPatternGradientTransform(ctx, method === 'fillText' ? this.fill : this.stroke); + for (var i = 0, len = this._textLines.length; i < len; i++) { + var heightOfLine = this.getHeightOfLine(i), + maxHeight = heightOfLine / this.lineHeight, + leftOffset = this._getLineLeftOffset(i); + this._renderTextLine( + method, + ctx, + this._textLines[i], + left + leftOffset - offsets.offsetX, + top + lineHeights + maxHeight - offsets.offsetY, + i + ); + lineHeights += heightOfLine; + } + ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextFill: function(ctx) { + if (!this.fill && !this.styleHas('fill')) { + return; + } + + this._renderTextCommon(ctx, 'fillText'); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextStroke: function(ctx) { + if ((!this.stroke || this.strokeWidth === 0) && this.isEmptyStyles()) { + return; + } + + if (this.shadow && !this.shadow.affectStroke) { + this._removeShadow(ctx); + } + + ctx.save(); + this._setLineDash(ctx, this.strokeDashArray); + ctx.beginPath(); + this._renderTextCommon(ctx, 'strokeText'); + ctx.closePath(); + ctx.restore(); + }, + + /** + * @private + * @param {String} method fillText or strokeText. + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Array} line Content of the line, splitted in an array by grapheme + * @param {Number} left + * @param {Number} top + * @param {Number} lineIndex + */ + _renderChars: function(method, ctx, line, left, top, lineIndex) { + // set proper line offset + var lineHeight = this.getHeightOfLine(lineIndex), + isJustify = this.textAlign.indexOf('justify') !== -1, + actualStyle, + nextStyle, + charsToRender = '', + charBox, + boxWidth = 0, + timeToRender, + shortCut = !isJustify && this.charSpacing === 0 && this.isEmptyStyles(lineIndex); + + ctx.save(); + top -= lineHeight * this._fontSizeFraction / this.lineHeight; + if (shortCut) { + // render all the line in one pass without checking + this._renderChar(method, ctx, lineIndex, 0, line.join(''), left, top, lineHeight); + ctx.restore(); + return; + } + for (var i = 0, len = line.length - 1; i <= len; i++) { + timeToRender = i === len || this.charSpacing; + charsToRender += line[i]; + charBox = this.__charBounds[lineIndex][i]; + if (boxWidth === 0) { + left += charBox.kernedWidth - charBox.width; + boxWidth += charBox.width; + } + else { + boxWidth += charBox.kernedWidth; + } + if (isJustify && !timeToRender) { + if (this._reSpaceAndTab.test(line[i])) { + timeToRender = true; + } + } + if (!timeToRender) { + // if we have charSpacing, we render char by char + actualStyle = actualStyle || this.getCompleteStyleDeclaration(lineIndex, i); + nextStyle = this.getCompleteStyleDeclaration(lineIndex, i + 1); + timeToRender = this._hasStyleChanged(actualStyle, nextStyle); + } + if (timeToRender) { + this._renderChar(method, ctx, lineIndex, i, charsToRender, left, top, lineHeight); + charsToRender = ''; + actualStyle = nextStyle; + left += boxWidth; + boxWidth = 0; + } + } + ctx.restore(); + }, + + /** + * @private + * @param {String} method + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Number} lineIndex + * @param {Number} charIndex + * @param {String} _char + * @param {Number} left Left coordinate + * @param {Number} top Top coordinate + * @param {Number} lineHeight Height of the line + */ + _renderChar: function(method, ctx, lineIndex, charIndex, _char, left, top) { + var decl = this._getStyleDeclaration(lineIndex, charIndex), + fullDecl = this.getCompleteStyleDeclaration(lineIndex, charIndex), + shouldFill = method === 'fillText' && fullDecl.fill, + shouldStroke = method === 'strokeText' && fullDecl.stroke && fullDecl.strokeWidth; + + if (!shouldStroke && !shouldFill) { + return; + } + decl && ctx.save(); + + this._applyCharStyles(method, ctx, lineIndex, charIndex, fullDecl); + + if (decl && decl.textBackgroundColor) { + this._removeShadow(ctx); + } + if (decl && decl.deltaY) { + top += decl.deltaY; + } + + shouldFill && ctx.fillText(_char, left, top); + shouldStroke && ctx.strokeText(_char, left, top); + decl && ctx.restore(); + }, + + /** + * Turns the character into a 'superior figure' (i.e. 'superscript') + * @param {Number} start selection start + * @param {Number} end selection end + * @returns {fabric.Text} thisArg + * @chainable + */ + setSuperscript: function(start, end) { + return this._setScript(start, end, this.superscript); + }, + + /** + * Turns the character into an 'inferior figure' (i.e. 'subscript') + * @param {Number} start selection start + * @param {Number} end selection end + * @returns {fabric.Text} thisArg + * @chainable + */ + setSubscript: function(start, end) { + return this._setScript(start, end, this.subscript); + }, + + /** + * Applies 'schema' at given position + * @private + * @param {Number} start selection start + * @param {Number} end selection end + * @param {Number} schema + * @returns {fabric.Text} thisArg + * @chainable + */ + _setScript: function(start, end, schema) { + var loc = this.get2DCursorLocation(start, true), + fontSize = this.getValueOfPropertyAt(loc.lineIndex, loc.charIndex, 'fontSize'), + dy = this.getValueOfPropertyAt(loc.lineIndex, loc.charIndex, 'deltaY'), + style = { fontSize: fontSize * schema.size, deltaY: dy + fontSize * schema.baseline }; + this.setSelectionStyles(style, start, end); + return this; + }, + + /** + * @private + * @param {Object} prevStyle + * @param {Object} thisStyle + */ + _hasStyleChanged: function(prevStyle, thisStyle) { + return prevStyle.fill !== thisStyle.fill || + prevStyle.stroke !== thisStyle.stroke || + prevStyle.strokeWidth !== thisStyle.strokeWidth || + prevStyle.fontSize !== thisStyle.fontSize || + prevStyle.fontFamily !== thisStyle.fontFamily || + prevStyle.fontWeight !== thisStyle.fontWeight || + prevStyle.fontStyle !== thisStyle.fontStyle || + prevStyle.deltaY !== thisStyle.deltaY; + }, + + /** + * @private + * @param {Object} prevStyle + * @param {Object} thisStyle + */ + _hasStyleChangedForSvg: function(prevStyle, thisStyle) { + return this._hasStyleChanged(prevStyle, thisStyle) || + prevStyle.overline !== thisStyle.overline || + prevStyle.underline !== thisStyle.underline || + prevStyle.linethrough !== thisStyle.linethrough; + }, + + /** + * @private + * @param {Number} lineIndex index text line + * @return {Number} Line left offset + */ + _getLineLeftOffset: function(lineIndex) { + var lineWidth = this.getLineWidth(lineIndex); + if (this.textAlign === 'center') { + return (this.width - lineWidth) / 2; + } + if (this.textAlign === 'right') { + return this.width - lineWidth; + } + if (this.textAlign === 'justify-center' && this.isEndOfWrapping(lineIndex)) { + return (this.width - lineWidth) / 2; + } + if (this.textAlign === 'justify-right' && this.isEndOfWrapping(lineIndex)) { + return this.width - lineWidth; + } + return 0; + }, + + /** + * @private + */ + _clearCache: function() { + this.__lineWidths = []; + this.__lineHeights = []; + this.__charBounds = []; + }, + + /** + * @private + */ + _shouldClearDimensionCache: function() { + var shouldClear = this._forceClearCache; + shouldClear || (shouldClear = this.hasStateChanged('_dimensionAffectingProps')); + if (shouldClear) { + this.dirty = true; + this._forceClearCache = false; + } + return shouldClear; + }, + + /** + * Measure a single line given its index. Used to calculate the initial + * text bounding box. The values are calculated and stored in __lineWidths cache. + * @private + * @param {Number} lineIndex line number + * @return {Number} Line width + */ + getLineWidth: function(lineIndex) { + if (this.__lineWidths[lineIndex]) { + return this.__lineWidths[lineIndex]; + } + + var width, line = this._textLines[lineIndex], lineInfo; + + if (line === '') { + width = 0; + } + else { + lineInfo = this.measureLine(lineIndex); + width = lineInfo.width; + } + this.__lineWidths[lineIndex] = width; + return width; + }, + + _getWidthOfCharSpacing: function() { + if (this.charSpacing !== 0) { + return this.fontSize * this.charSpacing / 1000; + } + return 0; + }, + + /** + * Retrieves the value of property at given character position + * @param {Number} lineIndex the line number + * @param {Number} charIndex the charater number + * @param {String} property the property name + * @returns the value of 'property' + */ + getValueOfPropertyAt: function(lineIndex, charIndex, property) { + var charStyle = this._getStyleDeclaration(lineIndex, charIndex); + if (charStyle && typeof charStyle[property] !== 'undefined') { + return charStyle[property]; + } + return this[property]; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextDecoration: function(ctx, type) { + if (!this[type] && !this.styleHas(type)) { + return; + } + var heightOfLine, size, _size, + lineLeftOffset, dy, _dy, + line, lastDecoration, + leftOffset = this._getLeftOffset(), + topOffset = this._getTopOffset(), top, + boxStart, boxWidth, charBox, currentDecoration, + maxHeight, currentFill, lastFill, + charSpacing = this._getWidthOfCharSpacing(); + + for (var i = 0, len = this._textLines.length; i < len; i++) { + heightOfLine = this.getHeightOfLine(i); + if (!this[type] && !this.styleHas(type, i)) { + topOffset += heightOfLine; + continue; + } + line = this._textLines[i]; + maxHeight = heightOfLine / this.lineHeight; + lineLeftOffset = this._getLineLeftOffset(i); + boxStart = 0; + boxWidth = 0; + lastDecoration = this.getValueOfPropertyAt(i, 0, type); + lastFill = this.getValueOfPropertyAt(i, 0, 'fill'); + top = topOffset + maxHeight * (1 - this._fontSizeFraction); + size = this.getHeightOfChar(i, 0); + dy = this.getValueOfPropertyAt(i, 0, 'deltaY'); + for (var j = 0, jlen = line.length; j < jlen; j++) { + charBox = this.__charBounds[i][j]; + currentDecoration = this.getValueOfPropertyAt(i, j, type); + currentFill = this.getValueOfPropertyAt(i, j, 'fill'); + _size = this.getHeightOfChar(i, j); + _dy = this.getValueOfPropertyAt(i, j, 'deltaY'); + if ((currentDecoration !== lastDecoration || currentFill !== lastFill || _size !== size || _dy !== dy) && + boxWidth > 0) { + ctx.fillStyle = lastFill; + lastDecoration && lastFill && ctx.fillRect( + leftOffset + lineLeftOffset + boxStart, + top + this.offsets[type] * size + dy, + boxWidth, + this.fontSize / 15 + ); + boxStart = charBox.left; + boxWidth = charBox.width; + lastDecoration = currentDecoration; + lastFill = currentFill; + size = _size; + dy = _dy; + } + else { + boxWidth += charBox.kernedWidth; + } + } + ctx.fillStyle = currentFill; + currentDecoration && currentFill && ctx.fillRect( + leftOffset + lineLeftOffset + boxStart, + top + this.offsets[type] * size + dy, + boxWidth - charSpacing, + this.fontSize / 15 + ); + topOffset += heightOfLine; + } + // if there is text background color no + // other shadows should be casted + this._removeShadow(ctx); + }, + + /** + * return font declaration string for canvas context + * @param {Object} [styleObject] object + * @returns {String} font declaration formatted for canvas context. + */ + _getFontDeclaration: function(styleObject, forMeasuring) { + var style = styleObject || this, family = this.fontFamily, + fontIsGeneric = fabric.Text.genericFonts.indexOf(family.toLowerCase()) > -1; + var fontFamily = family === undefined || + family.indexOf('\'') > -1 || family.indexOf(',') > -1 || + family.indexOf('"') > -1 || fontIsGeneric + ? style.fontFamily : '"' + style.fontFamily + '"'; + return [ + // node-canvas needs "weight style", while browsers need "style weight" + // verify if this can be fixed in JSDOM + (fabric.isLikelyNode ? style.fontWeight : style.fontStyle), + (fabric.isLikelyNode ? style.fontStyle : style.fontWeight), + forMeasuring ? this.CACHE_FONT_SIZE + 'px' : style.fontSize + 'px', + fontFamily + ].join(' '); + }, + + /** + * Renders text instance on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + render: function(ctx) { + // do not render if object is not visible + if (!this.visible) { + return; + } + if (this.canvas && this.canvas.skipOffscreen && !this.group && !this.isOnScreen()) { + return; + } + if (this._shouldClearDimensionCache()) { + this.initDimensions(); + } + this.callSuper('render', ctx); + }, + + /** + * Returns the text as an array of lines. + * @param {String} text text to split + * @returns {Array} Lines in the text + */ + _splitTextIntoLines: function(text) { + var lines = text.split(this._reNewline), + newLines = new Array(lines.length), + newLine = ['\n'], + newText = []; + for (var i = 0; i < lines.length; i++) { + newLines[i] = fabric.util.string.graphemeSplit(lines[i]); + newText = newText.concat(newLines[i], newLine); + } + newText.pop(); + return { _unwrappedLines: newLines, lines: lines, graphemeText: newText, graphemeLines: newLines }; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + var additionalProperties = [ + 'text', + 'fontSize', + 'fontWeight', + 'fontFamily', + 'fontStyle', + 'lineHeight', + 'underline', + 'overline', + 'linethrough', + 'textAlign', + 'textBackgroundColor', + 'charSpacing', + ].concat(propertiesToInclude); + var obj = this.callSuper('toObject', additionalProperties); + obj.styles = clone(this.styles, true); + return obj; + }, + + /** + * Sets property to a given value. When changing position/dimension -related properties (left, top, scale, angle, etc.) `set` does not update position of object's borders/controls. If you need to update those, call `setCoords()`. + * @param {String|Object} key Property name or object (if object, iterate over the object properties) + * @param {Object|Function} value Property value (if function, the value is passed into it and its return value is used as a new one) + * @return {fabric.Object} thisArg + * @chainable + */ + set: function(key, value) { + this.callSuper('set', key, value); + var needsDims = false; + if (typeof key === 'object') { + for (var _key in key) { + needsDims = needsDims || this._dimensionAffectingProps.indexOf(_key) !== -1; + } + } + else { + needsDims = this._dimensionAffectingProps.indexOf(key) !== -1; + } + if (needsDims) { + this.initDimensions(); + this.setCoords(); + } + return this; + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Text.fromElement}) + * @static + * @memberOf fabric.Text + * @see: http://www.w3.org/TR/SVG/text.html#TextElement + */ + fabric.Text.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat( + 'x y dx dy font-family font-style font-weight font-size letter-spacing text-decoration text-anchor'.split(' ')); + + /** + * Default SVG font size + * @static + * @memberOf fabric.Text + */ + fabric.Text.DEFAULT_SVG_FONT_SIZE = 16; + + /** + * Returns fabric.Text instance from an SVG element (not yet implemented) + * @static + * @memberOf fabric.Text + * @param {SVGElement} element Element to parse + * @param {Function} callback callback function invoked after parsing + * @param {Object} [options] Options object + */ + fabric.Text.fromElement = function(element, callback, options) { + if (!element) { + return callback(null); + } + + var parsedAttributes = fabric.parseAttributes(element, fabric.Text.ATTRIBUTE_NAMES), + parsedAnchor = parsedAttributes.textAnchor || 'left'; + options = fabric.util.object.extend((options ? clone(options) : { }), parsedAttributes); + + options.top = options.top || 0; + options.left = options.left || 0; + if (parsedAttributes.textDecoration) { + var textDecoration = parsedAttributes.textDecoration; + if (textDecoration.indexOf('underline') !== -1) { + options.underline = true; + } + if (textDecoration.indexOf('overline') !== -1) { + options.overline = true; + } + if (textDecoration.indexOf('line-through') !== -1) { + options.linethrough = true; + } + delete options.textDecoration; + } + if ('dx' in parsedAttributes) { + options.left += parsedAttributes.dx; + } + if ('dy' in parsedAttributes) { + options.top += parsedAttributes.dy; + } + if (!('fontSize' in options)) { + options.fontSize = fabric.Text.DEFAULT_SVG_FONT_SIZE; + } + + var textContent = ''; + + // The XML is not properly parsed in IE9 so a workaround to get + // textContent is through firstChild.data. Another workaround would be + // to convert XML loaded from a file to be converted using DOMParser (same way loadSVGFromString() does) + if (!('textContent' in element)) { + if ('firstChild' in element && element.firstChild !== null) { + if ('data' in element.firstChild && element.firstChild.data !== null) { + textContent = element.firstChild.data; + } + } + } + else { + textContent = element.textContent; + } + + textContent = textContent.replace(/^\s+|\s+$|\n+/g, '').replace(/\s+/g, ' '); + var originalStrokeWidth = options.strokeWidth; + options.strokeWidth = 0; + + var text = new fabric.Text(textContent, options), + textHeightScaleFactor = text.getScaledHeight() / text.height, + lineHeightDiff = (text.height + text.strokeWidth) * text.lineHeight - text.height, + scaledDiff = lineHeightDiff * textHeightScaleFactor, + textHeight = text.getScaledHeight() + scaledDiff, + offX = 0; + /* + Adjust positioning: + x/y attributes in SVG correspond to the bottom-left corner of text bounding box + fabric output by default at top, left. + */ + if (parsedAnchor === 'center') { + offX = text.getScaledWidth() / 2; + } + if (parsedAnchor === 'right') { + offX = text.getScaledWidth(); + } + text.set({ + left: text.left - offX, + top: text.top - (textHeight - text.fontSize * (0.07 + text._fontSizeFraction)) / text.lineHeight, + strokeWidth: typeof originalStrokeWidth !== 'undefined' ? originalStrokeWidth : 1, + }); + callback(text); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Text instance from an object representation + * @static + * @memberOf fabric.Text + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Text instance is created + */ + fabric.Text.fromObject = function(object, callback) { + return fabric.Object._fromObject('Text', object, callback, 'text'); + }; + + fabric.Text.genericFonts = ['sans-serif', 'serif', 'cursive', 'fantasy', 'monospace']; + + fabric.util.createAccessors && fabric.util.createAccessors(fabric.Text); + +})(typeof exports !== 'undefined' ? exports : this); +(function() { + fabric.util.object.extend(fabric.Text.prototype, /** @lends fabric.Text.prototype */ { + /** + * Returns true if object has no styling or no styling in a line + * @param {Number} lineIndex , lineIndex is on wrapped lines. + * @return {Boolean} + */ + isEmptyStyles: function(lineIndex) { + if (!this.styles) { + return true; + } + if (typeof lineIndex !== 'undefined' && !this.styles[lineIndex]) { + return true; + } + var obj = typeof lineIndex === 'undefined' ? this.styles : { line: this.styles[lineIndex] }; + for (var p1 in obj) { + for (var p2 in obj[p1]) { + // eslint-disable-next-line no-unused-vars + for (var p3 in obj[p1][p2]) { + return false; + } + } + } + return true; + }, + + /** + * Returns true if object has a style property or has it ina specified line + * This function is used to detect if a text will use a particular property or not. + * @param {String} property to check for + * @param {Number} lineIndex to check the style on + * @return {Boolean} + */ + styleHas: function(property, lineIndex) { + if (!this.styles || !property || property === '') { + return false; + } + if (typeof lineIndex !== 'undefined' && !this.styles[lineIndex]) { + return false; + } + var obj = typeof lineIndex === 'undefined' ? this.styles : { 0: this.styles[lineIndex] }; + // eslint-disable-next-line + for (var p1 in obj) { + // eslint-disable-next-line + for (var p2 in obj[p1]) { + if (typeof obj[p1][p2][property] !== 'undefined') { + return true; + } + } + } + return false; + }, + + /** + * Check if characters in a text have a value for a property + * whose value matches the textbox's value for that property. If so, + * the character-level property is deleted. If the character + * has no other properties, then it is also deleted. Finally, + * if the line containing that character has no other characters + * then it also is deleted. + * + * @param {string} property The property to compare between characters and text. + */ + cleanStyle: function(property) { + if (!this.styles || !property || property === '') { + return false; + } + var obj = this.styles, stylesCount = 0, letterCount, stylePropertyValue, + allStyleObjectPropertiesMatch = true, graphemeCount = 0, styleObject; + // eslint-disable-next-line + for (var p1 in obj) { + letterCount = 0; + // eslint-disable-next-line + for (var p2 in obj[p1]) { + var styleObject = obj[p1][p2], + stylePropertyHasBeenSet = styleObject.hasOwnProperty(property); + + stylesCount++; + + if (stylePropertyHasBeenSet) { + if (!stylePropertyValue) { + stylePropertyValue = styleObject[property]; + } + else if (styleObject[property] !== stylePropertyValue) { + allStyleObjectPropertiesMatch = false; + } + + if (styleObject[property] === this[property]) { + delete styleObject[property]; + } + } + else { + allStyleObjectPropertiesMatch = false; + } + + if (Object.keys(styleObject).length !== 0) { + letterCount++; + } + else { + delete obj[p1][p2]; + } + } + + if (letterCount === 0) { + delete obj[p1]; + } + } + // if every grapheme has the same style set then + // delete those styles and set it on the parent + for (var i = 0; i < this._textLines.length; i++) { + graphemeCount += this._textLines[i].length; + } + if (allStyleObjectPropertiesMatch && stylesCount === graphemeCount) { + this[property] = stylePropertyValue; + this.removeStyle(property); + } + }, + + /** + * Remove a style property or properties from all individual character styles + * in a text object. Deletes the character style object if it contains no other style + * props. Deletes a line style object if it contains no other character styles. + * + * @param {String} props The property to remove from character styles. + */ + removeStyle: function(property) { + if (!this.styles || !property || property === '') { + return; + } + var obj = this.styles, line, lineNum, charNum; + for (lineNum in obj) { + line = obj[lineNum]; + for (charNum in line) { + delete line[charNum][property]; + if (Object.keys(line[charNum]).length === 0) { + delete line[charNum]; + } + } + if (Object.keys(line).length === 0) { + delete obj[lineNum]; + } + } + }, + + /** + * @private + */ + _extendStyles: function(index, styles) { + var loc = this.get2DCursorLocation(index); + + if (!this._getLineStyle(loc.lineIndex)) { + this._setLineStyle(loc.lineIndex); + } + + if (!this._getStyleDeclaration(loc.lineIndex, loc.charIndex)) { + this._setStyleDeclaration(loc.lineIndex, loc.charIndex, {}); + } + + fabric.util.object.extend(this._getStyleDeclaration(loc.lineIndex, loc.charIndex), styles); + }, + + /** + * Returns 2d representation (lineIndex and charIndex) of cursor (or selection start) + * @param {Number} [selectionStart] Optional index. When not given, current selectionStart is used. + * @param {Boolean} [skipWrapping] consider the location for unwrapped lines. useful to manage styles. + */ + get2DCursorLocation: function(selectionStart, skipWrapping) { + if (typeof selectionStart === 'undefined') { + selectionStart = this.selectionStart; + } + var lines = skipWrapping ? this._unwrappedTextLines : this._textLines, + len = lines.length; + for (var i = 0; i < len; i++) { + if (selectionStart <= lines[i].length) { + return { + lineIndex: i, + charIndex: selectionStart + }; + } + selectionStart -= lines[i].length + this.missingNewlineOffset(i); + } + return { + lineIndex: i - 1, + charIndex: lines[i - 1].length < selectionStart ? lines[i - 1].length : selectionStart + }; + }, + + /** + * Gets style of a current selection/cursor (at the start position) + * if startIndex or endIndex are not provided, slectionStart or selectionEnd will be used. + * @param {Number} [startIndex] Start index to get styles at + * @param {Number} [endIndex] End index to get styles at, if not specified selectionEnd or startIndex + 1 + * @param {Boolean} [complete] get full style or not + * @return {Array} styles an array with one, zero or more Style objects + */ + getSelectionStyles: function(startIndex, endIndex, complete) { + if (typeof startIndex === 'undefined') { + startIndex = this.selectionStart || 0; + } + if (typeof endIndex === 'undefined') { + endIndex = this.selectionEnd || startIndex; + } + var styles = []; + for (var i = startIndex; i < endIndex; i++) { + styles.push(this.getStyleAtPosition(i, complete)); + } + return styles; + }, + + /** + * Gets style of a current selection/cursor position + * @param {Number} position to get styles at + * @param {Boolean} [complete] full style if true + * @return {Object} style Style object at a specified index + * @private + */ + getStyleAtPosition: function(position, complete) { + var loc = this.get2DCursorLocation(position), + style = complete ? this.getCompleteStyleDeclaration(loc.lineIndex, loc.charIndex) : + this._getStyleDeclaration(loc.lineIndex, loc.charIndex); + return style || {}; + }, + + /** + * Sets style of a current selection, if no selection exist, do not set anything. + * @param {Object} [styles] Styles object + * @param {Number} [startIndex] Start index to get styles at + * @param {Number} [endIndex] End index to get styles at, if not specified selectionEnd or startIndex + 1 + * @return {fabric.IText} thisArg + * @chainable + */ + setSelectionStyles: function(styles, startIndex, endIndex) { + if (typeof startIndex === 'undefined') { + startIndex = this.selectionStart || 0; + } + if (typeof endIndex === 'undefined') { + endIndex = this.selectionEnd || startIndex; + } + for (var i = startIndex; i < endIndex; i++) { + this._extendStyles(i, styles); + } + /* not included in _extendStyles to avoid clearing cache more than once */ + this._forceClearCache = true; + return this; + }, + + /** + * get the reference, not a clone, of the style object for a given character + * @param {Number} lineIndex + * @param {Number} charIndex + * @return {Object} style object + */ + _getStyleDeclaration: function(lineIndex, charIndex) { + var lineStyle = this.styles && this.styles[lineIndex]; + if (!lineStyle) { + return null; + } + return lineStyle[charIndex]; + }, + + /** + * return a new object that contains all the style property for a character + * the object returned is newly created + * @param {Number} lineIndex of the line where the character is + * @param {Number} charIndex position of the character on the line + * @return {Object} style object + */ + getCompleteStyleDeclaration: function(lineIndex, charIndex) { + var style = this._getStyleDeclaration(lineIndex, charIndex) || { }, + styleObject = { }, prop; + for (var i = 0; i < this._styleProperties.length; i++) { + prop = this._styleProperties[i]; + styleObject[prop] = typeof style[prop] === 'undefined' ? this[prop] : style[prop]; + } + return styleObject; + }, + + /** + * @param {Number} lineIndex + * @param {Number} charIndex + * @param {Object} style + * @private + */ + _setStyleDeclaration: function(lineIndex, charIndex, style) { + this.styles[lineIndex][charIndex] = style; + }, + + /** + * + * @param {Number} lineIndex + * @param {Number} charIndex + * @private + */ + _deleteStyleDeclaration: function(lineIndex, charIndex) { + delete this.styles[lineIndex][charIndex]; + }, + + /** + * @param {Number} lineIndex + * @return {Boolean} if the line exists or not + * @private + */ + _getLineStyle: function(lineIndex) { + return !!this.styles[lineIndex]; + }, + + /** + * Set the line style to an empty object so that is initialized + * @param {Number} lineIndex + * @private + */ + _setLineStyle: function(lineIndex) { + this.styles[lineIndex] = {}; + }, + + /** + * @param {Number} lineIndex + * @private + */ + _deleteLineStyle: function(lineIndex) { + delete this.styles[lineIndex]; + } + }); +})(); +(function() { + + function parseDecoration(object) { + if (object.textDecoration) { + object.textDecoration.indexOf('underline') > -1 && (object.underline = true); + object.textDecoration.indexOf('line-through') > -1 && (object.linethrough = true); + object.textDecoration.indexOf('overline') > -1 && (object.overline = true); + delete object.textDecoration; + } + } + + /** + * IText class (introduced in v1.4) Events are also fired with "text:" + * prefix when observing canvas. + * @class fabric.IText + * @extends fabric.Text + * @mixes fabric.Observable + * + * @fires changed + * @fires selection:changed + * @fires editing:entered + * @fires editing:exited + * + * @return {fabric.IText} thisArg + * @see {@link fabric.IText#initialize} for constructor definition + * + *

Supported key combinations:

+ *
+   *   Move cursor:                    left, right, up, down
+   *   Select character:               shift + left, shift + right
+   *   Select text vertically:         shift + up, shift + down
+   *   Move cursor by word:            alt + left, alt + right
+   *   Select words:                   shift + alt + left, shift + alt + right
+   *   Move cursor to line start/end:  cmd + left, cmd + right or home, end
+   *   Select till start/end of line:  cmd + shift + left, cmd + shift + right or shift + home, shift + end
+   *   Jump to start/end of text:      cmd + up, cmd + down
+   *   Select till start/end of text:  cmd + shift + up, cmd + shift + down or shift + pgUp, shift + pgDown
+   *   Delete character:               backspace
+   *   Delete word:                    alt + backspace
+   *   Delete line:                    cmd + backspace
+   *   Forward delete:                 delete
+   *   Copy text:                      ctrl/cmd + c
+   *   Paste text:                     ctrl/cmd + v
+   *   Cut text:                       ctrl/cmd + x
+   *   Select entire text:             ctrl/cmd + a
+   *   Quit editing                    tab or esc
+   * 
+ * + *

Supported mouse/touch combination

+ *
+   *   Position cursor:                click/touch
+   *   Create selection:               click/touch & drag
+   *   Create selection:               click & shift + click
+   *   Select word:                    double click
+   *   Select line:                    triple click
+   * 
+ */ + fabric.IText = fabric.util.createClass(fabric.Text, fabric.Observable, /** @lends fabric.IText.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'i-text', + + /** + * Index where text selection starts (or where cursor is when there is no selection) + * @type Number + * @default + */ + selectionStart: 0, + + /** + * Index where text selection ends + * @type Number + * @default + */ + selectionEnd: 0, + + /** + * Color of text selection + * @type String + * @default + */ + selectionColor: 'rgba(17,119,255,0.3)', + + /** + * Indicates whether text is in editing mode + * @type Boolean + * @default + */ + isEditing: false, + + /** + * Indicates whether a text can be edited + * @type Boolean + * @default + */ + editable: true, + + /** + * Border color of text object while it's in editing mode + * @type String + * @default + */ + editingBorderColor: 'rgba(102,153,255,0.25)', + + /** + * Width of cursor (in px) + * @type Number + * @default + */ + cursorWidth: 2, + + /** + * Color of text cursor color in editing mode. + * if not set (default) will take color from the text. + * if set to a color value that fabric can understand, it will + * be used instead of the color of the text at the current position. + * @type String + * @default + */ + cursorColor: '', + + /** + * Delay between cursor blink (in ms) + * @type Number + * @default + */ + cursorDelay: 1000, + + /** + * Duration of cursor fadein (in ms) + * @type Number + * @default + */ + cursorDuration: 600, + + /** + * Indicates whether internal text char widths can be cached + * @type Boolean + * @default + */ + caching: true, + + /** + * @private + */ + _reSpace: /\s|\n/, + + /** + * @private + */ + _currentCursorOpacity: 0, + + /** + * @private + */ + _selectionDirection: null, + + /** + * @private + */ + _abortCursorAnimation: false, + + /** + * @private + */ + __widthOfSpace: [], + + /** + * Helps determining when the text is in composition, so that the cursor + * rendering is altered. + */ + inCompositionMode: false, + + /** + * Constructor + * @param {String} text Text string + * @param {Object} [options] Options object + * @return {fabric.IText} thisArg + */ + initialize: function(text, options) { + this.callSuper('initialize', text, options); + this.initBehavior(); + }, + + /** + * Sets selection start (left boundary of a selection) + * @param {Number} index Index to set selection start to + */ + setSelectionStart: function(index) { + index = Math.max(index, 0); + this._updateAndFire('selectionStart', index); + }, + + /** + * Sets selection end (right boundary of a selection) + * @param {Number} index Index to set selection end to + */ + setSelectionEnd: function(index) { + index = Math.min(index, this.text.length); + this._updateAndFire('selectionEnd', index); + }, + + /** + * @private + * @param {String} property 'selectionStart' or 'selectionEnd' + * @param {Number} index new position of property + */ + _updateAndFire: function(property, index) { + if (this[property] !== index) { + this._fireSelectionChanged(); + this[property] = index; + } + this._updateTextarea(); + }, + + /** + * Fires the even of selection changed + * @private + */ + _fireSelectionChanged: function() { + this.fire('selection:changed'); + this.canvas && this.canvas.fire('text:selection:changed', { target: this }); + }, + + /** + * Initialize text dimensions. Render all text on given context + * or on a offscreen canvas to get the text width with measureText. + * Updates this.width and this.height with the proper values. + * Does not return dimensions. + * @private + */ + initDimensions: function() { + this.isEditing && this.initDelayedCursor(); + this.clearContextTop(); + this.callSuper('initDimensions'); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + render: function(ctx) { + this.clearContextTop(); + this.callSuper('render', ctx); + // clear the cursorOffsetCache, so we ensure to calculate once per renderCursor + // the correct position but not at every cursor animation. + this.cursorOffsetCache = { }; + this.renderCursorOrSelection(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + this.callSuper('_render', ctx); + }, + + /** + * Prepare and clean the contextTop + */ + clearContextTop: function(skipRestore) { + if (!this.isEditing || !this.canvas || !this.canvas.contextTop) { + return; + } + var ctx = this.canvas.contextTop, v = this.canvas.viewportTransform; + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + this.transform(ctx); + this._clearTextArea(ctx); + skipRestore || ctx.restore(); + }, + /** + * Renders cursor or selection (depending on what exists) + * it does on the contextTop. If contextTop is not available, do nothing. + */ + renderCursorOrSelection: function() { + if (!this.isEditing || !this.canvas || !this.canvas.contextTop) { + return; + } + var boundaries = this._getCursorBoundaries(), + ctx = this.canvas.contextTop; + this.clearContextTop(true); + if (this.selectionStart === this.selectionEnd) { + this.renderCursor(boundaries, ctx); + } + else { + this.renderSelection(boundaries, ctx); + } + ctx.restore(); + }, + + _clearTextArea: function(ctx) { + // we add 4 pixel, to be sure to do not leave any pixel out + var width = this.width + 4, height = this.height + 4; + ctx.clearRect(-width / 2, -height / 2, width, height); + }, + + /** + * Returns cursor boundaries (left, top, leftOffset, topOffset) + * @private + * @param {Array} chars Array of characters + * @param {String} typeOfBoundaries + */ + _getCursorBoundaries: function(position) { + + // left/top are left/top of entire text box + // leftOffset/topOffset are offset from that left/top point of a text box + + if (typeof position === 'undefined') { + position = this.selectionStart; + } + + var left = this._getLeftOffset(), + top = this._getTopOffset(), + offsets = this._getCursorBoundariesOffsets(position); + + return { + left: left, + top: top, + leftOffset: offsets.left, + topOffset: offsets.top + }; + }, + + /** + * @private + */ + _getCursorBoundariesOffsets: function(position) { + if (this.cursorOffsetCache && 'top' in this.cursorOffsetCache) { + return this.cursorOffsetCache; + } + var lineLeftOffset, + lineIndex, + charIndex, + topOffset = 0, + leftOffset = 0, + boundaries, + cursorPosition = this.get2DCursorLocation(position); + charIndex = cursorPosition.charIndex; + lineIndex = cursorPosition.lineIndex; + for (var i = 0; i < lineIndex; i++) { + topOffset += this.getHeightOfLine(i); + } + lineLeftOffset = this._getLineLeftOffset(lineIndex); + var bound = this.__charBounds[lineIndex][charIndex]; + bound && (leftOffset = bound.left); + if (this.charSpacing !== 0 && charIndex === this._textLines[lineIndex].length) { + leftOffset -= this._getWidthOfCharSpacing(); + } + boundaries = { + top: topOffset, + left: lineLeftOffset + (leftOffset > 0 ? leftOffset : 0), + }; + this.cursorOffsetCache = boundaries; + return this.cursorOffsetCache; + }, + + /** + * Renders cursor + * @param {Object} boundaries + * @param {CanvasRenderingContext2D} ctx transformed context to draw on + */ + renderCursor: function(boundaries, ctx) { + var cursorLocation = this.get2DCursorLocation(), + lineIndex = cursorLocation.lineIndex, + charIndex = cursorLocation.charIndex > 0 ? cursorLocation.charIndex - 1 : 0, + charHeight = this.getValueOfPropertyAt(lineIndex, charIndex, 'fontSize'), + multiplier = this.scaleX * this.canvas.getZoom(), + cursorWidth = this.cursorWidth / multiplier, + topOffset = boundaries.topOffset, + dy = this.getValueOfPropertyAt(lineIndex, charIndex, 'deltaY'); + + topOffset += (1 - this._fontSizeFraction) * this.getHeightOfLine(lineIndex) / this.lineHeight + - charHeight * (1 - this._fontSizeFraction); + + if (this.inCompositionMode) { + this.renderSelection(boundaries, ctx); + } + + ctx.fillStyle = this.cursorColor || this.getValueOfPropertyAt(lineIndex, charIndex, 'fill'); + ctx.globalAlpha = this.__isMousedown ? 1 : this._currentCursorOpacity; + ctx.fillRect( + boundaries.left + boundaries.leftOffset - cursorWidth / 2, + topOffset + boundaries.top + dy, + cursorWidth, + charHeight); + }, + + /** + * Renders text selection + * @param {Object} boundaries Object with left/top/leftOffset/topOffset + * @param {CanvasRenderingContext2D} ctx transformed context to draw on + */ + renderSelection: function(boundaries, ctx) { + + var selectionStart = this.inCompositionMode ? this.hiddenTextarea.selectionStart : this.selectionStart, + selectionEnd = this.inCompositionMode ? this.hiddenTextarea.selectionEnd : this.selectionEnd, + isJustify = this.textAlign.indexOf('justify') !== -1, + start = this.get2DCursorLocation(selectionStart), + end = this.get2DCursorLocation(selectionEnd), + startLine = start.lineIndex, + endLine = end.lineIndex, + startChar = start.charIndex < 0 ? 0 : start.charIndex, + endChar = end.charIndex < 0 ? 0 : end.charIndex; + + for (var i = startLine; i <= endLine; i++) { + var lineOffset = this._getLineLeftOffset(i) || 0, + lineHeight = this.getHeightOfLine(i), + realLineHeight = 0, boxStart = 0, boxEnd = 0; + + if (i === startLine) { + boxStart = this.__charBounds[startLine][startChar].left; + } + if (i >= startLine && i < endLine) { + boxEnd = isJustify && !this.isEndOfWrapping(i) ? this.width : this.getLineWidth(i) || 5; // WTF is this 5? + } + else if (i === endLine) { + if (endChar === 0) { + boxEnd = this.__charBounds[endLine][endChar].left; + } + else { + var charSpacing = this._getWidthOfCharSpacing(); + boxEnd = this.__charBounds[endLine][endChar - 1].left + + this.__charBounds[endLine][endChar - 1].width - charSpacing; + } + } + realLineHeight = lineHeight; + if (this.lineHeight < 1 || (i === endLine && this.lineHeight > 1)) { + lineHeight /= this.lineHeight; + } + if (this.inCompositionMode) { + ctx.fillStyle = this.compositionColor || 'black'; + ctx.fillRect( + boundaries.left + lineOffset + boxStart, + boundaries.top + boundaries.topOffset + lineHeight, + boxEnd - boxStart, + 1); + } + else { + ctx.fillStyle = this.selectionColor; + ctx.fillRect( + boundaries.left + lineOffset + boxStart, + boundaries.top + boundaries.topOffset, + boxEnd - boxStart, + lineHeight); + } + + + boundaries.topOffset += realLineHeight; + } + }, + + /** + * High level function to know the height of the cursor. + * the currentChar is the one that precedes the cursor + * Returns fontSize of char at the current cursor + * Unused from the library, is for the end user + * @return {Number} Character font size + */ + getCurrentCharFontSize: function() { + var cp = this._getCurrentCharIndex(); + return this.getValueOfPropertyAt(cp.l, cp.c, 'fontSize'); + }, + + /** + * High level function to know the color of the cursor. + * the currentChar is the one that precedes the cursor + * Returns color (fill) of char at the current cursor + * Unused from the library, is for the end user + * @return {String} Character color (fill) + */ + getCurrentCharColor: function() { + var cp = this._getCurrentCharIndex(); + return this.getValueOfPropertyAt(cp.l, cp.c, 'fill'); + }, + + /** + * Returns the cursor position for the getCurrent.. functions + * @private + */ + _getCurrentCharIndex: function() { + var cursorPosition = this.get2DCursorLocation(this.selectionStart, true), + charIndex = cursorPosition.charIndex > 0 ? cursorPosition.charIndex - 1 : 0; + return { l: cursorPosition.lineIndex, c: charIndex }; + } + }); + + /** + * Returns fabric.IText instance from an object representation + * @static + * @memberOf fabric.IText + * @param {Object} object Object to create an instance from + * @param {function} [callback] invoked with new instance as argument + */ + fabric.IText.fromObject = function(object, callback) { + parseDecoration(object); + if (object.styles) { + for (var i in object.styles) { + for (var j in object.styles[i]) { + parseDecoration(object.styles[i][j]); + } + } + } + fabric.Object._fromObject('IText', object, callback, 'text'); + }; +})(); +(function() { + + var clone = fabric.util.object.clone; + + fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ { + + /** + * Initializes all the interactive behavior of IText + */ + initBehavior: function() { + this.initAddedHandler(); + this.initRemovedHandler(); + this.initCursorSelectionHandlers(); + this.initDoubleClickSimulation(); + this.mouseMoveHandler = this.mouseMoveHandler.bind(this); + }, + + onDeselect: function() { + this.isEditing && this.exitEditing(); + this.selected = false; + }, + + /** + * Initializes "added" event handler + */ + initAddedHandler: function() { + var _this = this; + this.on('added', function() { + var canvas = _this.canvas; + if (canvas) { + if (!canvas._hasITextHandlers) { + canvas._hasITextHandlers = true; + _this._initCanvasHandlers(canvas); + } + canvas._iTextInstances = canvas._iTextInstances || []; + canvas._iTextInstances.push(_this); + } + }); + }, + + initRemovedHandler: function() { + var _this = this; + this.on('removed', function() { + var canvas = _this.canvas; + if (canvas) { + canvas._iTextInstances = canvas._iTextInstances || []; + fabric.util.removeFromArray(canvas._iTextInstances, _this); + if (canvas._iTextInstances.length === 0) { + canvas._hasITextHandlers = false; + _this._removeCanvasHandlers(canvas); + } + } + }); + }, + + /** + * register canvas event to manage exiting on other instances + * @private + */ + _initCanvasHandlers: function(canvas) { + canvas._mouseUpITextHandler = function() { + if (canvas._iTextInstances) { + canvas._iTextInstances.forEach(function(obj) { + obj.__isMousedown = false; + }); + } + }; + canvas.on('mouse:up', canvas._mouseUpITextHandler); + }, + + /** + * remove canvas event to manage exiting on other instances + * @private + */ + _removeCanvasHandlers: function(canvas) { + canvas.off('mouse:up', canvas._mouseUpITextHandler); + }, + + /** + * @private + */ + _tick: function() { + this._currentTickState = this._animateCursor(this, 1, this.cursorDuration, '_onTickComplete'); + }, + + /** + * @private + */ + _animateCursor: function(obj, targetOpacity, duration, completeMethod) { + + var tickState; + + tickState = { + isAborted: false, + abort: function() { + this.isAborted = true; + }, + }; + + obj.animate('_currentCursorOpacity', targetOpacity, { + duration: duration, + onComplete: function() { + if (!tickState.isAborted) { + obj[completeMethod](); + } + }, + onChange: function() { + // we do not want to animate a selection, only cursor + if (obj.canvas && obj.selectionStart === obj.selectionEnd) { + obj.renderCursorOrSelection(); + } + }, + abort: function() { + return tickState.isAborted; + } + }); + return tickState; + }, + + /** + * @private + */ + _onTickComplete: function() { + + var _this = this; + + if (this._cursorTimeout1) { + clearTimeout(this._cursorTimeout1); + } + this._cursorTimeout1 = setTimeout(function() { + _this._currentTickCompleteState = _this._animateCursor(_this, 0, this.cursorDuration / 2, '_tick'); + }, 100); + }, + + /** + * Initializes delayed cursor + */ + initDelayedCursor: function(restart) { + var _this = this, + delay = restart ? 0 : this.cursorDelay; + + this.abortCursorAnimation(); + this._currentCursorOpacity = 1; + this._cursorTimeout2 = setTimeout(function() { + _this._tick(); + }, delay); + }, + + /** + * Aborts cursor animation and clears all timeouts + */ + abortCursorAnimation: function() { + var shouldClear = this._currentTickState || this._currentTickCompleteState, + canvas = this.canvas; + this._currentTickState && this._currentTickState.abort(); + this._currentTickCompleteState && this._currentTickCompleteState.abort(); + + clearTimeout(this._cursorTimeout1); + clearTimeout(this._cursorTimeout2); + + this._currentCursorOpacity = 0; + // to clear just itext area we need to transform the context + // it may not be worth it + if (shouldClear && canvas) { + canvas.clearContext(canvas.contextTop || canvas.contextContainer); + } + + }, + + /** + * Selects entire text + * @return {fabric.IText} thisArg + * @chainable + */ + selectAll: function() { + this.selectionStart = 0; + this.selectionEnd = this._text.length; + this._fireSelectionChanged(); + this._updateTextarea(); + return this; + }, + + /** + * Returns selected text + * @return {String} + */ + getSelectedText: function() { + return this._text.slice(this.selectionStart, this.selectionEnd).join(''); + }, + + /** + * Find new selection index representing start of current word according to current selection index + * @param {Number} startFrom Current selection index + * @return {Number} New selection index + */ + findWordBoundaryLeft: function(startFrom) { + var offset = 0, index = startFrom - 1; + + // remove space before cursor first + if (this._reSpace.test(this._text[index])) { + while (this._reSpace.test(this._text[index])) { + offset++; + index--; + } + } + while (/\S/.test(this._text[index]) && index > -1) { + offset++; + index--; + } + + return startFrom - offset; + }, + + /** + * Find new selection index representing end of current word according to current selection index + * @param {Number} startFrom Current selection index + * @return {Number} New selection index + */ + findWordBoundaryRight: function(startFrom) { + var offset = 0, index = startFrom; + + // remove space after cursor first + if (this._reSpace.test(this._text[index])) { + while (this._reSpace.test(this._text[index])) { + offset++; + index++; + } + } + while (/\S/.test(this._text[index]) && index < this._text.length) { + offset++; + index++; + } + + return startFrom + offset; + }, + + /** + * Find new selection index representing start of current line according to current selection index + * @param {Number} startFrom Current selection index + * @return {Number} New selection index + */ + findLineBoundaryLeft: function(startFrom) { + var offset = 0, index = startFrom - 1; + + while (!/\n/.test(this._text[index]) && index > -1) { + offset++; + index--; + } + + return startFrom - offset; + }, + + /** + * Find new selection index representing end of current line according to current selection index + * @param {Number} startFrom Current selection index + * @return {Number} New selection index + */ + findLineBoundaryRight: function(startFrom) { + var offset = 0, index = startFrom; + + while (!/\n/.test(this._text[index]) && index < this._text.length) { + offset++; + index++; + } + + return startFrom + offset; + }, + + /** + * Finds index corresponding to beginning or end of a word + * @param {Number} selectionStart Index of a character + * @param {Number} direction 1 or -1 + * @return {Number} Index of the beginning or end of a word + */ + searchWordBoundary: function(selectionStart, direction) { + var text = this._text, + index = this._reSpace.test(text[selectionStart]) ? selectionStart - 1 : selectionStart, + _char = text[index], + // wrong + reNonWord = fabric.reNonWord; + + while (!reNonWord.test(_char) && index > 0 && index < text.length) { + index += direction; + _char = text[index]; + } + if (reNonWord.test(_char)) { + index += direction === 1 ? 0 : 1; + } + return index; + }, + + /** + * Selects a word based on the index + * @param {Number} selectionStart Index of a character + */ + selectWord: function(selectionStart) { + selectionStart = selectionStart || this.selectionStart; + var newSelectionStart = this.searchWordBoundary(selectionStart, -1), /* search backwards */ + newSelectionEnd = this.searchWordBoundary(selectionStart, 1); /* search forward */ + + this.selectionStart = newSelectionStart; + this.selectionEnd = newSelectionEnd; + this._fireSelectionChanged(); + this._updateTextarea(); + this.renderCursorOrSelection(); + }, + + /** + * Selects a line based on the index + * @param {Number} selectionStart Index of a character + * @return {fabric.IText} thisArg + * @chainable + */ + selectLine: function(selectionStart) { + selectionStart = selectionStart || this.selectionStart; + var newSelectionStart = this.findLineBoundaryLeft(selectionStart), + newSelectionEnd = this.findLineBoundaryRight(selectionStart); + + this.selectionStart = newSelectionStart; + this.selectionEnd = newSelectionEnd; + this._fireSelectionChanged(); + this._updateTextarea(); + return this; + }, + + /** + * Enters editing state + * @return {fabric.IText} thisArg + * @chainable + */ + enterEditing: function(e) { + if (this.isEditing || !this.editable) { + return; + } + + if (this.canvas) { + this.canvas.calcOffset(); + this.exitEditingOnOthers(this.canvas); + } + + this.isEditing = true; + + this.initHiddenTextarea(e); + this.hiddenTextarea.focus(); + this.hiddenTextarea.value = this.text; + this._updateTextarea(); + this._saveEditingProps(); + this._setEditingProps(); + this._textBeforeEdit = this.text; + + this._tick(); + this.fire('editing:entered'); + this._fireSelectionChanged(); + if (!this.canvas) { + return this; + } + this.canvas.fire('text:editing:entered', { target: this }); + this.initMouseMoveHandler(); + this.canvas.requestRenderAll(); + return this; + }, + + exitEditingOnOthers: function(canvas) { + if (canvas._iTextInstances) { + canvas._iTextInstances.forEach(function(obj) { + obj.selected = false; + if (obj.isEditing) { + obj.exitEditing(); + } + }); + } + }, + + /** + * Initializes "mousemove" event handler + */ + initMouseMoveHandler: function() { + this.canvas.on('mouse:move', this.mouseMoveHandler); + }, + + /** + * @private + */ + mouseMoveHandler: function(options) { + if (!this.__isMousedown || !this.isEditing) { + return; + } + + var newSelectionStart = this.getSelectionStartFromPointer(options.e), + currentStart = this.selectionStart, + currentEnd = this.selectionEnd; + if ( + (newSelectionStart !== this.__selectionStartOnMouseDown || currentStart === currentEnd) + && + (currentStart === newSelectionStart || currentEnd === newSelectionStart) + ) { + return; + } + if (newSelectionStart > this.__selectionStartOnMouseDown) { + this.selectionStart = this.__selectionStartOnMouseDown; + this.selectionEnd = newSelectionStart; + } + else { + this.selectionStart = newSelectionStart; + this.selectionEnd = this.__selectionStartOnMouseDown; + } + if (this.selectionStart !== currentStart || this.selectionEnd !== currentEnd) { + this.restartCursorIfNeeded(); + this._fireSelectionChanged(); + this._updateTextarea(); + this.renderCursorOrSelection(); + } + }, + + /** + * @private + */ + _setEditingProps: function() { + this.hoverCursor = 'text'; + + if (this.canvas) { + this.canvas.defaultCursor = this.canvas.moveCursor = 'text'; + } + + this.borderColor = this.editingBorderColor; + this.hasControls = this.selectable = false; + this.lockMovementX = this.lockMovementY = true; + }, + + /** + * convert from textarea to grapheme indexes + */ + fromStringToGraphemeSelection: function(start, end, text) { + var smallerTextStart = text.slice(0, start), + graphemeStart = fabric.util.string.graphemeSplit(smallerTextStart).length; + if (start === end) { + return { selectionStart: graphemeStart, selectionEnd: graphemeStart }; + } + var smallerTextEnd = text.slice(start, end), + graphemeEnd = fabric.util.string.graphemeSplit(smallerTextEnd).length; + return { selectionStart: graphemeStart, selectionEnd: graphemeStart + graphemeEnd }; + }, + + /** + * convert from fabric to textarea values + */ + fromGraphemeToStringSelection: function(start, end, _text) { + var smallerTextStart = _text.slice(0, start), + graphemeStart = smallerTextStart.join('').length; + if (start === end) { + return { selectionStart: graphemeStart, selectionEnd: graphemeStart }; + } + var smallerTextEnd = _text.slice(start, end), + graphemeEnd = smallerTextEnd.join('').length; + return { selectionStart: graphemeStart, selectionEnd: graphemeStart + graphemeEnd }; + }, + + /** + * @private + */ + _updateTextarea: function() { + this.cursorOffsetCache = { }; + if (!this.hiddenTextarea) { + return; + } + if (!this.inCompositionMode) { + var newSelection = this.fromGraphemeToStringSelection(this.selectionStart, this.selectionEnd, this._text); + this.hiddenTextarea.selectionStart = newSelection.selectionStart; + this.hiddenTextarea.selectionEnd = newSelection.selectionEnd; + } + this.updateTextareaPosition(); + }, + + /** + * @private + */ + updateFromTextArea: function() { + if (!this.hiddenTextarea) { + return; + } + this.cursorOffsetCache = { }; + this.text = this.hiddenTextarea.value; + if (this._shouldClearDimensionCache()) { + this.initDimensions(); + this.setCoords(); + } + var newSelection = this.fromStringToGraphemeSelection( + this.hiddenTextarea.selectionStart, this.hiddenTextarea.selectionEnd, this.hiddenTextarea.value); + this.selectionEnd = this.selectionStart = newSelection.selectionEnd; + if (!this.inCompositionMode) { + this.selectionStart = newSelection.selectionStart; + } + this.updateTextareaPosition(); + }, + + /** + * @private + */ + updateTextareaPosition: function() { + if (this.selectionStart === this.selectionEnd) { + var style = this._calcTextareaPosition(); + this.hiddenTextarea.style.left = style.left; + this.hiddenTextarea.style.top = style.top; + } + }, + + /** + * @private + * @return {Object} style contains style for hiddenTextarea + */ + _calcTextareaPosition: function() { + if (!this.canvas) { + return { x: 1, y: 1 }; + } + var desiredPosition = this.inCompositionMode ? this.compositionStart : this.selectionStart, + boundaries = this._getCursorBoundaries(desiredPosition), + cursorLocation = this.get2DCursorLocation(desiredPosition), + lineIndex = cursorLocation.lineIndex, + charIndex = cursorLocation.charIndex, + charHeight = this.getValueOfPropertyAt(lineIndex, charIndex, 'fontSize') * this.lineHeight, + leftOffset = boundaries.leftOffset, + m = this.calcTransformMatrix(), + p = { + x: boundaries.left + leftOffset, + y: boundaries.top + boundaries.topOffset + charHeight + }, + retinaScaling = this.canvas.getRetinaScaling(), + upperCanvas = this.canvas.upperCanvasEl, + upperCanvasWidth = upperCanvas.width / retinaScaling, + upperCanvasHeight = upperCanvas.height / retinaScaling, + maxWidth = upperCanvasWidth - charHeight, + maxHeight = upperCanvasHeight - charHeight, + scaleX = upperCanvas.clientWidth / upperCanvasWidth, + scaleY = upperCanvas.clientHeight / upperCanvasHeight; + + p = fabric.util.transformPoint(p, m); + p = fabric.util.transformPoint(p, this.canvas.viewportTransform); + p.x *= scaleX; + p.y *= scaleY; + if (p.x < 0) { + p.x = 0; + } + if (p.x > maxWidth) { + p.x = maxWidth; + } + if (p.y < 0) { + p.y = 0; + } + if (p.y > maxHeight) { + p.y = maxHeight; + } + + // add canvas offset on document + p.x += this.canvas._offset.left; + p.y += this.canvas._offset.top; + + return { left: p.x + 'px', top: p.y + 'px', fontSize: charHeight + 'px', charHeight: charHeight }; + }, + + /** + * @private + */ + _saveEditingProps: function() { + this._savedProps = { + hasControls: this.hasControls, + borderColor: this.borderColor, + lockMovementX: this.lockMovementX, + lockMovementY: this.lockMovementY, + hoverCursor: this.hoverCursor, + selectable: this.selectable, + defaultCursor: this.canvas && this.canvas.defaultCursor, + moveCursor: this.canvas && this.canvas.moveCursor + }; + }, + + /** + * @private + */ + _restoreEditingProps: function() { + if (!this._savedProps) { + return; + } + + this.hoverCursor = this._savedProps.hoverCursor; + this.hasControls = this._savedProps.hasControls; + this.borderColor = this._savedProps.borderColor; + this.selectable = this._savedProps.selectable; + this.lockMovementX = this._savedProps.lockMovementX; + this.lockMovementY = this._savedProps.lockMovementY; + + if (this.canvas) { + this.canvas.defaultCursor = this._savedProps.defaultCursor; + this.canvas.moveCursor = this._savedProps.moveCursor; + } + }, + + /** + * Exits from editing state + * @return {fabric.IText} thisArg + * @chainable + */ + exitEditing: function() { + var isTextChanged = (this._textBeforeEdit !== this.text); + var hiddenTextarea = this.hiddenTextarea; + this.selected = false; + this.isEditing = false; + + this.selectionEnd = this.selectionStart; + + if (hiddenTextarea) { + hiddenTextarea.blur && hiddenTextarea.blur(); + hiddenTextarea.parentNode && hiddenTextarea.parentNode.removeChild(hiddenTextarea); + } + this.hiddenTextarea = null; + this.abortCursorAnimation(); + this._restoreEditingProps(); + this._currentCursorOpacity = 0; + if (this._shouldClearDimensionCache()) { + this.initDimensions(); + this.setCoords(); + } + this.fire('editing:exited'); + isTextChanged && this.fire('modified'); + if (this.canvas) { + this.canvas.off('mouse:move', this.mouseMoveHandler); + this.canvas.fire('text:editing:exited', { target: this }); + isTextChanged && this.canvas.fire('object:modified', { target: this }); + } + return this; + }, + + /** + * @private + */ + _removeExtraneousStyles: function() { + for (var prop in this.styles) { + if (!this._textLines[prop]) { + delete this.styles[prop]; + } + } + }, + + /** + * remove and reflow a style block from start to end. + * @param {Number} start linear start position for removal (included in removal) + * @param {Number} end linear end position for removal ( excluded from removal ) + */ + removeStyleFromTo: function(start, end) { + var cursorStart = this.get2DCursorLocation(start, true), + cursorEnd = this.get2DCursorLocation(end, true), + lineStart = cursorStart.lineIndex, + charStart = cursorStart.charIndex, + lineEnd = cursorEnd.lineIndex, + charEnd = cursorEnd.charIndex, + i, styleObj; + if (lineStart !== lineEnd) { + // step1 remove the trailing of lineStart + if (this.styles[lineStart]) { + for (i = charStart; i < this._unwrappedTextLines[lineStart].length; i++) { + delete this.styles[lineStart][i]; + } + } + // step2 move the trailing of lineEnd to lineStart if needed + if (this.styles[lineEnd]) { + for (i = charEnd; i < this._unwrappedTextLines[lineEnd].length; i++) { + styleObj = this.styles[lineEnd][i]; + if (styleObj) { + this.styles[lineStart] || (this.styles[lineStart] = { }); + this.styles[lineStart][charStart + i - charEnd] = styleObj; + } + } + } + // step3 detects lines will be completely removed. + for (i = lineStart + 1; i <= lineEnd; i++) { + delete this.styles[i]; + } + // step4 shift remaining lines. + this.shiftLineStyles(lineEnd, lineStart - lineEnd); + } + else { + // remove and shift left on the same line + if (this.styles[lineStart]) { + styleObj = this.styles[lineStart]; + var diff = charEnd - charStart, numericChar, _char; + for (i = charStart; i < charEnd; i++) { + delete styleObj[i]; + } + for (_char in this.styles[lineStart]) { + numericChar = parseInt(_char, 10); + if (numericChar >= charEnd) { + styleObj[numericChar - diff] = styleObj[_char]; + delete styleObj[_char]; + } + } + } + } + }, + + /** + * Shifts line styles up or down + * @param {Number} lineIndex Index of a line + * @param {Number} offset Can any number? + */ + shiftLineStyles: function(lineIndex, offset) { + // shift all line styles by offset upward or downward + // do not clone deep. we need new array, not new style objects + var clonedStyles = clone(this.styles); + for (var line in this.styles) { + var numericLine = parseInt(line, 10); + if (numericLine > lineIndex) { + this.styles[numericLine + offset] = clonedStyles[numericLine]; + if (!clonedStyles[numericLine - offset]) { + delete this.styles[numericLine]; + } + } + } + }, + + restartCursorIfNeeded: function() { + if (!this._currentTickState || this._currentTickState.isAborted + || !this._currentTickCompleteState || this._currentTickCompleteState.isAborted + ) { + this.initDelayedCursor(); + } + }, + + /** + * Handle insertion of more consecutive style lines for when one or more + * newlines gets added to the text. Since current style needs to be shifted + * first we shift the current style of the number lines needed, then we add + * new lines from the last to the first. + * @param {Number} lineIndex Index of a line + * @param {Number} charIndex Index of a char + * @param {Number} qty number of lines to add + * @param {Array} copiedStyle Array of objects styles + */ + insertNewlineStyleObject: function(lineIndex, charIndex, qty, copiedStyle) { + var currentCharStyle, + newLineStyles = {}, + somethingAdded = false, + isEndOfLine = this._unwrappedTextLines[lineIndex].length === charIndex; + + qty || (qty = 1); + this.shiftLineStyles(lineIndex, qty); + if (this.styles[lineIndex]) { + currentCharStyle = this.styles[lineIndex][charIndex === 0 ? charIndex : charIndex - 1]; + } + // we clone styles of all chars + // after cursor onto the current line + for (var index in this.styles[lineIndex]) { + var numIndex = parseInt(index, 10); + if (numIndex >= charIndex) { + somethingAdded = true; + newLineStyles[numIndex - charIndex] = this.styles[lineIndex][index]; + // remove lines from the previous line since they're on a new line now + if (!(isEndOfLine && charIndex === 0)) { + delete this.styles[lineIndex][index]; + } + } + } + var styleCarriedOver = false; + if (somethingAdded && !isEndOfLine) { + // if is end of line, the extra style we copied + // is probably not something we want + this.styles[lineIndex + qty] = newLineStyles; + styleCarriedOver = true; + } + if (styleCarriedOver) { + // skip the last line of since we already prepared it. + qty--; + } + // for the all the lines or all the other lines + // we clone current char style onto the next (otherwise empty) line + while (qty > 0) { + if (copiedStyle && copiedStyle[qty - 1]) { + this.styles[lineIndex + qty] = { 0: clone(copiedStyle[qty - 1]) }; + } + else if (currentCharStyle) { + this.styles[lineIndex + qty] = { 0: clone(currentCharStyle) }; + } + else { + delete this.styles[lineIndex + qty]; + } + qty--; + } + this._forceClearCache = true; + }, + + /** + * Inserts style object for a given line/char index + * @param {Number} lineIndex Index of a line + * @param {Number} charIndex Index of a char + * @param {Number} quantity number Style object to insert, if given + * @param {Array} copiedStyle array of style objects + */ + insertCharStyleObject: function(lineIndex, charIndex, quantity, copiedStyle) { + if (!this.styles) { + this.styles = {}; + } + var currentLineStyles = this.styles[lineIndex], + currentLineStylesCloned = currentLineStyles ? clone(currentLineStyles) : {}; + + quantity || (quantity = 1); + // shift all char styles by quantity forward + // 0,1,2,3 -> (charIndex=2) -> 0,1,3,4 -> (insert 2) -> 0,1,2,3,4 + for (var index in currentLineStylesCloned) { + var numericIndex = parseInt(index, 10); + if (numericIndex >= charIndex) { + currentLineStyles[numericIndex + quantity] = currentLineStylesCloned[numericIndex]; + // only delete the style if there was nothing moved there + if (!currentLineStylesCloned[numericIndex - quantity]) { + delete currentLineStyles[numericIndex]; + } + } + } + this._forceClearCache = true; + if (copiedStyle) { + while (quantity--) { + if (!Object.keys(copiedStyle[quantity]).length) { + continue; + } + if (!this.styles[lineIndex]) { + this.styles[lineIndex] = {}; + } + this.styles[lineIndex][charIndex + quantity] = clone(copiedStyle[quantity]); + } + return; + } + if (!currentLineStyles) { + return; + } + var newStyle = currentLineStyles[charIndex ? charIndex - 1 : 1]; + while (newStyle && quantity--) { + this.styles[lineIndex][charIndex + quantity] = clone(newStyle); + } + }, + + /** + * Inserts style object(s) + * @param {Array} insertedText Characters at the location where style is inserted + * @param {Number} start cursor index for inserting style + * @param {Array} [copiedStyle] array of style objects to insert. + */ + insertNewStyleBlock: function(insertedText, start, copiedStyle) { + var cursorLoc = this.get2DCursorLocation(start, true), + addedLines = [0], linesLength = 0; + // get an array of how many char per lines are being added. + for (var i = 0; i < insertedText.length; i++) { + if (insertedText[i] === '\n') { + linesLength++; + addedLines[linesLength] = 0; + } + else { + addedLines[linesLength]++; + } + } + // for the first line copy the style from the current char position. + if (addedLines[0] > 0) { + this.insertCharStyleObject(cursorLoc.lineIndex, cursorLoc.charIndex, addedLines[0], copiedStyle); + copiedStyle = copiedStyle && copiedStyle.slice(addedLines[0] + 1); + } + linesLength && this.insertNewlineStyleObject( + cursorLoc.lineIndex, cursorLoc.charIndex + addedLines[0], linesLength); + for (var i = 1; i < linesLength; i++) { + if (addedLines[i] > 0) { + this.insertCharStyleObject(cursorLoc.lineIndex + i, 0, addedLines[i], copiedStyle); + } + else if (copiedStyle) { + this.styles[cursorLoc.lineIndex + i][0] = copiedStyle[0]; + } + copiedStyle = copiedStyle && copiedStyle.slice(addedLines[i] + 1); + } + // we use i outside the loop to get it like linesLength + if (addedLines[i] > 0) { + this.insertCharStyleObject(cursorLoc.lineIndex + i, 0, addedLines[i], copiedStyle); + } + }, + + /** + * Set the selectionStart and selectionEnd according to the new position of cursor + * mimic the key - mouse navigation when shift is pressed. + */ + setSelectionStartEndWithShift: function(start, end, newSelection) { + if (newSelection <= start) { + if (end === start) { + this._selectionDirection = 'left'; + } + else if (this._selectionDirection === 'right') { + this._selectionDirection = 'left'; + this.selectionEnd = start; + } + this.selectionStart = newSelection; + } + else if (newSelection > start && newSelection < end) { + if (this._selectionDirection === 'right') { + this.selectionEnd = newSelection; + } + else { + this.selectionStart = newSelection; + } + } + else { + // newSelection is > selection start and end + if (end === start) { + this._selectionDirection = 'right'; + } + else if (this._selectionDirection === 'left') { + this._selectionDirection = 'right'; + this.selectionStart = end; + } + this.selectionEnd = newSelection; + } + }, + + setSelectionInBoundaries: function() { + var length = this.text.length; + if (this.selectionStart > length) { + this.selectionStart = length; + } + else if (this.selectionStart < 0) { + this.selectionStart = 0; + } + if (this.selectionEnd > length) { + this.selectionEnd = length; + } + else if (this.selectionEnd < 0) { + this.selectionEnd = 0; + } + } + }); +})(); +fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ { + /** + * Initializes "dbclick" event handler + */ + initDoubleClickSimulation: function() { + + // for double click + this.__lastClickTime = +new Date(); + + // for triple click + this.__lastLastClickTime = +new Date(); + + this.__lastPointer = { }; + + this.on('mousedown', this.onMouseDown); + }, + + /** + * Default event handler to simulate triple click + * @private + */ + onMouseDown: function(options) { + if (!this.canvas) { + return; + } + this.__newClickTime = +new Date(); + var newPointer = options.pointer; + if (this.isTripleClick(newPointer)) { + this.fire('tripleclick', options); + this._stopEvent(options.e); + } + this.__lastLastClickTime = this.__lastClickTime; + this.__lastClickTime = this.__newClickTime; + this.__lastPointer = newPointer; + this.__lastIsEditing = this.isEditing; + this.__lastSelected = this.selected; + }, + + isTripleClick: function(newPointer) { + return this.__newClickTime - this.__lastClickTime < 500 && + this.__lastClickTime - this.__lastLastClickTime < 500 && + this.__lastPointer.x === newPointer.x && + this.__lastPointer.y === newPointer.y; + }, + + /** + * @private + */ + _stopEvent: function(e) { + e.preventDefault && e.preventDefault(); + e.stopPropagation && e.stopPropagation(); + }, + + /** + * Initializes event handlers related to cursor or selection + */ + initCursorSelectionHandlers: function() { + this.initMousedownHandler(); + this.initMouseupHandler(); + this.initClicks(); + }, + + /** + * Default handler for double click, select a word + */ + doubleClickHandler: function(options) { + if (!this.isEditing) { + return; + } + this.selectWord(this.getSelectionStartFromPointer(options.e)); + }, + + /** + * Default handler for triple click, select a line + */ + tripleClickHandler: function(options) { + if (!this.isEditing) { + return; + } + this.selectLine(this.getSelectionStartFromPointer(options.e)); + }, + + /** + * Initializes double and triple click event handlers + */ + initClicks: function() { + this.on('mousedblclick', this.doubleClickHandler); + this.on('tripleclick', this.tripleClickHandler); + }, + + /** + * Default event handler for the basic functionalities needed on _mouseDown + * can be overridden to do something different. + * Scope of this implementation is: find the click position, set selectionStart + * find selectionEnd, initialize the drawing of either cursor or selection area + * initializing a mousedDown on a text area will cancel fabricjs knowledge of + * current compositionMode. It will be set to false. + */ + _mouseDownHandler: function(options) { + if (!this.canvas || !this.editable || (options.e.button && options.e.button !== 1)) { + return; + } + + this.__isMousedown = true; + + if (this.selected) { + this.inCompositionMode = false; + this.setCursorByClick(options.e); + } + + if (this.isEditing) { + this.__selectionStartOnMouseDown = this.selectionStart; + if (this.selectionStart === this.selectionEnd) { + this.abortCursorAnimation(); + } + this.renderCursorOrSelection(); + } + }, + + /** + * Default event handler for the basic functionalities needed on mousedown:before + * can be overridden to do something different. + * Scope of this implementation is: verify the object is already selected when mousing down + */ + _mouseDownHandlerBefore: function(options) { + if (!this.canvas || !this.editable || (options.e.button && options.e.button !== 1)) { + return; + } + // we want to avoid that an object that was selected and then becomes unselectable, + // may trigger editing mode in some way. + this.selected = this === this.canvas._activeObject; + }, + + /** + * Initializes "mousedown" event handler + */ + initMousedownHandler: function() { + this.on('mousedown', this._mouseDownHandler); + this.on('mousedown:before', this._mouseDownHandlerBefore); + }, + + /** + * Initializes "mouseup" event handler + */ + initMouseupHandler: function() { + this.on('mouseup', this.mouseUpHandler); + }, + + /** + * standard hander for mouse up, overridable + * @private + */ + mouseUpHandler: function(options) { + this.__isMousedown = false; + if (!this.editable || this.group || + (options.transform && options.transform.actionPerformed) || + (options.e.button && options.e.button !== 1)) { + return; + } + + if (this.canvas) { + var currentActive = this.canvas._activeObject; + if (currentActive && currentActive !== this) { + // avoid running this logic when there is an active object + // this because is possible with shift click and fast clicks, + // to rapidly deselect and reselect this object and trigger an enterEdit + return; + } + } + + if (this.__lastSelected && !this.__corner) { + this.selected = false; + this.__lastSelected = false; + this.enterEditing(options.e); + if (this.selectionStart === this.selectionEnd) { + this.initDelayedCursor(true); + } + else { + this.renderCursorOrSelection(); + } + } + else { + this.selected = true; + } + }, + + /** + * Changes cursor location in a text depending on passed pointer (x/y) object + * @param {Event} e Event object + */ + setCursorByClick: function(e) { + var newSelection = this.getSelectionStartFromPointer(e), + start = this.selectionStart, end = this.selectionEnd; + if (e.shiftKey) { + this.setSelectionStartEndWithShift(start, end, newSelection); + } + else { + this.selectionStart = newSelection; + this.selectionEnd = newSelection; + } + if (this.isEditing) { + this._fireSelectionChanged(); + this._updateTextarea(); + } + }, + + /** + * Returns index of a character corresponding to where an object was clicked + * @param {Event} e Event object + * @return {Number} Index of a character + */ + getSelectionStartFromPointer: function(e) { + var mouseOffset = this.getLocalPointer(e), + prevWidth = 0, + width = 0, + height = 0, + charIndex = 0, + lineIndex = 0, + lineLeftOffset, + line; + + for (var i = 0, len = this._textLines.length; i < len; i++) { + if (height <= mouseOffset.y) { + height += this.getHeightOfLine(i) * this.scaleY; + lineIndex = i; + if (i > 0) { + charIndex += this._textLines[i - 1].length + this.missingNewlineOffset(i - 1); + } + } + else { + break; + } + } + lineLeftOffset = this._getLineLeftOffset(lineIndex); + width = lineLeftOffset * this.scaleX; + line = this._textLines[lineIndex]; + for (var j = 0, jlen = line.length; j < jlen; j++) { + prevWidth = width; + // i removed something about flipX here, check. + width += this.__charBounds[lineIndex][j].kernedWidth * this.scaleX; + if (width <= mouseOffset.x) { + charIndex++; + } + else { + break; + } + } + return this._getNewSelectionStartFromOffset(mouseOffset, prevWidth, width, charIndex, jlen); + }, + + /** + * @private + */ + _getNewSelectionStartFromOffset: function(mouseOffset, prevWidth, width, index, jlen) { + // we need Math.abs because when width is after the last char, the offset is given as 1, while is 0 + var distanceBtwLastCharAndCursor = mouseOffset.x - prevWidth, + distanceBtwNextCharAndCursor = width - mouseOffset.x, + offset = distanceBtwNextCharAndCursor > distanceBtwLastCharAndCursor || + distanceBtwNextCharAndCursor < 0 ? 0 : 1, + newSelectionStart = index + offset; + // if object is horizontally flipped, mirror cursor location from the end + if (this.flipX) { + newSelectionStart = jlen - newSelectionStart; + } + + if (newSelectionStart > this._text.length) { + newSelectionStart = this._text.length; + } + + return newSelectionStart; + } +}); +fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ { + + /** + * Initializes hidden textarea (needed to bring up keyboard in iOS) + */ + initHiddenTextarea: function() { + this.hiddenTextarea = fabric.document.createElement('textarea'); + this.hiddenTextarea.setAttribute('autocapitalize', 'off'); + this.hiddenTextarea.setAttribute('autocorrect', 'off'); + this.hiddenTextarea.setAttribute('autocomplete', 'off'); + this.hiddenTextarea.setAttribute('spellcheck', 'false'); + this.hiddenTextarea.setAttribute('data-fabric-hiddentextarea', ''); + this.hiddenTextarea.setAttribute('wrap', 'off'); + var style = this._calcTextareaPosition(); + // line-height: 1px; was removed from the style to fix this: + // https://bugs.chromium.org/p/chromium/issues/detail?id=870966 + this.hiddenTextarea.style.cssText = 'position: absolute; top: ' + style.top + + '; left: ' + style.left + '; z-index: -999; opacity: 0; width: 1px; height: 1px; font-size: 1px;' + + ' paddingーtop: ' + style.fontSize + ';'; + fabric.document.body.appendChild(this.hiddenTextarea); + + fabric.util.addListener(this.hiddenTextarea, 'keydown', this.onKeyDown.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'keyup', this.onKeyUp.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'input', this.onInput.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'copy', this.copy.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'cut', this.copy.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'paste', this.paste.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'compositionstart', this.onCompositionStart.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'compositionupdate', this.onCompositionUpdate.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'compositionend', this.onCompositionEnd.bind(this)); + + if (!this._clickHandlerInitialized && this.canvas) { + fabric.util.addListener(this.canvas.upperCanvasEl, 'click', this.onClick.bind(this)); + this._clickHandlerInitialized = true; + } + }, + + /** + * For functionalities on keyDown + * Map a special key to a function of the instance/prototype + * If you need different behaviour for ESC or TAB or arrows, you have to change + * this map setting the name of a function that you build on the fabric.Itext or + * your prototype. + * the map change will affect all Instances unless you need for only some text Instances + * in that case you have to clone this object and assign your Instance. + * this.keysMap = fabric.util.object.clone(this.keysMap); + * The function must be in fabric.Itext.prototype.myFunction And will receive event as args[0] + */ + keysMap: { + 9: 'exitEditing', + 27: 'exitEditing', + 33: 'moveCursorUp', + 34: 'moveCursorDown', + 35: 'moveCursorRight', + 36: 'moveCursorLeft', + 37: 'moveCursorLeft', + 38: 'moveCursorUp', + 39: 'moveCursorRight', + 40: 'moveCursorDown', + }, + + /** + * For functionalities on keyUp + ctrl || cmd + */ + ctrlKeysMapUp: { + 67: 'copy', + 88: 'cut' + }, + + /** + * For functionalities on keyDown + ctrl || cmd + */ + ctrlKeysMapDown: { + 65: 'selectAll' + }, + + onClick: function() { + // No need to trigger click event here, focus is enough to have the keyboard appear on Android + this.hiddenTextarea && this.hiddenTextarea.focus(); + }, + + /** + * Handles keydown event + * only used for arrows and combination of modifier keys. + * @param {Event} e Event object + */ + onKeyDown: function(e) { + if (!this.isEditing) { + return; + } + if (e.keyCode in this.keysMap) { + this[this.keysMap[e.keyCode]](e); + } + else if ((e.keyCode in this.ctrlKeysMapDown) && (e.ctrlKey || e.metaKey)) { + this[this.ctrlKeysMapDown[e.keyCode]](e); + } + else { + return; + } + e.stopImmediatePropagation(); + e.preventDefault(); + if (e.keyCode >= 33 && e.keyCode <= 40) { + // if i press an arrow key just update selection + this.inCompositionMode = false; + this.clearContextTop(); + this.renderCursorOrSelection(); + } + else { + this.canvas && this.canvas.requestRenderAll(); + } + }, + + /** + * Handles keyup event + * We handle KeyUp because ie11 and edge have difficulties copy/pasting + * if a copy/cut event fired, keyup is dismissed + * @param {Event} e Event object + */ + onKeyUp: function(e) { + if (!this.isEditing || this._copyDone || this.inCompositionMode) { + this._copyDone = false; + return; + } + if ((e.keyCode in this.ctrlKeysMapUp) && (e.ctrlKey || e.metaKey)) { + this[this.ctrlKeysMapUp[e.keyCode]](e); + } + else { + return; + } + e.stopImmediatePropagation(); + e.preventDefault(); + this.canvas && this.canvas.requestRenderAll(); + }, + + /** + * Handles onInput event + * @param {Event} e Event object + */ + onInput: function(e) { + var fromPaste = this.fromPaste; + this.fromPaste = false; + e && e.stopPropagation(); + if (!this.isEditing) { + return; + } + // decisions about style changes. + var nextText = this._splitTextIntoLines(this.hiddenTextarea.value).graphemeText, + charCount = this._text.length, + nextCharCount = nextText.length, + removedText, insertedText, + charDiff = nextCharCount - charCount, + selectionStart = this.selectionStart, selectionEnd = this.selectionEnd, + selection = selectionStart !== selectionEnd, + copiedStyle, removeFrom, removeTo; + if (this.hiddenTextarea.value === '') { + this.styles = { }; + this.updateFromTextArea(); + this.fire('changed'); + if (this.canvas) { + this.canvas.fire('text:changed', { target: this }); + this.canvas.requestRenderAll(); + } + return; + } + + var textareaSelection = this.fromStringToGraphemeSelection( + this.hiddenTextarea.selectionStart, + this.hiddenTextarea.selectionEnd, + this.hiddenTextarea.value + ); + var backDelete = selectionStart > textareaSelection.selectionStart; + + if (selection) { + removedText = this._text.slice(selectionStart, selectionEnd); + charDiff += selectionEnd - selectionStart; + } + else if (nextCharCount < charCount) { + if (backDelete) { + removedText = this._text.slice(selectionEnd + charDiff, selectionEnd); + } + else { + removedText = this._text.slice(selectionStart, selectionStart - charDiff); + } + } + insertedText = nextText.slice(textareaSelection.selectionEnd - charDiff, textareaSelection.selectionEnd); + if (removedText && removedText.length) { + if (insertedText.length) { + // let's copy some style before deleting. + // we want to copy the style before the cursor OR the style at the cursor if selection + // is bigger than 0. + copiedStyle = this.getSelectionStyles(selectionStart, selectionStart + 1, false); + // now duplicate the style one for each inserted text. + copiedStyle = insertedText.map(function() { + // this return an array of references, but that is fine since we are + // copying the style later. + return copiedStyle[0]; + }); + } + if (selection) { + removeFrom = selectionStart; + removeTo = selectionEnd; + } + else if (backDelete) { + // detect differencies between forwardDelete and backDelete + removeFrom = selectionEnd - removedText.length; + removeTo = selectionEnd; + } + else { + removeFrom = selectionEnd; + removeTo = selectionEnd + removedText.length; + } + this.removeStyleFromTo(removeFrom, removeTo); + } + if (insertedText.length) { + if (fromPaste && insertedText.join('') === fabric.copiedText && !fabric.disableStyleCopyPaste) { + copiedStyle = fabric.copiedTextStyle; + } + this.insertNewStyleBlock(insertedText, selectionStart, copiedStyle); + } + this.updateFromTextArea(); + this.fire('changed'); + if (this.canvas) { + this.canvas.fire('text:changed', { target: this }); + this.canvas.requestRenderAll(); + } + }, + /** + * Composition start + */ + onCompositionStart: function() { + this.inCompositionMode = true; + }, + + /** + * Composition end + */ + onCompositionEnd: function() { + this.inCompositionMode = false; + }, + + // /** + // * Composition update + // */ + onCompositionUpdate: function(e) { + this.compositionStart = e.target.selectionStart; + this.compositionEnd = e.target.selectionEnd; + this.updateTextareaPosition(); + }, + + /** + * Copies selected text + * @param {Event} e Event object + */ + copy: function() { + if (this.selectionStart === this.selectionEnd) { + //do not cut-copy if no selection + return; + } + + fabric.copiedText = this.getSelectedText(); + if (!fabric.disableStyleCopyPaste) { + fabric.copiedTextStyle = this.getSelectionStyles(this.selectionStart, this.selectionEnd, true); + } + else { + fabric.copiedTextStyle = null; + } + this._copyDone = true; + }, + + /** + * Pastes text + * @param {Event} e Event object + */ + paste: function() { + this.fromPaste = true; + }, + + /** + * @private + * @param {Event} e Event object + * @return {Object} Clipboard data object + */ + _getClipboardData: function(e) { + return (e && e.clipboardData) || fabric.window.clipboardData; + }, + + /** + * Finds the width in pixels before the cursor on the same line + * @private + * @param {Number} lineIndex + * @param {Number} charIndex + * @return {Number} widthBeforeCursor width before cursor + */ + _getWidthBeforeCursor: function(lineIndex, charIndex) { + var widthBeforeCursor = this._getLineLeftOffset(lineIndex), bound; + + if (charIndex > 0) { + bound = this.__charBounds[lineIndex][charIndex - 1]; + widthBeforeCursor += bound.left + bound.width; + } + return widthBeforeCursor; + }, + + /** + * Gets start offset of a selection + * @param {Event} e Event object + * @param {Boolean} isRight + * @return {Number} + */ + getDownCursorOffset: function(e, isRight) { + var selectionProp = this._getSelectionForOffset(e, isRight), + cursorLocation = this.get2DCursorLocation(selectionProp), + lineIndex = cursorLocation.lineIndex; + // if on last line, down cursor goes to end of line + if (lineIndex === this._textLines.length - 1 || e.metaKey || e.keyCode === 34) { + // move to the end of a text + return this._text.length - selectionProp; + } + var charIndex = cursorLocation.charIndex, + widthBeforeCursor = this._getWidthBeforeCursor(lineIndex, charIndex), + indexOnOtherLine = this._getIndexOnLine(lineIndex + 1, widthBeforeCursor), + textAfterCursor = this._textLines[lineIndex].slice(charIndex); + return textAfterCursor.length + indexOnOtherLine + 1 + this.missingNewlineOffset(lineIndex); + }, + + /** + * private + * Helps finding if the offset should be counted from Start or End + * @param {Event} e Event object + * @param {Boolean} isRight + * @return {Number} + */ + _getSelectionForOffset: function(e, isRight) { + if (e.shiftKey && this.selectionStart !== this.selectionEnd && isRight) { + return this.selectionEnd; + } + else { + return this.selectionStart; + } + }, + + /** + * @param {Event} e Event object + * @param {Boolean} isRight + * @return {Number} + */ + getUpCursorOffset: function(e, isRight) { + var selectionProp = this._getSelectionForOffset(e, isRight), + cursorLocation = this.get2DCursorLocation(selectionProp), + lineIndex = cursorLocation.lineIndex; + if (lineIndex === 0 || e.metaKey || e.keyCode === 33) { + // if on first line, up cursor goes to start of line + return -selectionProp; + } + var charIndex = cursorLocation.charIndex, + widthBeforeCursor = this._getWidthBeforeCursor(lineIndex, charIndex), + indexOnOtherLine = this._getIndexOnLine(lineIndex - 1, widthBeforeCursor), + textBeforeCursor = this._textLines[lineIndex].slice(0, charIndex), + missingNewlineOffset = this.missingNewlineOffset(lineIndex - 1); + // return a negative offset + return -this._textLines[lineIndex - 1].length + + indexOnOtherLine - textBeforeCursor.length + (1 - missingNewlineOffset); + }, + + /** + * for a given width it founds the matching character. + * @private + */ + _getIndexOnLine: function(lineIndex, width) { + + var line = this._textLines[lineIndex], + lineLeftOffset = this._getLineLeftOffset(lineIndex), + widthOfCharsOnLine = lineLeftOffset, + indexOnLine = 0, charWidth, foundMatch; + + for (var j = 0, jlen = line.length; j < jlen; j++) { + charWidth = this.__charBounds[lineIndex][j].width; + widthOfCharsOnLine += charWidth; + if (widthOfCharsOnLine > width) { + foundMatch = true; + var leftEdge = widthOfCharsOnLine - charWidth, + rightEdge = widthOfCharsOnLine, + offsetFromLeftEdge = Math.abs(leftEdge - width), + offsetFromRightEdge = Math.abs(rightEdge - width); + + indexOnLine = offsetFromRightEdge < offsetFromLeftEdge ? j : (j - 1); + break; + } + } + + // reached end + if (!foundMatch) { + indexOnLine = line.length - 1; + } + + return indexOnLine; + }, + + + /** + * Moves cursor down + * @param {Event} e Event object + */ + moveCursorDown: function(e) { + if (this.selectionStart >= this._text.length && this.selectionEnd >= this._text.length) { + return; + } + this._moveCursorUpOrDown('Down', e); + }, + + /** + * Moves cursor up + * @param {Event} e Event object + */ + moveCursorUp: function(e) { + if (this.selectionStart === 0 && this.selectionEnd === 0) { + return; + } + this._moveCursorUpOrDown('Up', e); + }, + + /** + * Moves cursor up or down, fires the events + * @param {String} direction 'Up' or 'Down' + * @param {Event} e Event object + */ + _moveCursorUpOrDown: function(direction, e) { + // getUpCursorOffset + // getDownCursorOffset + var action = 'get' + direction + 'CursorOffset', + offset = this[action](e, this._selectionDirection === 'right'); + if (e.shiftKey) { + this.moveCursorWithShift(offset); + } + else { + this.moveCursorWithoutShift(offset); + } + if (offset !== 0) { + this.setSelectionInBoundaries(); + this.abortCursorAnimation(); + this._currentCursorOpacity = 1; + this.initDelayedCursor(); + this._fireSelectionChanged(); + this._updateTextarea(); + } + }, + + /** + * Moves cursor with shift + * @param {Number} offset + */ + moveCursorWithShift: function(offset) { + var newSelection = this._selectionDirection === 'left' + ? this.selectionStart + offset + : this.selectionEnd + offset; + this.setSelectionStartEndWithShift(this.selectionStart, this.selectionEnd, newSelection); + return offset !== 0; + }, + + /** + * Moves cursor up without shift + * @param {Number} offset + */ + moveCursorWithoutShift: function(offset) { + if (offset < 0) { + this.selectionStart += offset; + this.selectionEnd = this.selectionStart; + } + else { + this.selectionEnd += offset; + this.selectionStart = this.selectionEnd; + } + return offset !== 0; + }, + + /** + * Moves cursor left + * @param {Event} e Event object + */ + moveCursorLeft: function(e) { + if (this.selectionStart === 0 && this.selectionEnd === 0) { + return; + } + this._moveCursorLeftOrRight('Left', e); + }, + + /** + * @private + * @return {Boolean} true if a change happened + */ + _move: function(e, prop, direction) { + var newValue; + if (e.altKey) { + newValue = this['findWordBoundary' + direction](this[prop]); + } + else if (e.metaKey || e.keyCode === 35 || e.keyCode === 36 ) { + newValue = this['findLineBoundary' + direction](this[prop]); + } + else { + this[prop] += direction === 'Left' ? -1 : 1; + return true; + } + if (typeof newValue !== undefined && this[prop] !== newValue) { + this[prop] = newValue; + return true; + } + }, + + /** + * @private + */ + _moveLeft: function(e, prop) { + return this._move(e, prop, 'Left'); + }, + + /** + * @private + */ + _moveRight: function(e, prop) { + return this._move(e, prop, 'Right'); + }, + + /** + * Moves cursor left without keeping selection + * @param {Event} e + */ + moveCursorLeftWithoutShift: function(e) { + var change = true; + this._selectionDirection = 'left'; + + // only move cursor when there is no selection, + // otherwise we discard it, and leave cursor on same place + if (this.selectionEnd === this.selectionStart && this.selectionStart !== 0) { + change = this._moveLeft(e, 'selectionStart'); + + } + this.selectionEnd = this.selectionStart; + return change; + }, + + /** + * Moves cursor left while keeping selection + * @param {Event} e + */ + moveCursorLeftWithShift: function(e) { + if (this._selectionDirection === 'right' && this.selectionStart !== this.selectionEnd) { + return this._moveLeft(e, 'selectionEnd'); + } + else if (this.selectionStart !== 0){ + this._selectionDirection = 'left'; + return this._moveLeft(e, 'selectionStart'); + } + }, + + /** + * Moves cursor right + * @param {Event} e Event object + */ + moveCursorRight: function(e) { + if (this.selectionStart >= this._text.length && this.selectionEnd >= this._text.length) { + return; + } + this._moveCursorLeftOrRight('Right', e); + }, + + /** + * Moves cursor right or Left, fires event + * @param {String} direction 'Left', 'Right' + * @param {Event} e Event object + */ + _moveCursorLeftOrRight: function(direction, e) { + var actionName = 'moveCursor' + direction + 'With'; + this._currentCursorOpacity = 1; + + if (e.shiftKey) { + actionName += 'Shift'; + } + else { + actionName += 'outShift'; + } + if (this[actionName](e)) { + this.abortCursorAnimation(); + this.initDelayedCursor(); + this._fireSelectionChanged(); + this._updateTextarea(); + } + }, + + /** + * Moves cursor right while keeping selection + * @param {Event} e + */ + moveCursorRightWithShift: function(e) { + if (this._selectionDirection === 'left' && this.selectionStart !== this.selectionEnd) { + return this._moveRight(e, 'selectionStart'); + } + else if (this.selectionEnd !== this._text.length) { + this._selectionDirection = 'right'; + return this._moveRight(e, 'selectionEnd'); + } + }, + + /** + * Moves cursor right without keeping selection + * @param {Event} e Event object + */ + moveCursorRightWithoutShift: function(e) { + var changed = true; + this._selectionDirection = 'right'; + + if (this.selectionStart === this.selectionEnd) { + changed = this._moveRight(e, 'selectionStart'); + this.selectionEnd = this.selectionStart; + } + else { + this.selectionStart = this.selectionEnd; + } + return changed; + }, + + /** + * Removes characters from start/end + * start/end ar per grapheme position in _text array. + * + * @param {Number} start + * @param {Number} end default to start + 1 + */ + removeChars: function(start, end) { + if (typeof end === 'undefined') { + end = start + 1; + } + this.removeStyleFromTo(start, end); + this._text.splice(start, end - start); + this.text = this._text.join(''); + this.set('dirty', true); + if (this._shouldClearDimensionCache()) { + this.initDimensions(); + this.setCoords(); + } + this._removeExtraneousStyles(); + }, + + /** + * insert characters at start position, before start position. + * start equal 1 it means the text get inserted between actual grapheme 0 and 1 + * if style array is provided, it must be as the same length of text in graphemes + * if end is provided and is bigger than start, old text is replaced. + * start/end ar per grapheme position in _text array. + * + * @param {String} text text to insert + * @param {Array} style array of style objects + * @param {Number} start + * @param {Number} end default to start + 1 + */ + insertChars: function(text, style, start, end) { + if (typeof end === 'undefined') { + end = start; + } + if (end > start) { + this.removeStyleFromTo(start, end); + } + var graphemes = fabric.util.string.graphemeSplit(text); + this.insertNewStyleBlock(graphemes, start, style); + this._text = [].concat(this._text.slice(0, start), graphemes, this._text.slice(end)); + this.text = this._text.join(''); + this.set('dirty', true); + if (this._shouldClearDimensionCache()) { + this.initDimensions(); + this.setCoords(); + } + this._removeExtraneousStyles(); + }, + +}); +/* _TO_SVG_START_ */ +(function() { + var toFixed = fabric.util.toFixed, + multipleSpacesRegex = / +/g; + + fabric.util.object.extend(fabric.Text.prototype, /** @lends fabric.Text.prototype */ { + + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + _toSVG: function() { + var offsets = this._getSVGLeftTopOffsets(), + textAndBg = this._getSVGTextAndBg(offsets.textTop, offsets.textLeft); + return this._wrapSVGTextAndBg(textAndBg); + }, + + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + return this._createBaseSVGMarkup( + this._toSVG(), + { reviver: reviver, noStyle: true, withShadow: true } + ); + }, + + /** + * @private + */ + _getSVGLeftTopOffsets: function() { + return { + textLeft: -this.width / 2, + textTop: -this.height / 2, + lineTop: this.getHeightOfLine(0) + }; + }, + + /** + * @private + */ + _wrapSVGTextAndBg: function(textAndBg) { + var noShadow = true, + textDecoration = this.getSvgTextDecoration(this); + return [ + textAndBg.textBgRects.join(''), + '\t\t', + textAndBg.textSpans.join(''), + '\n' + ]; + }, + + /** + * @private + * @param {Number} textTopOffset Text top offset + * @param {Number} textLeftOffset Text left offset + * @return {Object} + */ + _getSVGTextAndBg: function(textTopOffset, textLeftOffset) { + var textSpans = [], + textBgRects = [], + height = textTopOffset, lineOffset; + // bounding-box background + this._setSVGBg(textBgRects); + + // text and text-background + for (var i = 0, len = this._textLines.length; i < len; i++) { + lineOffset = this._getLineLeftOffset(i); + if (this.textBackgroundColor || this.styleHas('textBackgroundColor', i)) { + this._setSVGTextLineBg(textBgRects, i, textLeftOffset + lineOffset, height); + } + this._setSVGTextLineText(textSpans, i, textLeftOffset + lineOffset, height); + height += this.getHeightOfLine(i); + } + + return { + textSpans: textSpans, + textBgRects: textBgRects + }; + }, + + /** + * @private + */ + _createTextCharSpan: function(_char, styleDecl, left, top) { + var shouldUseWhitespace = _char !== _char.trim() || _char.match(multipleSpacesRegex), + styleProps = this.getSvgSpanStyles(styleDecl, shouldUseWhitespace), + fillStyles = styleProps ? 'style="' + styleProps + '"' : '', + dy = styleDecl.deltaY, dySpan = '', + NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS; + if (dy) { + dySpan = ' dy="' + toFixed(dy, NUM_FRACTION_DIGITS) + '" '; + } + return [ + '', + fabric.util.string.escapeXml(_char), + '' + ].join(''); + }, + + _setSVGTextLineText: function(textSpans, lineIndex, textLeftOffset, textTopOffset) { + // set proper line offset + var lineHeight = this.getHeightOfLine(lineIndex), + isJustify = this.textAlign.indexOf('justify') !== -1, + actualStyle, + nextStyle, + charsToRender = '', + charBox, style, + boxWidth = 0, + line = this._textLines[lineIndex], + timeToRender; + + textTopOffset += lineHeight * (1 - this._fontSizeFraction) / this.lineHeight; + for (var i = 0, len = line.length - 1; i <= len; i++) { + timeToRender = i === len || this.charSpacing; + charsToRender += line[i]; + charBox = this.__charBounds[lineIndex][i]; + if (boxWidth === 0) { + textLeftOffset += charBox.kernedWidth - charBox.width; + boxWidth += charBox.width; + } + else { + boxWidth += charBox.kernedWidth; + } + if (isJustify && !timeToRender) { + if (this._reSpaceAndTab.test(line[i])) { + timeToRender = true; + } + } + if (!timeToRender) { + // if we have charSpacing, we render char by char + actualStyle = actualStyle || this.getCompleteStyleDeclaration(lineIndex, i); + nextStyle = this.getCompleteStyleDeclaration(lineIndex, i + 1); + timeToRender = this._hasStyleChangedForSvg(actualStyle, nextStyle); + } + if (timeToRender) { + style = this._getStyleDeclaration(lineIndex, i) || { }; + textSpans.push(this._createTextCharSpan(charsToRender, style, textLeftOffset, textTopOffset)); + charsToRender = ''; + actualStyle = nextStyle; + textLeftOffset += boxWidth; + boxWidth = 0; + } + } + }, + + _pushTextBgRect: function(textBgRects, color, left, top, width, height) { + var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS; + textBgRects.push( + '\t\t\n'); + }, + + _setSVGTextLineBg: function(textBgRects, i, leftOffset, textTopOffset) { + var line = this._textLines[i], + heightOfLine = this.getHeightOfLine(i) / this.lineHeight, + boxWidth = 0, + boxStart = 0, + charBox, currentColor, + lastColor = this.getValueOfPropertyAt(i, 0, 'textBackgroundColor'); + for (var j = 0, jlen = line.length; j < jlen; j++) { + charBox = this.__charBounds[i][j]; + currentColor = this.getValueOfPropertyAt(i, j, 'textBackgroundColor'); + if (currentColor !== lastColor) { + lastColor && this._pushTextBgRect(textBgRects, lastColor, leftOffset + boxStart, + textTopOffset, boxWidth, heightOfLine); + boxStart = charBox.left; + boxWidth = charBox.width; + lastColor = currentColor; + } + else { + boxWidth += charBox.kernedWidth; + } + } + currentColor && this._pushTextBgRect(textBgRects, currentColor, leftOffset + boxStart, + textTopOffset, boxWidth, heightOfLine); + }, + + /** + * Adobe Illustrator (at least CS5) is unable to render rgba()-based fill values + * we work around it by "moving" alpha channel into opacity attribute and setting fill's alpha to 1 + * + * @private + * @param {*} value + * @return {String} + */ + _getFillAttributes: function(value) { + var fillColor = (value && typeof value === 'string') ? new fabric.Color(value) : ''; + if (!fillColor || !fillColor.getSource() || fillColor.getAlpha() === 1) { + return 'fill="' + value + '"'; + } + return 'opacity="' + fillColor.getAlpha() + '" fill="' + fillColor.setAlpha(1).toRgb() + '"'; + }, + + /** + * @private + */ + _getSVGLineTopOffset: function(lineIndex) { + var lineTopOffset = 0, lastHeight = 0; + for (var j = 0; j < lineIndex; j++) { + lineTopOffset += this.getHeightOfLine(j); + } + lastHeight = this.getHeightOfLine(j); + return { + lineTop: lineTopOffset, + offset: (this._fontSizeMult - this._fontSizeFraction) * lastHeight / (this.lineHeight * this._fontSizeMult) + }; + }, + + /** + * Returns styles-string for svg-export + * @param {Boolean} skipShadow a boolean to skip shadow filter output + * @return {String} + */ + getSvgStyles: function(skipShadow) { + var svgStyle = fabric.Object.prototype.getSvgStyles.call(this, skipShadow); + return svgStyle + ' white-space: pre;'; + }, + }); +})(); +/* _TO_SVG_END_ */ +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = {}); + + /** + * Textbox class, based on IText, allows the user to resize the text rectangle + * and wraps lines automatically. Textboxes have their Y scaling locked, the + * user can only change width. Height is adjusted automatically based on the + * wrapping of lines. + * @class fabric.Textbox + * @extends fabric.IText + * @mixes fabric.Observable + * @return {fabric.Textbox} thisArg + * @see {@link fabric.Textbox#initialize} for constructor definition + */ + fabric.Textbox = fabric.util.createClass(fabric.IText, fabric.Observable, { + + /** + * Type of an object + * @type String + * @default + */ + type: 'textbox', + + /** + * Minimum width of textbox, in pixels. + * @type Number + * @default + */ + minWidth: 20, + + /** + * Minimum calculated width of a textbox, in pixels. + * fixed to 2 so that an empty textbox cannot go to 0 + * and is still selectable without text. + * @type Number + * @default + */ + dynamicMinWidth: 2, + + /** + * Cached array of text wrapping. + * @type Array + */ + __cachedLines: null, + + /** + * Override standard Object class values + */ + lockScalingFlip: true, + + /** + * Override standard Object class values + * Textbox needs this on false + */ + noScaleCache: false, + + /** + * Properties which when set cause object to change dimensions + * @type Object + * @private + */ + _dimensionAffectingProps: fabric.Text.prototype._dimensionAffectingProps.concat('width'), + + /** + * Use this regular expression to split strings in breakable lines + * @private + */ + _wordJoiners: /[ \t\r]/, + + /** + * Use this boolean property in order to split strings that have no white space concept. + * this is a cheap way to help with chinese/japaense + * @type Boolean + * @since 2.6.0 + */ + splitByGrapheme: false, + + /** + * Unlike superclass's version of this function, Textbox does not update + * its width. + * @private + * @override + */ + initDimensions: function() { + if (this.__skipDimension) { + return; + } + this.isEditing && this.initDelayedCursor(); + this.clearContextTop(); + this._clearCache(); + // clear dynamicMinWidth as it will be different after we re-wrap line + this.dynamicMinWidth = 0; + // wrap lines + this._styleMap = this._generateStyleMap(this._splitText()); + // if after wrapping, the width is smaller than dynamicMinWidth, change the width and re-wrap + if (this.dynamicMinWidth > this.width) { + this._set('width', this.dynamicMinWidth); + } + if (this.textAlign.indexOf('justify') !== -1) { + // once text is measured we need to make space fatter to make justified text. + this.enlargeSpaces(); + } + // clear cache and re-calculate height + this.height = this.calcTextHeight(); + this.saveState({ propertySet: '_dimensionAffectingProps' }); + }, + + /** + * Generate an object that translates the style object so that it is + * broken up by visual lines (new lines and automatic wrapping). + * The original text styles object is broken up by actual lines (new lines only), + * which is only sufficient for Text / IText + * @private + */ + _generateStyleMap: function(textInfo) { + var realLineCount = 0, + realLineCharCount = 0, + charCount = 0, + map = {}; + + for (var i = 0; i < textInfo.graphemeLines.length; i++) { + if (textInfo.graphemeText[charCount] === '\n' && i > 0) { + realLineCharCount = 0; + charCount++; + realLineCount++; + } + else if (!this.splitByGrapheme && this._reSpaceAndTab.test(textInfo.graphemeText[charCount]) && i > 0) { + // this case deals with space's that are removed from end of lines when wrapping + realLineCharCount++; + charCount++; + } + + map[i] = { line: realLineCount, offset: realLineCharCount }; + + charCount += textInfo.graphemeLines[i].length; + realLineCharCount += textInfo.graphemeLines[i].length; + } + + return map; + }, + + /** + * Returns true if object has a style property or has it on a specified line + * @param {Number} lineIndex + * @return {Boolean} + */ + styleHas: function(property, lineIndex) { + if (this._styleMap && !this.isWrapping) { + var map = this._styleMap[lineIndex]; + if (map) { + lineIndex = map.line; + } + } + return fabric.Text.prototype.styleHas.call(this, property, lineIndex); + }, + + /** + * Returns true if object has no styling or no styling in a line + * @param {Number} lineIndex , lineIndex is on wrapped lines. + * @return {Boolean} + */ + isEmptyStyles: function(lineIndex) { + if (!this.styles) { + return true; + } + var offset = 0, nextLineIndex = lineIndex + 1, nextOffset, obj, shouldLimit = false, + map = this._styleMap[lineIndex], mapNextLine = this._styleMap[lineIndex + 1]; + if (map) { + lineIndex = map.line; + offset = map.offset; + } + if (mapNextLine) { + nextLineIndex = mapNextLine.line; + shouldLimit = nextLineIndex === lineIndex; + nextOffset = mapNextLine.offset; + } + obj = typeof lineIndex === 'undefined' ? this.styles : { line: this.styles[lineIndex] }; + for (var p1 in obj) { + for (var p2 in obj[p1]) { + if (p2 >= offset && (!shouldLimit || p2 < nextOffset)) { + // eslint-disable-next-line no-unused-vars + for (var p3 in obj[p1][p2]) { + return false; + } + } + } + } + return true; + }, + + /** + * @param {Number} lineIndex + * @param {Number} charIndex + * @private + */ + _getStyleDeclaration: function(lineIndex, charIndex) { + if (this._styleMap && !this.isWrapping) { + var map = this._styleMap[lineIndex]; + if (!map) { + return null; + } + lineIndex = map.line; + charIndex = map.offset + charIndex; + } + return this.callSuper('_getStyleDeclaration', lineIndex, charIndex); + }, + + /** + * @param {Number} lineIndex + * @param {Number} charIndex + * @param {Object} style + * @private + */ + _setStyleDeclaration: function(lineIndex, charIndex, style) { + var map = this._styleMap[lineIndex]; + lineIndex = map.line; + charIndex = map.offset + charIndex; + + this.styles[lineIndex][charIndex] = style; + }, + + /** + * @param {Number} lineIndex + * @param {Number} charIndex + * @private + */ + _deleteStyleDeclaration: function(lineIndex, charIndex) { + var map = this._styleMap[lineIndex]; + lineIndex = map.line; + charIndex = map.offset + charIndex; + delete this.styles[lineIndex][charIndex]; + }, + + /** + * probably broken need a fix + * Returns the real style line that correspond to the wrapped lineIndex line + * Used just to verify if the line does exist or not. + * @param {Number} lineIndex + * @returns {Boolean} if the line exists or not + * @private + */ + _getLineStyle: function(lineIndex) { + var map = this._styleMap[lineIndex]; + return !!this.styles[map.line]; + }, + + /** + * Set the line style to an empty object so that is initialized + * @param {Number} lineIndex + * @param {Object} style + * @private + */ + _setLineStyle: function(lineIndex) { + var map = this._styleMap[lineIndex]; + this.styles[map.line] = {}; + }, + + /** + * Wraps text using the 'width' property of Textbox. First this function + * splits text on newlines, so we preserve newlines entered by the user. + * Then it wraps each line using the width of the Textbox by calling + * _wrapLine(). + * @param {Array} lines The string array of text that is split into lines + * @param {Number} desiredWidth width you want to wrap to + * @returns {Array} Array of lines + */ + _wrapText: function(lines, desiredWidth) { + var wrapped = [], i; + this.isWrapping = true; + for (i = 0; i < lines.length; i++) { + wrapped = wrapped.concat(this._wrapLine(lines[i], i, desiredWidth)); + } + this.isWrapping = false; + return wrapped; + }, + + /** + * Helper function to measure a string of text, given its lineIndex and charIndex offset + * it gets called when charBounds are not available yet. + * @param {CanvasRenderingContext2D} ctx + * @param {String} text + * @param {number} lineIndex + * @param {number} charOffset + * @returns {number} + * @private + */ + _measureWord: function(word, lineIndex, charOffset) { + var width = 0, prevGrapheme, skipLeft = true; + charOffset = charOffset || 0; + for (var i = 0, len = word.length; i < len; i++) { + var box = this._getGraphemeBox(word[i], lineIndex, i + charOffset, prevGrapheme, skipLeft); + width += box.kernedWidth; + prevGrapheme = word[i]; + } + return width; + }, + + /** + * Wraps a line of text using the width of the Textbox and a context. + * @param {Array} line The grapheme array that represent the line + * @param {Number} lineIndex + * @param {Number} desiredWidth width you want to wrap the line to + * @param {Number} reservedSpace space to remove from wrapping for custom functionalities + * @returns {Array} Array of line(s) into which the given text is wrapped + * to. + */ + _wrapLine: function(_line, lineIndex, desiredWidth, reservedSpace) { + var lineWidth = 0, + splitByGrapheme = this.splitByGrapheme, + graphemeLines = [], + line = [], + // spaces in different languges? + words = splitByGrapheme ? fabric.util.string.graphemeSplit(_line) : _line.split(this._wordJoiners), + word = '', + offset = 0, + infix = splitByGrapheme ? '' : ' ', + wordWidth = 0, + infixWidth = 0, + largestWordWidth = 0, + lineJustStarted = true, + additionalSpace = this._getWidthOfCharSpacing(), + reservedSpace = reservedSpace || 0; + // fix a difference between split and graphemeSplit + if (words.length === 0) { + words.push([]); + } + desiredWidth -= reservedSpace; + for (var i = 0; i < words.length; i++) { + // if using splitByGrapheme words are already in graphemes. + word = splitByGrapheme ? words[i] : fabric.util.string.graphemeSplit(words[i]); + wordWidth = this._measureWord(word, lineIndex, offset); + offset += word.length; + + lineWidth += infixWidth + wordWidth - additionalSpace; + if (lineWidth >= desiredWidth && !lineJustStarted) { + graphemeLines.push(line); + line = []; + lineWidth = wordWidth; + lineJustStarted = true; + } + else { + lineWidth += additionalSpace; + } + + if (!lineJustStarted && !splitByGrapheme) { + line.push(infix); + } + line = line.concat(word); + + infixWidth = splitByGrapheme ? 0 : this._measureWord([infix], lineIndex, offset); + offset++; + lineJustStarted = false; + // keep track of largest word + if (wordWidth > largestWordWidth) { + largestWordWidth = wordWidth; + } + } + + i && graphemeLines.push(line); + + if (largestWordWidth + reservedSpace > this.dynamicMinWidth) { + this.dynamicMinWidth = largestWordWidth - additionalSpace + reservedSpace; + } + return graphemeLines; + }, + + /** + * Detect if the text line is ended with an hard break + * text and itext do not have wrapping, return false + * @param {Number} lineIndex text to split + * @return {Boolean} + */ + isEndOfWrapping: function(lineIndex) { + if (!this._styleMap[lineIndex + 1]) { + // is last line, return true; + return true; + } + if (this._styleMap[lineIndex + 1].line !== this._styleMap[lineIndex].line) { + // this is last line before a line break, return true; + return true; + } + return false; + }, + + /** + * Detect if a line has a linebreak and so we need to account for it when moving + * and counting style. + * @return Number + */ + missingNewlineOffset: function(lineIndex) { + if (this.splitByGrapheme) { + return this.isEndOfWrapping(lineIndex) ? 1 : 0; + } + return 1; + }, + + /** + * Gets lines of text to render in the Textbox. This function calculates + * text wrapping on the fly every time it is called. + * @param {String} text text to split + * @returns {Array} Array of lines in the Textbox. + * @override + */ + _splitTextIntoLines: function(text) { + var newText = fabric.Text.prototype._splitTextIntoLines.call(this, text), + graphemeLines = this._wrapText(newText.lines, this.width), + lines = new Array(graphemeLines.length); + for (var i = 0; i < graphemeLines.length; i++) { + lines[i] = graphemeLines[i].join(''); + } + newText.lines = lines; + newText.graphemeLines = graphemeLines; + return newText; + }, + + getMinWidth: function() { + return Math.max(this.minWidth, this.dynamicMinWidth); + }, + + _removeExtraneousStyles: function() { + var linesToKeep = {}; + for (var prop in this._styleMap) { + if (this._textLines[prop]) { + linesToKeep[this._styleMap[prop].line] = 1; + } + } + for (var prop in this.styles) { + if (!linesToKeep[prop]) { + delete this.styles[prop]; + } + } + }, + + /** + * Returns object representation of an instance + * @method toObject + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return this.callSuper('toObject', ['minWidth', 'splitByGrapheme'].concat(propertiesToInclude)); + } + }); + + /** + * Returns fabric.Textbox instance from an object representation + * @static + * @memberOf fabric.Textbox + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Textbox instance is created + */ + fabric.Textbox.fromObject = function(object, callback) { + return fabric.Object._fromObject('Textbox', object, callback, 'text'); + }; +})(typeof exports !== 'undefined' ? exports : this); +(function() { + + /** + * Override _setObjectScale and add Textbox specific resizing behavior. Resizing + * a Textbox doesn't scale text, it only changes width and makes text wrap automatically. + */ + var setObjectScaleOverridden = fabric.Canvas.prototype._setObjectScale; + + fabric.Canvas.prototype._setObjectScale = function(localMouse, transform, + lockScalingX, lockScalingY, by, lockScalingFlip, _dim) { + + var t = transform.target, scaled, + scaleX = localMouse.x * t.scaleX / _dim.x, + scaleY = localMouse.y * t.scaleY / _dim.y; + if (by === 'x' && t instanceof fabric.Textbox) { + var tw = t._getTransformedDimensions().x; + var w = t.width * (localMouse.x / tw); + transform.newScaleX = scaleX; + transform.newScaleY = scaleY; + if (w >= t.getMinWidth()) { + scaled = w !== t.width; + t.set('width', w); + return scaled; + } + } + else { + return setObjectScaleOverridden.call(fabric.Canvas.prototype, localMouse, transform, + lockScalingX, lockScalingY, by, lockScalingFlip, _dim); + } + }; + + fabric.util.object.extend(fabric.Textbox.prototype, /** @lends fabric.IText.prototype */ { + /** + * @private + */ + _removeExtraneousStyles: function() { + for (var prop in this._styleMap) { + if (!this._textLines[prop]) { + delete this.styles[this._styleMap[prop].line]; + } + } + }, + + }); +})(); diff --git a/libraries/canvas-note/hammer.2.0.8.min.js b/libraries/canvas-note/hammer.2.0.8.min.js new file mode 100644 index 000000000..edadee159 --- /dev/null +++ b/libraries/canvas-note/hammer.2.0.8.min.js @@ -0,0 +1,7 @@ +/*! Hammer.JS - v2.0.8 - 2016-04-23 + * http://hammerjs.github.io/ + * + * Copyright (c) 2016 Jorik Tangelder; + * Licensed under the MIT license */ +!function(a,b,c,d){"use strict";function e(a,b,c){return setTimeout(j(a,c),b)}function f(a,b,c){return Array.isArray(a)?(g(a,c[b],c),!0):!1}function g(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e\s*\(/gm,"{anonymous}()@"):"Unknown Stack Trace",f=a.console&&(a.console.warn||a.console.log);return f&&f.call(a.console,e,d),b.apply(this,arguments)}}function i(a,b,c){var d,e=b.prototype;d=a.prototype=Object.create(e),d.constructor=a,d._super=e,c&&la(d,c)}function j(a,b){return function(){return a.apply(b,arguments)}}function k(a,b){return typeof a==oa?a.apply(b?b[0]||d:d,b):a}function l(a,b){return a===d?b:a}function m(a,b,c){g(q(b),function(b){a.addEventListener(b,c,!1)})}function n(a,b,c){g(q(b),function(b){a.removeEventListener(b,c,!1)})}function o(a,b){for(;a;){if(a==b)return!0;a=a.parentNode}return!1}function p(a,b){return a.indexOf(b)>-1}function q(a){return a.trim().split(/\s+/g)}function r(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;dc[b]}):d.sort()),d}function u(a,b){for(var c,e,f=b[0].toUpperCase()+b.slice(1),g=0;g1&&!c.firstMultiple?c.firstMultiple=D(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=E(d);b.timeStamp=ra(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=I(h,i),b.distance=H(h,i),B(c,b),b.offsetDirection=G(b.deltaX,b.deltaY);var j=F(b.deltaTime,b.deltaX,b.deltaY);b.overallVelocityX=j.x,b.overallVelocityY=j.y,b.overallVelocity=qa(j.x)>qa(j.y)?j.x:j.y,b.scale=g?K(g.pointers,d):1,b.rotation=g?J(g.pointers,d):0,b.maxPointers=c.prevInput?b.pointers.length>c.prevInput.maxPointers?b.pointers.length:c.prevInput.maxPointers:b.pointers.length,C(c,b);var k=a.element;o(b.srcEvent.target,k)&&(k=b.srcEvent.target),b.target=k}function B(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};b.eventType!==Ea&&f.eventType!==Ga||(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function C(a,b){var c,e,f,g,h=a.lastInterval||b,i=b.timeStamp-h.timeStamp;if(b.eventType!=Ha&&(i>Da||h.velocity===d)){var j=b.deltaX-h.deltaX,k=b.deltaY-h.deltaY,l=F(i,j,k);e=l.x,f=l.y,c=qa(l.x)>qa(l.y)?l.x:l.y,g=G(j,k),a.lastInterval=b}else c=h.velocity,e=h.velocityX,f=h.velocityY,g=h.direction;b.velocity=c,b.velocityX=e,b.velocityY=f,b.direction=g}function D(a){for(var b=[],c=0;ce;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:pa(c/b),y:pa(d/b)}}function F(a,b,c){return{x:b/a||0,y:c/a||0}}function G(a,b){return a===b?Ia:qa(a)>=qa(b)?0>a?Ja:Ka:0>b?La:Ma}function H(a,b,c){c||(c=Qa);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function I(a,b,c){c||(c=Qa);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function J(a,b){return I(b[1],b[0],Ra)+I(a[1],a[0],Ra)}function K(a,b){return H(b[0],b[1],Ra)/H(a[0],a[1],Ra)}function L(){this.evEl=Ta,this.evWin=Ua,this.pressed=!1,x.apply(this,arguments)}function M(){this.evEl=Xa,this.evWin=Ya,x.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function N(){this.evTarget=$a,this.evWin=_a,this.started=!1,x.apply(this,arguments)}function O(a,b){var c=s(a.touches),d=s(a.changedTouches);return b&(Ga|Ha)&&(c=t(c.concat(d),"identifier",!0)),[c,d]}function P(){this.evTarget=bb,this.targetIds={},x.apply(this,arguments)}function Q(a,b){var c=s(a.touches),d=this.targetIds;if(b&(Ea|Fa)&&1===c.length)return d[c[0].identifier]=!0,[c,c];var e,f,g=s(a.changedTouches),h=[],i=this.target;if(f=c.filter(function(a){return o(a.target,i)}),b===Ea)for(e=0;e-1&&d.splice(a,1)};setTimeout(e,cb)}}function U(a){for(var b=a.srcEvent.clientX,c=a.srcEvent.clientY,d=0;d=f&&db>=g)return!0}return!1}function V(a,b){this.manager=a,this.set(b)}function W(a){if(p(a,jb))return jb;var b=p(a,kb),c=p(a,lb);return b&&c?jb:b||c?b?kb:lb:p(a,ib)?ib:hb}function X(){if(!fb)return!1;var b={},c=a.CSS&&a.CSS.supports;return["auto","manipulation","pan-y","pan-x","pan-x pan-y","none"].forEach(function(d){b[d]=c?a.CSS.supports("touch-action",d):!0}),b}function Y(a){this.options=la({},this.defaults,a||{}),this.id=v(),this.manager=null,this.options.enable=l(this.options.enable,!0),this.state=nb,this.simultaneous={},this.requireFail=[]}function Z(a){return a&sb?"cancel":a&qb?"end":a&pb?"move":a&ob?"start":""}function $(a){return a==Ma?"down":a==La?"up":a==Ja?"left":a==Ka?"right":""}function _(a,b){var c=b.manager;return c?c.get(a):a}function aa(){Y.apply(this,arguments)}function ba(){aa.apply(this,arguments),this.pX=null,this.pY=null}function ca(){aa.apply(this,arguments)}function da(){Y.apply(this,arguments),this._timer=null,this._input=null}function ea(){aa.apply(this,arguments)}function fa(){aa.apply(this,arguments)}function ga(){Y.apply(this,arguments),this.pTime=!1,this.pCenter=!1,this._timer=null,this._input=null,this.count=0}function ha(a,b){return b=b||{},b.recognizers=l(b.recognizers,ha.defaults.preset),new ia(a,b)}function ia(a,b){this.options=la({},ha.defaults,b||{}),this.options.inputTarget=this.options.inputTarget||a,this.handlers={},this.session={},this.recognizers=[],this.oldCssProps={},this.element=a,this.input=y(this),this.touchAction=new V(this,this.options.touchAction),ja(this,!0),g(this.options.recognizers,function(a){var b=this.add(new a[0](a[1]));a[2]&&b.recognizeWith(a[2]),a[3]&&b.requireFailure(a[3])},this)}function ja(a,b){var c=a.element;if(c.style){var d;g(a.options.cssProps,function(e,f){d=u(c.style,f),b?(a.oldCssProps[d]=c.style[d],c.style[d]=e):c.style[d]=a.oldCssProps[d]||""}),b||(a.oldCssProps={})}}function ka(a,c){var d=b.createEvent("Event");d.initEvent(a,!0,!0),d.gesture=c,c.target.dispatchEvent(d)}var la,ma=["","webkit","Moz","MS","ms","o"],na=b.createElement("div"),oa="function",pa=Math.round,qa=Math.abs,ra=Date.now;la="function"!=typeof Object.assign?function(a){if(a===d||null===a)throw new TypeError("Cannot convert undefined or null to object");for(var b=Object(a),c=1;ch&&(b.push(a),h=b.length-1):e&(Ga|Ha)&&(c=!0),0>h||(b[h]=a,this.callback(this.manager,e,{pointers:b,changedPointers:[a],pointerType:f,srcEvent:a}),c&&b.splice(h,1))}});var Za={touchstart:Ea,touchmove:Fa,touchend:Ga,touchcancel:Ha},$a="touchstart",_a="touchstart touchmove touchend touchcancel";i(N,x,{handler:function(a){var b=Za[a.type];if(b===Ea&&(this.started=!0),this.started){var c=O.call(this,a,b);b&(Ga|Ha)&&c[0].length-c[1].length===0&&(this.started=!1),this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:za,srcEvent:a})}}});var ab={touchstart:Ea,touchmove:Fa,touchend:Ga,touchcancel:Ha},bb="touchstart touchmove touchend touchcancel";i(P,x,{handler:function(a){var b=ab[a.type],c=Q.call(this,a,b);c&&this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:za,srcEvent:a})}});var cb=2500,db=25;i(R,x,{handler:function(a,b,c){var d=c.pointerType==za,e=c.pointerType==Ba;if(!(e&&c.sourceCapabilities&&c.sourceCapabilities.firesTouchEvents)){if(d)S.call(this,b,c);else if(e&&U.call(this,c))return;this.callback(a,b,c)}},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var eb=u(na.style,"touchAction"),fb=eb!==d,gb="compute",hb="auto",ib="manipulation",jb="none",kb="pan-x",lb="pan-y",mb=X();V.prototype={set:function(a){a==gb&&(a=this.compute()),fb&&this.manager.element.style&&mb[a]&&(this.manager.element.style[eb]=a),this.actions=a.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var a=[];return g(this.manager.recognizers,function(b){k(b.options.enable,[b])&&(a=a.concat(b.getTouchAction()))}),W(a.join(" "))},preventDefaults:function(a){var b=a.srcEvent,c=a.offsetDirection;if(this.manager.session.prevented)return void b.preventDefault();var d=this.actions,e=p(d,jb)&&!mb[jb],f=p(d,lb)&&!mb[lb],g=p(d,kb)&&!mb[kb];if(e){var h=1===a.pointers.length,i=a.distance<2,j=a.deltaTime<250;if(h&&i&&j)return}return g&&f?void 0:e||f&&c&Na||g&&c&Oa?this.preventSrc(b):void 0},preventSrc:function(a){this.manager.session.prevented=!0,a.preventDefault()}};var nb=1,ob=2,pb=4,qb=8,rb=qb,sb=16,tb=32;Y.prototype={defaults:{},set:function(a){return la(this.options,a),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(a){if(f(a,"recognizeWith",this))return this;var b=this.simultaneous;return a=_(a,this),b[a.id]||(b[a.id]=a,a.recognizeWith(this)),this},dropRecognizeWith:function(a){return f(a,"dropRecognizeWith",this)?this:(a=_(a,this),delete this.simultaneous[a.id],this)},requireFailure:function(a){if(f(a,"requireFailure",this))return this;var b=this.requireFail;return a=_(a,this),-1===r(b,a)&&(b.push(a),a.requireFailure(this)),this},dropRequireFailure:function(a){if(f(a,"dropRequireFailure",this))return this;a=_(a,this);var b=r(this.requireFail,a);return b>-1&&this.requireFail.splice(b,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(a){return!!this.simultaneous[a.id]},emit:function(a){function b(b){c.manager.emit(b,a)}var c=this,d=this.state;qb>d&&b(c.options.event+Z(d)),b(c.options.event),a.additionalEvent&&b(a.additionalEvent),d>=qb&&b(c.options.event+Z(d))},tryEmit:function(a){return this.canEmit()?this.emit(a):void(this.state=tb)},canEmit:function(){for(var a=0;af?Ja:Ka,c=f!=this.pX,d=Math.abs(a.deltaX)):(e=0===g?Ia:0>g?La:Ma,c=g!=this.pY,d=Math.abs(a.deltaY))),a.direction=e,c&&d>b.threshold&&e&b.direction},attrTest:function(a){return aa.prototype.attrTest.call(this,a)&&(this.state&ob||!(this.state&ob)&&this.directionTest(a))},emit:function(a){this.pX=a.deltaX,this.pY=a.deltaY;var b=$(a.direction);b&&(a.additionalEvent=this.options.event+b),this._super.emit.call(this,a)}}),i(ca,aa,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[jb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.scale-1)>this.options.threshold||this.state&ob)},emit:function(a){if(1!==a.scale){var b=a.scale<1?"in":"out";a.additionalEvent=this.options.event+b}this._super.emit.call(this,a)}}),i(da,Y,{defaults:{event:"press",pointers:1,time:251,threshold:9},getTouchAction:function(){return[hb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distanceb.time;if(this._input=a,!d||!c||a.eventType&(Ga|Ha)&&!f)this.reset();else if(a.eventType&Ea)this.reset(),this._timer=e(function(){this.state=rb,this.tryEmit()},b.time,this);else if(a.eventType&Ga)return rb;return tb},reset:function(){clearTimeout(this._timer)},emit:function(a){this.state===rb&&(a&&a.eventType&Ga?this.manager.emit(this.options.event+"up",a):(this._input.timeStamp=ra(),this.manager.emit(this.options.event,this._input)))}}),i(ea,aa,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[jb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.rotation)>this.options.threshold||this.state&ob)}}),i(fa,aa,{defaults:{event:"swipe",threshold:10,velocity:.3,direction:Na|Oa,pointers:1},getTouchAction:function(){return ba.prototype.getTouchAction.call(this)},attrTest:function(a){var b,c=this.options.direction;return c&(Na|Oa)?b=a.overallVelocity:c&Na?b=a.overallVelocityX:c&Oa&&(b=a.overallVelocityY),this._super.attrTest.call(this,a)&&c&a.offsetDirection&&a.distance>this.options.threshold&&a.maxPointers==this.options.pointers&&qa(b)>this.options.velocity&&a.eventType&Ga},emit:function(a){var b=$(a.offsetDirection);b&&this.manager.emit(this.options.event+b,a),this.manager.emit(this.options.event,a)}}),i(ga,Y,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:9,posThreshold:10},getTouchAction:function(){return[ib]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance Date: Sat, 7 Nov 2020 23:06:34 +0100 Subject: [PATCH 04/94] basic infinite-drawing-canvas integration --- .../canvas-note-utils/EraserBrush.js | 254 +-- .../canvas-note-utils/EraserBrushPath.js | 69 + .../type_widgets/canvas-note-utils/gui.js | 193 ++ .../infinite-drawing-canvas.js | 503 +++++ .../canvas-note-utils/lib/deleteIcon.js | 3 + .../canvas-note-utils/lib/lodash.cloneDeep.js | 1748 +++++++++++++++++ .../canvas-note-utils/lib/lodash.debounce.js | 70 + .../canvas-note-utils/lib/lodash.throttle.js | 439 +++++ .../canvas-note-utils/lib/sleep.js | 7 + .../type_widgets/canvas-note-utils/utils.js | 46 + .../app/widgets/type_widgets/canvas_note.js | 377 +--- 11 files changed, 3287 insertions(+), 422 deletions(-) create mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/EraserBrushPath.js create mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/gui.js create mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/infinite-drawing-canvas.js create mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/lib/deleteIcon.js create mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.cloneDeep.js create mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.debounce.js create mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.throttle.js create mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/lib/sleep.js create mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/utils.js diff --git a/src/public/app/widgets/type_widgets/canvas-note-utils/EraserBrush.js b/src/public/app/widgets/type_widgets/canvas-note-utils/EraserBrush.js index 1e966788f..b934c092a 100644 --- a/src/public/app/widgets/type_widgets/canvas-note-utils/EraserBrush.js +++ b/src/public/app/widgets/type_widgets/canvas-note-utils/EraserBrush.js @@ -1,128 +1,150 @@ +import _cloneDeep from './lib/lodash.cloneDeep.js'; + const EraserBrushFactory = (fabric) => { + /** + * ErasedGroup, part of EraserBrush + * + * Made it so that the bound is calculated on the original only + * + * Note: Might not work with versions other than 3.1.0 / 4.0.0 since it uses some + * fabric.js overwriting + * + * Source: https://github.com/fabricjs/fabric.js/issues/1225#issuecomment-499620550 + */ + const ErasedGroup = fabric.util.createClass(fabric.Group, { + original: null, + erasedPath: null, + initialize: function (original, erasedPath, options, isAlreadyGrouped) { + this.original = original; + this.erasedPath = erasedPath; + this.callSuper( + 'initialize', + [this.original, this.erasedPath], + options, + isAlreadyGrouped, + ); + }, + _calcBounds: function (onlyWidthHeight) { + const aX = [], + aY = [], + props = ['tr', 'br', 'bl', 'tl'], + jLen = props.length, + ignoreZoom = true; + + let o = this.original; + o.setCoords(ignoreZoom); + for (let j = 0; j < jLen; j++) { + const prop = props[j]; + aX.push(o.aCoords[prop].x); // when using dev-fabric js, we need aCoords, in minified oCoords + aY.push(o.aCoords[prop].y); // when using dev-fabric js, we need aCoords, in minified oCoords + } + + console.log('_calcBounds', aX, aY, props, jLen, onlyWidthHeight); + + this._getBounds(aX, aY, onlyWidthHeight); + }, + }); + + /** + * EraserBrush, part of EraserBrush + * + * Made it so that the path will be 'merged' with other objects + * into a customized group and has a 'destination-out' composition + * + * Note: Might not work with versions other than 3.1.0 / 4.0.0 since it uses some + * fabric.js overwriting + * + * Source: https://github.com/fabricjs/fabric.js/issues/1225#issuecomment-499620550 + */ + const EraserBrush = fabric.util.createClass(fabric.PencilBrush, { /** - * ErasedGroup, part of EraserBrush - * - * Made it so that the bound is calculated on the original only - * - * Note: Might not work with versions other than 3.1.0 / 4.0.0 since it uses some - * fabric.js overwriting - * - * Source: https://github.com/fabricjs/fabric.js/issues/1225#issuecomment-499620550 + * On mouseup after drawing the path on contextTop canvas + * we use the points captured to create an new fabric path object + * and add it to the fabric canvas. */ - const ErasedGroup = fabric.util.createClass(fabric.Group, { - original: null, - erasedPath: null, - initialize: function (original, erasedPath, options, isAlreadyGrouped) { - this.original = original; - this.erasedPath = erasedPath; - this.callSuper('initialize', [this.original, this.erasedPath], options, isAlreadyGrouped); - }, + _finalizeAndAddPath: async function () { + var ctx = this.canvas.contextTop; + ctx.closePath(); + if (this.decimate) { + this._points = this.decimatePoints(this._points, this.decimate); + } + var pathData = this.convertPointsToSVGPath(this._points).join(''); + if (pathData === 'M 0 0 Q 0 0 0 0 L 0 0') { + // do not create 0 width/height paths, as they are + // rendered inconsistently across browsers + // Firefox 4, for example, renders a dot, + // whereas Chrome 10 renders nothing + this.canvas.requestRenderAll(); + return; + } - _calcBounds: function (onlyWidthHeight) { - const aX = [], - aY = [], - props = ['tr', 'br', 'bl', 'tl'], - jLen = props.length, - ignoreZoom = true; + // use globalCompositeOperation to 'fake' eraser + var path = this.createPath(pathData); + path.globalCompositeOperation = 'destination-out'; + path.selectable = false; + path.evented = false; + path.absolutePositioned = true; - let o = this.original; - o.setCoords(ignoreZoom); - for (let j = 0; j < jLen; j++) { - const prop = props[j]; - aX.push(o.oCoords[prop].x); - aY.push(o.oCoords[prop].y); - } + // grab all the objects that intersects with the path, filter out objects + // that are not desired, such as Text and IText + // otherwise text might get erased (under some circumstances, this might be desired?!) + const objects = this.canvas.getObjects().filter((obj) => { + if (obj instanceof fabric.Textbox) return false; + if (obj instanceof fabric.Text) return false; + if (obj instanceof fabric.IText) return false; + // get all objects, that intersect + // intersectsWithObject(x, absoluteopt=true) <- enables working eraser during zoom + if (!obj.intersectsWithObject(path, true)) return false; + return true; + }); - this._getBounds(aX, aY, onlyWidthHeight); - }, + // async loop to ensure, that first we do the erasing for all objects, and then update canvas + for (const intersectedObject of objects) { + // eraserPath is handled by reference later, so we need copy for every intersectedObject + const eraserPath = _cloneDeep(path); + + // by adding path-object with 'destination-out', it will be 'erased' + const erasedGroup = new ErasedGroup(intersectedObject, eraserPath); + + const erasedGroupDataURL = erasedGroup.toDataURL({ + withoutTransform: true, + }); + // Be aware of async behavior! + const fabricImage = await fabricImageFromURLPromise(erasedGroupDataURL); + // TODO: If complete path was erased, remove canvas object completely! Right now, an empty image is added + console.log(eraserPath, erasedGroup, 'fabricimage', fabricImage); + console.image(erasedGroupDataURL); + fabricImage.set({ + left: erasedGroup.left, + top: erasedGroup.top, + }); + + this.canvas.remove(intersectedObject); + this.canvas.add(fabricImage); + } + + this.canvas.renderAll(); + // removes path of eraser + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + }, + }); + + /** + * Promisiefied fromUrl: + * http://fabricjs.com/docs/fabric.Image.html#.fromURL + * + * @param {string} url URL to create an image from + * @param {object} imgOptionsopt Options object + */ + const fabricImageFromURLPromise = (url, imgOptionsopt) => { + return new Promise((resolve) => { + fabric.Image.fromURL(url, resolve, imgOptionsopt); }); + }; - /** - * EraserBrush, part of EraserBrush - * - * Made it so that the path will be 'merged' with other objects - * into a customized group and has a 'destination-out' composition - * - * Note: Might not work with versions other than 3.1.0 / 4.0.0 since it uses some - * fabric.js overwriting - * - * Source: https://github.com/fabricjs/fabric.js/issues/1225#issuecomment-499620550 - */ - const EraserBrush = fabric.util.createClass(fabric.PencilBrush, { - - /** - * On mouseup after drawing the path on contextTop canvas - * we use the points captured to create an new fabric path object - * and add it to the fabric canvas. - */ - _finalizeAndAddPath: function () { - var ctx = this.canvas.contextTop; - ctx.closePath(); - if (this.decimate) { - this._points = this.decimatePoints(this._points, this.decimate); - } - var pathData = this.convertPointsToSVGPath(this._points).join(''); - if (pathData === 'M 0 0 Q 0 0 0 0 L 0 0') { - // do not create 0 width/height paths, as they are - // rendered inconsistently across browsers - // Firefox 4, for example, renders a dot, - // whereas Chrome 10 renders nothing - this.canvas.requestRenderAll(); - return; - } - - // use globalCompositeOperation to 'fake' eraser - var path = this.createPath(pathData); - path.globalCompositeOperation = 'destination-out'; - path.selectable = false; - path.evented = false; - path.absolutePositioned = true; - - // grab all the objects that intersects with the path - const objects = this.canvas.getObjects().filter((obj) => { - // if (obj instanceof fabric.Textbox) return false; - // if (obj instanceof fabric.IText) return false; - if (!obj.intersectsWithObject(path)) return false; - return true; - }); - - if (objects.length > 0) { - - // merge those objects into a group - const mergedGroup = new fabric.Group(objects); - - // This will perform the actual 'erasing' - // NOTE: you can do this for each object, instead of doing it with a merged group - // however, there will be a visible lag when there's many objects affected by this - const newPath = new ErasedGroup(mergedGroup, path); - - const left = newPath.left; - const top = newPath.top; - - // convert it into a dataURL, then back to a fabric image - const newData = newPath.toDataURL({ - withoutTransform: true - }); - fabric.Image.fromURL(newData, (fabricImage) => { - fabricImage.set({ - left: left, - top: top, - }); - - // remove the old objects then add the new image - this.canvas.remove(...objects); - this.canvas.add(fabricImage); - }); - } - - this.canvas.clearContext(this.canvas.contextTop); - this.canvas.renderAll(); - this._resetShadow(); - }, - }); - - return {EraserBrush, ErasedGroup}; + return { EraserBrush, ErasedGroup }; }; export default EraserBrushFactory; diff --git a/src/public/app/widgets/type_widgets/canvas-note-utils/EraserBrushPath.js b/src/public/app/widgets/type_widgets/canvas-note-utils/EraserBrushPath.js new file mode 100644 index 000000000..ed71c3e71 --- /dev/null +++ b/src/public/app/widgets/type_widgets/canvas-note-utils/EraserBrushPath.js @@ -0,0 +1,69 @@ +const EraserBrushPathFactory = (fabric) => { + /** + * EraserBrushPath, part of EraserBrushPath + * + * Made it so that the path will be 'merged' with other objects + * into a customized group and has a 'destination-out' composition + * + * Note: Might not work with versions other than 3.1.0 / 4.0.0 since it uses some + * fabric.js overwriting + * + * Source: https://github.com/fabricjs/fabric.js/issues/1225#issuecomment-499620550 + */ + const EraserBrushPath = fabric.util.createClass(fabric.PencilBrush, { + /** + * On mouseup after drawing the path on contextTop canvas + * we use the points captured to create an new fabric path object + * and add it to the fabric canvas. + */ + _finalizeAndAddPath: async function () { + var ctx = this.canvas.contextTop; + ctx.closePath(); + if (this.decimate) { + this._points = this.decimatePoints(this._points, this.decimate); + } + var pathData = this.convertPointsToSVGPath(this._points).join(''); + if (pathData === 'M 0 0 Q 0 0 0 0 L 0 0') { + // do not create 0 width/height paths, as they are + // rendered inconsistently across browsers + // Firefox 4, for example, renders a dot, + // whereas Chrome 10 renders nothing + this.canvas.requestRenderAll(); + return; + } + + // use globalCompositeOperation to 'fake' eraser + var path = this.createPath(pathData); + path.globalCompositeOperation = 'destination-out'; + path.selectable = false; + path.evented = false; + path.absolutePositioned = true; + + // grab all the objects that intersects with the path, filter out objects + // that are not desired, such as Text and IText + // otherwise text might get erased (under some circumstances, this might be desired?!) + const objects = this.canvas.getObjects().filter((obj) => { + if (obj instanceof fabric.Textbox) return false; + if (obj instanceof fabric.Text) return false; + if (obj instanceof fabric.IText) return false; + // intersectsWithObject(x, absoluteopt=true) <- enables working eraser during zoom + if (!obj.intersectsWithObject(path, true)) return false; + return true; + }); + + // async loop to ensure, that first we do the erasing for all objects, and then update canvas + for (const intersectedObject of objects) { + this.canvas.remove(intersectedObject); + } + + this.canvas.renderAll(); + // removes path of eraser + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + }, + }); + + return { EraserBrushPath }; +}; + +export default EraserBrushPathFactory; diff --git a/src/public/app/widgets/type_widgets/canvas-note-utils/gui.js b/src/public/app/widgets/type_widgets/canvas-note-utils/gui.js new file mode 100644 index 000000000..66a4c0506 --- /dev/null +++ b/src/public/app/widgets/type_widgets/canvas-note-utils/gui.js @@ -0,0 +1,193 @@ +import EraserBrushFactory from './EraserBrush.js'; +import EraserBrushPathFactory from './EraserBrushPath.js'; + +/** + * add listeners to buttons + */ +export const initButtons = (self) => { + const canvas = self.$canvas; + + var saveCanvas = $('#save-canvas'), + refreshCanvas = $('#refresh-canvas'), + zoom100 = $('#zoom-100'), + showSVG = $('#show-svg'), + clearEl = $('#clear-canvas'), + undo = $('#undo'), + redo = $('#redo'); + const deletedItems = []; + + undo.on('click', () => { + // // Source: https://stackoverflow.com/a/28666556 + // var lastItemIndex = canvas.getObjects().length - 1; + // var item = canvas.item(lastItemIndex); + + // deletedItems.push(item); + // // if(item.get('type') === 'path') { + // canvas.remove(item); + // canvas.renderAll(); + // // } + + canvas.undo(); //fabric-history + }); + + redo.on('click', () => { + // const lastItem = deletedItems.pop(); + // if (lastItem) { + // canvas.add(lastItem); + // canvas.renderAll(); + // } + + canvas.redo(); //fabric-history + }); + + clearEl.on('click', () => { + console.log('cE-oC'); + canvas.clear(); + }); + + saveCanvas.on('click', () => { + console.log('sC-oC'); + const canvasContent = canvas.toJSON(); + console.log('Canvas JSON', canvasContent); + const payload = { + width: self.width, + height: self.height, + lastScale: self.lastScale, + canvas: canvasContent, + }; + localStorage.setItem('infiniteCanvas', JSON.stringify(payload)); + }); + + refreshCanvas.on('click', () => { + console.log('rC-oC'); + const infiniteCanvas = JSON.parse(localStorage.getItem('infiniteCanvas') || ""); + console.log('rcoc, inf', infiniteCanvas); + + canvas.loadFromJSON(infiniteCanvas.canvas, () => { + self.width = self.scaledWidth = infiniteCanvas.width; + self.height = self.scaledHeight = infiniteCanvas.height; + self.lastScale = infiniteCanvas.lastScale; + canvas.setWidth(infiniteCanvas.width); + canvas.setHeight(infiniteCanvas.height); + self.$canvasContainer.width(infiniteCanvas.width).height(infiniteCanvas.height); + canvas.renderAll(); + }); + }); + + zoom100.on('click', () => { + console.log('zoom100'); + // TODO extract zoom to into separate function (reuse for zoom 100% button) + // zoom level of canvas + self.resetZoom(); + + canvas.renderAll(); + }); + + showSVG.on('click', () => { + console.log('showSVG'); + const svg = self.$canvas.toSVG(); + const imageSrc = `data:image/svg+xml;utf8,${svg}`; + // $('#svgImage').html(``); + $('#svgImage').html(`${svg}`); + }); + + $('#enlarge-left').on('click', () => { + const enlargeValue = parseInt($('#enlargeValue').val(), 10); + self.$canvas.transformCanvas('left', enlargeValue); + }); + $('#enlarge-top').on('click', () => { + const enlargeValue = parseInt($('#enlargeValue').val(), 10); + self.$canvas.transformCanvas('top', enlargeValue); + }); + $('#enlarge-right').on('click', () => { + const enlargeValue = parseInt($('#enlargeValue').val(), 10); + self.$canvas.transformCanvas('right', enlargeValue); + }); + $('#enlarge-bottom').on('click', () => { + const enlargeValue = parseInt($('#enlargeValue').val(), 10); + self.$canvas.transformCanvas('bottom', enlargeValue); + }); + $('#crop-canvas').on('click', () => { + self.cropCanvas(); + }); + + $('#mode-select').on('click', () => { + self.$canvas.isDrawingMode = false; + self.drawWithTouch = false; + }); + $('#mode-drawWithTouch').on('click', () => { + self.drawWithTouch = true; + }); +}; + +export const initPens = (self) => { + const canvas = self.$canvas; + $('#pen-1').on('click', () => { + canvas.freeDrawingBrush = new fabric['PencilBrush'](canvas); + canvas.freeDrawingBrush.color = 'black'; + canvas.freeDrawingBrush.width = 2; + canvas.isDrawingMode = true; + }); + $('#pen-2').on('click', () => { + canvas.freeDrawingBrush = new fabric['PencilBrush'](canvas); + canvas.freeDrawingBrush.color = 'red'; + canvas.freeDrawingBrush.width = 2; + canvas.isDrawingMode = true; + }); + $('#pen-3').on('click', () => { + canvas.freeDrawingBrush = new fabric['PencilBrush'](canvas); + canvas.freeDrawingBrush.color = 'green'; + canvas.freeDrawingBrush.width = 2; + canvas.isDrawingMode = true; + }); + $('#pen-4').on('click', () => { + canvas.freeDrawingBrush = new fabric['PencilBrush'](canvas); + canvas.freeDrawingBrush.color = 'blue'; + canvas.freeDrawingBrush.width = 2; + canvas.isDrawingMode = true; + }); + $('#marker-1').on('click', () => { + canvas.freeDrawingBrush = new fabric['PencilBrush'](canvas); + canvas.freeDrawingBrush.color = 'rgba(255, 255, 0, 0.5)'; + canvas.freeDrawingBrush.width = 10; + canvas.isDrawingMode = true; + }); + $('#marker-2').on('click', () => { + canvas.freeDrawingBrush = new fabric['PencilBrush'](canvas); + canvas.freeDrawingBrush.color = 'rgba(241,229,170, 0.5)'; + canvas.freeDrawingBrush.width = 10; + canvas.isDrawingMode = true; + }); + $('#marker-3').on('click', () => { + canvas.freeDrawingBrush = new fabric['PencilBrush'](canvas); + canvas.freeDrawingBrush.color = 'rgba(51,204,0, 0.5)'; + canvas.freeDrawingBrush.width = 10; + canvas.isDrawingMode = true; + }); + $('#marker-4').on('click', () => { + canvas.freeDrawingBrush = new fabric['PencilBrush'](canvas); + canvas.freeDrawingBrush.color = 'rgba(75,141,242, 0.5)'; + canvas.freeDrawingBrush.width = 10; + canvas.isDrawingMode = true; + }); + $('#eraser').on('click', () => { + const { EraserBrush } = EraserBrushFactory(fabric); + const eraserBrush = new EraserBrush(canvas); + eraserBrush.width = 10; + eraserBrush.color = 'rgb(236,195,195)'; // erser works with opacity! + canvas.freeDrawingBrush = eraserBrush; + canvas.isDrawingMode = true; + }); + $('#eraser-path').on('click', () => { + const { EraserBrushPath } = EraserBrushPathFactory(fabric); + const eraserBrush = new EraserBrushPath(canvas); + eraserBrush.width = 8; + eraserBrush.color = 'rgba(236,195,220, 20)'; // erser works with opacity! + canvas.freeDrawingBrush = eraserBrush; + canvas.isDrawingMode = true; + }); + $('#text-1').on('click', () => { + self.activatePlaceTextBox = true; + canvas.isDrawingMode = false; + }); +}; diff --git a/src/public/app/widgets/type_widgets/canvas-note-utils/infinite-drawing-canvas.js b/src/public/app/widgets/type_widgets/canvas-note-utils/infinite-drawing-canvas.js new file mode 100644 index 000000000..cccba8200 --- /dev/null +++ b/src/public/app/widgets/type_widgets/canvas-note-utils/infinite-drawing-canvas.js @@ -0,0 +1,503 @@ +import _throttle from './lib/lodash.throttle.js'; +import _debounce from './lib/lodash.debounce.js'; +import sleep from './lib/sleep.js'; +import deleteIcon from './lib/deleteIcon.js'; + +var img = document.createElement('img'); +img.src = deleteIcon; + +/** + * Class of all valid Infinite Canvas States + * + * usage: + * const canvasState = new CanvasState(); + * canvasState.on('selecting', ()=>{}); + * canvasState.activate('selecting'); +Inspiration: https://stackoverflow.com/a/53917410 +https://developer.mozilla.org/en-US/docs/Web/API/EventTarget + */ +class CanvasState extends EventTarget { + constructor(initialState) { + this.states = { + IDLE: 'idle', + INTERACTING: 'interacting', + DRAGGING: 'dragging', + PANNING: 'panning', + SELECTING: 'selecting', + PINCH_ZOOMING: 'pinch_zooming', + SELECTED: 'selected,', + }; + + this.currentState = initialState || this.state.IDLE; + + this.listeners = {}; + } + + activate(state) { + if (this._isValidState(state)) { + this.currentState = state; + this.dispatchEvent(new Event(state)); + } else { + throw new Error(`This is not a valid State: '${state}`); + } + } + + _isValidState(state) { + const statesArray = Object.values(this.states); + return statesArray.find(state); + } + + get() { + return this.currentState; + } + + getStates() { + return this.states; + } +} + +/** + * Infinite Canvas + */ +class InfiniteCanvas { + constructor($canvas, $parent, $canvasContainer) { + this.$canvas = $canvas; + this.$canvasContainer = $canvasContainer; + this.$parent = $parent; + + // Canvas + this.isDragging; + this.selection; + this.lastPosX; + this.lastPosY; + this.startPosX = 0; + this.startPosY = 0; + this.numberOfPanEvents; + this.lastScale = 1; + this.fonts = [ + 'Times New Roman', + 'Arial', + 'Verdana', + 'Calibri', + 'Consolas', + 'Comic Sans MS', + ]; + this.width = this.scaledWidth = 1500; //px + this.height = this.scaledHeight = 1500; //px + this.drawWithTouch = false; + this.activatePlaceTextBox = false; + + // bind methods to this + this.handlePointerEventBefore = this.handlePointerEventBefore.bind(this); + this.resizeCanvas = this.resizeCanvas.bind(this); + this.handlePinch = this.handlePinch.bind(this); + this.handlePinchEnd = this.handlePinchEnd.bind(this); + this.handlePanStart = this.handlePanStart.bind(this); + this.handlePanning = this.handlePanning.bind(this); + this.handlePanEnd = this.handlePanEnd.bind(this); + this.transformCanvas = this.transformCanvas.bind(this); + this.resetZoom = this.resetZoom.bind(this); + this.cropCanvas = this.cropCanvas.bind(this); + this.placeTextBox = this.placeTextBox.bind(this); + } + + overrideFabric() { + const self = this; + + fabric.Object.prototype.controls.deleteControl = new fabric.Control({ + x: 0.5, + y: -0.5, + offsetY: 16, + cursorStyle: 'pointer', + mouseUpHandler: self.deleteObject, + render: self.renderIcon, + cornerSize: 24, + }); + } + + renderIcon(ctx, left, top, styleOverride, fabricObject) { + var size = this.cornerSize; + ctx.save(); + ctx.translate(left, top); + ctx.rotate(fabric.util.degreesToRadians(fabricObject.angle)); + ctx.drawImage(img, -size / 2, -size / 2, size, size); + ctx.restore(); + } + + deleteObject(eventData, target) { + var canvas = target.canvas; + canvas.remove(target); + canvas.requestRenderAll(); + } + + initFabric() { + this.overrideFabric(); + + const canvasElement = this.$canvas.get(0); // fabric.Canvas requires HTMLElement + this.canvasElement = canvasElement; + + const self = this; + const canvas = new fabric.Canvas(canvasElement, { + isDrawingMode: false, + allowTouchScrolling: true, + transparentCorners: false, + }); + this.$canvas = canvas; + // fabric.Object.prototype.transparentCorners = false; + + // Resizing + // FIXME: canvas should only enlarge, maybe we dont even need, since canvas will scroll behind parent! + // const canvasNote = this.$parent.get(0); + // new ResizeObserver(_throttle(this.resizeCanvas, 200)).observe(canvasNote); // this leads to a eraserbrush remaining... + + // Handle different input devices: Touch (Finger), Pen, Mouse + canvas.on('mouse:down:before', this.handlePointerEventBefore); + + this.hammer = new Hammer.Manager(canvas.upperCanvasEl); + var pinch = new Hammer.Pinch(); + var pan = new Hammer.Pan(); + this.hammer.add([pinch, pan]); + + // Zoom (Pinch) + // FIXME: not working + // Problem: Somehow eraser planes from matched do not overlay and then do not erase + this.hammer.on('pinchmove', _throttle(this.handlePinch, 20)); + // the pinchend call must be debounced, since a pinchmove event might + // occur after a couple of ms after the actual pinchend event. With the + // debounce, it is garuanted, that this.lastScale and the scale for the + // next pinch zoom is set correctly + this.hammer.on('pinchend', _debounce(this.handlePinchEnd, 200)); + + // Move Canvas + this.hammer.on('panstart', this.handlePanStart); + this.hammer.on('pan', this.handlePanning); + this.hammer.on('panend', this.handlePanEnd); + + canvas.transformCanvas = this.transformCanvas; + + return self; + } + + /** + * + * @param {string} direction [top, left, right, bottom] + * @param {float} distance distance in px + */ + transformCanvas(direction, distance) { + console.log('transforming', direction, distance); + const canvas = this.$canvas; + this.resetZoom(); + + const items = canvas.getObjects(); + + // Move all items, so that it seems canvas was added on the outside + for (let i = 0; i < items.length; i++) { + const item = canvas.item(i).setCoords(); + console.log('tc, item', item); + if (direction === 'top') { + // move all down + item.top = item.top + distance; + } + if (direction === 'left') { + // move all to the right + item.left = item.left + distance; + } + } + + let newWidth = this.scaledWidth, + newHeight = this.scaledHeight; + + if (direction === 'top' || direction === 'bottom') { + newHeight = this.scaledHeight + distance; + } else if (direction === 'left' || direction === 'right') { + newWidth = this.scaledWidth + distance; + } + this.scaledWidth = this.width = newWidth; + this.scaledHeight = this.height = newHeight; + canvas.setWidth(newWidth); + canvas.setHeight(newHeight); + + this.$canvasContainer.width(newWidth).height(newHeight); + + canvas.renderAll(); + console.log('called tc', direction, distance); + } + + resetZoom() { + const canvas = this.$canvas; + + // zoom level of canvas + canvas.setZoom(1); + // width of + canvas.setWidth(this.width); + canvas.setHeight(this.height); + // reset scale, so that for next pinch we start with "fresh" values + this.scaledWidth = this.width; + this.scaledHeight = this.height; + this.lastScale = 1; + // set div container of canvas + this.$canvasContainer.width(this.width).height(this.height); + } + + handlePointerEventBefore(fabricEvent) { + const canvas = this.$canvas; + const inputType = this.recognizeInput(fabricEvent.e); + console.log('mdb', fabricEvent, fabricEvent.e, 'inputType', inputType); + // place text box independent of touch type + if (this.activatePlaceTextBox) { + if (fabricEvent && fabricEvent.absolutePointer) { + this.placeTextBox(fabricEvent.absolutePointer.x, fabricEvent.absolutePointer.y); + this.activatePlaceTextBox = false; + return; + } + } + + // recognize touch + if (inputType === 'touch') { + if (this.drawWithTouch) { + // drawing + canvas.isDrawingMode = true; + } else { + // panning + console.log('mdb touch'); + canvas.isDrawingMode = false; + canvas.selection = false; + // unselect any possible targets (if you start the pan on an object) + if (fabricEvent.target && canvas) { + // source: https://stackoverflow.com/a/25535052 + canvas.deactivateAll().renderAll(); + } + } + } else if (inputType === 'pen') { + // draw with pen + console.log('mdb pen'); + canvas.isDrawingMode = true; + } else if (inputType === 'mouse') { + // draw with mouse + console.log('mdb mouse, draw'); + } else { + console.log('mdb input type not recognized!'); + throw new Error('input type not recognized!'); + } + } + + placeTextBox(x, y) { + const canvas = this.$canvas; + canvas.add( + new fabric.IText('Tap and Type', { + fontFamily: 'Arial', + // fontWeith: '200', + fontSize: 15, + left: x, + top: y, + }), + ); + canvas.isDrawingMode = false; + } + + handlePinch(e) { + console.log('hp', e); + const canvas = this.$canvas; + console.log('pinch', e, 'pinchingi scale', this.lastScale, e.scale); + // during pinch, we need to focus top left corner. + // otherwise canvas might slip underneath the container and misalign. + let point = null; + point = new fabric.Point(0, 0); + // point = new fabric.Point(e.center.x, e.center.y); + canvas.zoomToPoint(point, this.lastScale * e.scale); + } + + handlePinchEnd(e) { + const canvas = this.$canvas; + + console.log('hpe', e); + this.lastScale = this.lastScale * e.scale; + console.log('pinchend', this.lastScale, e.scale, e); + + // resize canvas, maybe this fixes eraser + this.scaledWidth = this.scaledWidth * e.scale; + this.scaledHeight = this.scaledHeight * e.scale; + canvas.setWidth(this.scaledWidth); + canvas.setHeight(this.scaledHeight); + + this.$canvasContainer.width(this.scaledWidth).height(this.scaledHeight); + + // ("width", `${self.width}px`); + // console.log('zoom100, cc', self.$canvasContainer); + + // reactivate drawing mode after the pinch is over + } + + handlePanStart(e) { + const canvas = this.$canvas; + console.log('panstart', e); + + if ( + e.pointerType === 'touch' && + !this.drawWithTouch // pointertype mouse and canvas state mouse-drag + ) { + canvas.isDrawingMode = false; + canvas.isDragging = true; + canvas.selection = false; + this.selection = false; + + var scrollContainer = $('#parentContainer').get(0); + this.startPosX = scrollContainer.scrollLeft; + this.startPosY = scrollContainer.scrollTop; + } + } + + handlePanning(e) { + const canvas = this.$canvas; + // console.log('panning', e); + + if (e.pointerType === 'touch') { + // console.log('pan', e); + if (canvas.isDragging) { + // scrolltest + const panMultiplier = 1.0; + const dx = this.startPosX - e.deltaX * panMultiplier; + const dy = this.startPosY - e.deltaY * panMultiplier; + var scrollContainer = $('#parentContainer'); + scrollContainer.scrollLeft(dx); + scrollContainer.scrollTop(dy); + canvas.requestRenderAll(); + } + } + } + + async handlePanEnd(e) { + const canvas = this.$canvas; + console.log('panend', e); + + if (e.pointerType === 'touch') { + // take momentum of panning to do it once panning is finished + // let deltaX = e.deltaX; + // let deltaY = e.deltaY; + // for(let v = Math.abs(e.overallVelocity); v>0; v=v-0.1) { + // if (deltaX > 0) { + // deltaX = e.deltaX + e.deltaX * v; + // } else { + // deltaX = e.deltaX - e.deltaX * v; + // } + // deltaY = e.deltaY + e.deltaY * v; + // const newEvent = {...e, overallVelocity: v, deltaX, deltaY}; + // console.log('vel', v, deltaX, deltaY, newEvent); + // this.handlePanning(newEvent); + // await this.sleep(1000); + // } + + // on mouse up we want to recalculate new interaction + // for all objects, so we call setViewportTransform + // canvas.setViewportTransform(canvas.viewportTransform); + canvas.isDragging = false; + canvas.selection = true; + + var scrollContainer = $('#parentContainer').get(0); + this.startPosX = scrollContainer.scrollLeft; + this.startPosY = scrollContainer.scrollTop; + } + } + + /** + * + * @param {FabricPointerEvent} e + */ + recognizeInput(e) { + const TOUCH = 'touch'; + const PEN = 'pen'; + const MOUSE = 'mouse'; + // we need to modify fabric.js in order to get the + // pointerevent and not only the touchevent when using pen + console.log('recognizeInput Touchevent', e); + + if (e.touches) { + if (e.touches.length > 1) { + // most likely pinch, since two fingers, aka touch inputs + console.log('recognizeInput', TOUCH); + return TOUCH; + } + if (e.touches.length === 1) { + // now it may be pen or one finger + const touchEvent = e.touches[0] || {}; + console.log('recognizeInput Touchevent', touchEvent); + if (touchEvent.radiusX === 0.5 && touchEvent.radiusY === 0.5) { + // when we have pointer event, we can distinguish between + // pen (buttons=1) and eraser (buttons=32) <- pointerevent + // at least on chrome; firefox not supported :-( + console.log('recognizeInput', PEN); + return PEN; + } else { + console.log('recognizeInput', TOUCH); + return TOUCH; + } + } + } else { + console.log('recognizeInput', MOUSE); + return MOUSE; + } + } + + // detect parent div size change + resizeCanvas() { + const canvas = this.$canvas; + const width = this.$parent.width(); + const height = this.$parent.height(); + console.log(`setting canvas to ${width} x ${height}px`); + // canvas.setWidth(width); + // canvas.setHeight(height); + canvas.setWidth(1500); + canvas.setHeight(1500); + canvas.renderAll(); + } + + /** + * Crop the canvas to the surrounding box of all elements on the canvas + * + Learnings: we must NOT use fabric.Group, since this messes with items and then + SVG export is scwed. Items coordinates are not set correctly! + fabric.Group(items).aCoords does NOT work. + Therefore we need to get bounding box ourselves + Note: Or maybe we can use group, destroy and readd everything afterwards: + http://fabricjs.com/manage-selection + https://gist.github.com/msievers/6069778#gistcomment-2030151 + https://stackoverflow.com/a/31828460 + */ + async cropCanvas() { + console.log('cropCanvas'); + const canvas = this.$canvas; + + // get all objects + const items = canvas.getObjects(); + // get maximum bounding rectangle of all objects + const bound = { tl: { x: Infinity, y: Infinity }, br: { x: 0, y: 0 } }; + for (let i = 0; i < items.length; i++) { + // focus on tl/br; + const item = items[i]; + const tl = item.aCoords.tl; + const br = item.aCoords.br; + console.log('cC, item', tl, br); + if (tl.x < bound.tl.x) { + bound.tl.x = tl.x; + } + if (tl.y < bound.tl.y) { + bound.tl.y = tl.y; + } + if (br.x > bound.br.x) { + bound.br.x = br.x; + } + if (br.y > bound.br.y) { + bound.br.y = br.y; + } + } + console.log('cC, bounds:', bound); + + // cut area on all sides + this.transformCanvas('left', -bound.tl.x); + this.transformCanvas('top', -bound.tl.y); + this.transformCanvas('right', -(this.width - bound.br.x + bound.tl.x)); + this.transformCanvas('bottom', -(this.height - bound.br.y + bound.tl.y)); + } +} + +export { InfiniteCanvas, CanvasState }; diff --git a/src/public/app/widgets/type_widgets/canvas-note-utils/lib/deleteIcon.js b/src/public/app/widgets/type_widgets/canvas-note-utils/lib/deleteIcon.js new file mode 100644 index 000000000..37e85759a --- /dev/null +++ b/src/public/app/widgets/type_widgets/canvas-note-utils/lib/deleteIcon.js @@ -0,0 +1,3 @@ +var deleteIcon = "data:image/svg+xml,%3C%3Fxml version='1.0' encoding='utf-8'%3F%3E%3C!DOCTYPE svg PUBLIC '-//W3C//DTD SVG 1.1//EN' 'http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd'%3E%3Csvg version='1.1' id='Ebene_1' xmlns='http://www.w3.org/2000/svg' xmlns:xlink='http://www.w3.org/1999/xlink' x='0px' y='0px' width='595.275px' height='595.275px' viewBox='200 215 230 470' xml:space='preserve'%3E%3Ccircle style='fill:%23F44336;' cx='299.76' cy='439.067' r='218.516'/%3E%3Cg%3E%3Crect x='267.162' y='307.978' transform='matrix(0.7071 -0.7071 0.7071 0.7071 -222.6202 340.6915)' style='fill:white;' width='65.545' height='262.18'/%3E%3Crect x='266.988' y='308.153' transform='matrix(0.7071 0.7071 -0.7071 0.7071 398.3889 -83.3116)' style='fill:white;' width='65.544' height='262.179'/%3E%3C/g%3E%3C/svg%3E"; + +export default deleteIcon; \ No newline at end of file diff --git a/src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.cloneDeep.js b/src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.cloneDeep.js new file mode 100644 index 000000000..5a9cf9cf9 --- /dev/null +++ b/src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.cloneDeep.js @@ -0,0 +1,1748 @@ +/** + * lodash (Custom Build) + * Build: `lodash modularize exports="npm" -o ./` + * Copyright jQuery Foundation and other contributors + * Released under MIT license + * Based on Underscore.js 1.8.3 + * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + */ + +/** Used as the size to enable large array optimizations. */ +var LARGE_ARRAY_SIZE = 200; + +/** Used to stand-in for `undefined` hash values. */ +var HASH_UNDEFINED = '__lodash_hash_undefined__'; + +/** Used as references for various `Number` constants. */ +var MAX_SAFE_INTEGER = 9007199254740991; + +/** `Object#toString` result references. */ +var argsTag = '[object Arguments]', + arrayTag = '[object Array]', + boolTag = '[object Boolean]', + dateTag = '[object Date]', + errorTag = '[object Error]', + funcTag = '[object Function]', + genTag = '[object GeneratorFunction]', + mapTag = '[object Map]', + numberTag = '[object Number]', + objectTag = '[object Object]', + promiseTag = '[object Promise]', + regexpTag = '[object RegExp]', + setTag = '[object Set]', + stringTag = '[object String]', + symbolTag = '[object Symbol]', + weakMapTag = '[object WeakMap]'; + +var arrayBufferTag = '[object ArrayBuffer]', + dataViewTag = '[object DataView]', + float32Tag = '[object Float32Array]', + float64Tag = '[object Float64Array]', + int8Tag = '[object Int8Array]', + int16Tag = '[object Int16Array]', + int32Tag = '[object Int32Array]', + uint8Tag = '[object Uint8Array]', + uint8ClampedTag = '[object Uint8ClampedArray]', + uint16Tag = '[object Uint16Array]', + uint32Tag = '[object Uint32Array]'; + +/** + * Used to match `RegExp` + * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). + */ +var reRegExpChar = /[\\^$.*+?()[\]{}|]/g; + +/** Used to match `RegExp` flags from their coerced string values. */ +var reFlags = /\w*$/; + +/** Used to detect host constructors (Safari). */ +var reIsHostCtor = /^\[object .+?Constructor\]$/; + +/** Used to detect unsigned integer values. */ +var reIsUint = /^(?:0|[1-9]\d*)$/; + +/** Used to identify `toStringTag` values supported by `_.clone`. */ +var cloneableTags = {}; +cloneableTags[argsTag] = cloneableTags[arrayTag] = +cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = +cloneableTags[boolTag] = cloneableTags[dateTag] = +cloneableTags[float32Tag] = cloneableTags[float64Tag] = +cloneableTags[int8Tag] = cloneableTags[int16Tag] = +cloneableTags[int32Tag] = cloneableTags[mapTag] = +cloneableTags[numberTag] = cloneableTags[objectTag] = +cloneableTags[regexpTag] = cloneableTags[setTag] = +cloneableTags[stringTag] = cloneableTags[symbolTag] = +cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = +cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; +cloneableTags[errorTag] = cloneableTags[funcTag] = +cloneableTags[weakMapTag] = false; + +/** Detect free variable `global` from Node.js. */ +var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; + +/** Detect free variable `self`. */ +var freeSelf = typeof self == 'object' && self && self.Object === Object && self; + +/** Used as a reference to the global object. */ +var root = freeGlobal || freeSelf || Function('return this')(); + +/** Detect free variable `exports`. */ +var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports; + +/** Detect free variable `module`. */ +var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module; + +/** Detect the popular CommonJS extension `module.exports`. */ +var moduleExports = freeModule && freeModule.exports === freeExports; + +/** + * Adds the key-value `pair` to `map`. + * + * @private + * @param {Object} map The map to modify. + * @param {Array} pair The key-value pair to add. + * @returns {Object} Returns `map`. + */ +function addMapEntry(map, pair) { + // Don't return `map.set` because it's not chainable in IE 11. + map.set(pair[0], pair[1]); + return map; +} + +/** + * Adds `value` to `set`. + * + * @private + * @param {Object} set The set to modify. + * @param {*} value The value to add. + * @returns {Object} Returns `set`. + */ +function addSetEntry(set, value) { + // Don't return `set.add` because it's not chainable in IE 11. + set.add(value); + return set; +} + +/** + * A specialized version of `_.forEach` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ +function arrayEach(array, iteratee) { + var index = -1, + length = array ? array.length : 0; + + while (++index < length) { + if (iteratee(array[index], index, array) === false) { + break; + } + } + return array; +} + +/** + * Appends the elements of `values` to `array`. + * + * @private + * @param {Array} array The array to modify. + * @param {Array} values The values to append. + * @returns {Array} Returns `array`. + */ +function arrayPush(array, values) { + var index = -1, + length = values.length, + offset = array.length; + + while (++index < length) { + array[offset + index] = values[index]; + } + return array; +} + +/** + * A specialized version of `_.reduce` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initAccum] Specify using the first element of `array` as + * the initial value. + * @returns {*} Returns the accumulated value. + */ +function arrayReduce(array, iteratee, accumulator, initAccum) { + var index = -1, + length = array ? array.length : 0; + + if (initAccum && length) { + accumulator = array[++index]; + } + while (++index < length) { + accumulator = iteratee(accumulator, array[index], index, array); + } + return accumulator; +} + +/** + * The base implementation of `_.times` without support for iteratee shorthands + * or max array length checks. + * + * @private + * @param {number} n The number of times to invoke `iteratee`. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the array of results. + */ +function baseTimes(n, iteratee) { + var index = -1, + result = Array(n); + + while (++index < n) { + result[index] = iteratee(index); + } + return result; +} + +/** + * Gets the value at `key` of `object`. + * + * @private + * @param {Object} [object] The object to query. + * @param {string} key The key of the property to get. + * @returns {*} Returns the property value. + */ +function getValue(object, key) { + return object == null ? undefined : object[key]; +} + +/** + * Checks if `value` is a host object in IE < 9. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a host object, else `false`. + */ +function isHostObject(value) { + // Many host objects are `Object` objects that can coerce to strings + // despite having improperly defined `toString` methods. + var result = false; + if (value != null && typeof value.toString != 'function') { + try { + result = !!(value + ''); + } catch (e) {} + } + return result; +} + +/** + * Converts `map` to its key-value pairs. + * + * @private + * @param {Object} map The map to convert. + * @returns {Array} Returns the key-value pairs. + */ +function mapToArray(map) { + var index = -1, + result = Array(map.size); + + map.forEach(function(value, key) { + result[++index] = [key, value]; + }); + return result; +} + +/** + * Creates a unary function that invokes `func` with its argument transformed. + * + * @private + * @param {Function} func The function to wrap. + * @param {Function} transform The argument transform. + * @returns {Function} Returns the new function. + */ +function overArg(func, transform) { + return function(arg) { + return func(transform(arg)); + }; +} + +/** + * Converts `set` to an array of its values. + * + * @private + * @param {Object} set The set to convert. + * @returns {Array} Returns the values. + */ +function setToArray(set) { + var index = -1, + result = Array(set.size); + + set.forEach(function(value) { + result[++index] = value; + }); + return result; +} + +/** Used for built-in method references. */ +var arrayProto = Array.prototype, + funcProto = Function.prototype, + objectProto = Object.prototype; + +/** Used to detect overreaching core-js shims. */ +var coreJsData = root['__core-js_shared__']; + +/** Used to detect methods masquerading as native. */ +var maskSrcKey = (function() { + var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ''); + return uid ? ('Symbol(src)_1.' + uid) : ''; +}()); + +/** Used to resolve the decompiled source of functions. */ +var funcToString = funcProto.toString; + +/** Used to check objects for own properties. */ +var hasOwnProperty = objectProto.hasOwnProperty; + +/** + * Used to resolve the + * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) + * of values. + */ +var objectToString = objectProto.toString; + +/** Used to detect if a method is native. */ +var reIsNative = RegExp('^' + + funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') + .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' +); + +/** Built-in value references. */ +var Buffer = moduleExports ? root.Buffer : undefined, + Symbol = root.Symbol, + Uint8Array = root.Uint8Array, + getPrototype = overArg(Object.getPrototypeOf, Object), + objectCreate = Object.create, + propertyIsEnumerable = objectProto.propertyIsEnumerable, + splice = arrayProto.splice; + +/* Built-in method references for those with the same name as other `lodash` methods. */ +var nativeGetSymbols = Object.getOwnPropertySymbols, + nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, + nativeKeys = overArg(Object.keys, Object); + +/* Built-in method references that are verified to be native. */ +var DataView = getNative(root, 'DataView'), + Map = getNative(root, 'Map'), + Promise = getNative(root, 'Promise'), + Set = getNative(root, 'Set'), + WeakMap = getNative(root, 'WeakMap'), + nativeCreate = getNative(Object, 'create'); + +/** Used to detect maps, sets, and weakmaps. */ +var dataViewCtorString = toSource(DataView), + mapCtorString = toSource(Map), + promiseCtorString = toSource(Promise), + setCtorString = toSource(Set), + weakMapCtorString = toSource(WeakMap); + +/** Used to convert symbols to primitives and strings. */ +var symbolProto = Symbol ? Symbol.prototype : undefined, + symbolValueOf = symbolProto ? symbolProto.valueOf : undefined; + +/** + * Creates a hash object. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ +function Hash(entries) { + var index = -1, + length = entries ? entries.length : 0; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } +} + +/** + * Removes all key-value entries from the hash. + * + * @private + * @name clear + * @memberOf Hash + */ +function hashClear() { + this.__data__ = nativeCreate ? nativeCreate(null) : {}; +} + +/** + * Removes `key` and its value from the hash. + * + * @private + * @name delete + * @memberOf Hash + * @param {Object} hash The hash to modify. + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ +function hashDelete(key) { + return this.has(key) && delete this.__data__[key]; +} + +/** + * Gets the hash value for `key`. + * + * @private + * @name get + * @memberOf Hash + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ +function hashGet(key) { + var data = this.__data__; + if (nativeCreate) { + var result = data[key]; + return result === HASH_UNDEFINED ? undefined : result; + } + return hasOwnProperty.call(data, key) ? data[key] : undefined; +} + +/** + * Checks if a hash value for `key` exists. + * + * @private + * @name has + * @memberOf Hash + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ +function hashHas(key) { + var data = this.__data__; + return nativeCreate ? data[key] !== undefined : hasOwnProperty.call(data, key); +} + +/** + * Sets the hash `key` to `value`. + * + * @private + * @name set + * @memberOf Hash + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the hash instance. + */ +function hashSet(key, value) { + var data = this.__data__; + data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; + return this; +} + +// Add methods to `Hash`. +Hash.prototype.clear = hashClear; +Hash.prototype['delete'] = hashDelete; +Hash.prototype.get = hashGet; +Hash.prototype.has = hashHas; +Hash.prototype.set = hashSet; + +/** + * Creates an list cache object. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ +function ListCache(entries) { + var index = -1, + length = entries ? entries.length : 0; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } +} + +/** + * Removes all key-value entries from the list cache. + * + * @private + * @name clear + * @memberOf ListCache + */ +function listCacheClear() { + this.__data__ = []; +} + +/** + * Removes `key` and its value from the list cache. + * + * @private + * @name delete + * @memberOf ListCache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ +function listCacheDelete(key) { + var data = this.__data__, + index = assocIndexOf(data, key); + + if (index < 0) { + return false; + } + var lastIndex = data.length - 1; + if (index == lastIndex) { + data.pop(); + } else { + splice.call(data, index, 1); + } + return true; +} + +/** + * Gets the list cache value for `key`. + * + * @private + * @name get + * @memberOf ListCache + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ +function listCacheGet(key) { + var data = this.__data__, + index = assocIndexOf(data, key); + + return index < 0 ? undefined : data[index][1]; +} + +/** + * Checks if a list cache value for `key` exists. + * + * @private + * @name has + * @memberOf ListCache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ +function listCacheHas(key) { + return assocIndexOf(this.__data__, key) > -1; +} + +/** + * Sets the list cache `key` to `value`. + * + * @private + * @name set + * @memberOf ListCache + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the list cache instance. + */ +function listCacheSet(key, value) { + var data = this.__data__, + index = assocIndexOf(data, key); + + if (index < 0) { + data.push([key, value]); + } else { + data[index][1] = value; + } + return this; +} + +// Add methods to `ListCache`. +ListCache.prototype.clear = listCacheClear; +ListCache.prototype['delete'] = listCacheDelete; +ListCache.prototype.get = listCacheGet; +ListCache.prototype.has = listCacheHas; +ListCache.prototype.set = listCacheSet; + +/** + * Creates a map cache object to store key-value pairs. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ +function MapCache(entries) { + var index = -1, + length = entries ? entries.length : 0; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } +} + +/** + * Removes all key-value entries from the map. + * + * @private + * @name clear + * @memberOf MapCache + */ +function mapCacheClear() { + this.__data__ = { + 'hash': new Hash, + 'map': new (Map || ListCache), + 'string': new Hash + }; +} + +/** + * Removes `key` and its value from the map. + * + * @private + * @name delete + * @memberOf MapCache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ +function mapCacheDelete(key) { + return getMapData(this, key)['delete'](key); +} + +/** + * Gets the map value for `key`. + * + * @private + * @name get + * @memberOf MapCache + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ +function mapCacheGet(key) { + return getMapData(this, key).get(key); +} + +/** + * Checks if a map value for `key` exists. + * + * @private + * @name has + * @memberOf MapCache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ +function mapCacheHas(key) { + return getMapData(this, key).has(key); +} + +/** + * Sets the map `key` to `value`. + * + * @private + * @name set + * @memberOf MapCache + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the map cache instance. + */ +function mapCacheSet(key, value) { + getMapData(this, key).set(key, value); + return this; +} + +// Add methods to `MapCache`. +MapCache.prototype.clear = mapCacheClear; +MapCache.prototype['delete'] = mapCacheDelete; +MapCache.prototype.get = mapCacheGet; +MapCache.prototype.has = mapCacheHas; +MapCache.prototype.set = mapCacheSet; + +/** + * Creates a stack cache object to store key-value pairs. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ +function Stack(entries) { + this.__data__ = new ListCache(entries); +} + +/** + * Removes all key-value entries from the stack. + * + * @private + * @name clear + * @memberOf Stack + */ +function stackClear() { + this.__data__ = new ListCache; +} + +/** + * Removes `key` and its value from the stack. + * + * @private + * @name delete + * @memberOf Stack + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ +function stackDelete(key) { + return this.__data__['delete'](key); +} + +/** + * Gets the stack value for `key`. + * + * @private + * @name get + * @memberOf Stack + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ +function stackGet(key) { + return this.__data__.get(key); +} + +/** + * Checks if a stack value for `key` exists. + * + * @private + * @name has + * @memberOf Stack + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ +function stackHas(key) { + return this.__data__.has(key); +} + +/** + * Sets the stack `key` to `value`. + * + * @private + * @name set + * @memberOf Stack + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the stack cache instance. + */ +function stackSet(key, value) { + var cache = this.__data__; + if (cache instanceof ListCache) { + var pairs = cache.__data__; + if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { + pairs.push([key, value]); + return this; + } + cache = this.__data__ = new MapCache(pairs); + } + cache.set(key, value); + return this; +} + +// Add methods to `Stack`. +Stack.prototype.clear = stackClear; +Stack.prototype['delete'] = stackDelete; +Stack.prototype.get = stackGet; +Stack.prototype.has = stackHas; +Stack.prototype.set = stackSet; + +/** + * Creates an array of the enumerable property names of the array-like `value`. + * + * @private + * @param {*} value The value to query. + * @param {boolean} inherited Specify returning inherited property names. + * @returns {Array} Returns the array of property names. + */ +function arrayLikeKeys(value, inherited) { + // Safari 8.1 makes `arguments.callee` enumerable in strict mode. + // Safari 9 makes `arguments.length` enumerable in strict mode. + var result = (isArray(value) || isArguments(value)) + ? baseTimes(value.length, String) + : []; + + var length = result.length, + skipIndexes = !!length; + + for (var key in value) { + if ((inherited || hasOwnProperty.call(value, key)) && + !(skipIndexes && (key == 'length' || isIndex(key, length)))) { + result.push(key); + } + } + return result; +} + +/** + * Assigns `value` to `key` of `object` if the existing value is not equivalent + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. + */ +function assignValue(object, key, value) { + var objValue = object[key]; + if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || + (value === undefined && !(key in object))) { + object[key] = value; + } +} + +/** + * Gets the index at which the `key` is found in `array` of key-value pairs. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} key The key to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + */ +function assocIndexOf(array, key) { + var length = array.length; + while (length--) { + if (eq(array[length][0], key)) { + return length; + } + } + return -1; +} + +/** + * The base implementation of `_.assign` without support for multiple sources + * or `customizer` functions. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @returns {Object} Returns `object`. + */ +function baseAssign(object, source) { + return object && copyObject(source, keys(source), object); +} + +/** + * The base implementation of `_.clone` and `_.cloneDeep` which tracks + * traversed objects. + * + * @private + * @param {*} value The value to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @param {boolean} [isFull] Specify a clone including symbols. + * @param {Function} [customizer] The function to customize cloning. + * @param {string} [key] The key of `value`. + * @param {Object} [object] The parent object of `value`. + * @param {Object} [stack] Tracks traversed objects and their clone counterparts. + * @returns {*} Returns the cloned value. + */ +function baseClone(value, isDeep, isFull, customizer, key, object, stack) { + var result; + if (customizer) { + result = object ? customizer(value, key, object, stack) : customizer(value); + } + if (result !== undefined) { + return result; + } + if (!isObject(value)) { + return value; + } + var isArr = isArray(value); + if (isArr) { + result = initCloneArray(value); + if (!isDeep) { + return copyArray(value, result); + } + } else { + var tag = getTag(value), + isFunc = tag == funcTag || tag == genTag; + + if (isBuffer(value)) { + return cloneBuffer(value, isDeep); + } + if (tag == objectTag || tag == argsTag || (isFunc && !object)) { + if (isHostObject(value)) { + return object ? value : {}; + } + result = initCloneObject(isFunc ? {} : value); + if (!isDeep) { + return copySymbols(value, baseAssign(result, value)); + } + } else { + if (!cloneableTags[tag]) { + return object ? value : {}; + } + result = initCloneByTag(value, tag, baseClone, isDeep); + } + } + // Check for circular references and return its corresponding clone. + stack || (stack = new Stack); + var stacked = stack.get(value); + if (stacked) { + return stacked; + } + stack.set(value, result); + + if (!isArr) { + var props = isFull ? getAllKeys(value) : keys(value); + } + arrayEach(props || value, function(subValue, key) { + if (props) { + key = subValue; + subValue = value[key]; + } + // Recursively populate clone (susceptible to call stack limits). + assignValue(result, key, baseClone(subValue, isDeep, isFull, customizer, key, value, stack)); + }); + return result; +} + +/** + * The base implementation of `_.create` without support for assigning + * properties to the created object. + * + * @private + * @param {Object} prototype The object to inherit from. + * @returns {Object} Returns the new object. + */ +function baseCreate(proto) { + return isObject(proto) ? objectCreate(proto) : {}; +} + +/** + * The base implementation of `getAllKeys` and `getAllKeysIn` which uses + * `keysFunc` and `symbolsFunc` to get the enumerable property names and + * symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {Function} keysFunc The function to get the keys of `object`. + * @param {Function} symbolsFunc The function to get the symbols of `object`. + * @returns {Array} Returns the array of property names and symbols. + */ +function baseGetAllKeys(object, keysFunc, symbolsFunc) { + var result = keysFunc(object); + return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); +} + +/** + * The base implementation of `getTag`. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the `toStringTag`. + */ +function baseGetTag(value) { + return objectToString.call(value); +} + +/** + * The base implementation of `_.isNative` without bad shim checks. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a native function, + * else `false`. + */ +function baseIsNative(value) { + if (!isObject(value) || isMasked(value)) { + return false; + } + var pattern = (isFunction(value) || isHostObject(value)) ? reIsNative : reIsHostCtor; + return pattern.test(toSource(value)); +} + +/** + * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + */ +function baseKeys(object) { + if (!isPrototype(object)) { + return nativeKeys(object); + } + var result = []; + for (var key in Object(object)) { + if (hasOwnProperty.call(object, key) && key != 'constructor') { + result.push(key); + } + } + return result; +} + +/** + * Creates a clone of `buffer`. + * + * @private + * @param {Buffer} buffer The buffer to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Buffer} Returns the cloned buffer. + */ +function cloneBuffer(buffer, isDeep) { + if (isDeep) { + return buffer.slice(); + } + var result = new buffer.constructor(buffer.length); + buffer.copy(result); + return result; +} + +/** + * Creates a clone of `arrayBuffer`. + * + * @private + * @param {ArrayBuffer} arrayBuffer The array buffer to clone. + * @returns {ArrayBuffer} Returns the cloned array buffer. + */ +function cloneArrayBuffer(arrayBuffer) { + var result = new arrayBuffer.constructor(arrayBuffer.byteLength); + new Uint8Array(result).set(new Uint8Array(arrayBuffer)); + return result; +} + +/** + * Creates a clone of `dataView`. + * + * @private + * @param {Object} dataView The data view to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned data view. + */ +function cloneDataView(dataView, isDeep) { + var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; + return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); +} + +/** + * Creates a clone of `map`. + * + * @private + * @param {Object} map The map to clone. + * @param {Function} cloneFunc The function to clone values. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned map. + */ +function cloneMap(map, isDeep, cloneFunc) { + var array = isDeep ? cloneFunc(mapToArray(map), true) : mapToArray(map); + return arrayReduce(array, addMapEntry, new map.constructor); +} + +/** + * Creates a clone of `regexp`. + * + * @private + * @param {Object} regexp The regexp to clone. + * @returns {Object} Returns the cloned regexp. + */ +function cloneRegExp(regexp) { + var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); + result.lastIndex = regexp.lastIndex; + return result; +} + +/** + * Creates a clone of `set`. + * + * @private + * @param {Object} set The set to clone. + * @param {Function} cloneFunc The function to clone values. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned set. + */ +function cloneSet(set, isDeep, cloneFunc) { + var array = isDeep ? cloneFunc(setToArray(set), true) : setToArray(set); + return arrayReduce(array, addSetEntry, new set.constructor); +} + +/** + * Creates a clone of the `symbol` object. + * + * @private + * @param {Object} symbol The symbol object to clone. + * @returns {Object} Returns the cloned symbol object. + */ +function cloneSymbol(symbol) { + return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; +} + +/** + * Creates a clone of `typedArray`. + * + * @private + * @param {Object} typedArray The typed array to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned typed array. + */ +function cloneTypedArray(typedArray, isDeep) { + var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; + return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); +} + +/** + * Copies the values of `source` to `array`. + * + * @private + * @param {Array} source The array to copy values from. + * @param {Array} [array=[]] The array to copy values to. + * @returns {Array} Returns `array`. + */ +function copyArray(source, array) { + var index = -1, + length = source.length; + + array || (array = Array(length)); + while (++index < length) { + array[index] = source[index]; + } + return array; +} + +/** + * Copies properties of `source` to `object`. + * + * @private + * @param {Object} source The object to copy properties from. + * @param {Array} props The property identifiers to copy. + * @param {Object} [object={}] The object to copy properties to. + * @param {Function} [customizer] The function to customize copied values. + * @returns {Object} Returns `object`. + */ +function copyObject(source, props, object, customizer) { + object || (object = {}); + + var index = -1, + length = props.length; + + while (++index < length) { + var key = props[index]; + + var newValue = customizer + ? customizer(object[key], source[key], key, object, source) + : undefined; + + assignValue(object, key, newValue === undefined ? source[key] : newValue); + } + return object; +} + +/** + * Copies own symbol properties of `source` to `object`. + * + * @private + * @param {Object} source The object to copy symbols from. + * @param {Object} [object={}] The object to copy symbols to. + * @returns {Object} Returns `object`. + */ +function copySymbols(source, object) { + return copyObject(source, getSymbols(source), object); +} + +/** + * Creates an array of own enumerable property names and symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names and symbols. + */ +function getAllKeys(object) { + return baseGetAllKeys(object, keys, getSymbols); +} + +/** + * Gets the data for `map`. + * + * @private + * @param {Object} map The map to query. + * @param {string} key The reference key. + * @returns {*} Returns the map data. + */ +function getMapData(map, key) { + var data = map.__data__; + return isKeyable(key) + ? data[typeof key == 'string' ? 'string' : 'hash'] + : data.map; +} + +/** + * Gets the native function at `key` of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {string} key The key of the method to get. + * @returns {*} Returns the function if it's native, else `undefined`. + */ +function getNative(object, key) { + var value = getValue(object, key); + return baseIsNative(value) ? value : undefined; +} + +/** + * Creates an array of the own enumerable symbol properties of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of symbols. + */ +var getSymbols = nativeGetSymbols ? overArg(nativeGetSymbols, Object) : stubArray; + +/** + * Gets the `toStringTag` of `value`. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the `toStringTag`. + */ +var getTag = baseGetTag; + +// Fallback for data views, maps, sets, and weak maps in IE 11, +// for data views in Edge < 14, and promises in Node.js. +if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || + (Map && getTag(new Map) != mapTag) || + (Promise && getTag(Promise.resolve()) != promiseTag) || + (Set && getTag(new Set) != setTag) || + (WeakMap && getTag(new WeakMap) != weakMapTag)) { + getTag = function(value) { + var result = objectToString.call(value), + Ctor = result == objectTag ? value.constructor : undefined, + ctorString = Ctor ? toSource(Ctor) : undefined; + + if (ctorString) { + switch (ctorString) { + case dataViewCtorString: return dataViewTag; + case mapCtorString: return mapTag; + case promiseCtorString: return promiseTag; + case setCtorString: return setTag; + case weakMapCtorString: return weakMapTag; + } + } + return result; + }; +} + +/** + * Initializes an array clone. + * + * @private + * @param {Array} array The array to clone. + * @returns {Array} Returns the initialized clone. + */ +function initCloneArray(array) { + var length = array.length, + result = array.constructor(length); + + // Add properties assigned by `RegExp#exec`. + if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { + result.index = array.index; + result.input = array.input; + } + return result; +} + +/** + * Initializes an object clone. + * + * @private + * @param {Object} object The object to clone. + * @returns {Object} Returns the initialized clone. + */ +function initCloneObject(object) { + return (typeof object.constructor == 'function' && !isPrototype(object)) + ? baseCreate(getPrototype(object)) + : {}; +} + +/** + * Initializes an object clone based on its `toStringTag`. + * + * **Note:** This function only supports cloning values with tags of + * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. + * + * @private + * @param {Object} object The object to clone. + * @param {string} tag The `toStringTag` of the object to clone. + * @param {Function} cloneFunc The function to clone values. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the initialized clone. + */ +function initCloneByTag(object, tag, cloneFunc, isDeep) { + var Ctor = object.constructor; + switch (tag) { + case arrayBufferTag: + return cloneArrayBuffer(object); + + case boolTag: + case dateTag: + return new Ctor(+object); + + case dataViewTag: + return cloneDataView(object, isDeep); + + case float32Tag: case float64Tag: + case int8Tag: case int16Tag: case int32Tag: + case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: + return cloneTypedArray(object, isDeep); + + case mapTag: + return cloneMap(object, isDeep, cloneFunc); + + case numberTag: + case stringTag: + return new Ctor(object); + + case regexpTag: + return cloneRegExp(object); + + case setTag: + return cloneSet(object, isDeep, cloneFunc); + + case symbolTag: + return cloneSymbol(object); + } +} + +/** + * Checks if `value` is a valid array-like index. + * + * @private + * @param {*} value The value to check. + * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. + * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. + */ +function isIndex(value, length) { + length = length == null ? MAX_SAFE_INTEGER : length; + return !!length && + (typeof value == 'number' || reIsUint.test(value)) && + (value > -1 && value % 1 == 0 && value < length); +} + +/** + * Checks if `value` is suitable for use as unique object key. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is suitable, else `false`. + */ +function isKeyable(value) { + var type = typeof value; + return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') + ? (value !== '__proto__') + : (value === null); +} + +/** + * Checks if `func` has its source masked. + * + * @private + * @param {Function} func The function to check. + * @returns {boolean} Returns `true` if `func` is masked, else `false`. + */ +function isMasked(func) { + return !!maskSrcKey && (maskSrcKey in func); +} + +/** + * Checks if `value` is likely a prototype object. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. + */ +function isPrototype(value) { + var Ctor = value && value.constructor, + proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; + + return value === proto; +} + +/** + * Converts `func` to its source code. + * + * @private + * @param {Function} func The function to process. + * @returns {string} Returns the source code. + */ +function toSource(func) { + if (func != null) { + try { + return funcToString.call(func); + } catch (e) {} + try { + return (func + ''); + } catch (e) {} + } + return ''; +} + +/** + * This method is like `_.clone` except that it recursively clones `value`. + * + * @static + * @memberOf _ + * @since 1.0.0 + * @category Lang + * @param {*} value The value to recursively clone. + * @returns {*} Returns the deep cloned value. + * @see _.clone + * @example + * + * var objects = [{ 'a': 1 }, { 'b': 2 }]; + * + * var deep = _.cloneDeep(objects); + * console.log(deep[0] === objects[0]); + * // => false + */ +function cloneDeep(value) { + return baseClone(value, true, true); +} + +/** + * Performs a + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * comparison between two values to determine if they are equivalent. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @example + * + * var object = { 'a': 1 }; + * var other = { 'a': 1 }; + * + * _.eq(object, object); + * // => true + * + * _.eq(object, other); + * // => false + * + * _.eq('a', 'a'); + * // => true + * + * _.eq('a', Object('a')); + * // => false + * + * _.eq(NaN, NaN); + * // => true + */ +function eq(value, other) { + return value === other || (value !== value && other !== other); +} + +/** + * Checks if `value` is likely an `arguments` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an `arguments` object, + * else `false`. + * @example + * + * _.isArguments(function() { return arguments; }()); + * // => true + * + * _.isArguments([1, 2, 3]); + * // => false + */ +function isArguments(value) { + // Safari 8.1 makes `arguments.callee` enumerable in strict mode. + return isArrayLikeObject(value) && hasOwnProperty.call(value, 'callee') && + (!propertyIsEnumerable.call(value, 'callee') || objectToString.call(value) == argsTag); +} + +/** + * Checks if `value` is classified as an `Array` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array, else `false`. + * @example + * + * _.isArray([1, 2, 3]); + * // => true + * + * _.isArray(document.body.children); + * // => false + * + * _.isArray('abc'); + * // => false + * + * _.isArray(_.noop); + * // => false + */ +var isArray = Array.isArray; + +/** + * Checks if `value` is array-like. A value is considered array-like if it's + * not a function and has a `value.length` that's an integer greater than or + * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is array-like, else `false`. + * @example + * + * _.isArrayLike([1, 2, 3]); + * // => true + * + * _.isArrayLike(document.body.children); + * // => true + * + * _.isArrayLike('abc'); + * // => true + * + * _.isArrayLike(_.noop); + * // => false + */ +function isArrayLike(value) { + return value != null && isLength(value.length) && !isFunction(value); +} + +/** + * This method is like `_.isArrayLike` except that it also checks if `value` + * is an object. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array-like object, + * else `false`. + * @example + * + * _.isArrayLikeObject([1, 2, 3]); + * // => true + * + * _.isArrayLikeObject(document.body.children); + * // => true + * + * _.isArrayLikeObject('abc'); + * // => false + * + * _.isArrayLikeObject(_.noop); + * // => false + */ +function isArrayLikeObject(value) { + return isObjectLike(value) && isArrayLike(value); +} + +/** + * Checks if `value` is a buffer. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a buffer, else `false`. + * @example + * + * _.isBuffer(new Buffer(2)); + * // => true + * + * _.isBuffer(new Uint8Array(2)); + * // => false + */ +var isBuffer = nativeIsBuffer || stubFalse; + +/** + * Checks if `value` is classified as a `Function` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a function, else `false`. + * @example + * + * _.isFunction(_); + * // => true + * + * _.isFunction(/abc/); + * // => false + */ +function isFunction(value) { + // The use of `Object#toString` avoids issues with the `typeof` operator + // in Safari 8-9 which returns 'object' for typed array and other constructors. + var tag = isObject(value) ? objectToString.call(value) : ''; + return tag == funcTag || tag == genTag; +} + +/** + * Checks if `value` is a valid array-like length. + * + * **Note:** This method is loosely based on + * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. + * @example + * + * _.isLength(3); + * // => true + * + * _.isLength(Number.MIN_VALUE); + * // => false + * + * _.isLength(Infinity); + * // => false + * + * _.isLength('3'); + * // => false + */ +function isLength(value) { + return typeof value == 'number' && + value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; +} + +/** + * Checks if `value` is the + * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) + * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(_.noop); + * // => true + * + * _.isObject(null); + * // => false + */ +function isObject(value) { + var type = typeof value; + return !!value && (type == 'object' || type == 'function'); +} + +/** + * Checks if `value` is object-like. A value is object-like if it's not `null` + * and has a `typeof` result of "object". + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @example + * + * _.isObjectLike({}); + * // => true + * + * _.isObjectLike([1, 2, 3]); + * // => true + * + * _.isObjectLike(_.noop); + * // => false + * + * _.isObjectLike(null); + * // => false + */ +function isObjectLike(value) { + return !!value && typeof value == 'object'; +} + +/** + * Creates an array of the own enumerable property names of `object`. + * + * **Note:** Non-object values are coerced to objects. See the + * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) + * for more details. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.keys(new Foo); + * // => ['a', 'b'] (iteration order is not guaranteed) + * + * _.keys('hi'); + * // => ['0', '1'] + */ +function keys(object) { + return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object); +} + +/** + * This method returns a new empty array. + * + * @static + * @memberOf _ + * @since 4.13.0 + * @category Util + * @returns {Array} Returns the new empty array. + * @example + * + * var arrays = _.times(2, _.stubArray); + * + * console.log(arrays); + * // => [[], []] + * + * console.log(arrays[0] === arrays[1]); + * // => false + */ +function stubArray() { + return []; +} + +/** + * This method returns `false`. + * + * @static + * @memberOf _ + * @since 4.13.0 + * @category Util + * @returns {boolean} Returns `false`. + * @example + * + * _.times(2, _.stubFalse); + * // => [false, false] + */ +function stubFalse() { + return false; +} + +export default cloneDeep; diff --git a/src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.debounce.js b/src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.debounce.js new file mode 100644 index 000000000..a930f7732 --- /dev/null +++ b/src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.debounce.js @@ -0,0 +1,70 @@ +/** + * Returns a function, that, as long as it continues to be invoked, will not + * be triggered. The function will be called after it stops being called for + * N milliseconds. If `immediate` is passed, trigger the function on the + * leading edge, instead of the trailing. The function also has a property 'clear' + * that is a function which will clear the timer to prevent previously scheduled executions. + * + * @source underscore.js + * @see http://unscriptable.com/2009/03/20/debouncing-javascript-methods/ + * @param {Function} function to wrap + * @param {Number} timeout in ms (`100`) + * @param {Boolean} whether to execute at the beginning (`false`) + * @api public + */ +function debounce(func, wait, immediate){ + var timeout, args, context, timestamp, result; + if (null == wait) wait = 100; + + function later() { + var last = Date.now() - timestamp; + + if (last < wait && last >= 0) { + timeout = setTimeout(later, wait - last); + } else { + timeout = null; + if (!immediate) { + result = func.apply(context, args); + context = args = null; + } + } + }; + + var debounced = function(){ + context = this; + args = arguments; + timestamp = Date.now(); + var callNow = immediate && !timeout; + if (!timeout) timeout = setTimeout(later, wait); + if (callNow) { + result = func.apply(context, args); + context = args = null; + } + + return result; + }; + + debounced.clear = function() { + if (timeout) { + clearTimeout(timeout); + timeout = null; + } + }; + + debounced.flush = function() { + if (timeout) { + result = func.apply(context, args); + context = args = null; + + clearTimeout(timeout); + timeout = null; + } + }; + + return debounced; +}; + +// Adds compatibility for ES modules +debounce.debounce = debounce; + +export default debounce; diff --git a/src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.throttle.js b/src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.throttle.js new file mode 100644 index 000000000..91309ead0 --- /dev/null +++ b/src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.throttle.js @@ -0,0 +1,439 @@ +/** + * lodash (Custom Build) + * Build: `lodash modularize exports="npm" -o ./` + * Copyright jQuery Foundation and other contributors + * Released under MIT license + * Based on Underscore.js 1.8.3 + * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + */ + +/** Used as the `TypeError` message for "Functions" methods. */ +var FUNC_ERROR_TEXT = 'Expected a function'; + +/** Used as references for various `Number` constants. */ +var NAN = 0 / 0; + +/** `Object#toString` result references. */ +var symbolTag = '[object Symbol]'; + +/** Used to match leading and trailing whitespace. */ +var reTrim = /^\s+|\s+$/g; + +/** Used to detect bad signed hexadecimal string values. */ +var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; + +/** Used to detect binary string values. */ +var reIsBinary = /^0b[01]+$/i; + +/** Used to detect octal string values. */ +var reIsOctal = /^0o[0-7]+$/i; + +/** Built-in method references without a dependency on `root`. */ +var freeParseInt = parseInt; + +/** Detect free variable `global` from Node.js. */ +var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; + +/** Detect free variable `self`. */ +var freeSelf = typeof self == 'object' && self && self.Object === Object && self; + +/** Used as a reference to the global object. */ +var root = freeGlobal || freeSelf || Function('return this')(); + +/** Used for built-in method references. */ +var objectProto = Object.prototype; + +/** + * Used to resolve the + * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) + * of values. + */ +var objectToString = objectProto.toString; + +/* Built-in method references for those with the same name as other `lodash` methods. */ +var nativeMax = Math.max, + nativeMin = Math.min; + +/** + * Gets the timestamp of the number of milliseconds that have elapsed since + * the Unix epoch (1 January 1970 00:00:00 UTC). + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Date + * @returns {number} Returns the timestamp. + * @example + * + * _.defer(function(stamp) { + * console.log(_.now() - stamp); + * }, _.now()); + * // => Logs the number of milliseconds it took for the deferred invocation. + */ +var now = function() { + return root.Date.now(); +}; + +/** + * Creates a debounced function that delays invoking `func` until after `wait` + * milliseconds have elapsed since the last time the debounced function was + * invoked. The debounced function comes with a `cancel` method to cancel + * delayed `func` invocations and a `flush` method to immediately invoke them. + * Provide `options` to indicate whether `func` should be invoked on the + * leading and/or trailing edge of the `wait` timeout. The `func` is invoked + * with the last arguments provided to the debounced function. Subsequent + * calls to the debounced function return the result of the last `func` + * invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is + * invoked on the trailing edge of the timeout only if the debounced function + * is invoked more than once during the `wait` timeout. + * + * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred + * until to the next tick, similar to `setTimeout` with a timeout of `0`. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.debounce` and `_.throttle`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to debounce. + * @param {number} [wait=0] The number of milliseconds to delay. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=false] + * Specify invoking on the leading edge of the timeout. + * @param {number} [options.maxWait] + * The maximum time `func` is allowed to be delayed before it's invoked. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new debounced function. + * @example + * + * // Avoid costly calculations while the window size is in flux. + * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); + * + * // Invoke `sendMail` when clicked, debouncing subsequent calls. + * jQuery(element).on('click', _.debounce(sendMail, 300, { + * 'leading': true, + * 'trailing': false + * })); + * + * // Ensure `batchLog` is invoked once after 1 second of debounced calls. + * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); + * var source = new EventSource('/stream'); + * jQuery(source).on('message', debounced); + * + * // Cancel the trailing debounced invocation. + * jQuery(window).on('popstate', debounced.cancel); + */ +function debounce(func, wait, options) { + var lastArgs, + lastThis, + maxWait, + result, + timerId, + lastCallTime, + lastInvokeTime = 0, + leading = false, + maxing = false, + trailing = true; + + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + wait = toNumber(wait) || 0; + if (isObject(options)) { + leading = !!options.leading; + maxing = 'maxWait' in options; + maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; + trailing = 'trailing' in options ? !!options.trailing : trailing; + } + + function invokeFunc(time) { + var args = lastArgs, + thisArg = lastThis; + + lastArgs = lastThis = undefined; + lastInvokeTime = time; + result = func.apply(thisArg, args); + return result; + } + + function leadingEdge(time) { + // Reset any `maxWait` timer. + lastInvokeTime = time; + // Start the timer for the trailing edge. + timerId = setTimeout(timerExpired, wait); + // Invoke the leading edge. + return leading ? invokeFunc(time) : result; + } + + function remainingWait(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime, + result = wait - timeSinceLastCall; + + return maxing ? nativeMin(result, maxWait - timeSinceLastInvoke) : result; + } + + function shouldInvoke(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime; + + // Either this is the first call, activity has stopped and we're at the + // trailing edge, the system time has gone backwards and we're treating + // it as the trailing edge, or we've hit the `maxWait` limit. + return (lastCallTime === undefined || (timeSinceLastCall >= wait) || + (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); + } + + function timerExpired() { + var time = now(); + if (shouldInvoke(time)) { + return trailingEdge(time); + } + // Restart the timer. + timerId = setTimeout(timerExpired, remainingWait(time)); + } + + function trailingEdge(time) { + timerId = undefined; + + // Only invoke if we have `lastArgs` which means `func` has been + // debounced at least once. + if (trailing && lastArgs) { + return invokeFunc(time); + } + lastArgs = lastThis = undefined; + return result; + } + + function cancel() { + if (timerId !== undefined) { + clearTimeout(timerId); + } + lastInvokeTime = 0; + lastArgs = lastCallTime = lastThis = timerId = undefined; + } + + function flush() { + return timerId === undefined ? result : trailingEdge(now()); + } + + function debounced() { + var time = now(), + isInvoking = shouldInvoke(time); + + lastArgs = arguments; + lastThis = this; + lastCallTime = time; + + if (isInvoking) { + if (timerId === undefined) { + return leadingEdge(lastCallTime); + } + if (maxing) { + // Handle invocations in a tight loop. + timerId = setTimeout(timerExpired, wait); + return invokeFunc(lastCallTime); + } + } + if (timerId === undefined) { + timerId = setTimeout(timerExpired, wait); + } + return result; + } + debounced.cancel = cancel; + debounced.flush = flush; + return debounced; +} + +/** + * Creates a throttled function that only invokes `func` at most once per + * every `wait` milliseconds. The throttled function comes with a `cancel` + * method to cancel delayed `func` invocations and a `flush` method to + * immediately invoke them. Provide `options` to indicate whether `func` + * should be invoked on the leading and/or trailing edge of the `wait` + * timeout. The `func` is invoked with the last arguments provided to the + * throttled function. Subsequent calls to the throttled function return the + * result of the last `func` invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is + * invoked on the trailing edge of the timeout only if the throttled function + * is invoked more than once during the `wait` timeout. + * + * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred + * until to the next tick, similar to `setTimeout` with a timeout of `0`. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.throttle` and `_.debounce`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to throttle. + * @param {number} [wait=0] The number of milliseconds to throttle invocations to. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=true] + * Specify invoking on the leading edge of the timeout. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new throttled function. + * @example + * + * // Avoid excessively updating the position while scrolling. + * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); + * + * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. + * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); + * jQuery(element).on('click', throttled); + * + * // Cancel the trailing throttled invocation. + * jQuery(window).on('popstate', throttled.cancel); + */ +function throttle(func, wait, options) { + var leading = true, + trailing = true; + + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + if (isObject(options)) { + leading = 'leading' in options ? !!options.leading : leading; + trailing = 'trailing' in options ? !!options.trailing : trailing; + } + return debounce(func, wait, { + 'leading': leading, + 'maxWait': wait, + 'trailing': trailing + }); +} + +/** + * Checks if `value` is the + * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) + * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(_.noop); + * // => true + * + * _.isObject(null); + * // => false + */ +function isObject(value) { + var type = typeof value; + return !!value && (type == 'object' || type == 'function'); +} + +/** + * Checks if `value` is object-like. A value is object-like if it's not `null` + * and has a `typeof` result of "object". + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @example + * + * _.isObjectLike({}); + * // => true + * + * _.isObjectLike([1, 2, 3]); + * // => true + * + * _.isObjectLike(_.noop); + * // => false + * + * _.isObjectLike(null); + * // => false + */ +function isObjectLike(value) { + return !!value && typeof value == 'object'; +} + +/** + * Checks if `value` is classified as a `Symbol` primitive or object. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. + * @example + * + * _.isSymbol(Symbol.iterator); + * // => true + * + * _.isSymbol('abc'); + * // => false + */ +function isSymbol(value) { + return typeof value == 'symbol' || + (isObjectLike(value) && objectToString.call(value) == symbolTag); +} + +/** + * Converts `value` to a number. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to process. + * @returns {number} Returns the number. + * @example + * + * _.toNumber(3.2); + * // => 3.2 + * + * _.toNumber(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toNumber(Infinity); + * // => Infinity + * + * _.toNumber('3.2'); + * // => 3.2 + */ +function toNumber(value) { + if (typeof value == 'number') { + return value; + } + if (isSymbol(value)) { + return NAN; + } + if (isObject(value)) { + var other = typeof value.valueOf == 'function' ? value.valueOf() : value; + value = isObject(other) ? (other + '') : other; + } + if (typeof value != 'string') { + return value === 0 ? value : +value; + } + value = value.replace(reTrim, ''); + var isBinary = reIsBinary.test(value); + return (isBinary || reIsOctal.test(value)) + ? freeParseInt(value.slice(2), isBinary ? 2 : 8) + : (reIsBadHex.test(value) ? NAN : +value); +} + +export default throttle; diff --git a/src/public/app/widgets/type_widgets/canvas-note-utils/lib/sleep.js b/src/public/app/widgets/type_widgets/canvas-note-utils/lib/sleep.js new file mode 100644 index 000000000..1077c579a --- /dev/null +++ b/src/public/app/widgets/type_widgets/canvas-note-utils/lib/sleep.js @@ -0,0 +1,7 @@ +export const sleep = (time) => { + return new Promise((resolve) => { + setTimeout(resolve, time); + }); +}; + +export default sleep; \ No newline at end of file diff --git a/src/public/app/widgets/type_widgets/canvas-note-utils/utils.js b/src/public/app/widgets/type_widgets/canvas-note-utils/utils.js new file mode 100644 index 000000000..bd623871c --- /dev/null +++ b/src/public/app/widgets/type_widgets/canvas-note-utils/utils.js @@ -0,0 +1,46 @@ +function addDemoContent(canvas) { + var comicSansText = new fabric.Text("I'm in Comic Sans", { + fontFamily: 'Comic Sans MS', + left: 100, + top: 100, + }); + canvas.add(comicSansText); + var demoLine = new fabric.Line([30, 30, 150, 210], { + fill: 'green', + stroke: 'blue', + strokeWidth: 5, + selectable: false, + evented: false, + }); + canvas.add(demoLine); +} + +function addBg(canvas) { + // Add BG + var bg = new fabric.Rect({ + width: 1500, + height: 1500, + // stroke: 'Fuchsia', + // strokeWidth: 10, + fill: '#FCFFEB', + evented: false, + selectable: false, + }); + // bg.fill = new fabric.Pattern( + // { + // source: + // 'data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABQAAAAUCAYAAACNiR0NAAAASElEQVQ4y2NkYGD4z0A6+M3AwMBKrGJWBgYGZiibEQ0zIInDaCaoelYyHYcX/GeitomjBo4aOGrgQBj4b7RwGFwGsjAwMDAAAD2/BjgezgsZAAAAAElFTkSuQmCC', + // }, + // function () { + // bg.dirty = true; + // canvas.requestRenderAll(); + // }, + // ); + bg.canvas = canvas; + canvas.backgroundImage = bg; +} + +export { + addBg, + addDemoContent, +}; diff --git a/src/public/app/widgets/type_widgets/canvas_note.js b/src/public/app/widgets/type_widgets/canvas_note.js index 1d5cfe49b..ec32be0bb 100644 --- a/src/public/app/widgets/type_widgets/canvas_note.js +++ b/src/public/app/widgets/type_widgets/canvas_note.js @@ -1,78 +1,66 @@ import libraryLoader from "../../services/library_loader.js"; import TypeWidget from "./type_widget.js"; import appContext from "../../services/app_context.js"; -import EraserBrushFactory from './canvas-note-utils/EraserBrush.js'; +import {InfiniteCanvas} from './canvas-note-utils/infinite-drawing-canvas.js'; +import { initButtons, initPens } from './canvas-note-utils/gui.js'; +import _debounce from './canvas-note-utils/lib/lodash.debounce.js'; const TPL = ` -
- - -
- -
- - - 30
- - -
- - -
- - - 0
- - - 0
+
+
+ +
+
-
- - - - - - - -
-
- -
-
`; + +
+ + + + Pens: + + + + +
+ + + + + + + Shapes: + +
+ Mode: + + + + +
+ Canvas: + Enlarge px + + + + + Crop: + +
+ + +
+`; export default class CanvasNoteTypeWidget extends TypeWidget { + constructor() { + super(); + + this.initCanvas = this.initCanvas.bind(this); + } static getType() { return "canvas-note"; } @@ -84,16 +72,17 @@ export default class CanvasNoteTypeWidget extends TypeWidget { .requireLibrary(libraryLoader.CANVAS_NOTE) .then(() => { console.log("fabric.js-loaded") - this.initFabric(); + this.initCanvas(); }); return this.$widget; } async doRefresh(note) { + // get note from backend and put into canvas const noteComplement = await this.tabContext.getNoteComplement(); - if (this.__canvas && noteComplement.content) { - this.__canvas.loadFromJSON(noteComplement.content); + if (this.canvas && noteComplement.content) { + this.canvas.loadFromJSON(noteComplement.content); } console.log('doRefresh', note, noteComplement); } @@ -111,246 +100,22 @@ export default class CanvasNoteTypeWidget extends TypeWidget { this.spacedUpdate.scheduleUpdate(); } - initFabric() { - const self = this; - const canvas = this.__canvas = new fabric.Canvas('c', { - isDrawingMode: true - }); - fabric.Object.prototype.transparentCorners = false; + initCanvas() { + const myCanvas = new InfiniteCanvas( + $('.canvasElement'), + $('#parentContainer'), + $('#canvasContainer'), + ); - canvas.on('after:render', () => { - self.saveData(); - }); + this.infiniteCanvas = myCanvas.initFabric(); + this.canvas = this.infiniteCanvas.$canvas; - window.addEventListener('resize', resizeCanvas, false); + this.canvas.setWidth(myCanvas.width); + this.canvas.setHeight(myCanvas.height); - function resizeCanvas() { - const width = $('.note-detail-canvas-note').width(); - const height = $('.note-detail-canvas-note').height() - console.log(`setting canvas to ${width} x ${height}px`) - canvas.setWidth(width); - canvas.setHeight(height); - canvas.renderAll(); - } - - // resize on init - resizeCanvas(); - - const {EraserBrush} = EraserBrushFactory(fabric); - - var drawingModeEl = $('#drawing-mode'), - drawingOptionsEl = $('#drawing-mode-options'), - drawingColorEl = $('#drawing-color'), - drawingShadowColorEl = $('#drawing-shadow-color'), - drawingLineWidthEl = $('#drawing-line-width'), - drawingShadowWidth = $('#drawing-shadow-width'), - drawingShadowOffset = $('#drawing-shadow-offset'), - saveCanvas = $('#save-canvas'), - refreshCanvas = $('#refresh-canvas'), - clearEl = $('#clear-canvas'), - undo = $('#undo'), - redo = $('#redo') - ; - - const deletedItems = []; - - undo.on('click', function () { - // Source: https://stackoverflow.com/a/28666556 - var lastItemIndex = (canvas.getObjects().length - 1); - var item = canvas.item(lastItemIndex); - - deletedItems.push(item); - // if(item.get('type') === 'path') { - canvas.remove(item); - canvas.renderAll(); - // } - }) - - redo.on('click', function () { - const lastItem = deletedItems.pop(); - if (lastItem) { - canvas.add(lastItem); - canvas.renderAll(); - } - }) - - clearEl.on('click', function () { - console.log('cE-oC'); - canvas.clear() - }); - - saveCanvas.on('click', function () { - console.log('sC-oC'); - const canvasContent = canvas.toJSON(); - console.log('Canvas JSON', canvasContent); - self.saveData(); - }); - refreshCanvas.on('click', function () { - console.log('rC-oC'); - self.doRefresh('no note entity needed for refresh, only noteComplement'); - }); - drawingModeEl.on('click', function () { - canvas.isDrawingMode = !canvas.isDrawingMode; - if (canvas.isDrawingMode) { - drawingModeEl.html('Cancel drawing mode'); - drawingOptionsEl.css('display', ''); - } else { - drawingModeEl.html('Enter drawing mode'); - drawingOptionsEl.css('display', 'none'); - } - }); - // - // if (fabric.PatternBrush) { - // var vLinePatternBrush = new fabric.PatternBrush(canvas); - // vLinePatternBrush.getPatternSrc = function () { - // - // var patternCanvas = fabric.document.createElement('canvas'); - // patternCanvas.width = patternCanvas.height = 10; - // var ctx = patternCanvas.getContext('2d'); - // - // ctx.strokeStyle = this.color; - // ctx.lineWidth = 5; - // ctx.beginPath(); - // ctx.moveTo(0, 5); - // ctx.lineTo(10, 5); - // ctx.closePath(); - // ctx.stroke(); - // - // return patternCanvas; - // }; - // - // var hLinePatternBrush = new fabric.PatternBrush(canvas); - // hLinePatternBrush.getPatternSrc = function () { - // - // var patternCanvas = fabric.document.createElement('canvas'); - // patternCanvas.width = patternCanvas.height = 10; - // var ctx = patternCanvas.getContext('2d'); - // - // ctx.strokeStyle = this.color; - // ctx.lineWidth = 5; - // ctx.beginPath(); - // ctx.moveTo(5, 0); - // ctx.lineTo(5, 10); - // ctx.closePath(); - // ctx.stroke(); - // - // return patternCanvas; - // }; - // - // var squarePatternBrush = new fabric.PatternBrush(canvas); - // squarePatternBrush.getPatternSrc = function () { - // - // var squareWidth = 10, squareDistance = 2; - // - // var patternCanvas = fabric.document.createElement('canvas'); - // patternCanvas.width = patternCanvas.height = squareWidth + squareDistance; - // var ctx = patternCanvas.getContext('2d'); - // - // ctx.fillStyle = this.color; - // ctx.fillRect(0, 0, squareWidth, squareWidth); - // - // return patternCanvas; - // }; - // - // var diamondPatternBrush = new fabric.PatternBrush(canvas); - // diamondPatternBrush.getPatternSrc = function () { - // - // var squareWidth = 10, squareDistance = 5; - // var patternCanvas = fabric.document.createElement('canvas'); - // var rect = new fabric.Rect({ - // width: squareWidth, - // height: squareWidth, - // angle: 45, - // fill: this.color - // }); - // - // var canvasWidth = rect.getBoundingRect().width; - // - // patternCanvas.width = patternCanvas.height = canvasWidth + squareDistance; - // rect.set({left: canvasWidth / 2, top: canvasWidth / 2}); - // - // var ctx = patternCanvas.getContext('2d'); - // rect.render(ctx); - // - // return patternCanvas; - // }; - // - // // var img = new Image(); - // // img.src = './libraries/canvas-note/honey_im_subtle.png'; - // - // // var texturePatternBrush = new fabric.PatternBrush(canvas); - // // texturePatternBrush.source = img; - // } - - $('#drawing-mode-selector').change(function () { - if (false) { - } - // else if (this.value === 'hline') { - // canvas.freeDrawingBrush = vLinePatternBrush; - // } else if (this.value === 'vline') { - // canvas.freeDrawingBrush = hLinePatternBrush; - // } else if (this.value === 'square') { - // canvas.freeDrawingBrush = squarePatternBrush; - // } else if (this.value === 'diamond') { - // canvas.freeDrawingBrush = diamondPatternBrush; - // } - // else if (this.value === 'texture') { - // canvas.freeDrawingBrush = texturePatternBrush; - // } - else if (this.value === "Eraser") { - // to use it, just set the brush - const eraserBrush = new EraserBrush(canvas); - eraserBrush.width = parseInt(drawingLineWidthEl.val(), 10) || 1; - eraserBrush.color = 'rgb(236,195,195)'; // erser works with opacity! - canvas.freeDrawingBrush = eraserBrush; - canvas.isDrawingMode = true; - } else { - canvas.freeDrawingBrush = new fabric[this.value + 'Brush'](canvas); - canvas.freeDrawingBrush.color = drawingColorEl.val(); - canvas.freeDrawingBrush.width = parseInt(drawingLineWidthEl.val(), 10) || 1; - canvas.freeDrawingBrush.shadow = new fabric.Shadow({ - blur: parseInt(drawingShadowWidth.val(), 10) || 0, - offsetX: 0, - offsetY: 0, - affectStroke: true, - color: drawingShadowColorEl.val(), - }); - } - - - }); - - drawingColorEl.change(function () { - canvas.freeDrawingBrush.color = this.value; - }); - drawingShadowColorEl.change(function () { - canvas.freeDrawingBrush.shadow.color = this.value; - }) - drawingLineWidthEl.change(function () { - canvas.freeDrawingBrush.width = parseInt(this.value, 10) || 1; - drawingLineWidthEl.prev().html(this.value); - }); - drawingShadowWidth.change(function () { - canvas.freeDrawingBrush.shadow.blur = parseInt(this.value, 10) || 0; - drawingShadowWidth.prev().html(this.value); - }); - drawingShadowOffset.change(function () { - canvas.freeDrawingBrush.shadow.offsetX = parseInt(this.value, 10) || 0; - canvas.freeDrawingBrush.shadow.offsetY = parseInt(this.value, 10) || 0; - drawingShadowOffset.prev().html(this.value); - }) - - if (canvas.freeDrawingBrush) { - canvas.freeDrawingBrush.color = drawingColorEl.value; - canvas.freeDrawingBrush.width = parseInt(drawingLineWidthEl.value, 10) || 1; - canvas.freeDrawingBrush.shadow = new fabric.Shadow({ - blur: parseInt(drawingShadowWidth.value, 10) || 0, - offsetX: 0, - offsetY: 0, - affectStroke: true, - color: drawingShadowColorEl.value, - }); - } + // Buttons + initButtons(this.infiniteCanvas); + initPens(this.infiniteCanvas); } } From 2a2c82cd292fe0c7f8c8f452605e5a712b86c4bb Mon Sep 17 00:00:00 2001 From: thfrei <7283497+thfrei@users.noreply.github.com> Date: Sat, 7 Nov 2020 23:17:40 +0100 Subject: [PATCH 05/94] minor update for canvas --- src/public/app/widgets/type_widgets/canvas_note.js | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/src/public/app/widgets/type_widgets/canvas_note.js b/src/public/app/widgets/type_widgets/canvas_note.js index ec32be0bb..64f3dbbb4 100644 --- a/src/public/app/widgets/type_widgets/canvas_note.js +++ b/src/public/app/widgets/type_widgets/canvas_note.js @@ -8,7 +8,8 @@ import _debounce from './canvas-note-utils/lib/lodash.debounce.js'; const TPL = `
+ style=" /*resize: both;*/ + overflow:auto; width: 100%; height: 80%; background-color: rgba(255,248,230,0.58); border: 1px double #efefef;">
From 22363f5b741d14ce5337b0e3d8bd0ee192eea2b0 Mon Sep 17 00:00:00 2001 From: thfrei <7283497+thfrei@users.noreply.github.com> Date: Mon, 9 Nov 2020 23:04:46 +0100 Subject: [PATCH 06/94] working trilium canvas note --- .../infinite-drawing-canvas.js | 98 +++++++++++++++---- .../app/widgets/type_widgets/canvas_note.js | 24 +++-- 2 files changed, 95 insertions(+), 27 deletions(-) diff --git a/src/public/app/widgets/type_widgets/canvas-note-utils/infinite-drawing-canvas.js b/src/public/app/widgets/type_widgets/canvas-note-utils/infinite-drawing-canvas.js index cccba8200..72392e3af 100644 --- a/src/public/app/widgets/type_widgets/canvas-note-utils/infinite-drawing-canvas.js +++ b/src/public/app/widgets/type_widgets/canvas-note-utils/infinite-drawing-canvas.js @@ -13,11 +13,12 @@ img.src = deleteIcon; * const canvasState = new CanvasState(); * canvasState.on('selecting', ()=>{}); * canvasState.activate('selecting'); -Inspiration: https://stackoverflow.com/a/53917410 -https://developer.mozilla.org/en-US/docs/Web/API/EventTarget + Inspiration: https://stackoverflow.com/a/53917410 + https://developer.mozilla.org/en-US/docs/Web/API/EventTarget */ class CanvasState extends EventTarget { constructor(initialState) { + super(); this.states = { IDLE: 'idle', INTERACTING: 'interacting', @@ -99,6 +100,9 @@ class InfiniteCanvas { this.resetZoom = this.resetZoom.bind(this); this.cropCanvas = this.cropCanvas.bind(this); this.placeTextBox = this.placeTextBox.bind(this); + this.getInfiniteCanvas = this.getInfiniteCanvas.bind(this); + this.setInfiniteCanvas = this.setInfiniteCanvas.bind(this); + this.overrideFabric = this.overrideFabric.bind(this); } overrideFabric() { @@ -178,6 +182,55 @@ class InfiniteCanvas { return self; } + /** + * prepares object that has width, scale and height of current view + * @returns {{canvas: *, width: *, lastScale: number, height: *}} + */ + getInfiniteCanvas() { + const canvas = this.$canvas; + const canvasContent = canvas.toJSON(); + console.log('Canvas JSON', canvasContent); + const payload = { + width: this.width, + height: this.height, + lastScale: this.lastScale, + canvas: canvasContent, + }; + return payload; + } + + /** + * load infinite canvas json into canvas + * @param infiniteCanvasState + */ + async setInfiniteCanvas(infiniteCanvasState) { + const self = this; + const canvasContainer = this.$canvasContainer; + const {lastScale, width, height, canvas} = infiniteCanvasState; + + // console.log('sICJSON', payload, canvasContainer); + + return new Promise((resolve, reject) => { + const savedCanvas = canvas; + if (savedCanvas) { + this.$canvas.loadFromJSON(savedCanvas, function() { + console.log('loaded?'); + self.width = self.scaledWidth = parseInt(width, 10); + self.height = self.scaledHeight = parseInt(height, 10); + self.lastScale = lastScale; + self.$canvas.setWidth(self.width); + self.$canvas.setHeight(self.height); + self.$canvasContainer.width(self.width).height(self.height); + self.$canvas.renderAll(); + resolve(); + }); + } else { + console.log('payload empty?'); + reject('payload empty?'); + } + }); + } + /** * * @param {string} direction [top, left, right, bottom] @@ -205,7 +258,7 @@ class InfiniteCanvas { } let newWidth = this.scaledWidth, - newHeight = this.scaledHeight; + newHeight = this.scaledHeight; if (direction === 'top' || direction === 'bottom') { newHeight = this.scaledHeight + distance; @@ -246,7 +299,10 @@ class InfiniteCanvas { // place text box independent of touch type if (this.activatePlaceTextBox) { if (fabricEvent && fabricEvent.absolutePointer) { - this.placeTextBox(fabricEvent.absolutePointer.x, fabricEvent.absolutePointer.y); + this.placeTextBox( + fabricEvent.absolutePointer.x, + fabricEvent.absolutePointer.y, + ); this.activatePlaceTextBox = false; return; } @@ -284,13 +340,13 @@ class InfiniteCanvas { placeTextBox(x, y) { const canvas = this.$canvas; canvas.add( - new fabric.IText('Tap and Type', { - fontFamily: 'Arial', - // fontWeith: '200', - fontSize: 15, - left: x, - top: y, - }), + new fabric.IText('Tap and Type', { + fontFamily: 'Arial', + // fontWeith: '200', + fontSize: 15, + left: x, + top: y, + }), ); canvas.isDrawingMode = false; } @@ -333,8 +389,8 @@ class InfiniteCanvas { console.log('panstart', e); if ( - e.pointerType === 'touch' && - !this.drawWithTouch // pointertype mouse and canvas state mouse-drag + e.pointerType === 'touch' && + !this.drawWithTouch // pointertype mouse and canvas state mouse-drag ) { canvas.isDrawingMode = false; canvas.isDragging = true; @@ -454,14 +510,14 @@ class InfiniteCanvas { /** * Crop the canvas to the surrounding box of all elements on the canvas * - Learnings: we must NOT use fabric.Group, since this messes with items and then - SVG export is scwed. Items coordinates are not set correctly! - fabric.Group(items).aCoords does NOT work. - Therefore we need to get bounding box ourselves - Note: Or maybe we can use group, destroy and readd everything afterwards: - http://fabricjs.com/manage-selection - https://gist.github.com/msievers/6069778#gistcomment-2030151 - https://stackoverflow.com/a/31828460 + Learnings: we must NOT use fabric.Group, since this messes with items and then + SVG export is scwed. Items coordinates are not set correctly! + fabric.Group(items).aCoords does NOT work. + Therefore we need to get bounding box ourselves + Note: Or maybe we can use group, destroy and readd everything afterwards: + http://fabricjs.com/manage-selection + https://gist.github.com/msievers/6069778#gistcomment-2030151 + https://stackoverflow.com/a/31828460 */ async cropCanvas() { console.log('cropCanvas'); diff --git a/src/public/app/widgets/type_widgets/canvas_note.js b/src/public/app/widgets/type_widgets/canvas_note.js index 64f3dbbb4..c46dd1370 100644 --- a/src/public/app/widgets/type_widgets/canvas_note.js +++ b/src/public/app/widgets/type_widgets/canvas_note.js @@ -9,7 +9,7 @@ import _debounce from './canvas-note-utils/lib/lodash.debounce.js'; const TPL = `
+ overflow:auto; width: 100%; height: 70%; background-color: rgba(255,248,230,0.58); border: 1px double #efefef;">
@@ -25,7 +25,6 @@ const TPL = ` -
+ + `; export default class CanvasNoteTypeWidget extends TypeWidget { From 53666cbfe82775be6069a16e6c9ea1f81f369751 Mon Sep 17 00:00:00 2001 From: thfrei <7283497+thfrei@users.noreply.github.com> Date: Mon, 15 Feb 2021 16:34:50 +0100 Subject: [PATCH 09/94] lint --- .../app/widgets/type_widgets/canvas_note.js | 22 ++++++++++--------- 1 file changed, 12 insertions(+), 10 deletions(-) diff --git a/src/public/app/widgets/type_widgets/canvas_note.js b/src/public/app/widgets/type_widgets/canvas_note.js index e67fc8f31..6bcf6a3c3 100644 --- a/src/public/app/widgets/type_widgets/canvas_note.js +++ b/src/public/app/widgets/type_widgets/canvas_note.js @@ -1,25 +1,27 @@ import libraryLoader from "../../services/library_loader.js"; import TypeWidget from "./type_widget.js"; import appContext from "../../services/app_context.js"; -import {InfiniteCanvas} from './canvas-note-utils/infinite-drawing-canvas.js'; +import { InfiniteCanvas } from './canvas-note-utils/infinite-drawing-canvas.js'; import { initButtons, initPens } from './canvas-note-utils/gui.js'; import _debounce from './canvas-note-utils/lib/lodash.debounce.js'; const TPL = ` -
+
- +

-
+
-
- - - +
+ + + Pens: From da84d164213db0eba078b397def0a57b849747a2 Mon Sep 17 00:00:00 2001 From: Tom <7283497+thfrei@users.noreply.github.com> Date: Tue, 5 Apr 2022 15:35:15 +0200 Subject: [PATCH 10/94] excalidraw include works, removed infinitedrawingcanvas --- .../excalidraw/excalidraw.production.min.js | 2 + .../excalidraw.production.min.js.LICENSE.txt | 25 + .../excalidraw/umd/react-dom.development.js | 26292 ++++++++++++++++ .../umd/react-dom.production.min.js | 245 + libraries/excalidraw/umd/react.development.js | 3357 ++ .../excalidraw/umd/react.production.min.js | 31 + src/public/app/services/library_loader.js | 10 +- .../canvas-note-utils/EraserBrush.js | 150 - .../canvas-note-utils/EraserBrushPath.js | 69 - .../type_widgets/canvas-note-utils/gui.js | 193 - .../infinite-drawing-canvas.js | 559 - .../canvas-note-utils/lib/deleteIcon.js | 3 - .../canvas-note-utils/lib/lodash.cloneDeep.js | 1748 - .../canvas-note-utils/lib/lodash.debounce.js | 70 - .../canvas-note-utils/lib/lodash.throttle.js | 439 - .../canvas-note-utils/lib/sleep.js | 7 - .../type_widgets/canvas-note-utils/utils.js | 46 - .../app/widgets/type_widgets/canvas_note.js | 251 +- 18 files changed, 30107 insertions(+), 3390 deletions(-) create mode 100644 libraries/excalidraw/excalidraw.production.min.js create mode 100644 libraries/excalidraw/excalidraw.production.min.js.LICENSE.txt create mode 100644 libraries/excalidraw/umd/react-dom.development.js create mode 100644 libraries/excalidraw/umd/react-dom.production.min.js create mode 100644 libraries/excalidraw/umd/react.development.js create mode 100644 libraries/excalidraw/umd/react.production.min.js delete mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/EraserBrush.js delete mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/EraserBrushPath.js delete mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/gui.js delete mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/infinite-drawing-canvas.js delete mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/lib/deleteIcon.js delete mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.cloneDeep.js delete mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.debounce.js delete mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/lib/lodash.throttle.js delete mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/lib/sleep.js delete mode 100644 src/public/app/widgets/type_widgets/canvas-note-utils/utils.js diff --git a/libraries/excalidraw/excalidraw.production.min.js b/libraries/excalidraw/excalidraw.production.min.js new file mode 100644 index 000000000..81be134e2 --- /dev/null +++ b/libraries/excalidraw/excalidraw.production.min.js @@ -0,0 +1,2 @@ +/*! For license information please see excalidraw.production.min.js.LICENSE.txt */ +!function(e,t){"object"==typeof exports&&"object"==typeof module?module.exports=t(require("react"),require("react-dom")):"function"==typeof define&&define.amd?define(["react","react-dom"],t):"object"==typeof exports?exports.Excalidraw=t(require("react"),require("react-dom")):e.Excalidraw=t(e.React,e.ReactDOM)}(self,(function(e,t){return function(){var n,r,o,i,a={7945:function(e,t,n){e.exports=n(1602)},200:function(e,t,n){var r="Expected a function",o=/^\s+|\s+$/g,i=/^[-+]0x[0-9a-f]+$/i,a=/^0b[01]+$/i,l=/^0o[0-7]+$/i,c=parseInt,s="object"==typeof n.g&&n.g&&n.g.Object===Object&&n.g,u="object"==typeof self&&self&&self.Object===Object&&self,d=s||u||Function("return this")(),f=Object.prototype.toString,p=Math.max,h=Math.min,m=function(){return d.Date.now()};function g(e,t,n){var o,i,a,l,c,s,u=0,d=!1,f=!1,g=!0;if("function"!=typeof e)throw new TypeError(r);function y(t){var n=o,r=i;return o=i=void 0,u=t,l=e.apply(r,n)}function x(e){return u=e,c=setTimeout(k,t),d?y(e):l}function w(e){var n=e-s;return void 0===s||n>=t||n<0||f&&e-u>=a}function k(){var e=m();if(w(e))return E(e);c=setTimeout(k,function(e){var n=t-(e-s);return f?h(n,a-(e-u)):n}(e))}function E(e){return c=void 0,g&&o?y(e):(o=i=void 0,l)}function _(){var e=m(),n=w(e);if(o=arguments,i=this,s=e,n){if(void 0===c)return x(s);if(f)return c=setTimeout(k,t),y(s)}return void 0===c&&(c=setTimeout(k,t)),l}return t=b(t)||0,v(n)&&(d=!!n.leading,a=(f="maxWait"in n)?p(b(n.maxWait)||0,t):a,g="trailing"in n?!!n.trailing:g),_.cancel=function(){void 0!==c&&clearTimeout(c),u=0,o=s=i=c=void 0},_.flush=function(){return void 0===c?l:E(m())},_}function v(e){var t=typeof e;return!!e&&("object"==t||"function"==t)}function b(e){if("number"==typeof e)return e;if(function(e){return"symbol"==typeof e||function(e){return!!e&&"object"==typeof e}(e)&&"[object Symbol]"==f.call(e)}(e))return NaN;if(v(e)){var t="function"==typeof e.valueOf?e.valueOf():e;e=v(t)?t+"":t}if("string"!=typeof e)return 0===e?e:+e;e=e.replace(o,"");var n=a.test(e);return n||l.test(e)?c(e.slice(2),n?2:8):i.test(e)?NaN:+e}e.exports=function(e,t,n){var o=!0,i=!0;if("function"!=typeof e)throw new TypeError(r);return v(n)&&(o="leading"in n?!!n.leading:o,i="trailing"in n?!!n.trailing:i),g(e,t,{leading:o,maxWait:t,trailing:i})}},2891:function(e,t,n){var r;e=n.nmd(e),function(){var o,i="Expected a function",a="__lodash_hash_undefined__",l="__lodash_placeholder__",c=16,s=32,u=64,d=128,f=256,p=1/0,h=9007199254740991,m=NaN,g=4294967295,v=[["ary",d],["bind",1],["bindKey",2],["curry",8],["curryRight",c],["flip",512],["partial",s],["partialRight",u],["rearg",f]],b="[object Arguments]",y="[object Array]",x="[object Boolean]",w="[object Date]",k="[object Error]",E="[object Function]",_="[object GeneratorFunction]",S="[object Map]",j="[object Number]",C="[object Object]",O="[object Promise]",I="[object RegExp]",M="[object Set]",T="[object String]",P="[object Symbol]",A="[object WeakMap]",L="[object ArrayBuffer]",D="[object DataView]",R="[object Float32Array]",z="[object Float64Array]",N="[object Int8Array]",H="[object Int16Array]",B="[object Int32Array]",F="[object Uint8Array]",U="[object Uint8ClampedArray]",K="[object Uint16Array]",W="[object Uint32Array]",V=/\b__p \+= '';/g,G=/\b(__p \+=) '' \+/g,Z=/(__e\(.*?\)|\b__t\)) \+\n'';/g,Y=/&(?:amp|lt|gt|quot|#39);/g,X=/[&<>"']/g,q=RegExp(Y.source),$=RegExp(X.source),Q=/<%-([\s\S]+?)%>/g,J=/<%([\s\S]+?)%>/g,ee=/<%=([\s\S]+?)%>/g,te=/\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/,ne=/^\w*$/,re=/[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g,oe=/[\\^$.*+?()[\]{}|]/g,ie=RegExp(oe.source),ae=/^\s+/,le=/\s/,ce=/\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/,se=/\{\n\/\* \[wrapped with (.+)\] \*/,ue=/,? & /,de=/[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g,fe=/[()=,{}\[\]\/\s]/,pe=/\\(\\)?/g,he=/\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g,me=/\w*$/,ge=/^[-+]0x[0-9a-f]+$/i,ve=/^0b[01]+$/i,be=/^\[object .+?Constructor\]$/,ye=/^0o[0-7]+$/i,xe=/^(?:0|[1-9]\d*)$/,we=/[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g,ke=/($^)/,Ee=/['\n\r\u2028\u2029\\]/g,_e="\\u0300-\\u036f\\ufe20-\\ufe2f\\u20d0-\\u20ff",Se="\\u2700-\\u27bf",je="a-z\\xdf-\\xf6\\xf8-\\xff",Ce="A-Z\\xc0-\\xd6\\xd8-\\xde",Oe="\\ufe0e\\ufe0f",Ie="\\xac\\xb1\\xd7\\xf7\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf\\u2000-\\u206f \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000",Me="['’]",Te="[\\ud800-\\udfff]",Pe="["+Ie+"]",Ae="["+_e+"]",Le="\\d+",De="[\\u2700-\\u27bf]",Re="["+je+"]",ze="[^\\ud800-\\udfff"+Ie+Le+Se+je+Ce+"]",Ne="\\ud83c[\\udffb-\\udfff]",He="[^\\ud800-\\udfff]",Be="(?:\\ud83c[\\udde6-\\uddff]){2}",Fe="[\\ud800-\\udbff][\\udc00-\\udfff]",Ue="["+Ce+"]",Ke="(?:"+Re+"|"+ze+")",We="(?:"+Ue+"|"+ze+")",Ve="(?:['’](?:d|ll|m|re|s|t|ve))?",Ge="(?:['’](?:D|LL|M|RE|S|T|VE))?",Ze="(?:"+Ae+"|"+Ne+")"+"?",Ye="[\\ufe0e\\ufe0f]?",Xe=Ye+Ze+("(?:\\u200d(?:"+[He,Be,Fe].join("|")+")"+Ye+Ze+")*"),qe="(?:"+[De,Be,Fe].join("|")+")"+Xe,$e="(?:"+[He+Ae+"?",Ae,Be,Fe,Te].join("|")+")",Qe=RegExp(Me,"g"),Je=RegExp(Ae,"g"),et=RegExp(Ne+"(?="+Ne+")|"+$e+Xe,"g"),tt=RegExp([Ue+"?"+Re+"+"+Ve+"(?="+[Pe,Ue,"$"].join("|")+")",We+"+"+Ge+"(?="+[Pe,Ue+Ke,"$"].join("|")+")",Ue+"?"+Ke+"+"+Ve,Ue+"+"+Ge,"\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])","\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])",Le,qe].join("|"),"g"),nt=RegExp("[\\u200d\\ud800-\\udfff"+_e+Oe+"]"),rt=/[a-z][A-Z]|[A-Z]{2}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/,ot=["Array","Buffer","DataView","Date","Error","Float32Array","Float64Array","Function","Int8Array","Int16Array","Int32Array","Map","Math","Object","Promise","RegExp","Set","String","Symbol","TypeError","Uint8Array","Uint8ClampedArray","Uint16Array","Uint32Array","WeakMap","_","clearTimeout","isFinite","parseInt","setTimeout"],it=-1,at={};at[R]=at[z]=at[N]=at[H]=at[B]=at[F]=at[U]=at[K]=at[W]=!0,at[b]=at[y]=at[L]=at[x]=at[D]=at[w]=at[k]=at[E]=at[S]=at[j]=at[C]=at[I]=at[M]=at[T]=at[A]=!1;var lt={};lt[b]=lt[y]=lt[L]=lt[D]=lt[x]=lt[w]=lt[R]=lt[z]=lt[N]=lt[H]=lt[B]=lt[S]=lt[j]=lt[C]=lt[I]=lt[M]=lt[T]=lt[P]=lt[F]=lt[U]=lt[K]=lt[W]=!0,lt[k]=lt[E]=lt[A]=!1;var ct={"\\":"\\","'":"'","\n":"n","\r":"r","\u2028":"u2028","\u2029":"u2029"},st=parseFloat,ut=parseInt,dt="object"==typeof n.g&&n.g&&n.g.Object===Object&&n.g,ft="object"==typeof self&&self&&self.Object===Object&&self,pt=dt||ft||Function("return this")(),ht=t&&!t.nodeType&&t,mt=ht&&e&&!e.nodeType&&e,gt=mt&&mt.exports===ht,vt=gt&&dt.process,bt=function(){try{var e=mt&&mt.require&&mt.require("util").types;return e||vt&&vt.binding&&vt.binding("util")}catch(e){}}(),yt=bt&&bt.isArrayBuffer,xt=bt&&bt.isDate,wt=bt&&bt.isMap,kt=bt&&bt.isRegExp,Et=bt&&bt.isSet,_t=bt&&bt.isTypedArray;function St(e,t,n){switch(n.length){case 0:return e.call(t);case 1:return e.call(t,n[0]);case 2:return e.call(t,n[0],n[1]);case 3:return e.call(t,n[0],n[1],n[2])}return e.apply(t,n)}function jt(e,t,n,r){for(var o=-1,i=null==e?0:e.length;++o-1}function Pt(e,t,n){for(var r=-1,o=null==e?0:e.length;++r-1;);return n}function tn(e,t){for(var n=e.length;n--&&Ft(t,e[n],0)>-1;);return n}function nn(e,t){for(var n=e.length,r=0;n--;)e[n]===t&&++r;return r}var rn=Gt({"À":"A","Á":"A","Â":"A","Ã":"A","Ä":"A","Å":"A","à":"a","á":"a","â":"a","ã":"a","ä":"a","å":"a","Ç":"C","ç":"c","Ð":"D","ð":"d","È":"E","É":"E","Ê":"E","Ë":"E","è":"e","é":"e","ê":"e","ë":"e","Ì":"I","Í":"I","Î":"I","Ï":"I","ì":"i","í":"i","î":"i","ï":"i","Ñ":"N","ñ":"n","Ò":"O","Ó":"O","Ô":"O","Õ":"O","Ö":"O","Ø":"O","ò":"o","ó":"o","ô":"o","õ":"o","ö":"o","ø":"o","Ù":"U","Ú":"U","Û":"U","Ü":"U","ù":"u","ú":"u","û":"u","ü":"u","Ý":"Y","ý":"y","ÿ":"y","Æ":"Ae","æ":"ae","Þ":"Th","þ":"th","ß":"ss","Ā":"A","Ă":"A","Ą":"A","ā":"a","ă":"a","ą":"a","Ć":"C","Ĉ":"C","Ċ":"C","Č":"C","ć":"c","ĉ":"c","ċ":"c","č":"c","Ď":"D","Đ":"D","ď":"d","đ":"d","Ē":"E","Ĕ":"E","Ė":"E","Ę":"E","Ě":"E","ē":"e","ĕ":"e","ė":"e","ę":"e","ě":"e","Ĝ":"G","Ğ":"G","Ġ":"G","Ģ":"G","ĝ":"g","ğ":"g","ġ":"g","ģ":"g","Ĥ":"H","Ħ":"H","ĥ":"h","ħ":"h","Ĩ":"I","Ī":"I","Ĭ":"I","Į":"I","İ":"I","ĩ":"i","ī":"i","ĭ":"i","į":"i","ı":"i","Ĵ":"J","ĵ":"j","Ķ":"K","ķ":"k","ĸ":"k","Ĺ":"L","Ļ":"L","Ľ":"L","Ŀ":"L","Ł":"L","ĺ":"l","ļ":"l","ľ":"l","ŀ":"l","ł":"l","Ń":"N","Ņ":"N","Ň":"N","Ŋ":"N","ń":"n","ņ":"n","ň":"n","ŋ":"n","Ō":"O","Ŏ":"O","Ő":"O","ō":"o","ŏ":"o","ő":"o","Ŕ":"R","Ŗ":"R","Ř":"R","ŕ":"r","ŗ":"r","ř":"r","Ś":"S","Ŝ":"S","Ş":"S","Š":"S","ś":"s","ŝ":"s","ş":"s","š":"s","Ţ":"T","Ť":"T","Ŧ":"T","ţ":"t","ť":"t","ŧ":"t","Ũ":"U","Ū":"U","Ŭ":"U","Ů":"U","Ű":"U","Ų":"U","ũ":"u","ū":"u","ŭ":"u","ů":"u","ű":"u","ų":"u","Ŵ":"W","ŵ":"w","Ŷ":"Y","ŷ":"y","Ÿ":"Y","Ź":"Z","Ż":"Z","Ž":"Z","ź":"z","ż":"z","ž":"z","IJ":"IJ","ij":"ij","Œ":"Oe","œ":"oe","ʼn":"'n","ſ":"s"}),on=Gt({"&":"&","<":"<",">":">",'"':""","'":"'"});function an(e){return"\\"+ct[e]}function ln(e){return nt.test(e)}function cn(e){var t=-1,n=Array(e.size);return e.forEach((function(e,r){n[++t]=[r,e]})),n}function sn(e,t){return function(n){return e(t(n))}}function un(e,t){for(var n=-1,r=e.length,o=0,i=[];++n",""":'"',"'":"'"});var vn=function e(t){var n,r=(t=null==t?pt:vn.defaults(pt.Object(),t,vn.pick(pt,ot))).Array,le=t.Date,_e=t.Error,Se=t.Function,je=t.Math,Ce=t.Object,Oe=t.RegExp,Ie=t.String,Me=t.TypeError,Te=r.prototype,Pe=Se.prototype,Ae=Ce.prototype,Le=t["__core-js_shared__"],De=Pe.toString,Re=Ae.hasOwnProperty,ze=0,Ne=(n=/[^.]+$/.exec(Le&&Le.keys&&Le.keys.IE_PROTO||""))?"Symbol(src)_1."+n:"",He=Ae.toString,Be=De.call(Ce),Fe=pt._,Ue=Oe("^"+De.call(Re).replace(oe,"\\$&").replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g,"$1.*?")+"$"),Ke=gt?t.Buffer:o,We=t.Symbol,Ve=t.Uint8Array,Ge=Ke?Ke.allocUnsafe:o,Ze=sn(Ce.getPrototypeOf,Ce),Ye=Ce.create,Xe=Ae.propertyIsEnumerable,qe=Te.splice,$e=We?We.isConcatSpreadable:o,et=We?We.iterator:o,nt=We?We.toStringTag:o,ct=function(){try{var e=hi(Ce,"defineProperty");return e({},"",{}),e}catch(e){}}(),dt=t.clearTimeout!==pt.clearTimeout&&t.clearTimeout,ft=le&&le.now!==pt.Date.now&&le.now,ht=t.setTimeout!==pt.setTimeout&&t.setTimeout,mt=je.ceil,vt=je.floor,bt=Ce.getOwnPropertySymbols,Nt=Ke?Ke.isBuffer:o,Gt=t.isFinite,bn=Te.join,yn=sn(Ce.keys,Ce),xn=je.max,wn=je.min,kn=le.now,En=t.parseInt,_n=je.random,Sn=Te.reverse,jn=hi(t,"DataView"),Cn=hi(t,"Map"),On=hi(t,"Promise"),In=hi(t,"Set"),Mn=hi(t,"WeakMap"),Tn=hi(Ce,"create"),Pn=Mn&&new Mn,An={},Ln=Fi(jn),Dn=Fi(Cn),Rn=Fi(On),zn=Fi(In),Nn=Fi(Mn),Hn=We?We.prototype:o,Bn=Hn?Hn.valueOf:o,Fn=Hn?Hn.toString:o;function Un(e){if(ol(e)&&!Za(e)&&!(e instanceof Gn)){if(e instanceof Vn)return e;if(Re.call(e,"__wrapped__"))return Ui(e)}return new Vn(e)}var Kn=function(){function e(){}return function(t){if(!rl(t))return{};if(Ye)return Ye(t);e.prototype=t;var n=new e;return e.prototype=o,n}}();function Wn(){}function Vn(e,t){this.__wrapped__=e,this.__actions__=[],this.__chain__=!!t,this.__index__=0,this.__values__=o}function Gn(e){this.__wrapped__=e,this.__actions__=[],this.__dir__=1,this.__filtered__=!1,this.__iteratees__=[],this.__takeCount__=g,this.__views__=[]}function Zn(e){var t=-1,n=null==e?0:e.length;for(this.clear();++t=t?e:t)),e}function ur(e,t,n,r,i,a){var l,c=1&t,s=2&t,u=4&t;if(n&&(l=i?n(e,r,i,a):n(e)),l!==o)return l;if(!rl(e))return e;var d=Za(e);if(d){if(l=function(e){var t=e.length,n=new e.constructor(t);t&&"string"==typeof e[0]&&Re.call(e,"index")&&(n.index=e.index,n.input=e.input);return n}(e),!c)return Po(e,l)}else{var f=vi(e),p=f==E||f==_;if($a(e))return jo(e,c);if(f==C||f==b||p&&!i){if(l=s||p?{}:yi(e),!c)return s?function(e,t){return Ao(e,gi(e),t)}(e,function(e,t){return e&&Ao(t,Dl(t),e)}(l,e)):function(e,t){return Ao(e,mi(e),t)}(e,ar(l,e))}else{if(!lt[f])return i?e:{};l=function(e,t,n){var r=e.constructor;switch(t){case L:return Co(e);case x:case w:return new r(+e);case D:return function(e,t){var n=t?Co(e.buffer):e.buffer;return new e.constructor(n,e.byteOffset,e.byteLength)}(e,n);case R:case z:case N:case H:case B:case F:case U:case K:case W:return Oo(e,n);case S:case M:return new r;case j:case T:return new r(e);case I:return function(e){var t=new e.constructor(e.source,me.exec(e));return t.lastIndex=e.lastIndex,t}(e);case P:return o=e,Bn?Ce(Bn.call(o)):{}}var o}(e,f,c)}}a||(a=new $n);var h=a.get(e);if(h)return h;a.set(e,l),sl(e)?e.forEach((function(r){l.add(ur(r,t,n,r,e,a))})):il(e)&&e.forEach((function(r,o){l.set(o,ur(r,t,n,o,e,a))}));var m=d?o:(u?s?li:ai:s?Dl:Ll)(e);return Ct(m||e,(function(r,o){m&&(r=e[o=r]),rr(l,o,ur(r,t,n,o,e,a))})),l}function dr(e,t,n){var r=n.length;if(null==e)return!r;for(e=Ce(e);r--;){var i=n[r],a=t[i],l=e[i];if(l===o&&!(i in e)||!a(l))return!1}return!0}function fr(e,t,n){if("function"!=typeof e)throw new Me(i);return Li((function(){e.apply(o,n)}),t)}function pr(e,t,n,r){var o=-1,i=Tt,a=!0,l=e.length,c=[],s=t.length;if(!l)return c;n&&(t=At(t,$t(n))),r?(i=Pt,a=!1):t.length>=200&&(i=Jt,a=!1,t=new qn(t));e:for(;++o-1},Yn.prototype.set=function(e,t){var n=this.__data__,r=or(n,e);return r<0?(++this.size,n.push([e,t])):n[r][1]=t,this},Xn.prototype.clear=function(){this.size=0,this.__data__={hash:new Zn,map:new(Cn||Yn),string:new Zn}},Xn.prototype.delete=function(e){var t=fi(this,e).delete(e);return this.size-=t?1:0,t},Xn.prototype.get=function(e){return fi(this,e).get(e)},Xn.prototype.has=function(e){return fi(this,e).has(e)},Xn.prototype.set=function(e,t){var n=fi(this,e),r=n.size;return n.set(e,t),this.size+=n.size==r?0:1,this},qn.prototype.add=qn.prototype.push=function(e){return this.__data__.set(e,a),this},qn.prototype.has=function(e){return this.__data__.has(e)},$n.prototype.clear=function(){this.__data__=new Yn,this.size=0},$n.prototype.delete=function(e){var t=this.__data__,n=t.delete(e);return this.size=t.size,n},$n.prototype.get=function(e){return this.__data__.get(e)},$n.prototype.has=function(e){return this.__data__.has(e)},$n.prototype.set=function(e,t){var n=this.__data__;if(n instanceof Yn){var r=n.__data__;if(!Cn||r.length<199)return r.push([e,t]),this.size=++n.size,this;n=this.__data__=new Xn(r)}return n.set(e,t),this.size=n.size,this};var hr=Ro(kr),mr=Ro(Er,!0);function gr(e,t){var n=!0;return hr(e,(function(e,r,o){return n=!!t(e,r,o)})),n}function vr(e,t,n){for(var r=-1,i=e.length;++r0&&n(l)?t>1?yr(l,t-1,n,r,o):Lt(o,l):r||(o[o.length]=l)}return o}var xr=zo(),wr=zo(!0);function kr(e,t){return e&&xr(e,t,Ll)}function Er(e,t){return e&&wr(e,t,Ll)}function _r(e,t){return Mt(t,(function(t){return el(e[t])}))}function Sr(e,t){for(var n=0,r=(t=ko(t,e)).length;null!=e&&nt}function Ir(e,t){return null!=e&&Re.call(e,t)}function Mr(e,t){return null!=e&&t in Ce(e)}function Tr(e,t,n){for(var i=n?Pt:Tt,a=e[0].length,l=e.length,c=l,s=r(l),u=1/0,d=[];c--;){var f=e[c];c&&t&&(f=At(f,$t(t))),u=wn(f.length,u),s[c]=!n&&(t||a>=120&&f.length>=120)?new qn(c&&f):o}f=e[0];var p=-1,h=s[0];e:for(;++p=l?c:c*("desc"==n[r]?-1:1)}return e.index-t.index}(e,t,n)}))}function Zr(e,t,n){for(var r=-1,o=t.length,i={};++r-1;)l!==e&&qe.call(l,c,1),qe.call(e,c,1);return e}function Xr(e,t){for(var n=e?t.length:0,r=n-1;n--;){var o=t[n];if(n==r||o!==i){var i=o;wi(o)?qe.call(e,o,1):ho(e,o)}}return e}function qr(e,t){return e+vt(_n()*(t-e+1))}function $r(e,t){var n="";if(!e||t<1||t>h)return n;do{t%2&&(n+=e),(t=vt(t/2))&&(e+=e)}while(t);return n}function Qr(e,t){return Di(Ii(e,t,ac),e+"")}function Jr(e){return Jn(Kl(e))}function eo(e,t){var n=Kl(e);return Ni(n,sr(t,0,n.length))}function to(e,t,n,r){if(!rl(e))return e;for(var i=-1,a=(t=ko(t,e)).length,l=a-1,c=e;null!=c&&++ii?0:i+t),(n=n>i?i:n)<0&&(n+=i),i=t>n?0:n-t>>>0,t>>>=0;for(var a=r(i);++o>>1,a=e[i];null!==a&&!dl(a)&&(n?a<=t:a=200){var s=t?null:Qo(e);if(s)return dn(s);a=!1,o=Jt,c=new qn}else c=t?[]:l;e:for(;++r=r?e:io(e,t,n)}var So=dt||function(e){return pt.clearTimeout(e)};function jo(e,t){if(t)return e.slice();var n=e.length,r=Ge?Ge(n):new e.constructor(n);return e.copy(r),r}function Co(e){var t=new e.constructor(e.byteLength);return new Ve(t).set(new Ve(e)),t}function Oo(e,t){var n=t?Co(e.buffer):e.buffer;return new e.constructor(n,e.byteOffset,e.length)}function Io(e,t){if(e!==t){var n=e!==o,r=null===e,i=e==e,a=dl(e),l=t!==o,c=null===t,s=t==t,u=dl(t);if(!c&&!u&&!a&&e>t||a&&l&&s&&!c&&!u||r&&l&&s||!n&&s||!i)return 1;if(!r&&!a&&!u&&e1?n[i-1]:o,l=i>2?n[2]:o;for(a=e.length>3&&"function"==typeof a?(i--,a):o,l&&ki(n[0],n[1],l)&&(a=i<3?o:a,i=1),t=Ce(t);++r-1?i[a?t[l]:l]:o}}function Uo(e){return ii((function(t){var n=t.length,r=n,a=Vn.prototype.thru;for(e&&t.reverse();r--;){var l=t[r];if("function"!=typeof l)throw new Me(i);if(a&&!c&&"wrapper"==si(l))var c=new Vn([],!0)}for(r=c?r:n;++r1&&y.reverse(),p&&uc))return!1;var u=a.get(e),d=a.get(t);if(u&&d)return u==t&&d==e;var f=-1,p=!0,h=2&n?new qn:o;for(a.set(e,t),a.set(t,e);++f-1&&e%1==0&&e1?"& ":"")+t[r],t=t.join(n>2?", ":" "),e.replace(ce,"{\n/* [wrapped with "+t+"] */\n")}(r,function(e,t){return Ct(v,(function(n){var r="_."+n[0];t&n[1]&&!Tt(e,r)&&e.push(r)})),e.sort()}(function(e){var t=e.match(se);return t?t[1].split(ue):[]}(r),n)))}function zi(e){var t=0,n=0;return function(){var r=kn(),i=16-(r-n);if(n=r,i>0){if(++t>=800)return arguments[0]}else t=0;return e.apply(o,arguments)}}function Ni(e,t){var n=-1,r=e.length,i=r-1;for(t=t===o?r:t;++n1?e[t-1]:o;return n="function"==typeof n?(e.pop(),n):o,ca(e,n)}));function ma(e){var t=Un(e);return t.__chain__=!0,t}function ga(e,t){return t(e)}var va=ii((function(e){var t=e.length,n=t?e[0]:0,r=this.__wrapped__,i=function(t){return cr(t,e)};return!(t>1||this.__actions__.length)&&r instanceof Gn&&wi(n)?((r=r.slice(n,+n+(t?1:0))).__actions__.push({func:ga,args:[i],thisArg:o}),new Vn(r,this.__chain__).thru((function(e){return t&&!e.length&&e.push(o),e}))):this.thru(i)}));var ba=Lo((function(e,t,n){Re.call(e,n)?++e[n]:lr(e,n,1)}));var ya=Fo(Gi),xa=Fo(Zi);function wa(e,t){return(Za(e)?Ct:hr)(e,di(t,3))}function ka(e,t){return(Za(e)?Ot:mr)(e,di(t,3))}var Ea=Lo((function(e,t,n){Re.call(e,n)?e[n].push(t):lr(e,n,[t])}));var _a=Qr((function(e,t,n){var o=-1,i="function"==typeof t,a=Xa(e)?r(e.length):[];return hr(e,(function(e){a[++o]=i?St(t,e,n):Pr(e,t,n)})),a})),Sa=Lo((function(e,t,n){lr(e,n,t)}));function ja(e,t){return(Za(e)?At:Fr)(e,di(t,3))}var Ca=Lo((function(e,t,n){e[n?0:1].push(t)}),(function(){return[[],[]]}));var Oa=Qr((function(e,t){if(null==e)return[];var n=t.length;return n>1&&ki(e,t[0],t[1])?t=[]:n>2&&ki(t[0],t[1],t[2])&&(t=[t[0]]),Gr(e,yr(t,1),[])})),Ia=ft||function(){return pt.Date.now()};function Ma(e,t,n){return t=n?o:t,t=e&&null==t?e.length:t,ei(e,d,o,o,o,o,t)}function Ta(e,t){var n;if("function"!=typeof t)throw new Me(i);return e=vl(e),function(){return--e>0&&(n=t.apply(this,arguments)),e<=1&&(t=o),n}}var Pa=Qr((function(e,t,n){var r=1;if(n.length){var o=un(n,ui(Pa));r|=s}return ei(e,r,t,n,o)})),Aa=Qr((function(e,t,n){var r=3;if(n.length){var o=un(n,ui(Aa));r|=s}return ei(t,r,e,n,o)}));function La(e,t,n){var r,a,l,c,s,u,d=0,f=!1,p=!1,h=!0;if("function"!=typeof e)throw new Me(i);function m(t){var n=r,i=a;return r=a=o,d=t,c=e.apply(i,n)}function g(e){return d=e,s=Li(b,t),f?m(e):c}function v(e){var n=e-u;return u===o||n>=t||n<0||p&&e-d>=l}function b(){var e=Ia();if(v(e))return y(e);s=Li(b,function(e){var n=t-(e-u);return p?wn(n,l-(e-d)):n}(e))}function y(e){return s=o,h&&r?m(e):(r=a=o,c)}function x(){var e=Ia(),n=v(e);if(r=arguments,a=this,u=e,n){if(s===o)return g(u);if(p)return So(s),s=Li(b,t),m(u)}return s===o&&(s=Li(b,t)),c}return t=yl(t)||0,rl(n)&&(f=!!n.leading,l=(p="maxWait"in n)?xn(yl(n.maxWait)||0,t):l,h="trailing"in n?!!n.trailing:h),x.cancel=function(){s!==o&&So(s),d=0,r=u=a=s=o},x.flush=function(){return s===o?c:y(Ia())},x}var Da=Qr((function(e,t){return fr(e,1,t)})),Ra=Qr((function(e,t,n){return fr(e,yl(t)||0,n)}));function za(e,t){if("function"!=typeof e||null!=t&&"function"!=typeof t)throw new Me(i);var n=function(){var r=arguments,o=t?t.apply(this,r):r[0],i=n.cache;if(i.has(o))return i.get(o);var a=e.apply(this,r);return n.cache=i.set(o,a)||i,a};return n.cache=new(za.Cache||Xn),n}function Na(e){if("function"!=typeof e)throw new Me(i);return function(){var t=arguments;switch(t.length){case 0:return!e.call(this);case 1:return!e.call(this,t[0]);case 2:return!e.call(this,t[0],t[1]);case 3:return!e.call(this,t[0],t[1],t[2])}return!e.apply(this,t)}}za.Cache=Xn;var Ha=Eo((function(e,t){var n=(t=1==t.length&&Za(t[0])?At(t[0],$t(di())):At(yr(t,1),$t(di()))).length;return Qr((function(r){for(var o=-1,i=wn(r.length,n);++o=t})),Ga=Ar(function(){return arguments}())?Ar:function(e){return ol(e)&&Re.call(e,"callee")&&!Xe.call(e,"callee")},Za=r.isArray,Ya=yt?$t(yt):function(e){return ol(e)&&Cr(e)==L};function Xa(e){return null!=e&&nl(e.length)&&!el(e)}function qa(e){return ol(e)&&Xa(e)}var $a=Nt||yc,Qa=xt?$t(xt):function(e){return ol(e)&&Cr(e)==w};function Ja(e){if(!ol(e))return!1;var t=Cr(e);return t==k||"[object DOMException]"==t||"string"==typeof e.message&&"string"==typeof e.name&&!ll(e)}function el(e){if(!rl(e))return!1;var t=Cr(e);return t==E||t==_||"[object AsyncFunction]"==t||"[object Proxy]"==t}function tl(e){return"number"==typeof e&&e==vl(e)}function nl(e){return"number"==typeof e&&e>-1&&e%1==0&&e<=h}function rl(e){var t=typeof e;return null!=e&&("object"==t||"function"==t)}function ol(e){return null!=e&&"object"==typeof e}var il=wt?$t(wt):function(e){return ol(e)&&vi(e)==S};function al(e){return"number"==typeof e||ol(e)&&Cr(e)==j}function ll(e){if(!ol(e)||Cr(e)!=C)return!1;var t=Ze(e);if(null===t)return!0;var n=Re.call(t,"constructor")&&t.constructor;return"function"==typeof n&&n instanceof n&&De.call(n)==Be}var cl=kt?$t(kt):function(e){return ol(e)&&Cr(e)==I};var sl=Et?$t(Et):function(e){return ol(e)&&vi(e)==M};function ul(e){return"string"==typeof e||!Za(e)&&ol(e)&&Cr(e)==T}function dl(e){return"symbol"==typeof e||ol(e)&&Cr(e)==P}var fl=_t?$t(_t):function(e){return ol(e)&&nl(e.length)&&!!at[Cr(e)]};var pl=Xo(Br),hl=Xo((function(e,t){return e<=t}));function ml(e){if(!e)return[];if(Xa(e))return ul(e)?hn(e):Po(e);if(et&&e[et])return function(e){for(var t,n=[];!(t=e.next()).done;)n.push(t.value);return n}(e[et]());var t=vi(e);return(t==S?cn:t==M?dn:Kl)(e)}function gl(e){return e?(e=yl(e))===p||e===-1/0?17976931348623157e292*(e<0?-1:1):e==e?e:0:0===e?e:0}function vl(e){var t=gl(e),n=t%1;return t==t?n?t-n:t:0}function bl(e){return e?sr(vl(e),0,g):0}function yl(e){if("number"==typeof e)return e;if(dl(e))return m;if(rl(e)){var t="function"==typeof e.valueOf?e.valueOf():e;e=rl(t)?t+"":t}if("string"!=typeof e)return 0===e?e:+e;e=qt(e);var n=ve.test(e);return n||ye.test(e)?ut(e.slice(2),n?2:8):ge.test(e)?m:+e}function xl(e){return Ao(e,Dl(e))}function wl(e){return null==e?"":fo(e)}var kl=Do((function(e,t){if(ji(t)||Xa(t))Ao(t,Ll(t),e);else for(var n in t)Re.call(t,n)&&rr(e,n,t[n])})),El=Do((function(e,t){Ao(t,Dl(t),e)})),_l=Do((function(e,t,n,r){Ao(t,Dl(t),e,r)})),Sl=Do((function(e,t,n,r){Ao(t,Ll(t),e,r)})),jl=ii(cr);var Cl=Qr((function(e,t){e=Ce(e);var n=-1,r=t.length,i=r>2?t[2]:o;for(i&&ki(t[0],t[1],i)&&(r=1);++n1),t})),Ao(e,li(e),n),r&&(n=ur(n,7,ri));for(var o=t.length;o--;)ho(n,t[o]);return n}));var Hl=ii((function(e,t){return null==e?{}:function(e,t){return Zr(e,t,(function(t,n){return Ml(e,n)}))}(e,t)}));function Bl(e,t){if(null==e)return{};var n=At(li(e),(function(e){return[e]}));return t=di(t),Zr(e,n,(function(e,n){return t(e,n[0])}))}var Fl=Jo(Ll),Ul=Jo(Dl);function Kl(e){return null==e?[]:Qt(e,Ll(e))}var Wl=Ho((function(e,t,n){return t=t.toLowerCase(),e+(n?Vl(t):t)}));function Vl(e){return Jl(wl(e).toLowerCase())}function Gl(e){return(e=wl(e))&&e.replace(we,rn).replace(Je,"")}var Zl=Ho((function(e,t,n){return e+(n?"-":"")+t.toLowerCase()})),Yl=Ho((function(e,t,n){return e+(n?" ":"")+t.toLowerCase()})),Xl=No("toLowerCase");var ql=Ho((function(e,t,n){return e+(n?"_":"")+t.toLowerCase()}));var $l=Ho((function(e,t,n){return e+(n?" ":"")+Jl(t)}));var Ql=Ho((function(e,t,n){return e+(n?" ":"")+t.toUpperCase()})),Jl=No("toUpperCase");function ec(e,t,n){return e=wl(e),(t=n?o:t)===o?function(e){return rt.test(e)}(e)?function(e){return e.match(tt)||[]}(e):function(e){return e.match(de)||[]}(e):e.match(t)||[]}var tc=Qr((function(e,t){try{return St(e,o,t)}catch(e){return Ja(e)?e:new _e(e)}})),nc=ii((function(e,t){return Ct(t,(function(t){t=Bi(t),lr(e,t,Pa(e[t],e))})),e}));function rc(e){return function(){return e}}var oc=Uo(),ic=Uo(!0);function ac(e){return e}function lc(e){return zr("function"==typeof e?e:ur(e,1))}var cc=Qr((function(e,t){return function(n){return Pr(n,e,t)}})),sc=Qr((function(e,t){return function(n){return Pr(e,n,t)}}));function uc(e,t,n){var r=Ll(t),o=_r(t,r);null!=n||rl(t)&&(o.length||!r.length)||(n=t,t=e,e=this,o=_r(t,Ll(t)));var i=!(rl(n)&&"chain"in n&&!n.chain),a=el(e);return Ct(o,(function(n){var r=t[n];e[n]=r,a&&(e.prototype[n]=function(){var t=this.__chain__;if(i||t){var n=e(this.__wrapped__),o=n.__actions__=Po(this.__actions__);return o.push({func:r,args:arguments,thisArg:e}),n.__chain__=t,n}return r.apply(e,Lt([this.value()],arguments))})})),e}function dc(){}var fc=Go(At),pc=Go(It),hc=Go(zt);function mc(e){return Ei(e)?Vt(Bi(e)):function(e){return function(t){return Sr(t,e)}}(e)}var gc=Yo(),vc=Yo(!0);function bc(){return[]}function yc(){return!1}var xc=Vo((function(e,t){return e+t}),0),wc=$o("ceil"),kc=Vo((function(e,t){return e/t}),1),Ec=$o("floor");var _c,Sc=Vo((function(e,t){return e*t}),1),jc=$o("round"),Cc=Vo((function(e,t){return e-t}),0);return Un.after=function(e,t){if("function"!=typeof t)throw new Me(i);return e=vl(e),function(){if(--e<1)return t.apply(this,arguments)}},Un.ary=Ma,Un.assign=kl,Un.assignIn=El,Un.assignInWith=_l,Un.assignWith=Sl,Un.at=jl,Un.before=Ta,Un.bind=Pa,Un.bindAll=nc,Un.bindKey=Aa,Un.castArray=function(){if(!arguments.length)return[];var e=arguments[0];return Za(e)?e:[e]},Un.chain=ma,Un.chunk=function(e,t,n){t=(n?ki(e,t,n):t===o)?1:xn(vl(t),0);var i=null==e?0:e.length;if(!i||t<1)return[];for(var a=0,l=0,c=r(mt(i/t));ai?0:i+n),(r=r===o||r>i?i:vl(r))<0&&(r+=i),r=n>r?0:bl(r);n>>0)?(e=wl(e))&&("string"==typeof t||null!=t&&!cl(t))&&!(t=fo(t))&&ln(e)?_o(hn(e),0,n):e.split(t,n):[]},Un.spread=function(e,t){if("function"!=typeof e)throw new Me(i);return t=null==t?0:xn(vl(t),0),Qr((function(n){var r=n[t],o=_o(n,0,t);return r&&Lt(o,r),St(e,this,o)}))},Un.tail=function(e){var t=null==e?0:e.length;return t?io(e,1,t):[]},Un.take=function(e,t,n){return e&&e.length?io(e,0,(t=n||t===o?1:vl(t))<0?0:t):[]},Un.takeRight=function(e,t,n){var r=null==e?0:e.length;return r?io(e,(t=r-(t=n||t===o?1:vl(t)))<0?0:t,r):[]},Un.takeRightWhile=function(e,t){return e&&e.length?go(e,di(t,3),!1,!0):[]},Un.takeWhile=function(e,t){return e&&e.length?go(e,di(t,3)):[]},Un.tap=function(e,t){return t(e),e},Un.throttle=function(e,t,n){var r=!0,o=!0;if("function"!=typeof e)throw new Me(i);return rl(n)&&(r="leading"in n?!!n.leading:r,o="trailing"in n?!!n.trailing:o),La(e,t,{leading:r,maxWait:t,trailing:o})},Un.thru=ga,Un.toArray=ml,Un.toPairs=Fl,Un.toPairsIn=Ul,Un.toPath=function(e){return Za(e)?At(e,Bi):dl(e)?[e]:Po(Hi(wl(e)))},Un.toPlainObject=xl,Un.transform=function(e,t,n){var r=Za(e),o=r||$a(e)||fl(e);if(t=di(t,4),null==n){var i=e&&e.constructor;n=o?r?new i:[]:rl(e)&&el(i)?Kn(Ze(e)):{}}return(o?Ct:kr)(e,(function(e,r,o){return t(n,e,r,o)})),n},Un.unary=function(e){return Ma(e,1)},Un.union=oa,Un.unionBy=ia,Un.unionWith=aa,Un.uniq=function(e){return e&&e.length?po(e):[]},Un.uniqBy=function(e,t){return e&&e.length?po(e,di(t,2)):[]},Un.uniqWith=function(e,t){return t="function"==typeof t?t:o,e&&e.length?po(e,o,t):[]},Un.unset=function(e,t){return null==e||ho(e,t)},Un.unzip=la,Un.unzipWith=ca,Un.update=function(e,t,n){return null==e?e:mo(e,t,wo(n))},Un.updateWith=function(e,t,n,r){return r="function"==typeof r?r:o,null==e?e:mo(e,t,wo(n),r)},Un.values=Kl,Un.valuesIn=function(e){return null==e?[]:Qt(e,Dl(e))},Un.without=sa,Un.words=ec,Un.wrap=function(e,t){return Ba(wo(t),e)},Un.xor=ua,Un.xorBy=da,Un.xorWith=fa,Un.zip=pa,Un.zipObject=function(e,t){return yo(e||[],t||[],rr)},Un.zipObjectDeep=function(e,t){return yo(e||[],t||[],to)},Un.zipWith=ha,Un.entries=Fl,Un.entriesIn=Ul,Un.extend=El,Un.extendWith=_l,uc(Un,Un),Un.add=xc,Un.attempt=tc,Un.camelCase=Wl,Un.capitalize=Vl,Un.ceil=wc,Un.clamp=function(e,t,n){return n===o&&(n=t,t=o),n!==o&&(n=(n=yl(n))==n?n:0),t!==o&&(t=(t=yl(t))==t?t:0),sr(yl(e),t,n)},Un.clone=function(e){return ur(e,4)},Un.cloneDeep=function(e){return ur(e,5)},Un.cloneDeepWith=function(e,t){return ur(e,5,t="function"==typeof t?t:o)},Un.cloneWith=function(e,t){return ur(e,4,t="function"==typeof t?t:o)},Un.conformsTo=function(e,t){return null==t||dr(e,t,Ll(t))},Un.deburr=Gl,Un.defaultTo=function(e,t){return null==e||e!=e?t:e},Un.divide=kc,Un.endsWith=function(e,t,n){e=wl(e),t=fo(t);var r=e.length,i=n=n===o?r:sr(vl(n),0,r);return(n-=t.length)>=0&&e.slice(n,i)==t},Un.eq=Ka,Un.escape=function(e){return(e=wl(e))&&$.test(e)?e.replace(X,on):e},Un.escapeRegExp=function(e){return(e=wl(e))&&ie.test(e)?e.replace(oe,"\\$&"):e},Un.every=function(e,t,n){var r=Za(e)?It:gr;return n&&ki(e,t,n)&&(t=o),r(e,di(t,3))},Un.find=ya,Un.findIndex=Gi,Un.findKey=function(e,t){return Ht(e,di(t,3),kr)},Un.findLast=xa,Un.findLastIndex=Zi,Un.findLastKey=function(e,t){return Ht(e,di(t,3),Er)},Un.floor=Ec,Un.forEach=wa,Un.forEachRight=ka,Un.forIn=function(e,t){return null==e?e:xr(e,di(t,3),Dl)},Un.forInRight=function(e,t){return null==e?e:wr(e,di(t,3),Dl)},Un.forOwn=function(e,t){return e&&kr(e,di(t,3))},Un.forOwnRight=function(e,t){return e&&Er(e,di(t,3))},Un.get=Il,Un.gt=Wa,Un.gte=Va,Un.has=function(e,t){return null!=e&&bi(e,t,Ir)},Un.hasIn=Ml,Un.head=Xi,Un.identity=ac,Un.includes=function(e,t,n,r){e=Xa(e)?e:Kl(e),n=n&&!r?vl(n):0;var o=e.length;return n<0&&(n=xn(o+n,0)),ul(e)?n<=o&&e.indexOf(t,n)>-1:!!o&&Ft(e,t,n)>-1},Un.indexOf=function(e,t,n){var r=null==e?0:e.length;if(!r)return-1;var o=null==n?0:vl(n);return o<0&&(o=xn(r+o,0)),Ft(e,t,o)},Un.inRange=function(e,t,n){return t=gl(t),n===o?(n=t,t=0):n=gl(n),function(e,t,n){return e>=wn(t,n)&&e=-9007199254740991&&e<=h},Un.isSet=sl,Un.isString=ul,Un.isSymbol=dl,Un.isTypedArray=fl,Un.isUndefined=function(e){return e===o},Un.isWeakMap=function(e){return ol(e)&&vi(e)==A},Un.isWeakSet=function(e){return ol(e)&&"[object WeakSet]"==Cr(e)},Un.join=function(e,t){return null==e?"":bn.call(e,t)},Un.kebabCase=Zl,Un.last=Ji,Un.lastIndexOf=function(e,t,n){var r=null==e?0:e.length;if(!r)return-1;var i=r;return n!==o&&(i=(i=vl(n))<0?xn(r+i,0):wn(i,r-1)),t==t?function(e,t,n){for(var r=n+1;r--;)if(e[r]===t)return r;return r}(e,t,i):Bt(e,Kt,i,!0)},Un.lowerCase=Yl,Un.lowerFirst=Xl,Un.lt=pl,Un.lte=hl,Un.max=function(e){return e&&e.length?vr(e,ac,Or):o},Un.maxBy=function(e,t){return e&&e.length?vr(e,di(t,2),Or):o},Un.mean=function(e){return Wt(e,ac)},Un.meanBy=function(e,t){return Wt(e,di(t,2))},Un.min=function(e){return e&&e.length?vr(e,ac,Br):o},Un.minBy=function(e,t){return e&&e.length?vr(e,di(t,2),Br):o},Un.stubArray=bc,Un.stubFalse=yc,Un.stubObject=function(){return{}},Un.stubString=function(){return""},Un.stubTrue=function(){return!0},Un.multiply=Sc,Un.nth=function(e,t){return e&&e.length?Vr(e,vl(t)):o},Un.noConflict=function(){return pt._===this&&(pt._=Fe),this},Un.noop=dc,Un.now=Ia,Un.pad=function(e,t,n){e=wl(e);var r=(t=vl(t))?pn(e):0;if(!t||r>=t)return e;var o=(t-r)/2;return Zo(vt(o),n)+e+Zo(mt(o),n)},Un.padEnd=function(e,t,n){e=wl(e);var r=(t=vl(t))?pn(e):0;return t&&rt){var r=e;e=t,t=r}if(n||e%1||t%1){var i=_n();return wn(e+i*(t-e+st("1e-"+((i+"").length-1))),t)}return qr(e,t)},Un.reduce=function(e,t,n){var r=Za(e)?Dt:Zt,o=arguments.length<3;return r(e,di(t,4),n,o,hr)},Un.reduceRight=function(e,t,n){var r=Za(e)?Rt:Zt,o=arguments.length<3;return r(e,di(t,4),n,o,mr)},Un.repeat=function(e,t,n){return t=(n?ki(e,t,n):t===o)?1:vl(t),$r(wl(e),t)},Un.replace=function(){var e=arguments,t=wl(e[0]);return e.length<3?t:t.replace(e[1],e[2])},Un.result=function(e,t,n){var r=-1,i=(t=ko(t,e)).length;for(i||(i=1,e=o);++rh)return[];var n=g,r=wn(e,g);t=di(t),e-=g;for(var o=Xt(r,t);++n=a)return e;var c=n-pn(r);if(c<1)return r;var s=l?_o(l,0,c).join(""):e.slice(0,c);if(i===o)return s+r;if(l&&(c+=s.length-c),cl(i)){if(e.slice(c).search(i)){var u,d=s;for(i.global||(i=Oe(i.source,wl(me.exec(i))+"g")),i.lastIndex=0;u=i.exec(d);)var f=u.index;s=s.slice(0,f===o?c:f)}}else if(e.indexOf(fo(i),c)!=c){var p=s.lastIndexOf(i);p>-1&&(s=s.slice(0,p))}return s+r},Un.unescape=function(e){return(e=wl(e))&&q.test(e)?e.replace(Y,gn):e},Un.uniqueId=function(e){var t=++ze;return wl(e)+t},Un.upperCase=Ql,Un.upperFirst=Jl,Un.each=wa,Un.eachRight=ka,Un.first=Xi,uc(Un,(_c={},kr(Un,(function(e,t){Re.call(Un.prototype,t)||(_c[t]=e)})),_c),{chain:!1}),Un.VERSION="4.17.21",Ct(["bind","bindKey","curry","curryRight","partial","partialRight"],(function(e){Un[e].placeholder=Un})),Ct(["drop","take"],(function(e,t){Gn.prototype[e]=function(n){n=n===o?1:xn(vl(n),0);var r=this.__filtered__&&!t?new Gn(this):this.clone();return r.__filtered__?r.__takeCount__=wn(n,r.__takeCount__):r.__views__.push({size:wn(n,g),type:e+(r.__dir__<0?"Right":"")}),r},Gn.prototype[e+"Right"]=function(t){return this.reverse()[e](t).reverse()}})),Ct(["filter","map","takeWhile"],(function(e,t){var n=t+1,r=1==n||3==n;Gn.prototype[e]=function(e){var t=this.clone();return t.__iteratees__.push({iteratee:di(e,3),type:n}),t.__filtered__=t.__filtered__||r,t}})),Ct(["head","last"],(function(e,t){var n="take"+(t?"Right":"");Gn.prototype[e]=function(){return this[n](1).value()[0]}})),Ct(["initial","tail"],(function(e,t){var n="drop"+(t?"":"Right");Gn.prototype[e]=function(){return this.__filtered__?new Gn(this):this[n](1)}})),Gn.prototype.compact=function(){return this.filter(ac)},Gn.prototype.find=function(e){return this.filter(e).head()},Gn.prototype.findLast=function(e){return this.reverse().find(e)},Gn.prototype.invokeMap=Qr((function(e,t){return"function"==typeof e?new Gn(this):this.map((function(n){return Pr(n,e,t)}))})),Gn.prototype.reject=function(e){return this.filter(Na(di(e)))},Gn.prototype.slice=function(e,t){e=vl(e);var n=this;return n.__filtered__&&(e>0||t<0)?new Gn(n):(e<0?n=n.takeRight(-e):e&&(n=n.drop(e)),t!==o&&(n=(t=vl(t))<0?n.dropRight(-t):n.take(t-e)),n)},Gn.prototype.takeRightWhile=function(e){return this.reverse().takeWhile(e).reverse()},Gn.prototype.toArray=function(){return this.take(g)},kr(Gn.prototype,(function(e,t){var n=/^(?:filter|find|map|reject)|While$/.test(t),r=/^(?:head|last)$/.test(t),i=Un[r?"take"+("last"==t?"Right":""):t],a=r||/^find/.test(t);i&&(Un.prototype[t]=function(){var t=this.__wrapped__,l=r?[1]:arguments,c=t instanceof Gn,s=l[0],u=c||Za(t),d=function(e){var t=i.apply(Un,Lt([e],l));return r&&f?t[0]:t};u&&n&&"function"==typeof s&&1!=s.length&&(c=u=!1);var f=this.__chain__,p=!!this.__actions__.length,h=a&&!f,m=c&&!p;if(!a&&u){t=m?t:new Gn(this);var g=e.apply(t,l);return g.__actions__.push({func:ga,args:[d],thisArg:o}),new Vn(g,f)}return h&&m?e.apply(this,l):(g=this.thru(d),h?r?g.value()[0]:g.value():g)})})),Ct(["pop","push","shift","sort","splice","unshift"],(function(e){var t=Te[e],n=/^(?:push|sort|unshift)$/.test(e)?"tap":"thru",r=/^(?:pop|shift)$/.test(e);Un.prototype[e]=function(){var e=arguments;if(r&&!this.__chain__){var o=this.value();return t.apply(Za(o)?o:[],e)}return this[n]((function(n){return t.apply(Za(n)?n:[],e)}))}})),kr(Gn.prototype,(function(e,t){var n=Un[t];if(n){var r=n.name+"";Re.call(An,r)||(An[r]=[]),An[r].push({name:t,func:n})}})),An[Ko(o,2).name]=[{name:"wrapper",func:o}],Gn.prototype.clone=function(){var e=new Gn(this.__wrapped__);return e.__actions__=Po(this.__actions__),e.__dir__=this.__dir__,e.__filtered__=this.__filtered__,e.__iteratees__=Po(this.__iteratees__),e.__takeCount__=this.__takeCount__,e.__views__=Po(this.__views__),e},Gn.prototype.reverse=function(){if(this.__filtered__){var e=new Gn(this);e.__dir__=-1,e.__filtered__=!0}else(e=this.clone()).__dir__*=-1;return e},Gn.prototype.value=function(){var e=this.__wrapped__.value(),t=this.__dir__,n=Za(e),r=t<0,o=n?e.length:0,i=function(e,t,n){var r=-1,o=n.length;for(;++r=this.__values__.length;return{done:e,value:e?o:this.__values__[this.__index__++]}},Un.prototype.plant=function(e){for(var t,n=this;n instanceof Wn;){var r=Ui(n);r.__index__=0,r.__values__=o,t?i.__wrapped__=r:t=r;var i=r;n=n.__wrapped__}return i.__wrapped__=e,t},Un.prototype.reverse=function(){var e=this.__wrapped__;if(e instanceof Gn){var t=e;return this.__actions__.length&&(t=new Gn(this)),(t=t.reverse()).__actions__.push({func:ga,args:[ra],thisArg:o}),new Vn(t,this.__chain__)}return this.thru(ra)},Un.prototype.toJSON=Un.prototype.valueOf=Un.prototype.value=function(){return vo(this.__wrapped__,this.__actions__)},Un.prototype.first=Un.prototype.head,et&&(Un.prototype[et]=function(){return this}),Un}();pt._=vn,(r=function(){return vn}.call(t,n,t,e))===o||(e.exports=r)}.call(this)},4516:function(e){"use strict";var t=Object.getOwnPropertySymbols,n=Object.prototype.hasOwnProperty,r=Object.prototype.propertyIsEnumerable;function o(e){if(null==e)throw new TypeError("Object.assign cannot be called with null or undefined");return Object(e)}e.exports=function(){try{if(!Object.assign)return!1;var e=new String("abc");if(e[5]="de","5"===Object.getOwnPropertyNames(e)[0])return!1;for(var t={},n=0;n<10;n++)t["_"+String.fromCharCode(n)]=n;if("0123456789"!==Object.getOwnPropertyNames(t).map((function(e){return t[e]})).join(""))return!1;var r={};return"abcdefghijklmnopqrst".split("").forEach((function(e){r[e]=e})),"abcdefghijklmnopqrst"===Object.keys(Object.assign({},r)).join("")}catch(e){return!1}}()?Object.assign:function(e,i){for(var a,l,c=o(e),s=1;s=0;--i){var a=this.tryEntries[i],l=a.completion;if("root"===a.tryLoc)return o("end");if(a.tryLoc<=this.prev){var c=r.call(a,"catchLoc"),s=r.call(a,"finallyLoc");if(c&&s){if(this.prev=0;--n){var o=this.tryEntries[n];if(o.tryLoc<=this.prev&&r.call(o,"finallyLoc")&&this.prev=0;--t){var n=this.tryEntries[t];if(n.finallyLoc===e)return this.complete(n.completion,n.afterLoc),C(n),m}},catch:function(e){for(var t=this.tryEntries.length-1;t>=0;--t){var n=this.tryEntries[t];if(n.tryLoc===e){var r=n.completion;if("throw"===r.type){var o=r.arg;C(n)}return o}}throw new Error("illegal catch attempt")},delegateYield:function(e,n,r){return this.delegate={iterator:I(e),resultName:n,nextLoc:r},"next"===this.method&&(this.arg=t),m}},e}(e.exports);try{regeneratorRuntime=t}catch(e){Function("r","regeneratorRuntime = r")(t)}},8336:function(e,t,n){var r=n(487),o=n(4295);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},554:function(e,t,n){var r=n(487),o=n(9135);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},2789:function(e,t,n){var r=n(487),o=n(3729);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},5080:function(e,t,n){var r=n(487),o=n(4241);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},7225:function(e,t,n){var r=n(487),o=n(6029);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},778:function(e,t,n){var r=n(487),o=n(9609);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},4220:function(e,t,n){var r=n(487),o=n(2345);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},4678:function(e,t,n){var r=n(487),o=n(9393);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},1292:function(e,t,n){var r=n(487),o=n(6578);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},196:function(e,t,n){var r=n(487),o=n(9482);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},2205:function(e,t,n){var r=n(487),o=n(7955);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},1310:function(e,t,n){var r=n(487),o=n(3195);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},3922:function(e,t,n){var r=n(487),o=n(2978);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},7096:function(e,t,n){var r=n(487),o=n(1587);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},7117:function(e,t,n){var r=n(487),o=n(9478);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},1106:function(e,t,n){var r=n(487),o=n(7369);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},3336:function(e,t,n){var r=n(487),o=n(1434);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},4406:function(e,t,n){var r=n(487),o=n(8923);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},6043:function(e,t,n){var r=n(487),o=n(5605);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},694:function(e,t,n){var r=n(487),o=n(5644);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},8328:function(e,t,n){var r=n(487),o=n(6843);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},8051:function(e,t,n){var r=n(487),o=n(8461);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},4301:function(e,t,n){var r=n(487),o=n(9935);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},9966:function(e,t,n){var r=n(487),o=n(532);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},9295:function(e,t,n){var r=n(487),o=n(7589);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},9781:function(e,t,n){var r=n(487),o=n(8465);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},371:function(e,t,n){var r=n(487),o=n(5892);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},4623:function(e,t,n){var r=n(487),o=n(3874);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},1528:function(e,t,n){var r=n(487),o=n(2681);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},518:function(e,t,n){var r=n(487),o=n(6759);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},9757:function(e,t,n){var r=n(487),o=n(9650);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},5422:function(e,t,n){var r=n(487),o=n(2044);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},276:function(e,t,n){var r=n(487),o=n(9144);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},6781:function(e,t,n){var r=n(487),o=n(6626);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},580:function(e,t,n){var r=n(487),o=n(6359);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},4285:function(e,t,n){var r=n(487),o=n(9915);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},3313:function(e,t,n){var r=n(487),o=n(9310);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},8635:function(e,t,n){var r=n(487),o=n(6464);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},4404:function(e,t,n){var r=n(487),o=n(5260);"string"==typeof(o=o.__esModule?o.default:o)&&(o=[[e.id,o,""]]);var i={insert:"head",singleton:!1};r(o,i);e.exports=o.locals||{}},487:function(e,t,n){"use strict";var r,o=function(){return void 0===r&&(r=Boolean(window&&document&&document.all&&!window.atob)),r},i=function(){var e={};return function(t){if(void 0===e[t]){var n=document.querySelector(t);if(window.HTMLIFrameElement&&n instanceof window.HTMLIFrameElement)try{n=n.contentDocument.head}catch(e){n=null}e[t]=n}return e[t]}}(),a=[];function l(e){for(var t=-1,n=0;n=0||Object.prototype.propertyIsEnumerable.call(e,n)&&(i[n]=e[n])}return i}},7316:function(e){e.exports=function(e,t){if(null==e)return{};var n,r,o={},i=Object.keys(e);for(r=0;r=0||(o[n]=e[n]);return o}},4295:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i),l=n(1667),c=n.n(l),s=new URL(n(3940),n.b),u=new URL(n(3147),n.b),d=a()(o()),f=c()(s),p=c()(u);d.push([e.id,'@font-face{font-family:"Virgil";src:url('+f+');font-display:swap}@font-face{font-family:"Cascadia";src:url('+p+");font-display:swap}",""]),t.default=d},9135:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,".excalidraw .ActiveFile .ActiveFile__fileName{display:flex;align-items:center}.excalidraw .ActiveFile .ActiveFile__fileName span{text-overflow:ellipsis;overflow:hidden;white-space:nowrap;width:9.3em}.excalidraw .ActiveFile .ActiveFile__fileName svg{width:1.15em;-webkit-margin-end:.3em;margin-inline-end:.3em;-webkit-transform:scaleY(0.9);transform:scaleY(0.9)}",""]),t.default=a},3729:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .Avatar{width:2.5rem;height:2.5rem;border-radius:1.25rem;display:flex;justify-content:center;align-items:center;color:#fff;cursor:pointer;font-size:.8rem;font-weight:500}",""]),t.default=a},4241:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .Card{display:flex;flex-direction:column;align-items:center;max-width:290px;margin:1em;text-align:center}.excalidraw .Card .Card-icon{font-size:2.6em;display:flex;flex:0 0 auto;padding:1.4rem;border-radius:50%;background:var(--card-color);color:#fff}.excalidraw .Card .Card-icon svg{width:2.8rem;height:2.8rem}.excalidraw .Card .Card-details{font-size:.96em;min-height:90px;padding:0 1em;margin-bottom:auto}.excalidraw .Card .Card-button.ToolIcon_type_button{height:2.5rem;margin-top:1em;margin-bottom:.3em;background-color:var(--card-color)}.excalidraw .Card .Card-button.ToolIcon_type_button:hover{background-color:var(--card-color-darker)}.excalidraw .Card .Card-button.ToolIcon_type_button:active{background-color:var(--card-color-darkest)}.excalidraw .Card .Card-button.ToolIcon_type_button .ToolIcon__label{color:#fff}.excalidraw .Card .Card-button.ToolIcon_type_button .Spinner{--spinner-color: #fff}",""]),t.default=a},6029:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .Checkbox{margin:4px .3em;display:flex;align-items:center;cursor:pointer;-webkit-user-select:none;user-select:none;-webkit-tap-highlight-color:transparent}.excalidraw .Checkbox:hover:not(.is-checked) .Checkbox-box:not(:focus){box-shadow:0 0 0 2px #4dabf7}.excalidraw .Checkbox:hover:not(.is-checked) .Checkbox-box:not(:focus) svg{display:block;opacity:.3}.excalidraw .Checkbox:active .Checkbox-box{box-shadow:0 0 2px 1px inset #1c7ed6 !important}.excalidraw .Checkbox:hover .Checkbox-box{background-color:rgba(208,235,255,.2)}.excalidraw .Checkbox.is-checked .Checkbox-box{background-color:#d0ebff}.excalidraw .Checkbox.is-checked .Checkbox-box svg{display:block}.excalidraw .Checkbox.is-checked:hover .Checkbox-box{background-color:#a5d8ff}.excalidraw .Checkbox .Checkbox-box{width:22px;height:22px;padding:0;flex:0 0 auto;margin:0 1em;display:flex;align-items:center;justify-content:center;box-shadow:0 0 0 2px #1c7ed6;background-color:transparent;border-radius:4px;color:#1c7ed6}.excalidraw .Checkbox .Checkbox-box:focus{box-shadow:0 0 0 3px #1c7ed6}.excalidraw .Checkbox .Checkbox-box svg{display:none;width:16px;height:16px;stroke-width:3px}.excalidraw .Checkbox .Checkbox-label{display:flex;align-items:center}.excalidraw .Checkbox .excalidraw-tooltip-icon{width:1em;height:1em}",""]),t.default=a},9609:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .CollabButton.is-collaborating{background-color:var(--button-special-active-bg-color)}.excalidraw .CollabButton.is-collaborating .ToolIcon__icon svg,.excalidraw .CollabButton.is-collaborating .ToolIcon__label{color:var(--icon-green-fill-color)}.excalidraw .CollabButton-collaborators{min-width:1em;position:absolute;bottom:-5px;padding:3px;border-radius:50%;background-color:#40c057;color:#fff;font-size:.7em;font-family:var(--ui-font)}:root[dir=ltr] .excalidraw .CollabButton-collaborators{right:-5px}:root[dir=rtl] .excalidraw .CollabButton-collaborators{left:-5px}",""]),t.default=a},2345:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i),l=n(1667),c=n.n(l),s=new URL(n(9669),n.b),u=a()(o()),d=c()(s);u.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .color-picker{background:var(--popup-bg-color);border:0 solid rgba(255,255,255,.25);box-shadow:rgba(0,0,0,.25) 0 1px 4px;border-radius:4px;position:absolute}:root[dir=ltr] .excalidraw .color-picker{left:-5.5px}:root[dir=rtl] .excalidraw .color-picker{right:-5.5px}.excalidraw .color-picker-control-container{display:grid;grid-template-columns:auto 1fr;align-items:center}.excalidraw .color-picker-triangle{width:0;height:0;border-style:solid;border-width:0 9px 10px;border-color:transparent transparent var(--popup-bg-color);position:absolute;top:-10px}:root[dir=ltr] .excalidraw .color-picker-triangle{left:12px}:root[dir=rtl] .excalidraw .color-picker-triangle{right:12px}.excalidraw .color-picker-triangle-shadow{border-color:transparent transparent rgba(0,0,0,.1);top:-11px}.excalidraw .color-picker-content{padding:.5rem;display:grid;grid-template-columns:repeat(5, auto);grid-gap:.5rem;border-radius:4px}.excalidraw .color-picker-content:focus{outline:none;box-shadow:0 0 0 2px var(--focus-highlight-color)}.excalidraw .color-picker-content .color-input-container{grid-column:1/span 5}.excalidraw .color-picker-swatch{position:relative;height:1.875rem;width:1.875rem;cursor:pointer;border-radius:4px;margin:0;box-sizing:border-box;border:1px solid #ddd;background-color:currentColor !important;-webkit-filter:var(--theme-filter);filter:var(--theme-filter)}.excalidraw .color-picker-swatch:focus{box-shadow:0 0 4px 1px currentColor;border-color:var(--select-highlight-color)}.excalidraw .color-picker-transparent{border-radius:4px;box-shadow:rgba(0,0,0,.1) 0 0 0 1px inset;position:absolute;top:0;right:0;bottom:0;left:0}.excalidraw .color-picker-transparent,.excalidraw .color-picker-label-swatch{background:url("+d+') left center}.excalidraw .color-picker-hash{background:var(--input-border-color);height:1.875rem;width:1.875rem;color:var(--input-label-color);display:flex;align-items:center;justify-content:center;position:relative}:root[dir=ltr] .excalidraw .color-picker-hash{border-radius:4px 0 0 4px}:root[dir=rtl] .excalidraw .color-picker-hash{border-radius:0 4px 4px 0}.excalidraw .color-input-container:focus-within .color-picker-hash{box-shadow:0 0 0 2px var(--focus-highlight-color)}.excalidraw .color-input-container:focus-within .color-picker-hash::before,.excalidraw .color-input-container:focus-within .color-picker-hash::after{content:"";width:1px;height:100%;position:absolute;top:0}.excalidraw .color-input-container:focus-within .color-picker-hash::before{background:var(--input-border-color)}:root[dir=ltr] .excalidraw .color-input-container:focus-within .color-picker-hash::before{right:-1px}:root[dir=rtl] .excalidraw .color-input-container:focus-within .color-picker-hash::before{left:-1px}.excalidraw .color-input-container:focus-within .color-picker-hash::after{background:var(--input-bg-color)}:root[dir=ltr] .excalidraw .color-input-container:focus-within .color-picker-hash::after{right:-2px}:root[dir=rtl] .excalidraw .color-input-container:focus-within .color-picker-hash::after{left:-2px}.excalidraw .color-input-container{display:flex}.excalidraw .color-picker-input{width:11ch;margin:0;font-size:1rem;background-color:var(--input-bg-color);color:var(--text-primary-color);border:0;outline:none;height:1.75em;box-shadow:var(--input-border-color) 0 0 0 1px inset;float:left;padding:1px;-webkit-padding-start:.5em;padding-inline-start:.5em;-webkit-appearance:none;appearance:none}:root[dir=ltr] .excalidraw .color-picker-input{border-radius:0 4px 4px 0}:root[dir=rtl] .excalidraw .color-picker-input{border-radius:4px 0 0 4px}.excalidraw .color-picker-label-swatch{height:1.875rem;width:1.875rem;-webkit-margin-end:.25rem;margin-inline-end:.25rem;border:1px solid #dee2e6;position:relative;overflow:hidden;background-color:transparent !important;-webkit-filter:var(--theme-filter);filter:var(--theme-filter)}.excalidraw .color-picker-label-swatch:after{content:"";position:absolute;top:0;left:0;width:100%;height:100%;background:var(--swatch-color)}.excalidraw .color-picker-keybinding{position:absolute;bottom:2px;font-size:.7em}:root[dir=ltr] .excalidraw .color-picker-keybinding{right:2px}:root[dir=rtl] .excalidraw .color-picker-keybinding{left:2px}.excalidraw--mobile.excalidraw .color-picker-keybinding{display:none}.excalidraw .color-picker-type-canvasBackground .color-picker-keybinding{color:#aaa}.excalidraw .color-picker-type-elementBackground .color-picker-keybinding{color:#fff}.excalidraw .color-picker-swatch[aria-label=transparent] .color-picker-keybinding{color:#aaa}.excalidraw .color-picker-type-elementStroke .color-picker-keybinding{color:#d4d4d4}.excalidraw.theme--dark .color-picker-type-elementBackground .color-picker-keybinding{color:#000}.excalidraw.theme--dark .color-picker-swatch[aria-label=transparent] .color-picker-keybinding{color:#000}',""]),t.default=u},9393:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .confirm-dialog-buttons{display:flex;padding:.2rem 0;justify-content:flex-end}.excalidraw .confirm-dialog .ToolIcon__icon{min-width:2.5rem;width:auto;font-size:1rem}.excalidraw .confirm-dialog .ToolIcon_type_button{margin-left:.8rem;padding:0 .5rem}.excalidraw .confirm-dialog__content{font-size:1rem}.excalidraw .confirm-dialog--confirm.ToolIcon_type_button{background-color:#fa5252}.excalidraw .confirm-dialog--confirm.ToolIcon_type_button:hover{background-color:#e03131}.excalidraw .confirm-dialog--confirm.ToolIcon_type_button .ToolIcon__icon{color:#fff}",""]),t.default=a},6578:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,':export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .context-menu{position:relative;border-radius:4px;box-shadow:0 3px 10px rgba(0,0,0,.2);padding:0;list-style:none;-webkit-user-select:none;user-select:none;margin:-0.25rem 0 0 .125rem;padding:.5rem 0;background-color:var(--popup-secondary-bg-color);border:1px solid var(--button-gray-3);cursor:default}.excalidraw .context-menu button{color:var(--popup-text-color)}.excalidraw .context-menu-option{position:relative;width:100%;min-width:9.5rem;margin:0;padding:.25rem 1rem .25rem 1.25rem;text-align:start;border-radius:0;background-color:transparent;border:none;white-space:nowrap;display:grid;grid-template-columns:1fr .2fr;align-items:center}.excalidraw .context-menu-option.checkmark::before{position:absolute;left:6px;margin-bottom:1px;content:"✓"}.excalidraw .context-menu-option.dangerous .context-menu-option__label{color:#f03e3e}.excalidraw .context-menu-option .context-menu-option__label{justify-self:start;-webkit-margin-end:20px;margin-inline-end:20px}.excalidraw .context-menu-option .context-menu-option__shortcut{justify-self:end;opacity:.6;font-family:inherit;font-size:.7rem}.excalidraw .context-menu-option:hover{color:var(--popup-bg-color);background-color:var(--select-highlight-color)}.excalidraw .context-menu-option:hover.dangerous{background-color:#fa5252}.excalidraw .context-menu-option:hover.dangerous .context-menu-option__label{color:var(--popup-bg-color)}.excalidraw .context-menu-option:focus{z-index:1}.excalidraw--mobile.excalidraw .context-menu-option{display:block}.excalidraw--mobile.excalidraw .context-menu-option .context-menu-option__label{-webkit-margin-end:0;margin-inline-end:0}.excalidraw--mobile.excalidraw .context-menu-option .context-menu-option__shortcut{display:none}.excalidraw .context-menu-option-separator{border:none;border-top:1px solid #adb5bd}',""]),t.default=a},9482:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .Dialog{-webkit-user-select:text;user-select:text;cursor:auto}.excalidraw .Dialog__title{display:grid;align-items:center;margin-top:0;grid-template-columns:1fr calc(var(--space-factor)*7);grid-gap:var(--metric);padding:calc(var(--space-factor)*2);text-align:center;font-variant:small-caps;font-size:1.2em}.excalidraw .Dialog__titleContent{flex:1}.excalidraw .Dialog .Modal__close{color:var(--icon-fill-color);margin:0}.excalidraw .Dialog__content{padding:0 16px 16px}.excalidraw--mobile.excalidraw .Dialog{--metric: calc(var(--space-factor) * 4);--inset-left: max(var(--metric), var(--sal));--inset-right: max(var(--metric), var(--sar))}.excalidraw--mobile.excalidraw .Dialog__title{grid-template-columns:calc(var(--space-factor)*7) 1fr calc(var(--space-factor)*7);position:-webkit-sticky;position:sticky;top:0;padding:calc(var(--space-factor)*2);background:var(--island-bg-color);font-size:1.25em;box-sizing:border-box;border-bottom:1px solid var(--button-gray-2);z-index:1}.excalidraw--mobile.excalidraw .Dialog__titleContent{text-align:center}.excalidraw--mobile.excalidraw .Dialog .Island{width:100vw;height:100%;box-sizing:border-box;overflow-y:auto;padding-left:max(calc(var(--padding) * var(--space-factor)), var(--sal));padding-right:max(calc(var(--padding) * var(--space-factor)), var(--sar));padding-bottom:max(calc(var(--padding) * var(--space-factor)), var(--sab))}.excalidraw--mobile.excalidraw .Dialog .Modal__close{order:-1}",""]),t.default=a},7955:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i),l=n(1667),c=n.n(l),s=new URL(n(9669),n.b),u=a()(o()),d=c()(s);u.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .ExportDialog__preview{--preview-padding: calc(var(--space-factor) * 4);background:url("+d+") left center;text-align:center;padding:var(--preview-padding);margin-bottom:calc(var(--space-factor)*3)}.excalidraw .ExportDialog__preview canvas{max-width:calc(100% - var(--preview-padding)*2);max-height:25rem}.excalidraw.theme--dark .ExportDialog__preview canvas{-webkit-filter:none;filter:none}.excalidraw .ExportDialog__actions{width:100%;display:flex;grid-gap:calc(var(--space-factor)*2);align-items:top;justify-content:space-between}.excalidraw--mobile.excalidraw .ExportDialog{display:flex;flex-direction:column}.excalidraw--mobile.excalidraw .ExportDialog__actions{flex-direction:column;align-items:center}.excalidraw--mobile.excalidraw .ExportDialog__actions>*{margin-bottom:calc(var(--space-factor)*3)}.excalidraw--mobile.excalidraw .ExportDialog__preview canvas{max-height:30vh}.excalidraw--mobile.excalidraw .ExportDialog__dialog,.excalidraw--mobile.excalidraw .ExportDialog__dialog .Island{height:100%;box-sizing:border-box}.excalidraw--mobile.excalidraw .ExportDialog__dialog .Island{overflow-y:auto}.excalidraw .ExportDialog--json .ExportDialog-cards{display:grid;grid-template-columns:repeat(auto-fit, minmax(200px, 1fr));justify-items:center;row-gap:2em}@media(max-width: 460px){.excalidraw .ExportDialog--json .ExportDialog-cards{grid-template-columns:repeat(auto-fit, minmax(240px, 1fr))}.excalidraw .ExportDialog--json .ExportDialog-cards .Card-details{min-height:40px}}.excalidraw .ExportDialog--json .ExportDialog-cards .ProjectName{width:-webkit-fit-content;width:-moz-fit-content;width:fit-content;margin:1em auto;align-items:flex-start;flex-direction:column}.excalidraw .ExportDialog--json .ExportDialog-cards .ProjectName .TextInput{width:auto}.excalidraw .ExportDialog--json .ExportDialog-cards .ProjectName-label{margin:.625em 0;font-weight:bold}.excalidraw button.ExportDialog-imageExportButton{width:5rem;height:5rem;margin:0 .2em;border-radius:1rem;background-color:var(--button-color);box-shadow:0 3px 5px -1px rgba(0,0,0,.28),0 6px 10px 0 rgba(0,0,0,.14);font-family:Cascadia;font-size:1.8em;color:#fff}.excalidraw button.ExportDialog-imageExportButton:hover{background-color:var(--button-color-darker)}.excalidraw button.ExportDialog-imageExportButton:active{background-color:var(--button-color-darkest);box-shadow:none}.excalidraw button.ExportDialog-imageExportButton svg{width:.9em}",""]),t.default=u},3195:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,".excalidraw .FixedSideContainer{position:absolute;pointer-events:none}.excalidraw .FixedSideContainer>*{pointer-events:all}.excalidraw .FixedSideContainer_side_top{left:var(--space-factor);top:var(--space-factor);right:var(--space-factor);z-index:2}.excalidraw .FixedSideContainer_side_top.zen-mode{right:42px}",""]),t.default=a},2978:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .HelpDialog h3{border-bottom:1px solid var(--button-gray-2);padding-bottom:4px}.excalidraw .HelpDialog--island{border:1px solid var(--button-gray-2);margin-bottom:16px}.excalidraw .HelpDialog--island-title{margin:0;padding:4px;background-color:var(--button-gray-1);text-align:center}.excalidraw .HelpDialog--shortcut{border-top:1px solid var(--button-gray-2)}.excalidraw .HelpDialog--key{word-break:keep-all;border:1px solid var(--button-gray-2);padding:2px 8px;margin:auto 4px;background-color:var(--button-gray-1);border-radius:2px;font-size:.8em;min-height:26px;box-sizing:border-box;display:flex;align-items:center;font-family:inherit}.excalidraw .HelpDialog--header{display:flex;flex-direction:row;justify-content:space-evenly;margin-bottom:32px;padding-bottom:16px}.excalidraw .HelpDialog--btn{border:1px solid var(--link-color);padding:8px 32px;border-radius:4px}.excalidraw .HelpDialog--btn:hover{text-decoration:none}",""]),t.default=a},1587:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .HintViewer{pointer-events:none;box-sizing:border-box;position:absolute;display:flex;justify-content:center;left:0;top:100%;max-width:100%;width:100%;margin-top:6px;text-align:center;color:#868e96;font-size:.8rem}.excalidraw--mobile.excalidraw .HintViewer{position:static;padding-right:2em}.excalidraw .HintViewer>span{padding:.2rem .4rem;background-color:var(--overlay-bg-color);border-radius:4px}",""]),t.default=a},9478:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,':export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .picker-container{display:inline-block;box-sizing:border-box;margin-right:.25rem}.excalidraw .picker{background:var(--popup-bg-color);border:0 solid rgba(255,255,255,.25);box-shadow:rgba(0,0,0,.25) 0 1px 4px;border-radius:4px;position:absolute}.excalidraw .picker-container button,.excalidraw .picker button{position:relative;display:flex;align-items:center;justify-content:center}.excalidraw .picker-container button:focus-visible,.excalidraw .picker button:focus-visible{outline:transparent;background-color:var(--button-gray-2)}.excalidraw .picker-container button:focus-visible svg,.excalidraw .picker button:focus-visible svg{opacity:1}.excalidraw .picker-container button:hover,.excalidraw .picker button:hover{background-color:var(--button-gray-2)}.excalidraw .picker-container button:active,.excalidraw .picker button:active{background-color:var(--button-gray-3)}.excalidraw .picker-container button:disabled,.excalidraw .picker button:disabled{cursor:not-allowed}.excalidraw .picker-container button svg,.excalidraw .picker button svg{margin:0;width:36px;height:18px;opacity:.6;pointer-events:none}.excalidraw .picker button{padding:.25rem .28rem .35rem .25rem}.excalidraw .picker-triangle{width:0;height:0;position:relative;top:-10px;z-index:10}:root[dir=ltr] .excalidraw .picker-triangle{left:12px}:root[dir=rtl] .excalidraw .picker-triangle{right:12px}.excalidraw .picker-triangle:before{content:"";position:absolute;border-style:solid;border-width:0 9px 10px;border-color:transparent transparent rgba(0,0,0,.1);top:-1px}.excalidraw .picker-triangle:after{content:"";position:absolute;border-style:solid;border-width:0 9px 10px;border-color:transparent transparent var(--popup-bg-color)}.excalidraw .picker-content{padding:.5rem;display:grid;grid-template-columns:repeat(3, auto);grid-gap:.5rem;border-radius:4px}:root[dir=rtl] .excalidraw .picker-content{padding:.4rem}.excalidraw .picker-keybinding{position:absolute;bottom:2px;font-size:.7em;color:var(--keybinding-color)}:root[dir=ltr] .excalidraw .picker-keybinding{right:2px}:root[dir=rtl] .excalidraw .picker-keybinding{left:2px}.excalidraw--mobile.excalidraw .picker-keybinding{display:none}.excalidraw .picker-type-canvasBackground .picker-keybinding{color:#aaa}.excalidraw .picker-type-elementBackground .picker-keybinding{color:#fff}.excalidraw .picker-swatch[aria-label=transparent] .picker-keybinding{color:#aaa}.excalidraw .picker-type-elementStroke .picker-keybinding{color:#d4d4d4}.excalidraw.theme--dark .picker-type-elementBackground .picker-keybinding{color:#000}.excalidraw.theme--dark .picker-swatch[aria-label=transparent] .picker-keybinding{color:#000}',""]),t.default=a},7369:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,".excalidraw .Island{--padding: 0;background-color:var(--island-bg-color);box-shadow:var(--shadow-island);border-radius:var(--border-radius-lg);padding:calc(var(--padding)*var(--space-factor));position:relative;transition:box-shadow .5s ease-in-out}.excalidraw .Island.zen-mode{box-shadow:none}",""]),t.default=a},1434:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,".excalidraw .layer-ui__wrapper{z-index:var(--zIndex-layerUI)}.excalidraw .layer-ui__wrapper__top-right{display:flex}.excalidraw .layer-ui__wrapper__footer{width:100%}.excalidraw .layer-ui__wrapper__footer-right{z-index:100;display:flex}.excalidraw .layer-ui__wrapper .zen-mode-transition{transition:-webkit-transform .5s ease-in-out;transition:transform .5s ease-in-out;transition:transform .5s ease-in-out, -webkit-transform .5s ease-in-out}:root[dir=ltr] .excalidraw .layer-ui__wrapper .zen-mode-transition.transition-left{-webkit-transform:translate(-999px, 0);transform:translate(-999px, 0)}:root[dir=ltr] .excalidraw .layer-ui__wrapper .zen-mode-transition.transition-right{-webkit-transform:translate(999px, 0);transform:translate(999px, 0)}:root[dir=rtl] .excalidraw .layer-ui__wrapper .zen-mode-transition.transition-left{-webkit-transform:translate(999px, 0);transform:translate(999px, 0)}:root[dir=rtl] .excalidraw .layer-ui__wrapper .zen-mode-transition.transition-right{-webkit-transform:translate(-999px, 0);transform:translate(-999px, 0)}:root[dir=ltr] .excalidraw .layer-ui__wrapper .zen-mode-transition.layer-ui__wrapper__footer-left--transition-left{-webkit-transform:translate(-76px, 0);transform:translate(-76px, 0)}:root[dir=rtl] .excalidraw .layer-ui__wrapper .zen-mode-transition.layer-ui__wrapper__footer-left--transition-left{-webkit-transform:translate(76px, 0);transform:translate(76px, 0)}.excalidraw .layer-ui__wrapper .zen-mode-transition.layer-ui__wrapper__footer-left--transition-bottom{-webkit-transform:translate(0, 92px);transform:translate(0, 92px)}.excalidraw .layer-ui__wrapper .disable-zen-mode{height:30px;position:absolute;bottom:10px;font-size:10px;padding:10px;font-weight:500;opacity:0;visibility:hidden;transition:visibility 0s linear 0s,opacity .5s}[dir=ltr] .excalidraw .layer-ui__wrapper .disable-zen-mode{right:15px}[dir=rtl] .excalidraw .layer-ui__wrapper .disable-zen-mode{left:15px}.excalidraw .layer-ui__wrapper .disable-zen-mode--visible{opacity:1;visibility:visible;transition:visibility 0s linear 300ms,opacity .5s;transition-delay:.8s}.excalidraw .layer-ui__wrapper .layer-ui__wrapper__footer-center{pointer-events:none}.excalidraw .layer-ui__wrapper .layer-ui__wrapper__footer-center>*{pointer-events:all}.excalidraw .layer-ui__wrapper .layer-ui__wrapper__footer-left,.excalidraw .layer-ui__wrapper .layer-ui__wrapper__footer-right,.excalidraw .layer-ui__wrapper .disable-zen-mode--visible{pointer-events:all}.excalidraw .layer-ui__wrapper .layer-ui__wrapper__footer-left{margin-bottom:.2em}.excalidraw .layer-ui__wrapper .layer-ui__wrapper__footer-right{margin-top:auto;margin-bottom:auto;-webkit-margin-end:1em;margin-inline-end:1em}",""]),t.default=a},8923:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,".excalidraw .layer-ui__library{margin:auto;display:flex;align-items:center;justify-content:center}.excalidraw .layer-ui__library .layer-ui__library-header{display:flex;align-items:center;width:100%;margin:2px 0}.excalidraw .layer-ui__library .layer-ui__library-header button{margin:0 2px}.excalidraw .layer-ui__library .layer-ui__library-header a{-webkit-margin-start:auto;margin-inline-start:auto;-webkit-padding-end:18px;padding-inline-end:18px;white-space:nowrap}.excalidraw .layer-ui__library-message{padding:10px 20px;max-width:200px}.excalidraw .publish-library-success .Dialog__content{display:flex;flex-direction:column}.excalidraw .publish-library-success-close.ToolIcon_type_button{background-color:#228be6;align-self:flex-end}.excalidraw .publish-library-success-close.ToolIcon_type_button:hover{background-color:#1971c2}.excalidraw .publish-library-success-close.ToolIcon_type_button .ToolIcon__icon{width:auto;font-size:1rem;color:#fff;padding:0 .5rem}",""]),t.default=a},5605:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,".excalidraw .library-menu-items-container .library-actions{display:flex}.excalidraw .library-menu-items-container .library-actions button .library-actions-counter{position:absolute;right:2px;bottom:2px;border-radius:50%;width:1em;height:1em;padding:1px;font-size:.7rem;background:#fff}.excalidraw .library-menu-items-container .library-actions--remove{background-color:#f03e3e}.excalidraw .library-menu-items-container .library-actions--remove:hover{background-color:#e03131}.excalidraw .library-menu-items-container .library-actions--remove:active{background-color:#c92a2a}.excalidraw .library-menu-items-container .library-actions--remove svg{color:#fff}.excalidraw .library-menu-items-container .library-actions--remove .library-actions-counter{color:#f03e3e}.excalidraw .library-menu-items-container .library-actions--export{background-color:#94d82d}.excalidraw .library-menu-items-container .library-actions--export:hover{background-color:#74b816}.excalidraw .library-menu-items-container .library-actions--export:active{background-color:#66a80f}.excalidraw .library-menu-items-container .library-actions--export svg{color:#fff}.excalidraw .library-menu-items-container .library-actions--export .library-actions-counter{color:#94d82d}.excalidraw .library-menu-items-container .library-actions--publish{background-color:#15aabf}.excalidraw .library-menu-items-container .library-actions--publish:hover{background-color:#1098ad}.excalidraw .library-menu-items-container .library-actions--publish:active{background-color:#0b7285}.excalidraw .library-menu-items-container .library-actions--publish svg{color:#fff}.excalidraw .library-menu-items-container .library-actions--publish label{margin-left:-0.2em;margin-right:1.1em;color:#fff;font-size:.86em}.excalidraw .library-menu-items-container .library-actions--publish .library-actions-counter{color:#15aabf}.excalidraw .library-menu-items-container .library-actions--load{background-color:#228be6}.excalidraw .library-menu-items-container .library-actions--load:hover{background-color:#1c7ed6}.excalidraw .library-menu-items-container .library-actions--load:active{background-color:#1864ab}.excalidraw .library-menu-items-container .library-actions--load svg{color:#fff}.excalidraw .library-menu-items-container__items{max-height:50vh;overflow:auto;margin-top:.5rem}.excalidraw .library-menu-items-container .separator{font-weight:500;font-size:.9rem;margin:.6em .2em;color:var(--text-primary-color)}",""]),t.default=a},5644:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .library-unit{align-items:center;border:1px solid var(--button-gray-2);display:flex;justify-content:center;position:relative;width:63px;height:63px}.excalidraw .library-unit--hover{box-shadow:inset 0px 0px 0px 2px #339af0;border-color:#339af0}.excalidraw .library-unit--selected{box-shadow:inset 0px 0px 0px 2px #1971c2;border-color:#1971c2}.excalidraw.theme--dark .library-unit{border-color:#303030}.excalidraw .library-unit__dragger{display:flex;align-items:center;justify-content:center;height:100%;width:100%}.excalidraw .library-unit__dragger>svg{-webkit-filter:var(--theme-filter);filter:var(--theme-filter);flex-grow:1;max-height:100%;max-width:100%}.excalidraw .library-unit__checkbox-container,.excalidraw .library-unit__checkbox-container:hover,.excalidraw .library-unit__checkbox-container:active{align-items:center;background:none;border:none;color:var(--icon-fill-color);display:flex;justify-content:center;margin:0;padding:.5rem;position:absolute;left:2rem;bottom:2rem;cursor:pointer}.excalidraw .library-unit__checkbox-container input,.excalidraw .library-unit__checkbox-container:hover input,.excalidraw .library-unit__checkbox-container:active input{cursor:pointer}.excalidraw .library-unit__checkbox{position:absolute;left:2.3rem;bottom:2.3rem}.excalidraw .library-unit__checkbox .Checkbox-box{width:13px;height:13px;border-radius:2px;margin:.5em .5em .2em .2em;background-color:#d0ebff}.excalidraw .library-unit__checkbox.Checkbox:hover .Checkbox-box{background-color:#a5d8ff}.excalidraw .library-unit__removeFromLibrary>svg{height:16px;width:16px}.excalidraw .library-unit__adder{-webkit-transform:scale(1);transform:scale(1);-webkit-animation:library-unit__adder-animation 1s ease-in infinite;animation:library-unit__adder-animation 1s ease-in infinite}.excalidraw .library-unit__adder{position:absolute;left:40%;top:40%;width:2rem;height:2rem;margin-left:-10px;margin-top:-10px;pointer-events:none}.excalidraw .library-unit:hover .library-unit__adder{fill:#1c7ed6}.excalidraw .library-unit:active .library-unit__adder{-webkit-animation:none;animation:none;-webkit-transform:scale(0.8);transform:scale(0.8);fill:#000}.excalidraw .library-unit__active{cursor:pointer}@-webkit-keyframes library-unit__adder-animation{0%{-webkit-transform:scale(0.85);transform:scale(0.85)}50%{-webkit-transform:scale(1);transform:scale(1)}100%{-webkit-transform:scale(0.85);transform:scale(0.85)}}@keyframes library-unit__adder-animation{0%{-webkit-transform:scale(0.85);transform:scale(0.85)}50%{-webkit-transform:scale(1);transform:scale(1)}100%{-webkit-transform:scale(0.85);transform:scale(0.85)}}",""]),t.default=a},6843:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw.excalidraw-modal-container{position:absolute;z-index:10}.excalidraw .Modal{position:absolute;top:0;left:0;right:0;bottom:0;display:flex;align-items:center;justify-content:center;overflow:auto;padding:calc(var(--space-factor)*10)}.excalidraw .Modal__background{position:absolute;top:0;left:0;right:0;bottom:0;z-index:1;background-color:rgba(0,0,0,.7)}.excalidraw .Modal__content{position:relative;z-index:2;width:100%;max-width:var(--max-width);max-height:100%;opacity:0;-webkit-transform:translateY(10px);transform:translateY(10px);-webkit-animation:Modal__content_fade-in .1s ease-out .05s forwards;animation:Modal__content_fade-in .1s ease-out .05s forwards;position:relative;overflow-y:auto;background:var(--island-bg-color);border:1px solid var(--dialog-border-color);box-shadow:0 2px 10px rgba(0,0,0,.25);border-radius:6px;box-sizing:border-box}.excalidraw .Modal__content:focus{outline:none}.excalidraw--mobile.excalidraw .Modal__content{max-width:100%;border:0;border-radius:0}@-webkit-keyframes Modal__content_fade-in{from{opacity:0;-webkit-transform:translateY(10px);transform:translateY(10px)}to{opacity:1;-webkit-transform:translateY(0);transform:translateY(0)}}@keyframes Modal__content_fade-in{from{opacity:0;-webkit-transform:translateY(10px);transform:translateY(10px)}to{opacity:1;-webkit-transform:translateY(0);transform:translateY(0)}}.excalidraw .Modal__close{width:calc(var(--space-factor)*7);height:calc(var(--space-factor)*7);display:flex;align-items:center;justify-content:center}.excalidraw .Modal__close svg{height:calc(var(--space-factor)*5)}.excalidraw--mobile.excalidraw .Modal{padding:0}.excalidraw--mobile.excalidraw .Modal__content{position:absolute;top:0;left:0;right:0;bottom:0}",""]),t.default=a},8461:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw--mobile.excalidraw .PasteChartDialog .Island{display:flex;flex-direction:column}.excalidraw .PasteChartDialog .container{display:flex;align-items:center;justify-content:space-around;flex-wrap:wrap}.excalidraw--mobile.excalidraw .PasteChartDialog .container{flex-direction:column;justify-content:center}.excalidraw .PasteChartDialog .ChartPreview{margin:8px;text-align:center;width:192px;height:128px;border-radius:2px;padding:1px;border:1px solid #ced4da;display:flex;align-items:center;justify-content:center;background:transparent}.excalidraw .PasteChartDialog .ChartPreview div{display:inline-block}.excalidraw .PasteChartDialog .ChartPreview svg{max-height:120px;max-width:186px}.excalidraw .PasteChartDialog .ChartPreview:hover{padding:0;border:2px solid #339af0}",""]),t.default=a},9935:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,".excalidraw .popover{position:absolute;z-index:10}",""]),t.default=a},532:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,".ProjectName{margin:auto;display:flex;align-items:center}.ProjectName .TextInput{height:calc(1rem - 3px);width:200px;overflow:hidden;text-align:center;margin-left:8px;text-overflow:ellipsis}.ProjectName .TextInput--readonly{background:none;border:none;width:auto;max-width:200px;padding-left:2px}.ProjectName .TextInput--readonly:hover{background:none}",""]),t.default=a},7589:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .publish-library__fields{display:flex;flex-direction:column}.excalidraw .publish-library__fields label{padding:1em;display:flex;justify-content:space-between;align-items:center}.excalidraw .publish-library__fields label span{font-weight:500;font-size:1rem;color:#868e96}.excalidraw .publish-library__fields label input,.excalidraw .publish-library__fields label textarea{width:70%;padding:.6em;font-family:var(--ui-font)}.excalidraw .publish-library__fields label .required{color:#e03131;margin:.2rem}.excalidraw .publish-library__buttons{display:flex;padding:.2rem 0;justify-content:flex-end}.excalidraw .publish-library__buttons .ToolIcon__icon{min-width:2.5rem;width:auto;font-size:1rem}.excalidraw .publish-library__buttons .ToolIcon_type_button{margin-left:1rem;padding:0 .5rem}.excalidraw .publish-library__buttons--confirm.ToolIcon_type_button{background-color:#228be6}.excalidraw .publish-library__buttons--confirm.ToolIcon_type_button:hover{background-color:#1971c2}.excalidraw .publish-library__buttons--cancel.ToolIcon_type_button{background-color:#adb5bd}.excalidraw .publish-library__buttons--cancel.ToolIcon_type_button:hover{background-color:#868e96}.excalidraw .publish-library__buttons .ToolIcon__icon{color:#fff}.excalidraw .publish-library__buttons .ToolIcon__icon .Spinner{--spinner-color: #fff}.excalidraw .publish-library__buttons .ToolIcon__icon .Spinner svg{padding:.5rem}.excalidraw .publish-library .selected-library-items{display:flex;padding:0 .8rem;flex-wrap:wrap}.excalidraw .publish-library .selected-library-items .single-library-item-wrapper{width:9rem}.excalidraw .publish-library-note{padding:1em;font-style:italic;font-size:14px;display:block}",""]),t.default=a},8465:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .single-library-item{position:relative}.excalidraw .single-library-item__svg{width:7.5rem;height:7.5rem;border:1px solid var(--button-gray-2);margin:.3rem}.excalidraw .single-library-item__svg svg{width:100%;height:100%}.excalidraw .single-library-item .ToolIcon__icon{background-color:#fff;width:auto;height:auto;margin:0 .5rem}.excalidraw .single-library-item .ToolIcon,.excalidraw .single-library-item .ToolIcon_type_button:hover{background-color:#fff}.excalidraw .single-library-item .required,.excalidraw .single-library-item .error{color:#e03131;font-weight:bold;font-size:1rem;margin:.2rem}.excalidraw .single-library-item .error{font-weight:500;margin:0;padding:.3em 0}.excalidraw .single-library-item--remove{position:absolute;top:.2rem;right:1.3rem}.excalidraw .single-library-item--remove .ToolIcon__icon{margin:0}.excalidraw .single-library-item--remove .ToolIcon__icon{background-color:#fa5252}.excalidraw .single-library-item--remove .ToolIcon__icon:hover{background-color:#f03e3e}.excalidraw .single-library-item--remove .ToolIcon__icon:active{background-color:#e03131}.excalidraw .single-library-item--remove svg{color:#fff;padding:.26rem;border-radius:.3em;width:1rem;height:1rem}",""]),t.default=a},5892:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,".excalidraw .Spinner{display:flex;align-items:center;justify-content:center;height:100%;margin-left:auto;margin-right:auto;--spinner-color: var(--icon-fill-color)}.excalidraw .Spinner svg{-webkit-animation:rotate 1.6s linear infinite;animation:rotate 1.6s linear infinite;-webkit-transform-origin:center center;transform-origin:center center}.excalidraw .Spinner circle{stroke:var(--spinner-color);-webkit-animation:dash 1.6s linear 0s infinite;animation:dash 1.6s linear 0s infinite;stroke-linecap:round}@-webkit-keyframes rotate{100%{-webkit-transform:rotate(360deg);transform:rotate(360deg)}}@keyframes rotate{100%{-webkit-transform:rotate(360deg);transform:rotate(360deg)}}@-webkit-keyframes dash{0%{stroke-dasharray:1,300;stroke-dashoffset:0}50%{stroke-dasharray:150,300;stroke-dashoffset:-200}100%{stroke-dasharray:1,300;stroke-dashoffset:-280}}@keyframes dash{0%{stroke-dasharray:1,300;stroke-dashoffset:0}50%{stroke-dasharray:150,300;stroke-dashoffset:-200}100%{stroke-dasharray:1,300;stroke-dashoffset:-280}}",""]),t.default=a},3874:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,".excalidraw .Stack{--gap: 0;display:grid;gap:calc(var(--space-factor)*var(--gap))}.excalidraw .Stack_vertical{grid-template-columns:auto;grid-auto-flow:row;grid-auto-rows:-webkit-min-content;grid-auto-rows:min-content}.excalidraw .Stack_horizontal{grid-template-rows:auto;grid-auto-flow:column;grid-auto-columns:-webkit-min-content;grid-auto-columns:min-content}",""]),t.default=a},2681:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .Stats{position:absolute;top:64px;right:12px;font-size:12px;z-index:10}.excalidraw .Stats h3{margin:0 24px 8px 0;white-space:nowrap}.excalidraw .Stats .close{float:right;height:16px;width:16px;cursor:pointer}.excalidraw .Stats .close svg{width:100%;height:100%}.excalidraw .Stats table{width:100%}.excalidraw .Stats table th{border-bottom:1px solid var(--input-border-color);padding:4px}.excalidraw .Stats table tr td:nth-child(2){min-width:24px;text-align:right}:root[dir=rtl] .excalidraw .Stats{left:12px;right:initial}:root[dir=rtl] .excalidraw .Stats h3{margin:0 0 8px 24px}:root[dir=rtl] .excalidraw .Stats .close{float:left}",""]),t.default=a},6759:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .TextInput{display:inline-block}",""]),t.default=a},9650:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .Toast{-webkit-animation:fade-in .5s;animation:fade-in .5s;background-color:var(--button-gray-1);border-radius:4px;bottom:10px;box-sizing:border-box;cursor:default;left:50%;margin-left:-150px;padding:4px 0;position:absolute;text-align:center;width:300px;z-index:999999}.excalidraw .Toast__message{color:var(--popup-text-color);white-space:pre-wrap}@-webkit-keyframes fade-in{from{opacity:0}to{opacity:1}}@keyframes fade-in{from{opacity:0}to{opacity:1}}",""]),t.default=a},2044:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw .ToolIcon{display:inline-flex;align-items:center;position:relative;cursor:pointer;-webkit-tap-highlight-color:transparent;-webkit-user-select:none;user-select:none}.excalidraw .ToolIcon--plain{background-color:transparent}.excalidraw .ToolIcon--plain .ToolIcon__icon{width:2rem;height:2rem}.excalidraw .ToolIcon_type_radio+.ToolIcon__icon,.excalidraw .ToolIcon_type_checkbox+.ToolIcon__icon{background-color:var(--button-gray-1)}.excalidraw .ToolIcon_type_radio+.ToolIcon__icon:hover,.excalidraw .ToolIcon_type_checkbox+.ToolIcon__icon:hover{background-color:var(--button-gray-2)}.excalidraw .ToolIcon_type_radio+.ToolIcon__icon:active,.excalidraw .ToolIcon_type_checkbox+.ToolIcon__icon:active{background-color:var(--button-gray-3)}.excalidraw .ToolIcon__icon{width:2.5rem;height:2.5rem;color:var(--icon-fill-color);display:flex;justify-content:center;align-items:center;border-radius:var(--border-radius-lg)}.excalidraw .ToolIcon__icon+.ToolIcon__label{-webkit-margin-start:0;margin-inline-start:0}.excalidraw .ToolIcon__icon svg{position:relative;height:1em;fill:var(--icon-fill-color);color:var(--icon-fill-color)}.excalidraw .ToolIcon__label{display:flex;align-items:center;color:var(--icon-fill-color);font-family:var(--ui-font);margin:0 .8em;text-overflow:ellipsis}.excalidraw .ToolIcon__label .Spinner{margin-left:.6em}.excalidraw .ToolIcon_size_small .ToolIcon__icon{width:2rem;height:2rem;font-size:.8em}.excalidraw .excalidraw .ToolIcon_type_button,.excalidraw .Modal .ToolIcon_type_button,.excalidraw .ToolIcon_type_button{padding:0;border:none;margin:0;font-size:inherit}.excalidraw .excalidraw .ToolIcon_type_button:focus-visible,.excalidraw .Modal .ToolIcon_type_button:focus-visible,.excalidraw .ToolIcon_type_button:focus-visible{box-shadow:0 0 0 2px var(--focus-highlight-color)}.excalidraw .excalidraw .ToolIcon_type_button.ToolIcon--selected,.excalidraw .Modal .ToolIcon_type_button.ToolIcon--selected,.excalidraw .ToolIcon_type_button.ToolIcon--selected{background-color:var(--button-gray-2)}.excalidraw .excalidraw .ToolIcon_type_button.ToolIcon--selected:active,.excalidraw .Modal .ToolIcon_type_button.ToolIcon--selected:active,.excalidraw .ToolIcon_type_button.ToolIcon--selected:active{background-color:var(--button-gray-3)}.excalidraw .excalidraw .ToolIcon_type_button:hover,.excalidraw .Modal .ToolIcon_type_button:hover,.excalidraw .ToolIcon_type_button:hover{background-color:var(--button-gray-2)}.excalidraw .excalidraw .ToolIcon_type_button:active,.excalidraw .Modal .ToolIcon_type_button:active,.excalidraw .ToolIcon_type_button:active{background-color:var(--button-gray-3)}.excalidraw .excalidraw .ToolIcon_type_button--show,.excalidraw .Modal .ToolIcon_type_button--show,.excalidraw .ToolIcon_type_button--show{visibility:visible}.excalidraw .excalidraw .ToolIcon_type_button--hide,.excalidraw .Modal .ToolIcon_type_button--hide,.excalidraw .ToolIcon_type_button--hide{visibility:hidden}.excalidraw .ToolIcon_type_radio,.excalidraw .ToolIcon_type_checkbox{position:absolute;opacity:0;pointer-events:none}.excalidraw .ToolIcon_type_radio:not(.ToolIcon_toggle_opaque):checked+.ToolIcon__icon,.excalidraw .ToolIcon_type_checkbox:not(.ToolIcon_toggle_opaque):checked+.ToolIcon__icon{background-color:var(--button-gray-2)}.excalidraw .ToolIcon_type_radio:not(.ToolIcon_toggle_opaque):checked+.ToolIcon__icon:active,.excalidraw .ToolIcon_type_checkbox:not(.ToolIcon_toggle_opaque):checked+.ToolIcon__icon:active{background-color:var(--button-gray-3)}.excalidraw .ToolIcon_type_radio:focus-visible+.ToolIcon__icon,.excalidraw .ToolIcon_type_checkbox:focus-visible+.ToolIcon__icon{box-shadow:0 0 0 2px var(--focus-highlight-color)}.excalidraw .ToolIcon_type_radio:active+.ToolIcon__icon,.excalidraw .ToolIcon_type_checkbox:active+.ToolIcon__icon{background-color:var(--button-gray-3)}.excalidraw .ToolIcon_type_floating{background-color:transparent}.excalidraw .ToolIcon_type_floating:hover{background-color:transparent}.excalidraw .ToolIcon_type_floating:active{background-color:transparent}.excalidraw .ToolIcon_type_floating .ToolIcon__icon{background-color:var(--button-gray-1);width:2rem;height:2em}.excalidraw .ToolIcon_type_floating .ToolIcon__icon:hover{background-color:var(--button-gray-2)}.excalidraw .ToolIcon_type_floating .ToolIcon__icon:active{background-color:var(--button-gray-3)}.excalidraw .ToolIcon__keybinding{position:absolute;bottom:2px;right:3px;font-size:.5em;color:var(--keybinding-color);font-family:var(--ui-font);-webkit-user-select:none;user-select:none}@media(max-width: 425px){.excalidraw .Shape .ToolIcon__icon{width:2rem;height:2rem}.excalidraw .Shape .ToolIcon__icon svg{height:.8em}}@media(max-width: 760px){.excalidraw .ToolIcon.ToolIcon_type_floating{display:inline-block;position:absolute;right:-8px;margin-left:0;border-radius:20px 0 0 20px;z-index:1;background-color:var(--button-gray-1)}.excalidraw .ToolIcon.ToolIcon_type_floating:hover{background-color:var(--button-gray-1)}.excalidraw .ToolIcon.ToolIcon_type_floating:active{background-color:var(--button-gray-2)}.excalidraw .ToolIcon.ToolIcon_type_floating .ToolIcon__icon{border-radius:inherit}.excalidraw .ToolIcon.ToolIcon_type_floating svg{position:static}.excalidraw .ToolIcon.ToolIcon__library{top:100px}.excalidraw .ToolIcon.ToolIcon__lock{-webkit-margin-end:0;margin-inline-end:0;top:60px}.excalidraw .ToolIcon.ToolIcon__penMode{-webkit-margin-end:0;margin-inline-end:0;top:140px}}:root[dir=ltr] .excalidraw .unlocked-icon{left:2px}:root[dir=rtl] .excalidraw .unlocked-icon{right:2px}",""]),t.default=a},9144:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,".excalidraw .App-toolbar-container .ToolIcon_type_floating .ToolIcon_type_radio+.ToolIcon__icon:active,.excalidraw .App-toolbar-container .ToolIcon_type_floating .ToolIcon_type_checkbox+.ToolIcon__icon:active{background:var(--color-primary-light)}.excalidraw .App-toolbar-container .ToolIcon_type_floating .ToolIcon_type_radio:checked+.ToolIcon__icon,.excalidraw .App-toolbar-container .ToolIcon_type_floating .ToolIcon_type_checkbox:checked+.ToolIcon__icon{background:var(--color-primary);--icon-fill-color: #ffffff;--keybinding-color: #ffffff}.excalidraw .App-toolbar-container .ToolIcon_type_floating .ToolIcon_type_radio:checked+.ToolIcon__icon:active,.excalidraw .App-toolbar-container .ToolIcon_type_floating .ToolIcon_type_checkbox:checked+.ToolIcon__icon:active{background:var(--color-primary-darker)}.excalidraw .App-toolbar-container .ToolIcon_type_floating .ToolIcon__keybinding{bottom:4px;right:4px}.excalidraw .App-toolbar-container .ToolIcon_type_floating:not(.is-mobile) .ToolIcon__icon{padding:1px;background-color:var(--island-bg-color);box-shadow:1px 3px 4px 0px rgba(0,0,0,.15);border-radius:50%;transition:box-shadow .5s ease,-webkit-transform .5s ease;transition:box-shadow .5s ease,transform .5s ease;transition:box-shadow .5s ease,transform .5s ease,-webkit-transform .5s ease}.excalidraw .App-toolbar-container .ToolIcon_type_floating .ToolIcon_type_radio:focus-within+.ToolIcon__icon,.excalidraw .App-toolbar-container .ToolIcon_type_floating .ToolIcon_type_checkbox:focus-within+.ToolIcon__icon{box-shadow:0 0 0 2px var(--focus-highlight-color)}.excalidraw .App-toolbar-container .ToolIcon__hidden{box-shadow:none !important;background-color:transparent !important;pointer-events:none !important}.excalidraw .App-toolbar-container .ToolIcon.ToolIcon__lock{-webkit-margin-end:var(--space-factor);margin-inline-end:var(--space-factor)}.excalidraw .App-toolbar-container .ToolIcon.ToolIcon__lock.ToolIcon_type_floating{margin-left:.1rem}.excalidraw .App-toolbar-container .ToolIcon__library{-webkit-margin-start:var(--space-factor);margin-inline-start:var(--space-factor)}.excalidraw .App-toolbar-container.zen-mode .ToolIcon_type_floating .ToolIcon__icon{box-shadow:none;-webkit-transform:scale(0.9);transform:scale(0.9)}.excalidraw .App-toolbar-container.zen-mode .ToolIcon_type_floating .ToolIcon_type_checkbox:not(:checked):not(:hover):not(:active)+.ToolIcon__icon svg{fill:#adb5bd;color:#adb5bd}.excalidraw .App-toolbar{border-radius:var(--border-radius-lg);box-shadow:0 0 0 1px rgba(0,0,0,.01),1px 1px 5px rgba(0,0,0,.15)}.excalidraw .App-toolbar .ToolIcon:hover{--icon-fill-color: var( --color-primary-contrast-offset, var(--color-primary) );--keybinding-color: var( --color-primary-contrast-offset, var(--color-primary) )}.excalidraw .App-toolbar .ToolIcon:active{--icon-fill-color: #212529;--keybinding-color: #212529}.excalidraw .App-toolbar .ToolIcon .ToolIcon__icon{background:transparent;border-radius:var(--border-radius-lg)}.excalidraw .App-toolbar .ToolIcon .ToolIcon_type_radio+.ToolIcon__icon:active,.excalidraw .App-toolbar .ToolIcon .ToolIcon_type_checkbox+.ToolIcon__icon:active{background:var(--color-primary-light)}.excalidraw .App-toolbar .ToolIcon .ToolIcon_type_radio:checked+.ToolIcon__icon,.excalidraw .App-toolbar .ToolIcon .ToolIcon_type_checkbox:checked+.ToolIcon__icon{background:var(--color-primary);--icon-fill-color: #ffffff;--keybinding-color: #ffffff}.excalidraw .App-toolbar .ToolIcon .ToolIcon_type_radio:checked+.ToolIcon__icon:active,.excalidraw .App-toolbar .ToolIcon .ToolIcon_type_checkbox:checked+.ToolIcon__icon:active{background:var(--color-primary-darker)}.excalidraw .App-toolbar .ToolIcon .ToolIcon__keybinding{bottom:4px;right:4px}.excalidraw .App-toolbar.zen-mode .ToolIcon__keybinding,.excalidraw .App-toolbar.zen-mode .HintViewer{display:none}.excalidraw.theme--dark .App-toolbar .ToolIcon:active{--icon-fill-color: #dee2e6;--keybinding-color: #dee2e6}",""]),t.default=a},6626:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw-tooltip{position:absolute;z-index:1000;padding:8px;border-radius:6px;box-sizing:border-box;pointer-events:none;word-wrap:break-word;background:#000;line-height:1.5;text-align:center;font-size:13px;font-weight:500;color:#fff;display:none}.excalidraw-tooltip.excalidraw-tooltip--visible{display:block}.excalidraw-tooltip-wrapper{display:flex}.excalidraw-tooltip-icon{width:.9em;height:.9em;margin-left:5px;margin-top:1px;display:flex}.excalidraw--mobile.excalidraw-tooltip-icon{display:none}",""]),t.default=a},6359:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,".excalidraw .UserList{pointer-events:none;padding:var(--space-factor) var(--space-factor) var(--space-factor) var(--space-factor);display:flex;flex-wrap:wrap;justify-content:flex-end}.excalidraw .UserList:empty{display:none}.excalidraw .UserList>*{pointer-events:all;margin:0 0 var(--space-factor) var(--space-factor)}.excalidraw .UserList_mobile{padding:0;justify-content:normal}.excalidraw .UserList_mobile>*{margin:0 var(--space-factor) var(--space-factor) 0}",""]),t.default=a},9915:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,".visually-hidden{position:absolute !important;height:1px;width:1px;overflow:hidden;clip:rect(1px, 1px, 1px, 1px);white-space:nowrap;-webkit-user-select:none;user-select:none}.LoadingMessage{position:absolute;top:0;right:0;bottom:0;left:0;z-index:999;display:flex;align-items:center;justify-content:center;pointer-events:none}.LoadingMessage span{background-color:var(--button-gray-1);border-radius:5px;padding:.8em 1.2em;color:var(--popup-text-color);font-size:1.3em}",""]),t.default=a},9310:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i),l=n(1667),c=n.n(l),s=new URL(n(7984),n.b),u=new URL(n(1639),n.b),d=a()(o()),f=c()(s),p=c()(u);d.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}:export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw{--theme-filter: none;--button-destructive-bg-color: #ffe3e3;--button-destructive-color: #c92a2a;--button-gray-1: #e9ecef;--button-gray-2: #ced4da;--button-gray-3: #adb5bd;--button-special-active-bg-color: #ebfbee;--dialog-border-color: #868e96;--dropdown-icon: url("+f+");--focus-highlight-color: #a5d8ff;--icon-fill-color: #212529;--icon-green-fill-color: #2b8a3e;--default-bg-color: #ffffff;--input-bg-color: #ffffff;--input-border-color: #ced4da;--input-hover-bg-color: #f1f3f5;--input-label-color: #495057;--island-bg-color: rgba(255, 255, 255, 0.96);--keybinding-color: #adb5bd;--link-color: #1c7ed6;--overlay-bg-color: rgba(255, 255, 255, 0.88);--popup-bg-color: #ffffff;--popup-secondary-bg-color: #f1f3f5;--popup-text-color: #000000;--popup-text-inverted-color: #ffffff;--sab: env(safe-area-inset-bottom);--sal: env(safe-area-inset-left);--sar: env(safe-area-inset-right);--sat: env(safe-area-inset-top);--select-highlight-color: #339af0;--shadow-island: 0 0 0 1px rgba(0, 0, 0, 0.01), 1px 1px 5px rgb(0 0 0 / 12%);--space-factor: 0.25rem;--text-primary-color: #343a40;--color-primary: #6965db;--color-primary-darker: #5b57d1;--color-primary-darkest: #4a47b1;--color-primary-light: #e2e1fc;--border-radius-md: 0.375rem;--border-radius-lg: 0.5rem}.excalidraw.theme--dark{background:#000}.excalidraw.theme--dark.theme--dark-background-none{background:none}.excalidraw.theme--dark{--theme-filter: invert(93%) hue-rotate(180deg);--button-destructive-bg-color: #5a0000;--button-destructive-color: #ffa8a8;--button-gray-1: #363636;--button-gray-2: #272727;--button-gray-3: #222;--button-special-active-bg-color: #204624;--dialog-border-color: #212529;--dropdown-icon: url("+p+');--focus-highlight-color: #228be6;--icon-fill-color: #ced4da;--icon-green-fill-color: #69db7c;--default-bg-color: #121212;--input-bg-color: #121212;--input-border-color: #2e2e2e;--input-hover-bg-color: #181818;--input-label-color: #e9ecef;--island-bg-color: rgba(30, 30, 30, 0.98);--keybinding-color: #868e96;--link-color: #4dabf7;--overlay-bg-color: rgba(52, 58, 64, 0.12);--popup-bg-color: #2c2c2c;--popup-secondary-bg-color: #222;--popup-text-color: #ced4da;--popup-text-inverted-color: #2c2c2c;--select-highlight-color: #4dabf7;--shadow-island: 1px 1px 5px rgba(0, 0, 0, 0.3);--text-primary-color: #ced4da;--color-primary: #5650f0;--color-primary-darker: #4b46d8;--color-primary-darkest: #3e39be;--color-primary-light: #3f3d64}:root{--zIndex-canvas: 1;--zIndex-wysiwyg: 2;--zIndex-layerUI: 3}.excalidraw{position:relative;overflow:hidden;color:var(--text-primary-color);display:flex;top:0;bottom:0;left:0;right:0;height:100%;width:100%;-webkit-user-select:none;user-select:none}.excalidraw:focus{outline:none}.excalidraw a{font-weight:500;text-decoration:none;color:var(--link-color)}.excalidraw a:hover{text-decoration:underline}.excalidraw canvas{touch-action:none;image-rendering:pixelated;image-rendering:-moz-crisp-edges;z-index:var(--zIndex-canvas)}.excalidraw__canvas{position:absolute}.excalidraw.theme--dark canvas{-webkit-filter:var(--theme-filter);filter:var(--theme-filter)}.excalidraw .FixedSideContainer{padding-top:var(--sat, 0);padding-right:var(--sar, 0);padding-bottom:var(--sab, 0);padding-left:var(--sal, 0)}.excalidraw .panelRow{display:flex;justify-content:space-between}.excalidraw .panelColumn{display:flex;flex-direction:column}.excalidraw .panelColumn h3,.excalidraw .panelColumn legend,.excalidraw .panelColumn .control-label{margin-top:.333rem;margin-bottom:.333rem;font-size:.75rem;color:var(--text-primary-color);font-weight:bold;display:block}.excalidraw .panelColumn .control-label input{display:block;width:100%}.excalidraw .panelColumn h3:first-child,.excalidraw .panelColumn legend:first-child,.excalidraw .panelColumn .control-label:first-child{margin-top:0}.excalidraw .panelColumn legend{padding:0}.excalidraw .panelColumn .iconSelectList{flex-wrap:wrap;position:relative}.excalidraw .panelColumn .buttonList{flex-wrap:wrap}.excalidraw .panelColumn .buttonList label{margin-right:.25rem;font-size:.75rem;display:inline-block}.excalidraw .panelColumn .buttonList input[type=radio],.excalidraw .panelColumn .buttonList input[type=button]{opacity:0;position:absolute;pointer-events:none}.excalidraw .panelColumn .buttonList .iconRow{margin-top:8px}.excalidraw .panelColumn .buttonList .ToolIcon{margin:0;-webkit-margin-end:8px;margin-inline-end:8px}.excalidraw .panelColumn .buttonList .ToolIcon:focus{outline:transparent;box-shadow:0 0 0 2px var(--focus-highlight-color)}.excalidraw .panelColumn .buttonList .ToolIcon:hover{background-color:var(--button-gray-2)}.excalidraw .panelColumn .buttonList .ToolIcon:active{background-color:var(--button-gray-3)}.excalidraw .panelColumn .buttonList .ToolIcon:disabled{cursor:not-allowed}.excalidraw .panelColumn .buttonList .ToolIcon__icon{width:28px;height:28px}.excalidraw .panelColumn fieldset{margin:0;margin-top:.333rem;padding:0;border:none}.excalidraw .divider{width:1px;background-color:#e9ecef;margin:1px}.excalidraw .buttonList label:focus-within,.excalidraw input:focus-visible{outline:transparent;box-shadow:0 0 0 2px var(--focus-highlight-color)}.excalidraw button,.excalidraw .buttonList label{-webkit-user-select:none;user-select:none;background-color:var(--button-gray-1);border:0;border-radius:var(--border-radius-md);margin:.125rem 0;padding:.25rem;white-space:nowrap;cursor:pointer}.excalidraw button:focus-visible,.excalidraw .buttonList label:focus-visible{outline:transparent;box-shadow:0 0 0 2px var(--focus-highlight-color)}.excalidraw button:hover,.excalidraw .buttonList label:hover{background-color:var(--button-gray-2)}.excalidraw button:active,.excalidraw .buttonList label:active{background-color:var(--button-gray-3)}.excalidraw button:disabled,.excalidraw .buttonList label:disabled{cursor:not-allowed}.excalidraw .active,.excalidraw .buttonList label.active{background-color:var(--color-primary);--icon-fill-color: #ffffff}.excalidraw .active:hover,.excalidraw .buttonList label.active:hover{background-color:var(--color-primary-darker)}.excalidraw .active:active,.excalidraw .buttonList label.active:active{background-color:var(--color-primary-darkest)}.excalidraw .buttonList.buttonListIcon label{display:inline-flex;justify-content:center;align-items:center}.excalidraw .buttonList.buttonListIcon label svg{width:35px;height:14px;padding:2px;opacity:.6}.excalidraw .buttonList.buttonListIcon label.active svg{opacity:1}.excalidraw .App-top-bar{z-index:var(--zIndex-layerUI);display:flex;flex-direction:column;align-items:center}.excalidraw .App-bottom-bar{position:absolute;top:0;bottom:0;left:0;right:0;--bar-padding: calc(4 * var(--space-factor));padding-top:max(var(--bar-padding), var(--sat,0));padding-right:var(--sar, 0);padding-bottom:var(--sab, 0);padding-left:var(--sal, 0);z-index:4;display:flex;align-items:flex-end;pointer-events:none}.excalidraw .App-bottom-bar>.Island{width:100%;max-width:100%;min-width:100%;box-sizing:border-box;max-height:100%;display:flex;flex-direction:column;pointer-events:initial}.excalidraw .App-bottom-bar>.Island .panelColumn{padding:8px 8px 0 8px}.excalidraw .App-toolbar{width:100%;box-sizing:border-box}.excalidraw .App-toolbar-content{display:flex;align-items:center;justify-content:space-between;padding:8px}.excalidraw .App-mobile-menu{width:100%;overflow-x:visible;overflow-y:auto;box-sizing:border-box;margin-bottom:var(--bar-padding)}.excalidraw .App-menu{display:grid;color:var(--icon-fill-color)}.excalidraw .App-menu_top{grid-template-columns:auto -webkit-max-content auto;grid-template-columns:auto max-content auto;grid-gap:4px;align-items:flex-start;cursor:default;pointer-events:none !important}.excalidraw .layer-ui__wrapper:not(.disable-pointerEvents) .App-menu_top>*{pointer-events:all}.excalidraw .App-menu_top>*:first-child{justify-self:flex-start}.excalidraw .App-menu_top>*:last-child{justify-self:flex-end}.excalidraw .App-menu_bottom{position:absolute;bottom:0;grid-template-columns:-webkit-min-content auto -webkit-min-content;grid-template-columns:min-content auto min-content;grid-gap:15px;align-items:flex-start;cursor:default;pointer-events:none !important;z-index:100}:root[dir=ltr] .excalidraw .App-menu_bottom{left:.25rem}:root[dir=rtl] .excalidraw .App-menu_bottom{right:.25rem}.excalidraw .App-menu_bottom--transition-left section{width:185px}.excalidraw .App-menu_bottom section{display:flex}.excalidraw .App-menu_bottom>*:first-child{justify-self:flex-start}.excalidraw .App-menu_bottom>*:last-child{justify-self:flex-end}.excalidraw .App-menu_left{grid-template-rows:1fr auto 1fr;height:100%}.excalidraw .App-menu_right{grid-template-rows:1fr;height:100%}.excalidraw .App-menu__left{overflow-y:auto}.excalidraw .dropdown-select{height:1.5rem;padding:0;-webkit-padding-start:.5rem;padding-inline-start:.5rem;-webkit-padding-end:1.5rem;padding-inline-end:1.5rem;color:var(--icon-fill-color);background-color:var(--button-gray-1);border-radius:var(--space-factor);border:1px solid var(--button-gray-2);font-size:.8rem;outline:none;-webkit-appearance:none;appearance:none;background-image:var(--dropdown-icon);background-repeat:no-repeat;background-position:right .7rem top 50%,0 0;background-size:.65em auto,100%}:root[dir=rtl] .excalidraw .dropdown-select{background-position:left .7rem top 50%,0 0}.excalidraw .dropdown-select:focus{box-shadow:0 0 0 2px var(--focus-highlight-color)}.excalidraw .dropdown-select:hover{background-color:var(--button-gray-2)}.excalidraw .dropdown-select:active{background-color:var(--button-gray-2)}.excalidraw .zIndexButton{margin:0;-webkit-margin-end:8px;margin-inline-end:8px;padding:5px;display:inline-flex;align-items:center;justify-content:center}.excalidraw .zIndexButton svg{width:18px;height:18px}.excalidraw .scroll-back-to-content{color:var(--popup-text-color);position:absolute;left:50%;bottom:30px;-webkit-transform:translateX(-50%);transform:translateX(-50%);padding:10px 20px}.excalidraw .help-icon{display:flex;cursor:pointer;fill:#868e96;padding:0;margin:0;background:none;color:var(--icon-fill-color)}.excalidraw .help-icon svg{width:1.5rem;height:1.5rem}.excalidraw .help-icon:hover{background:none}.excalidraw .reset-zoom-button{padding:.2em;background:transparent;color:var(--text-primary-color);font-family:var(--ui-font)}.excalidraw .undo-redo-buttons{display:grid;grid-auto-flow:column;gap:.4em;margin-top:auto;margin-bottom:auto;-webkit-margin-start:.6em;margin-inline-start:.6em}.excalidraw--mobile.excalidraw aside{display:none}.excalidraw--mobile.excalidraw .scroll-back-to-content{bottom:calc(80px + var(--sab, 0));z-index:-1}:root[dir=rtl] .excalidraw .rtl-mirror{-webkit-transform:scaleX(-1);transform:scaleX(-1)}.excalidraw .zen-mode-visibility{visibility:visible;opacity:1;height:auto;width:auto;transition:opacity .5s}.excalidraw .zen-mode-visibility.zen-mode-visibility--hidden{visibility:hidden;opacity:0;height:0;width:0;transition:opacity .5s}.excalidraw .disable-pointerEvents{pointer-events:none !important}.excalidraw.excalidraw--view-mode .App-menu{display:flex;justify-content:space-between}.excalidraw input[type=text],.excalidraw textarea:not(.excalidraw-wysiwyg){color:var(--text-primary-color);border:1.5px solid var(--input-border-color);padding:.75rem;white-space:nowrap;border-radius:var(--space-factor);background-color:var(--input-bg-color)}.excalidraw input[type=text]:not(:focus):hover,.excalidraw textarea:not(.excalidraw-wysiwyg):not(:focus):hover{background-color:var(--input-hover-bg-color)}.excalidraw input[type=text]:focus,.excalidraw textarea:not(.excalidraw-wysiwyg):focus{outline:none;box-shadow:0 0 0 2px var(--focus-highlight-color)}@media print{.excalidraw .App-bottom-bar,.excalidraw .FixedSideContainer,.excalidraw .layer-ui__wrapper{display:none}}.ErrorSplash.excalidraw{min-height:100vh;padding:20px 0;overflow:auto;display:flex;align-items:center;justify-content:center;-webkit-user-select:text;user-select:text}.ErrorSplash.excalidraw .ErrorSplash-messageContainer{display:flex;flex-direction:column;align-items:center;justify-content:center;padding:40px;background-color:#ffe3e3;border:3px solid #c92a2a}.ErrorSplash.excalidraw .ErrorSplash-paragraph{margin:15px 0;max-width:600px}.ErrorSplash.excalidraw .ErrorSplash-paragraph.align-center{text-align:center}.ErrorSplash.excalidraw .bigger,.ErrorSplash.excalidraw .bigger button{font-size:1.1em}.ErrorSplash.excalidraw .smaller,.ErrorSplash.excalidraw .smaller button{font-size:.9em}.ErrorSplash.excalidraw .ErrorSplash-details{display:flex;flex-direction:column;align-items:flex-start}.ErrorSplash.excalidraw .ErrorSplash-details textarea{width:100%;margin:10px 0;font-family:"Cascadia";font-size:.8em}',""]),t.default=d},6464:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,"",""]),a.locals={themeFilter:"invert(93%) hue-rotate(180deg)"},t.default=a},5260:function(e,t,n){"use strict";n.r(t);var r=n(8081),o=n.n(r),i=n(3645),a=n.n(i)()(o());a.push([e.id,":export{themeFilter:invert(93%) hue-rotate(180deg)}.excalidraw-hyperlinkContainer{display:flex;align-items:center;justify-content:space-between;position:absolute;box-shadow:0px 2px 4px 0 rgba(0,0,0,.3);z-index:100;background:var(--island-bg-color);border-radius:var(--border-radius-md);box-sizing:border-box;min-height:42px}.excalidraw-hyperlinkContainer-input,.excalidraw-hyperlinkContainer button{z-index:100}.excalidraw-hyperlinkContainer-input,.excalidraw-hyperlinkContainer-link{height:24px;padding:0 8px;line-height:24px;font-size:.9rem;font-weight:500;font-family:var(--ui-font)}.excalidraw-hyperlinkContainer-input{width:18rem;border:none;background-color:transparent;color:var(--text-primary-color);outline:none;border:none;box-shadow:none !important}.excalidraw-hyperlinkContainer-link{overflow:hidden;text-overflow:ellipsis;white-space:nowrap;max-width:15rem}.excalidraw-hyperlinkContainer button{color:#228be6;background-color:transparent !important;font-weight:500}.excalidraw-hyperlinkContainer button.excalidraw-hyperlinkContainer--remove{color:#c92a2a}.excalidraw-hyperlinkContainer .d-none{display:none}.excalidraw-hyperlinkContainer--remove .ToolIcon__icon svg{color:#fa5252}.excalidraw-hyperlinkContainer .ToolIcon__icon{width:2rem;height:2rem}.excalidraw-hyperlinkContainer__buttons{flex:0 0 auto}",""]),t.default=a},3645:function(e){"use strict";e.exports=function(e){var t=[];return t.toString=function(){return this.map((function(t){var n="",r=void 0!==t[5];return t[4]&&(n+="@supports (".concat(t[4],") {")),t[2]&&(n+="@media ".concat(t[2]," {")),r&&(n+="@layer".concat(t[5].length>0?" ".concat(t[5]):""," {")),n+=e(t),r&&(n+="}"),t[2]&&(n+="}"),t[4]&&(n+="}"),n})).join("")},t.i=function(e,n,r,o,i){"string"==typeof e&&(e=[[null,e,void 0]]);var a={};if(r)for(var l=0;l0?" ".concat(u[5]):""," {").concat(u[1],"}")),u[5]=i),n&&(u[2]?(u[1]="@media ".concat(u[2]," {").concat(u[1],"}"),u[2]=n):u[2]=n),o&&(u[4]?(u[1]="@supports (".concat(u[4],") {").concat(u[1],"}"),u[4]=o):u[4]="".concat(o)),t.push(u))}},t}},1667:function(e){"use strict";e.exports=function(e,t){return t||(t={}),e?(e=String(e.__esModule?e.default:e),/^['"].*['"]$/.test(e)&&(e=e.slice(1,-1)),t.hash&&(e+=t.hash),/["'() \t\n]|(%20)/.test(e)||t.needQuotes?'"'.concat(e.replace(/"/g,'\\"').replace(/\n/g,"\\n"),'"'):e):e}},8081:function(e){"use strict";e.exports=function(e){return e[1]}},8288:function(e,t,n){"use strict";n.d(t,{iC:function(){return a},f:function(){return l},qx:function(){return c},Iw:function(){return s},$e:function(){return u},wZ:function(){return d},ay:function(){return f},oc:function(){return p},Oh:function(){return h},Ks:function(){return r},Vi:function(){return m},$C:function(){return g},ut:function(){return v},C6:function(){return b},_D:function(){return y},n5:function(){return x},rk:function(){return w},Hg:function(){return k},hs:function(){return E},k:function(){return _},LO:function(){return S},r8:function(){return j},pb:function(){return C},LL:function(){return O},Gj:function(){return I},nM:function(){return M},Lg:function(){return T},HM:function(){return P},V4:function(){return A},sA:function(){return L},EH:function(){return D},ZF:function(){return R},UO:function(){return z},ah:function(){return N},cW:function(){return H},kV:function(){return B},sS:function(){return F},Yx:function(){return U},zK:function(){return K},ZB:function(){return W},qy:function(){return V},h6:function(){return G},jo:function(){return Z},$n:function(){return Y},hR:function(){return X},Kr:function(){return q},gK:function(){return $}});var r,o=n(8635),i=n.n(o),a="Excalidraw",l=10,c=8,s=5,u=1,d=30,f=Math.PI/12,p={TEXT:"text",CROSSHAIR:"crosshair",GRABBING:"grabbing",GRAB:"grab",POINTER:"pointer",MOVE:"move",AUTO:""},h={MAIN:0,WHEEL:1,SECONDARY:2,TOUCH:-1};!function(e){e.COPY="copy",e.PASTE="paste",e.CUT="cut",e.KEYDOWN="keydown",e.KEYUP="keyup",e.MOUSE_MOVE="mousemove",e.RESIZE="resize",e.UNLOAD="unload",e.FOCUS="focus",e.BLUR="blur",e.DRAG_OVER="dragover",e.DROP="drop",e.GESTURE_END="gestureend",e.BEFORE_UNLOAD="beforeunload",e.GESTURE_START="gesturestart",e.GESTURE_CHANGE="gesturechange",e.POINTER_MOVE="pointermove",e.POINTER_UP="pointerup",e.STATE_CHANGE="statechange",e.WHEEL="wheel",e.TOUCH_START="touchstart",e.TOUCH_END="touchend",e.HASHCHANGE="hashchange",e.VISIBILITY_CHANGE="visibilitychange",e.SCROLL="scroll",e.EXCALIDRAW_LINK="excalidraw-link"}(r||(r={}));var m={TEST:"test",DEVELOPMENT:"development"},g={SHAPE_ACTIONS_MENU:"App-menu__left"},v={Virgil:1,Helvetica:2,Cascadia:3},b={LIGHT:"light",DARK:"dark"},y="Segoe UI Emoji",x=20,w=v.Virgil,k="left",E="top",_=20,S={excalidraw:"application/vnd.excalidraw+json",excalidrawlib:"application/vnd.excalidrawlib+json",json:"application/json",svg:"image/svg+xml",png:"image/png",jpg:"image/jpeg",gif:"image/gif",binary:"application/octet-stream"},j={excalidraw:"excalidraw",excalidrawClipboard:"excalidraw/clipboard",excalidrawLibrary:"excalidrawlib"},C=window.location.origin,O=500,I=300,M=500,T=5e3,P=100,A=.1,L=300,D={VIEW:"viewMode",ZEN:"zenMode",GRID:"gridMode"},R=i().themeFilter,z={addLibrary:"addLibrary"},N={addLibrary:"addLibrary"},H={canvasActions:{changeViewBackgroundColor:!0,clearCanvas:!0,export:{saveFileToDisk:!0},loadScene:!0,saveToActiveFile:!0,theme:!0,saveAsImage:!0}},B=730,F=1e3,U=500,K=2,W=[1,2,3],V=10,G=1440,Z=[S.png,S.jpg,S.svg,S.gif],Y=2097152,X="http://www.w3.org/2000/svg",q={excalidraw:2,excalidrawLibrary:2},$=5},7314:function(e,t,n){"use strict";n.r(t),n.d(t,{FONT_FAMILY:function(){return s.ut},THEME:function(){return s.C6},bumpVersion:function(){return co},default:function(){return jg},defaultLang:function(){return y},exportToBlob:function(){return bm},exportToCanvas:function(){return vm},exportToSvg:function(){return ym},getFreeDrawSvgPath:function(){return $r},getNonDeletedElements:function(){return Cs},getSceneVersion:function(){return Ss},isInvisiblySmallElement:function(){return so},isLinearElement:function(){return Ye},languages:function(){return x},loadFromBlob:function(){return Nd},loadLibraryFromBlob:function(){return Hd},mutateElement:function(){return ao},newElementWith:function(){return lo},restore:function(){return Md},restoreAppState:function(){return Id},restoreElements:function(){return Od},serializeAsJSON:function(){return Xd}});var r=n(6479),o=n.n(r),i=n(9713),a=n.n(i),l=n(9787),c=n.n(l),s=n(8288),u=JSON.parse('{"u2":"@excalidraw/excalidraw","i8":"0.11.0"}');"production"!==s.Vi.TEST&&(n.p=window.EXCALIDRAW_ASSET_PATH||"https://unpkg.com/".concat(u.u2,"@").concat(u.i8,"/dist/"));var d=n(8950);function f(e,t){(null==t||t>e.length)&&(t=e.length);for(var n=0,r=new Array(t);nt.label?1:-1})).filter((function(e){return b[e.code]>=85})),w="__test__";"production"===s.Vi.DEVELOPMENT&&x.unshift({code:w,label:"test language"},{code:"".concat(w,".rtl"),label:"‪test language (rtl)‬",rtl:!0});var k=y,E={},_=function(){var e=(0,d.Z)(g().mark((function e(t){return g().wrap((function(e){for(;;)switch(e.prev=e.next){case 0:if(k=t,document.documentElement.dir=k.rtl?"rtl":"ltr",document.documentElement.lang=k.code,!t.code.startsWith(w)){e.next=7;break}E={},e.next=10;break;case 7:return e.next=9,n(788)("./".concat(k.code,".json"));case 9:E=e.sent;case 10:case"end":return e.stop()}}),e)})));return function(t){return e.apply(this,arguments)}}(),S=function(){return k},j=function(e,t){for(var n=0;n{const[t,n]=e;e[0]=(t-r)*a-(n-o)*l+r,e[1]=(t-r)*l+(n-o)*a+o}))}}function K(e){const t=e[0],n=e[1];return Math.sqrt(Math.pow(t[0]-n[0],2)+Math.pow(t[1]-n[1],2))}function W(e,t){const n=t.hachureAngle+90;let r=t.hachureGap;r<0&&(r=4*t.strokeWidth),r=Math.max(r,.1);const o=[0,0];if(n)for(const t of e)U(t,o,n);const i=function(e,t){const n=[];for(const t of e){const e=[...t];e[0].join(",")!==e[e.length-1].join(",")&&e.push([e[0][0],e[0][1]]),e.length>2&&n.push(e)}const r=[];t=Math.max(t,.1);const o=[];for(const e of n)for(let t=0;te.ymint.ymin?1:e.xt.x?1:e.ymax===t.ymax?0:(e.ymax-t.ymax)/Math.abs(e.ymax-t.ymax))),!o.length)return r;let i=[],a=o[0].ymin;for(;i.length||o.length;){if(o.length){let e=-1;for(let t=0;ta);t++)e=t;o.splice(0,e+1).forEach((e=>{i.push({s:a,edge:e})}))}if(i=i.filter((e=>!(e.edge.ymax<=a))),i.sort(((e,t)=>e.edge.x===t.edge.x?0:(e.edge.x-t.edge.x)/Math.abs(e.edge.x-t.edge.x))),i.length>1)for(let e=0;e=i.length)break;const n=i[e].edge,o=i[t].edge;r.push([[Math.round(n.x),a],[Math.round(o.x),a]])}a+=t,i.forEach((e=>{e.edge.x=e.edge.x+t*e.edge.islope}))}return r}(e,r);if(n){for(const t of e)U(t,o,-n);!function(e,t,n){const r=[];e.forEach((e=>r.push(...e))),U(r,t,n)}(i,o,-n)}return i}class V{constructor(e){this.helper=e}fillPolygons(e,t){return this._fillPolygons(e,t)}_fillPolygons(e,t){const n=W(e,t);return{type:"fillSketch",ops:this.renderLines(n,t)}}renderLines(e,t){const n=[];for(const r of e)n.push(...this.helper.doubleLineOps(r[0][0],r[0][1],r[1][0],r[1][1],t));return n}}class G extends V{fillPolygons(e,t){let n=t.hachureGap;n<0&&(n=4*t.strokeWidth),n=Math.max(n,.1);const r=W(e,Object.assign({},t,{hachureGap:n})),o=Math.PI/180*t.hachureAngle,i=[],a=.5*n*Math.cos(o),l=.5*n*Math.sin(o);for(const[e,t]of r)K([e,t])&&i.push([[e[0]-a,e[1]+l],[...t]],[[e[0]+a,e[1]-l],[...t]]);return{type:"fillSketch",ops:this.renderLines(i,t)}}}class Z extends V{fillPolygons(e,t){const n=this._fillPolygons(e,t),r=Object.assign({},t,{hachureAngle:t.hachureAngle+90}),o=this._fillPolygons(e,r);return n.ops=n.ops.concat(o.ops),n}}class Y{constructor(e){this.helper=e}fillPolygons(e,t){const n=W(e,t=Object.assign({},t,{hachureAngle:0}));return this.dotsOnLines(n,t)}dotsOnLines(e,t){const n=[];let r=t.hachureGap;r<0&&(r=4*t.strokeWidth),r=Math.max(r,.1);let o=t.fillWeight;o<0&&(o=t.strokeWidth/2);const i=r/4;for(const a of e){const e=K(a),l=e/r,c=Math.ceil(l)-1,s=e-c*r,u=(a[0][0]+a[1][0])/2-r/4,d=Math.min(a[0][1],a[1][1]);for(let e=0;e{const i=K(e),a=Math.floor(i/(n+r)),l=(i+r-a*(n+r))/2;let c=e[0],s=e[1];c[0]>s[0]&&(c=e[1],s=e[0]);const u=Math.atan((s[1]-c[1])/(s[0]-c[0]));for(let e=0;e{const o=K(e),i=Math.round(o/(2*t));let a=e[0],l=e[1];a[0]>l[0]&&(a=e[1],l=e[0]);const c=Math.atan((l[1]-a[1])/(l[0]-a[0]));for(let e=0;er%2?e+n:e+t));i.push({key:"C",data:e}),t=e[4],n=e[5];break}case"Q":i.push({key:"Q",data:[...l]}),t=l[2],n=l[3];break;case"q":{const e=l.map(((e,r)=>r%2?e+n:e+t));i.push({key:"Q",data:e}),t=e[2],n=e[3];break}case"A":i.push({key:"A",data:[...l]}),t=l[5],n=l[6];break;case"a":t+=l[5],n+=l[6],i.push({key:"A",data:[l[0],l[1],l[2],l[3],l[4],t,n]});break;case"H":i.push({key:"H",data:[...l]}),t=l[0];break;case"h":t+=l[0],i.push({key:"H",data:[t]});break;case"V":i.push({key:"V",data:[...l]}),n=l[0];break;case"v":n+=l[0],i.push({key:"V",data:[n]});break;case"S":i.push({key:"S",data:[...l]}),t=l[2],n=l[3];break;case"s":{const e=l.map(((e,r)=>r%2?e+n:e+t));i.push({key:"S",data:e}),t=e[2],n=e[3];break}case"T":i.push({key:"T",data:[...l]}),t=l[0],n=l[1];break;case"t":t+=l[0],n+=l[1],i.push({key:"T",data:[t,n]});break;case"Z":case"z":i.push({key:"Z",data:[]}),t=r,n=o}return i}function re(e){const t=[];let n="",r=0,o=0,i=0,a=0,l=0,c=0;for(const{key:s,data:u}of e){switch(s){case"M":t.push({key:"M",data:[...u]}),[r,o]=u,[i,a]=u;break;case"C":t.push({key:"C",data:[...u]}),r=u[4],o=u[5],l=u[2],c=u[3];break;case"L":t.push({key:"L",data:[...u]}),[r,o]=u;break;case"H":r=u[0],t.push({key:"L",data:[r,o]});break;case"V":o=u[0],t.push({key:"L",data:[r,o]});break;case"S":{let e=0,i=0;"C"===n||"S"===n?(e=r+(r-l),i=o+(o-c)):(e=r,i=o),t.push({key:"C",data:[e,i,...u]}),l=u[0],c=u[1],r=u[2],o=u[3];break}case"T":{const[e,i]=u;let a=0,s=0;"Q"===n||"T"===n?(a=r+(r-l),s=o+(o-c)):(a=r,s=o);const d=r+2*(a-r)/3,f=o+2*(s-o)/3,p=e+2*(a-e)/3,h=i+2*(s-i)/3;t.push({key:"C",data:[d,f,p,h,e,i]}),l=a,c=s,r=e,o=i;break}case"Q":{const[e,n,i,a]=u,s=r+2*(e-r)/3,d=o+2*(n-o)/3,f=i+2*(e-i)/3,p=a+2*(n-a)/3;t.push({key:"C",data:[s,d,f,p,i,a]}),l=e,c=n,r=i,o=a;break}case"A":{const e=Math.abs(u[0]),n=Math.abs(u[1]),i=u[2],a=u[3],l=u[4],c=u[5],s=u[6];if(0===e||0===n)t.push({key:"C",data:[r,o,c,s,c,s]}),r=c,o=s;else if(r!==c||o!==s){ie(r,o,c,s,e,n,i,a,l).forEach((function(e){t.push({key:"C",data:e})})),r=c,o=s}break}case"Z":t.push({key:"Z",data:[]}),r=i,o=a}n=s}return t}function oe(e,t,n){return[e*Math.cos(n)-t*Math.sin(n),e*Math.sin(n)+t*Math.cos(n)]}function ie(e,t,n,r,o,i,a,l,c,s){const u=(d=a,Math.PI*d/180);var d;let f=[],p=0,h=0,m=0,g=0;if(s)[p,h,m,g]=s;else{[e,t]=oe(e,t,-u),[n,r]=oe(n,r,-u);const a=(e-n)/2,s=(t-r)/2;let d=a*a/(o*o)+s*s/(i*i);d>1&&(d=Math.sqrt(d),o*=d,i*=d);const f=o*o,v=i*i,b=f*v-f*s*s-v*a*a,y=f*s*s+v*a*a,x=(l===c?-1:1)*Math.sqrt(Math.abs(b/y));m=x*o*s/i+(e+n)/2,g=x*-i*a/o+(t+r)/2,p=Math.asin(parseFloat(((t-g)/i).toFixed(9))),h=Math.asin(parseFloat(((r-g)/i).toFixed(9))),eh&&(p-=2*Math.PI),!c&&h>p&&(h-=2*Math.PI)}let v=h-p;if(Math.abs(v)>120*Math.PI/180){const e=h,t=n,l=r;h=c&&h>p?p+120*Math.PI/180*1:p+120*Math.PI/180*-1,f=ie(n=m+o*Math.cos(h),r=g+i*Math.sin(h),t,l,o,i,a,0,c,[h,e,m,g])}v=h-p;const b=Math.cos(p),y=Math.sin(p),x=Math.cos(h),w=Math.sin(h),k=Math.tan(v/4),E=4/3*o*k,_=4/3*i*k,S=[e,t],j=[e+E*y,t-_*b],C=[n+E*w,r-_*x],O=[n,r];if(j[0]=2*S[0]-j[0],j[1]=2*S[1]-j[1],s)return[j,C,O].concat(f);{f=[j,C,O].concat(f);const e=[];for(let t=0;t2){const o=[];for(let t=0;t2*Math.PI&&(p=0,h=2*Math.PI);const m=2*Math.PI/c.curveStepCount,g=Math.min(m/2,(h-p)/2),v=_e(g,s,u,d,f,p,h,1,c);if(!c.disableMultiStroke){const e=_e(g,s,u,d,f,p,h,1.5,c);v.push(...e)}return a&&(l?v.push(...ye(s,u,s+d*Math.cos(p),u+f*Math.sin(p),c),...ye(s,u,s+d*Math.cos(h),u+f*Math.sin(h),c)):v.push({op:"lineTo",data:[s,u]},{op:"lineTo",data:[s+d*Math.cos(p),u+f*Math.sin(p)]})),{type:"path",ops:v}}function he(e,t){const n=[];for(const r of e)if(r.length){const e=t.maxRandomnessOffset||0,o=r.length;if(o>2){n.push({op:"move",data:[r[0][0]+be(e,t),r[0][1]+be(e,t)]});for(let i=1;i500?.4:-.0016668*c+1.233334;let u=o.maxRandomnessOffset||0;u*u*100>l&&(u=c/10);const d=u/2,f=.2+.2*ge(o);let p=o.bowing*o.maxRandomnessOffset*(r-t)/200,h=o.bowing*o.maxRandomnessOffset*(e-n)/200;p=be(p,o,s),h=be(h,o,s);const m=[],g=()=>be(d,o,s),v=()=>be(u,o,s),b=o.preserveVertices;return i&&(a?m.push({op:"move",data:[e+(b?0:g()),t+(b?0:g())]}):m.push({op:"move",data:[e+(b?0:be(u,o,s)),t+(b?0:be(u,o,s))]})),a?m.push({op:"bcurveTo",data:[p+e+(n-e)*f+g(),h+t+(r-t)*f+g(),p+e+2*(n-e)*f+g(),h+t+2*(r-t)*f+g(),n+(b?0:g()),r+(b?0:g())]}):m.push({op:"bcurveTo",data:[p+e+(n-e)*f+v(),h+t+(r-t)*f+v(),p+e+2*(n-e)*f+v(),h+t+2*(r-t)*f+v(),n+(b?0:v()),r+(b?0:v())]}),m}function we(e,t,n){const r=[];r.push([e[0][0]+be(t,n),e[0][1]+be(t,n)]),r.push([e[0][0]+be(t,n),e[0][1]+be(t,n)]);for(let o=1;o3){const i=[],a=1-n.curveTightness;o.push({op:"move",data:[e[1][0],e[1][1]]});for(let t=1;t+21&&o.push(n)}else o.push(n);o.push(e[t+3])}else{const r=.5,i=e[t+0],a=e[t+1],l=e[t+2],c=e[t+3],s=Ie(i,a,r),u=Ie(a,l,r),d=Ie(l,c,r),f=Ie(s,u,r),p=Ie(u,d,r),h=Ie(f,p,r);Me([i,s,f,h],0,n,o),Me([h,p,d,c],0,n,o)}var i,a;return o}function Te(e,t){return Pe(e,0,e.length,t)}function Pe(e,t,n,r,o){const i=o||[],a=e[t],l=e[n-1];let c=0,s=1;for(let r=t+1;rc&&(c=t,s=r)}return Math.sqrt(c)>r?(Pe(e,t,s+1,r,i),Pe(e,s,n,r,i)):(i.length||i.push(a),i.push(l)),i}function Ae(e,t=.15,n){const r=[],o=(e.length-1)/3;for(let n=0;n0?Pe(r,0,r.length,n):r}const Le="none";class De{constructor(e){this.defaultOptions={maxRandomnessOffset:2,roughness:1,bowing:1,stroke:"#000",strokeWidth:1,curveTightness:0,curveFitting:.95,curveStepCount:9,fillStyle:"hachure",fillWeight:-1,hachureAngle:-41,hachureGap:-1,dashOffset:-1,dashGap:-1,zigzagOffset:-1,seed:0,disableMultiStroke:!1,disableMultiStrokeFill:!1,preserveVertices:!1},this.config=e||{},this.config.options&&(this.defaultOptions=this._o(this.config.options))}static newSeed(){return Math.floor(Math.random()*2**31)}_o(e){return e?Object.assign({},this.defaultOptions,e):this.defaultOptions}_d(e,t,n){return{shape:e,sets:t||[],options:n||this.defaultOptions}}line(e,t,n,r,o){const i=this._o(o);return this._d("line",[le(e,t,n,r,i)],i)}rectangle(e,t,n,r,o){const i=this._o(o),a=[],l=se(e,t,n,r,i);if(i.fill){const o=[[e,t],[e+n,t],[e+n,t+r],[e,t+r]];"solid"===i.fillStyle?a.push(he([o],i)):a.push(me([o],i))}return i.stroke!==Le&&a.push(l),this._d("rectangle",a,i)}ellipse(e,t,n,r,o){const i=this._o(o),a=[],l=de(n,r,i),c=fe(e,t,i,l);if(i.fill)if("solid"===i.fillStyle){const n=fe(e,t,i,l).opset;n.type="fillPath",a.push(n)}else a.push(me([c.estimatedPoints],i));return i.stroke!==Le&&a.push(c.opset),this._d("ellipse",a,i)}circle(e,t,n,r){const o=this.ellipse(e,t,n,n,r);return o.shape="circle",o}linearPath(e,t){const n=this._o(t);return this._d("linearPath",[ce(e,!1,n)],n)}arc(e,t,n,r,o,i,a=!1,l){const c=this._o(l),s=[],u=pe(e,t,n,r,o,i,a,!0,c);if(a&&c.fill)if("solid"===c.fillStyle){const a=Object.assign({},c);a.disableMultiStroke=!0;const l=pe(e,t,n,r,o,i,!0,!1,a);l.type="fillPath",s.push(l)}else s.push(function(e,t,n,r,o,i,a){const l=e,c=t;let s=Math.abs(n/2),u=Math.abs(r/2);s+=be(.01*s,a),u+=be(.01*u,a);let d=o,f=i;for(;d<0;)d+=2*Math.PI,f+=2*Math.PI;f-d>2*Math.PI&&(d=0,f=2*Math.PI);const p=(f-d)/a.curveStepCount,h=[];for(let e=d;e<=f;e+=p)h.push([l+s*Math.cos(e),c+u*Math.sin(e)]);return h.push([l+s*Math.cos(f),c+u*Math.sin(f)]),h.push([l,c]),me([h],a)}(e,t,n,r,o,i,c));return c.stroke!==Le&&s.push(u),this._d("arc",s,c)}curve(e,t){const n=this._o(t),r=[],o=ue(e,n);if(n.fill&&n.fill!==Le&&e.length>=3){const t=function(e,t=0){const n=e.length;if(n<3)throw new Error("A curve must have at least three points.");const r=[];if(3===n)r.push(je(e[0]),je(e[1]),je(e[2]),je(e[2]));else{const n=[];n.push(e[0],e[0]);for(let t=1;t{l.length>=4&&i.push(...Ae(l,t)),l=[]},s=()=>{c(),i.length&&(o.push(i),i=[])};for(const{key:e,data:t}of r)switch(e){case"M":s(),a=[t[0],t[1]],i.push(a);break;case"L":c(),i.push([t[0],t[1]]);break;case"C":if(!l.length){const e=i.length?i[i.length-1]:a;l.push([e[0],e[1]])}l.push([t[0],t[1]]),l.push([t[2],t[3]]),l.push([t[4],t[5]]);break;case"Z":c(),i.push([a[0],a[1]])}if(s(),!n)return o;const u=[];for(const e of o){const t=Te(e,n);t.length&&u.push(t)}return u}(e,1,a?4-4*n.simplification:(1+n.roughness)/2);return o&&("solid"===n.fillStyle?r.push(he(l,n)):r.push(me(l,n))),i&&(a?l.forEach((e=>{r.push(ce(e,!1,n))})):r.push(function(e,t){const n=re(ne(te(e))),r=[];let o=[0,0],i=[0,0];for(const{key:e,data:a}of n)switch(e){case"M":{const e=1*(t.maxRandomnessOffset||0),n=t.preserveVertices;r.push({op:"move",data:a.map((r=>r+(n?0:be(e,t))))}),i=[a[0],a[1]],o=[a[0],a[1]];break}case"L":r.push(...ye(i[0],i[1],a[0],a[1],t)),i=[a[0],a[1]];break;case"C":{const[e,n,o,l,c,s]=a;r.push(...Se(e,n,o,l,c,s,i,t)),i=[c,s];break}case"Z":r.push(...ye(i[0],i[1],o[0],o[1],t)),i=[o[0],o[1]]}return{type:"path",ops:r}}(e,n))),this._d("path",r,n)}opsToPath(e,t){let n="";for(const r of e.ops){const e="number"==typeof t&&t>=0?r.data.map((e=>+e.toFixed(t))):r.data;switch(r.op){case"move":n+=`M${e[0]} ${e[1]} `;break;case"bcurveTo":n+=`C${e[0]} ${e[1]}, ${e[2]} ${e[3]}, ${e[4]} ${e[5]} `;break;case"lineTo":n+=`L${e[0]} ${e[1]} `}}return n.trim()}toPaths(e){const t=e.sets||[],n=e.options||this.defaultOptions,r=[];for(const e of t){let t=null;switch(e.type){case"path":t={d:this.opsToPath(e),stroke:n.stroke,strokeWidth:n.strokeWidth,fill:Le};break;case"fillPath":t={d:this.opsToPath(e),stroke:Le,strokeWidth:0,fill:n.fill||Le};break;case"fillSketch":t=this.fillSketch(e,n)}t&&r.push(t)}return r}fillSketch(e,t){let n=t.fillWeight;return n<0&&(n=t.strokeWidth/2),{d:this.opsToPath(e),stroke:t.fill||Le,strokeWidth:n,fill:Le}}}class Re{constructor(e,t){this.canvas=e,this.ctx=this.canvas.getContext("2d"),this.gen=new De(t)}draw(e){const t=e.sets||[],n=e.options||this.getDefaultOptions(),r=this.ctx,o=e.options.fixedDecimalPlaceDigits;for(const i of t)switch(i.type){case"path":r.save(),r.strokeStyle="none"===n.stroke?"transparent":n.stroke,r.lineWidth=n.strokeWidth,n.strokeLineDash&&r.setLineDash(n.strokeLineDash),n.strokeLineDashOffset&&(r.lineDashOffset=n.strokeLineDashOffset),this._drawToContext(r,i,o),r.restore();break;case"fillPath":{r.save(),r.fillStyle=n.fill||"";const t="curve"===e.shape||"polygon"===e.shape||"path"===e.shape?"evenodd":"nonzero";this._drawToContext(r,i,o,t),r.restore();break}case"fillSketch":this.fillSketch(r,i,n)}}fillSketch(e,t,n){let r=n.fillWeight;r<0&&(r=n.strokeWidth/2),e.save(),n.fillLineDash&&e.setLineDash(n.fillLineDash),n.fillLineDashOffset&&(e.lineDashOffset=n.fillLineDashOffset),e.strokeStyle=n.fill||"",e.lineWidth=r,this._drawToContext(e,t,n.fixedDecimalPlaceDigits),e.restore()}_drawToContext(e,t,n,r="nonzero"){e.beginPath();for(const r of t.ops){const t="number"==typeof n&&n>=0?r.data.map((e=>+e.toFixed(n))):r.data;switch(r.op){case"move":e.moveTo(t[0],t[1]);break;case"bcurveTo":e.bezierCurveTo(t[0],t[1],t[2],t[3],t[4],t[5]);break;case"lineTo":e.lineTo(t[0],t[1])}}"fillPath"===t.type?e.fill(r):e.stroke()}get generator(){return this.gen}getDefaultOptions(){return this.gen.defaultOptions}line(e,t,n,r,o){const i=this.gen.line(e,t,n,r,o);return this.draw(i),i}rectangle(e,t,n,r,o){const i=this.gen.rectangle(e,t,n,r,o);return this.draw(i),i}ellipse(e,t,n,r,o){const i=this.gen.ellipse(e,t,n,r,o);return this.draw(i),i}circle(e,t,n,r){const o=this.gen.circle(e,t,n,r);return this.draw(o),o}linearPath(e,t){const n=this.gen.linearPath(e,t);return this.draw(n),n}polygon(e,t){const n=this.gen.polygon(e,t);return this.draw(n),n}arc(e,t,n,r,o,i,a=!1,l){const c=this.gen.arc(e,t,n,r,o,i,a,l);return this.draw(c),c}curve(e,t){const n=this.gen.curve(e,t);return this.draw(n),n}path(e,t){const n=this.gen.path(e,t);return this.draw(n),n}}const ze="http://www.w3.org/2000/svg";class Ne{constructor(e,t){this.svg=e,this.gen=new De(t)}draw(e){const t=e.sets||[],n=e.options||this.getDefaultOptions(),r=this.svg.ownerDocument||window.document,o=r.createElementNS(ze,"g"),i=e.options.fixedDecimalPlaceDigits;for(const a of t){let t=null;switch(a.type){case"path":t=r.createElementNS(ze,"path"),t.setAttribute("d",this.opsToPath(a,i)),t.setAttribute("stroke",n.stroke),t.setAttribute("stroke-width",n.strokeWidth+""),t.setAttribute("fill","none"),n.strokeLineDash&&t.setAttribute("stroke-dasharray",n.strokeLineDash.join(" ").trim()),n.strokeLineDashOffset&&t.setAttribute("stroke-dashoffset",`${n.strokeLineDashOffset}`);break;case"fillPath":t=r.createElementNS(ze,"path"),t.setAttribute("d",this.opsToPath(a,i)),t.setAttribute("stroke","none"),t.setAttribute("stroke-width","0"),t.setAttribute("fill",n.fill||""),"curve"!==e.shape&&"polygon"!==e.shape||t.setAttribute("fill-rule","evenodd");break;case"fillSketch":t=this.fillSketch(r,a,n)}t&&o.appendChild(t)}return o}fillSketch(e,t,n){let r=n.fillWeight;r<0&&(r=n.strokeWidth/2);const o=e.createElementNS(ze,"path");return o.setAttribute("d",this.opsToPath(t,n.fixedDecimalPlaceDigits)),o.setAttribute("stroke",n.fill||""),o.setAttribute("stroke-width",r+""),o.setAttribute("fill","none"),n.fillLineDash&&o.setAttribute("stroke-dasharray",n.fillLineDash.join(" ").trim()),n.fillLineDashOffset&&o.setAttribute("stroke-dashoffset",`${n.fillLineDashOffset}`),o}get generator(){return this.gen}getDefaultOptions(){return this.gen.defaultOptions}opsToPath(e,t){return this.gen.opsToPath(e,t)}line(e,t,n,r,o){const i=this.gen.line(e,t,n,r,o);return this.draw(i)}rectangle(e,t,n,r,o){const i=this.gen.rectangle(e,t,n,r,o);return this.draw(i)}ellipse(e,t,n,r,o){const i=this.gen.ellipse(e,t,n,r,o);return this.draw(i)}circle(e,t,n,r){const o=this.gen.circle(e,t,n,r);return this.draw(o)}linearPath(e,t){const n=this.gen.linearPath(e,t);return this.draw(n)}polygon(e,t){const n=this.gen.polygon(e,t);return this.draw(n)}arc(e,t,n,r,o,i,a=!1,l){const c=this.gen.arc(e,t,n,r,o,i,a,l);return this.draw(c)}curve(e,t){const n=this.gen.curve(e,t);return this.draw(n)}path(e,t){const n=this.gen.path(e,t);return this.draw(n)}}var He={canvas:(e,t)=>new Re(e,t),svg:(e,t)=>new Ne(e,t),generator:e=>new De(e),newSeed:()=>De.newSeed()};function Be(e){var t,n,r="";if("string"==typeof e||"number"==typeof e)r+=e;else if("object"==typeof e)if(Array.isArray(e))for(t=0;t{let t="",n=crypto.getRandomValues(new Uint8Array(e));for(;e--;){let r=63&n[e];t+=r<36?r.toString(36):r<62?(r-26).toString(36).toUpperCase():r<63?"_":"-"}return t};var Ke=function(e){return!!e&&"image"===e.type&&!!e.fileId},We=function(e){return!!e&&"image"===e.type},Ve=function(e){return null!=e&&"text"===e.type},Ge=function(e){return null!=e&&Ze(e.type)},Ze=function(e){return"freedraw"===e},Ye=function(e){return null!=e&&Xe(e.type)},Xe=function(e){return"arrow"===e||"line"===e},qe=function(e){return null!=e&&$e(e.type)},$e=function(e){return"arrow"===e},Qe=function(e){return null!=e&&("rectangle"===e.type||"diamond"===e.type||"ellipse"===e.type||"image"===e.type||"text"===e.type&&!e.containerId)},Je=function(e){var t;return Qe(e)&&!(null===(t=e.boundElements)||void 0===t||!t.some((function(e){return"text"===e.type})))},et=function(e){return null!==e&&Ve(e)&&null!==e.containerId},tt=function(e,t,n,r,o){return[(e-n)*Math.cos(o)-(t-r)*Math.sin(o)+n,(e-n)*Math.sin(o)+(t-r)*Math.cos(o)+r]},nt=function(e,t,n){return tt(e[0],e[1],t[0],t[1],n)},rt=function(e,t,n,r,o,i,a,l){var c=Math.cos(r),s=Math.sin(r);return e.e&&e.w?t+=o+a:e.e?(t+=o*(1+c),n+=o*s,t+=a*(1-c),n+=a*-s):e.w&&(t+=o*(1-c),n+=o*-s,t+=a*(1+c),n+=a*s),e.n&&e.s?n+=i+l:e.n?(t+=i*s,n+=i*(1-c),t+=l*-s,n+=l*(1+c)):e.s&&(t+=i*-s,n+=i*(1+c),t+=l*s,n+=l*(1-c)),[t,n]},ot=function(e,t,n,r){var o=n-e,i=r-t;return Math.hypot(o,i)},it=function(e){var t=arguments.length>1&&void 0!==arguments[1]?arguments[1]:1;if(e.length>=3){var n=[e[0],e[e.length-1]],r=n[0],o=n[1],i=ot(r[0],r[1],o[0],o[1]);return i<=s.qx/t}return!1},at=function(e,t,n){var r=e.length;if(r<3)return!1;for(var o=[Number.MAX_SAFE_INTEGER,n],i=[t,n],a=0,l=0;l=Math.min(e[0],n[0])&&t[1]<=Math.max(e[1],n[1])&&t[1]>=Math.min(e[1],n[1])},ct=function(e,t,n){var r=(t[1]-e[1])*(n[0]-t[0])-(t[0]-e[0])*(n[1]-t[1]);return 0===r?0:r>0?1:2},st=function(e,t,n,r){var o=ct(e,t,n),i=ct(e,t,r),a=ct(n,r,e),l=ct(n,r,t);return o!==i&&a!==l||(!(0!==o||!lt(e,n,t))||(!(0!==i||!lt(e,r,t))||(!(0!==a||!lt(n,e,r))||!(0!==l||!lt(n,t,r)))))},ut=function(e,t,n){return n?[Math.round(e/n)*n,Math.round(t/n)*n]:[e,t]},dt=function(e){var t=e.map((function(e){return e[0]})),n=e.map((function(e){return e[1]}));return{width:Math.max.apply(Math,P(t))-Math.min.apply(Math,P(t)),height:Math.max.apply(Math,P(n))-Math.min.apply(Math,P(n))}},ft=function(e,t,n){var r=n.map((function(t){return t[e]})),o=Math.max.apply(Math,P(r)),i=Math.min.apply(Math,P(r)),a=o-i,l=0===a?1:t/a,c=1/0,s=n.map((function(t){return t.map((function(t,n){if(n!==e)return t;var r=t*l;return c=Math.min(r,c),r}))}));if(2===s.length)return s;var u=i-c;return s.map((function(t){return t.map((function(t,n){return n===e?t+u:t}))}))};function pt(e,t){var n="undefined"!=typeof Symbol&&e[Symbol.iterator]||e["@@iterator"];if(!n){if(Array.isArray(e)||(n=function(e,t){if(!e)return;if("string"==typeof e)return ht(e,t);var n=Object.prototype.toString.call(e).slice(8,-1);"Object"===n&&e.constructor&&(n=e.constructor.name);if("Map"===n||"Set"===n)return Array.from(e);if("Arguments"===n||/^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))return ht(e,t)}(e))||t&&e&&"number"==typeof e.length){n&&(e=n);var r=0,o=function(){};return{s:o,n:function(){return r>=e.length?{done:!0}:{done:!1,value:e[r++]}},e:function(e){throw e},f:o}}throw new TypeError("Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.")}var i,a=!0,l=!1;return{s:function(){n=n.call(e)},n:function(){var e=n.next();return a=e.done,e},e:function(e){l=!0,i=e},f:function(){try{a||null==n.return||n.return()}finally{if(l)throw i}}}}function ht(e,t){(null==t||t>e.length)&&(t=e.length);for(var n=0,r=new Array(t);n",PERIOD:".",COMMA:",",A:"a",D:"d",E:"e",G:"g",I:"i",L:"l",O:"o",P:"p",Q:"q",R:"r",S:"s",T:"t",V:"v",X:"x",Y:"y",Z:"z",K:"k"},tn=function(e){return e===en.ARROW_LEFT||e===en.ARROW_RIGHT||e===en.ARROW_DOWN||e===en.ARROW_UP},nn=function(e){return e.altKey},rn=function(e){return e.shiftKey},on=function(e){return e.shiftKey},an=null,ln=function(){if(an)return an;var e=new Date,t=e.getFullYear(),n="".concat(e.getMonth()+1).padStart(2,"0"),r="".concat(e.getDate()).padStart(2,"0"),o="".concat(e.getHours()).padStart(2,"0"),i="".concat(e.getMinutes()).padStart(2,"0");return"".concat(t,"-").concat(n,"-").concat(r,"-").concat(o).concat(i)},cn=function(e){return e.charAt(0).toUpperCase()+e.slice(1)},sn=function(e){return e instanceof HTMLElement&&"wysiwyg"===e.dataset.type||e instanceof HTMLBRElement||e instanceof HTMLTextAreaElement||e instanceof HTMLInputElement&&("text"===e.type||"number"===e.type)},un=function(e){for(var t=e.fontFamily,n=0,r=Object.entries(s.ut);n=e.length?{done:!0}:{done:!1,value:e[r++]}},e:function(e){throw e},f:o}}throw new TypeError("Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.")}var i,a=!0,l=!1;return{s:function(){n=n.call(e)},n:function(){var e=n.next();return a=e.done,e},e:function(e){l=!0,i=e},f:function(){try{a||null==n.return||n.return()}finally{if(l)throw i}}}}function Dn(e,t){(null==t||t>e.length)&&(t=e.length);for(var n=0,r=new Array(t);ne)){return e*r(.5-t*(.5-n))}function Kn(e,t){return[e[0]+t[0],e[1]+t[1]]}function Wn(e,t){return[e[0]-t[0],e[1]-t[1]]}function Vn(e,t){return[e[0]*t,e[1]*t]}function Gn(e){return[e[1],-e[0]]}function Zn(e,t){return e[0]*t[0]+e[1]*t[1]}function Yn(e,t){return e[0]===t[0]&&e[1]===t[1]}function Xn(e,t){return function(e){return e[0]*e[0]+e[1]*e[1]}(Wn(e,t))}function qn(e){return function(e,t){return[e[0]/t,e[1]/t]}(e,function(e){return Math.hypot(e[0],e[1])}(e))}function $n(e,t){return Math.hypot(e[1]-t[1],e[0]-t[0])}function Qn(e,t,n){let r=Math.sin(n),o=Math.cos(n),i=e[0]-t[0],a=e[1]-t[1],l=i*r+a*o;return[i*o-a*r+t[0],l+t[1]]}function Jn(e,t,n){return Kn(e,Vn(Wn(t,e),n))}function er(e,t,n){return Kn(e,Vn(t,n))}var{min:tr,PI:nr}=Math,rr=nr+1e-4;function or(e,t={}){return function(e,t={}){let{size:n=16,smoothing:r=.5,thinning:o=.5,simulatePressure:i=!0,easing:a=(e=>e),start:l={},end:c={},last:s=!1}=t,{cap:u=!0,taper:d=0,easing:f=(e=>e*(2-e))}=l,{cap:p=!0,taper:h=0,easing:m=(e=>--e*e*e+1)}=c;if(0===e.length||n<=0)return[];let g,v=e[e.length-1].runningLength,b=Math.pow(n*r,2),y=[],x=[],w=e.slice(0,10).reduce(((e,t)=>{let r=t.pressure;if(i){let o=tr(1,t.distance/n),i=tr(1,1-o);r=tr(1,e+.275*o*(i-e))}return(e+r)/2}),e[0].pressure),k=Un(n,o,e[e.length-1].pressure,a),E=e[0].vector,_=e[0].point,S=_,j=_,C=S;for(let t=0;tb)&&(y.push(j),_=j),C=Kn(l,T),(t<=1||Xn(S,C)>b)&&(x.push(C),S=C),w=r,E=c}let O=e[0].point.slice(0,2),I=e.length>1?e[e.length-1].point.slice(0,2):Kn(e[0].point,[1,1]),M=[],T=[];if(1===e.length){if(!d&&!h||s){let e=er(O,qn(Gn(Wn(O,I))),-(g||k)),t=[];for(let n=1/13,r=n;r<=1;r+=n)t.push(Qn(e,O,2*rr*r));return t}}else{if(!(d||h&&1===e.length))if(u)for(let e=1/13,t=e;t<=1;t+=e){let e=Qn(x[0],O,rr*t);M.push(e)}else{let e=Wn(y[0],x[0]),t=Vn(e,.5),n=Vn(e,.51);M.push(Wn(O,t),Wn(O,n),Kn(O,n),Kn(O,t))}let t=Gn(function(e){return[-e[0],-e[1]]}(e[e.length-1].vector));if(h||d&&1===e.length)T.push(I);else if(p){let e=er(I,t,k);for(let t=1/29,n=t;n<1;n+=t)T.push(Qn(e,I,3*rr*n))}else T.push(Kn(I,Vn(t,k)),Kn(I,Vn(t,.99*k)),Wn(I,Vn(t,.99*k)),Wn(I,Vn(t,k)))}return y.concat(T,x.reverse(),M)}(function(e,t={}){var n;let{streamline:r=.5,size:o=16,last:i=!1}=t;if(0===e.length)return[];let a=.15+.85*(1-r),l=Array.isArray(e[0])?e:e.map((({x:e,y:t,pressure:n=.5})=>[e,t,n]));if(2===l.length){let e=l[1];l=l.slice(0,-1);for(let t=1;t<5;t++)l.push(Jn(l[0],e,t/4))}1===l.length&&(l=[...l,[...Kn(l[0],[1,1]),...l[0].slice(2)]]);let c=[{point:[l[0][0],l[0][1]],pressure:l[0][2]>=0?l[0][2]:.25,vector:[1,1],distance:0,runningLength:0}],s=!1,u=0,d=c[0],f=l.length-1;for(let e=1;e=0?l[e][2]:.5,vector:qn(Wn(d.point,t)),distance:n,runningLength:u},c.push(d)}return c[0].vector=(null==(n=c[1])?void 0:n.vector)||[0,0],c}(e,t),t)}var ir=function(e){return"string"==typeof e},ar=function(){function e(){L(this,e),this.callbacks=new Set,this.nonDeletedElements=[],this.elements=[],this.elementsMap=new Map}return R(e,[{key:"getElementsIncludingDeleted",value:function(){return this.elements}},{key:"getElements",value:function(){return this.nonDeletedElements}},{key:"getElement",value:function(e){return this.elementsMap.get(e)||null}},{key:"getNonDeletedElement",value:function(e){var t=this.getElement(e);return t&&Os(t)?t:null}},{key:"getNonDeletedElements",value:function(e){var t=this,n=[];return e.forEach((function(e){var r=t.getNonDeletedElement(e);null!=r&&n.push(r)})),n}},{key:"replaceAllElements",value:function(t){var n=this;this.elements=t,this.elementsMap.clear(),t.forEach((function(t){n.elementsMap.set(t.id,t),e.mapElementToScene(t,n)})),this.nonDeletedElements=Cs(this.elements),this.informMutation()}},{key:"informMutation",value:function(){for(var e=0,t=Array.from(this.callbacks);et.height-2*s.gK&&(l=i.height+2*s.gK,a=t.y+l/2-i.height/2),ao(t,{height:l})}ao(e,{width:i.width,height:i.height,baseline:i.baseline,y:a,text:o})},dr=function(e,t,n){var r=Tn(e);t.forEach((function(e){var t=n.get(e.id),o=kr(e);if(o){var i,a=n.get(o);ao(r.get(t),{boundElements:null===(i=e.boundElements)||void 0===i?void 0:i.concat({type:"text",id:a})}),ao(r.get(a),{containerId:t})}}))},fr=function(e,t){e.forEach((function(e){var n=kr(e);if(n){var r=sr.getScene(e).getElement(n);if(r&&r.text){if(!e)return;var o=r.text,i=r.height,a=e.height,l=r.baseline;if("n"!==t&&"s"!==t){o&&(o=br(r.originalText,dn(r),e.width));var c=pr(o,dn(r),e.width);i=c.height,l=c.baseline}if(i>e.height-2*s.gK){var u=(a=i+2*s.gK)-e.height,d="ne"===t||"nw"===t||"n"===t?e.y-u:e.y;ao(e,{height:a,y:d})}var f=e.y+a/2-i/2;ao(r,{text:o,width:e.width-2*s.gK,height:i,x:e.x+s.gK,y:f,baseline:l})}}}))},pr=function(e,t,n){e=e.split("\n").map((function(e){return e||" "})).join("\n");var r=document.createElement("div");if(r.style.position="absolute",r.style.whiteSpace="pre",r.style.font=t,r.style.minHeight="1em",n){var o=gr(t);r.style.width="".concat(String(n),"px"),r.style.maxWidth="".concat(String(n),"px"),r.style.overflow="hidden",r.style.wordBreak="break-word",r.style.lineHeight="".concat(String(o),"px"),r.style.whiteSpace="pre-wrap"}document.body.appendChild(r),r.innerText=e;var i=document.createElement("span");i.style.display="inline-block",i.style.overflow="hidden",i.style.width="1px",i.style.height="1px",r.appendChild(i);var a=i.offsetTop+i.offsetHeight,l=r.offsetWidth,c=r.offsetHeight;return document.body.removeChild(r),{width:l,height:c,baseline:a}},hr="ABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789".toLocaleUpperCase(),mr={},gr=function(e){return mr[e]||(mr[e]=pr(hr,e,null).height),mr[e]},vr=function(e,t){lr||(lr=document.createElement("canvas"));var n=lr.getContext("2d");n.font=t;var r=n.measureText(e);return Pn()?10*r.width:r.width},br=function(e,t,n){var r=n-2*s.gK,o=[],i=e.split("\n"),a=vr(" ",t);return i.forEach((function(e){var n=e.split(" ");if(1===n.length&&""===n[0])o.push(n[0]);else{for(var i="",l=0,c=0;c=r){for(i&&o.push(i),i="",l=0;n[c].length>0;){var s=n[c][0],u=yr.calculate(s,t);l+=u,n[c]=n[c].slice(1),l>=r?(" "===i.slice(-1)&&(i=i.slice(0,-1)),o.push(i),i=s,(l=u)===r&&(i="",l=0)):i+=s}l+a>=r?(o.push(i),i="",l=0):(i+=" ",l+=a),c++}else{for(;l=r){o.push(i),l=0,i="";break}if(c++,i+="".concat(d," "),l+a>=r){o.push(i.slice(0,-1)),i="",l=0;break}}l===r&&(i="",l=0)}}i&&(" "===i.slice(-1)&&(i=i.slice(0,-1)),o.push(i))}})),o.join("\n")},yr=(cr={},{calculate:function(e,t){var n=e.charCodeAt(0);if(cr[t]||(cr[t]=[]),!cr[t][n]){var r=vr(e,t);cr[t][n]=r}return cr[t][n]},getCache:function(e){return cr[e]}}),xr=function(e){var t=wr(e);return 0===t?pr(hr.split("").join("\n"),e).width+2*s.gK:t+2*s.gK},wr=function(e){var t=yr.getCache(e);if(!t)return 0;var n=t.filter((function(e){return void 0!==e}));return Math.min.apply(Math,P(n))},kr=function(e){var t,n;return null==e||null===(t=e.boundElements)||void 0===t||null===(n=t.filter((function(e){return"text"===e.type}))[0])||void 0===n?void 0:n.id},Er=function(e){if(!e)return null;var t,n=kr(e);return n&&(null===(t=sr.getScene(e))||void 0===t?void 0:t.getElement(n))||null},_r=function(e){return e&&e.containerId&&(null===(t=sr.getScene(e))||void 0===t?void 0:t.getElement(e.containerId))||null;var t};function Sr(e,t){var n=Object.keys(e);if(Object.getOwnPropertySymbols){var r=Object.getOwnPropertySymbols(e);t&&(r=r.filter((function(t){return Object.getOwnPropertyDescriptor(e,t).enumerable}))),n.push.apply(n,r)}return n}function jr(e){for(var t=1;t